diff --git a/kman.py b/kman.py
index 4b437b3..3d38d17 100644
--- a/kman.py
+++ b/kman.py
@@ -61,17 +61,28 @@ books_data =
 SYS = 'WIN' if platform.system()=='Windows' else \
    ('LINUX' if platform.system()=='LINUX' else 'MAC')
 
+frozen = 'not'
+#CURRPATH = os.path.dirname(os.path.realpath(sys.argv[0]))
+CURRPATH = ''
+if getattr(sys, 'frozen', False):
+    # we are running in a bundle
+    frozen = 'ever so'
+    CURRPATH = sys._MEIPASS
+    os.chdir(CURRPATH)
+else:
+    # we are running in a normal Python environment
+    CURRPATH = os.path.dirname(os.path.abspath(__file__))
+
 # some constants
 LASTLINE = '=========='
 NTPREF   = '--CG注:'
 CLIPFN   = 'My Clippings.txt'
 WORDFN   = 'vocab.db'
-CURRPATH = os.path.dirname(os.path.realpath(sys.argv[0]))
 OUTPREF  = os.path.join(CURRPATH,'CLIP')
 DEBUG    = 1   # 0 - INFO; 1 - DEBUG
 LOG2FILE = 1   # 0 - to stdio; 1 - to file
-LOGFILE  = 'log'
 DELIMITER= '|'
+LOGFILE      = os.path.join(CURRPATH,'log')
 BACKUPFOLDER = os.path.join(CURRPATH,'backup')
 BACKUPNOTEFN = os.path.join(BACKUPFOLDER,'bk.note.data') # kindle notes
 BACKUPWORDFN = os.path.join(BACKUPFOLDER,'bk.word.data') # kindle words
@@ -834,7 +845,7 @@ if __name__=='__main__':
     km.add_note_to_highlight(books)
 
     # test dict json convert
-    with open(os.path.join(CURRPATH,'xx', 'w'), encoding='utf8', errors='ignore') as fw:
+    with open(os.path.join(CURRPATH,'xx'), 'w', encoding='utf8', errors='ignore') as fw:
         fw.write(km.dict2json(books))
     if km.json2dict(os.path.join(CURRPATH,'xx'))==books: print( 'test OK')
 
diff --git a/kmanapp.py b/kmanapp.py
index 93a9fd1..3709609 100644
--- a/kmanapp.py
+++ b/kmanapp.py
@@ -867,6 +867,21 @@ class nTableModel(QAbstractTableModel):
 
 if __name__ == "__main__":
 
+    """
+    frozen = 'not'
+    if getattr(sys, 'frozen', False):
+        # we are running in a bundle
+        frozen = 'ever so'
+        bundle_dir = sys._MEIPASS
+    else:
+        # we are running in a normal Python environment
+        bundle_dir = os.path.dirname(os.path.abspath(__file__))
+    print( 'we are',frozen,'frozen')
+    print( 'bundle dir is', bundle_dir )
+    print( 'sys.argv[0] is', sys.argv[0] )
+    print( 'sys.executable is', sys.executable )
+    print( 'os.getcwd is', os.getcwd() )
+
     print('sys.path[0]', sys.path[0])
     print('sys.argv[0]', sys.argv[0])
     print('os.path.realpath(sys.executable)', os.path.realpath(sys.executable))
@@ -875,8 +890,11 @@ if __name__ == "__main__":
             os.path.dirname(os.path.realpath(sys.executable)))
     print('os.path.dirname(os.path.realpath(sys.argv[0]))',
             os.path.dirname(os.path.realpath(sys.argv[0])))
+    print('os.path.dirname(os.path.abspath(__file__))',
+            os.path.dirname(os.path.abspath(__file__)))
     util = Util()
     print('get_app_path',util.get_app_path())
+    """
 
     app = QApplication(sys.argv)
     kmw = kmanWindow()
@@ -912,4 +930,5 @@ if __name__ == "__main__":
         print ("Error: can not start thread")
     """
     app.exec_()
+    #sys.exit(app.exec_())
 
diff --git a/kmanapp.pyproject.user b/kmanapp.pyproject.user
index c750f72..57ce223 100644
--- a/kmanapp.pyproject.user
+++ b/kmanapp.pyproject.user
@@ -1,6 +1,6 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <!DOCTYPE QtCreatorProject>
-<!-- Written by QtCreator 4.11.2, 2020-06-25T21:57:36. -->
+<!-- Written by QtCreator 4.11.2, 2020-06-29T09:50:04. -->
 <qtcreator>
  <data>
   <variable>EnvironmentId</variable>
diff --git a/kmanapp.qrc b/kmanapp.qrc
index e1b5e37..2796b3e 100644
--- a/kmanapp.qrc
+++ b/kmanapp.qrc
@@ -54,7 +54,5 @@
         <file>icons/book.png</file>
         <file>icons/amazon.png</file>
         <file>icons/flower.png</file>
-        <file>kmanapp.ico</file>
-        <file>kmanapp.png</file>
     </qresource>
 </RCC>
diff --git a/kmanapp.spec b/kmanapp.spec
index 9c4299d..06d85a9 100644
--- a/kmanapp.spec
+++ b/kmanapp.spec
@@ -3,7 +3,7 @@
 block_cipher = None
 
 
-a = Analysis(['kmanapp.py'],
+a = Analysis(['kman.py', 'kmanapp.py', 'kmanapp_rc.py', 'mainwindow.py', 'mtable.py', 'parseweb.py', ],
              pathex=['/Users/mark/kman'],
              binaries=[],
              datas=[],
diff --git a/kmanapp_rc.py b/kmanapp_rc.py
index d913c5e..fe96fec 100644
--- a/kmanapp_rc.py
+++ b/kmanapp_rc.py
@@ -6,899 +6,6 @@
 from PySide2 import QtCore
 
 qt_resource_data = b"\
-\x00\x007\xa2\
-\x00\
-\x01\x08>x\x9c\xed}\x07XT\xd7\x1a\xed\x19z\x19\
-\x98\x19\x86\x8e\x82]c\x8f\xc6\x165\xf6.\xf6\xae\xd8\
-\x11EP\x10\x11D\x90\xde{\x15\xa9J\x95.\x8a\xbd\
-a{j41j\x9a11\xb6\xa8\xe9\xf9\xde\xbd\xf7\
-%\xf7\xc6\xb8\xde\xbf\xcf\xcc\xe0\xcc\x04\x15+h\xd8\xf7\
-\xdb\xd7\x9c\xd1\x99s\xe6\xfck\xaf\x7f\xad\xfd\xef}\x86\
-\xe3\x04\xf4\xbf\x80\x00\x8e\xfe\xbf\x15\xd7IO\xc0\x99s\
-\x1c\xd7\x89:\xbd\xc4^\xe4_\x975\x01gb\xc8\xf1\
-\xbd\xb95\xb7\xe6Vo\x13\xd4\xd3\x9b\xdb\xdb\xdfX\x9c\
-5\xa9kQ\xd7\x91wm\xf9k\x1a\x5c3\x0e\xde\xe6\
-\xc6\xe2\xcbb\xadO\xdd\x98\xba\x89\xbc\x8b\xa9\xb3l\xc9\
-\xb0\xc0p\xd0\x8c\x81\xb7\xab\xb1x\xb2\xd8\xb3\xf8\x1aQ\
-g\xd2\xa95\xf5.\xd4\xbbQ\xef@\xdd\x86\xba\x84\xba\
-\x1e\xd7\x8c\x81\xb7\xa9)\xf8^\x97\xba\x88z\x0b\xea\xdd\
-\xa9\xdbkH\x8c\xe28c\xc3DN XH\xc7\x03\
-\xa8\xb7\xa5n\xca\xc9\xf8A\x8bk\xc6\xc0\x9b\xde\x14\xb1\
-gc\x9a\x8d\xedV\xd4\xfbR_\xa4\xd9\xd1z\xbf`\
-L\xdf\xbf\xb8\xe1\xbd\xc1uk\xfb-\xa7\xa1\xe1M\xaf\
-\x8f\xa0\xde\x91\xba\x19u\x03\xae\x19\x03orcqc\
-\xf1ccYJ\xbd\x0d\xf5\x81\xd4\x9d\xb5\xdek\xf3\xa1\
-\xde\xca1\xe0\xc6\xf4\x057\xba/4\xa6\x0e\x01\xf7n\
-\xfb\xbb\x9c\xa6F\x10\xfd\xfd\x18\xea\xefp\xb2\x1ca\xc8\
-5c\xe0Ml\x8a\xd8\xb31\xcc\xc62\xcb\xef\xc38\
-\x0d\xc1\x06\xed\x11]\xaf\x1ax\xdaC\xcfi,\x04\xe3\
-\x07@c\xca\x10\x18\xc4\xbbCg\xfd|p};\xff\
-\xc4ikE\xd1\xbf\x1d\xcf\xc9\xb4\x81%u!'\xd3\
-\x8c\x1a\x8d\xf4]\x9a\xdb\xb35\x85\xc6gc\xd7\x82\x93\
-\x8d\xe51\x14\xd7`\x9d\xa9}\xee\x1al\x98\x04\xe1\xe6\
-\xe9\xd0w\xb1\x87\xc6\xa4\xc1\xd0q\x9d\x05\xc3TO\x18\
-\xa6xB\xcfg\x09\x04\x83\xba\xff\xc6\xe9j'\xd2{\
-&q2mh\xc55c\xe0Mh\xea\x1a\x9f\xc5\x8d\
-\xc5o\x92\xc0H?Ew\xfe\xa0_\x0d\xbc(\xf6\x01\
-3a\x1c1\x0f\x86^3\xa01}\x18\xac\xbd\x97B\
-\xb8u\x03\x84\xe9\xd4\xd36@/\xc0\x11\x1a\xc3{\xff\
-\x9b3\xd4\xcb\xa2\xf7N\xa3\xde\x83\xba\xb5\xfc3u\xb8\
-f\x0c4\xc5\xa6\xd0y,>\xcc\xd73\x8d\xff.\xf5\
-\x99\x1aR\xe3\x02\xdd\xc5C\xff\xe0\xc7=\xc5\xde(r\
->\xc4IK \x8aX\x04\xcdY#\xe1\x96\x10\x85\x89\
-\x89\xfe0\xce\xdd\x04a\xa67\xe1\xc0\x0b\xfaa\xab\xa0\
-1n\xc0\x1f\xe4\x0d\x0a\xe83f\xc9?\xab\x85\xfc\xb3\
-\x15\x18h\xd6\x04M\xa3)\xfb;6\x8fcK\xfd=\
-\xea\x0b4\xacM\xaau\x17\x0d\xf9S\x7f\xedx\x18\xfa\
-M\xe7c/J^\x0a\x93\xcc\x95\x90\xe6\xac\x86\xd6\xbc\
-\xd1X\x9f\x9d\x82\xb3g\xcfbFr\x10\xc4\xf9~\x10\
-fm\xe41`\x10\xed\x0a\xcdI\x83\xff\xc7\x89\x8dJ\
-\xe8\xb3\xe6R\xefM\xbd%\xd7\x8c\x81\xa6\xd4\x94\xfd\x1d\
-\x9b\xc7cs:\xcc\xc7;jv\xb0:N\xe3\xfe\xa1\
-\xde\xcaQ0Xo\x0fa\xc8\x1c\x88h\xdc\x9bd\xad\
-\x82\xb4p-L\xcb\xd7C\xcfe*&\x86m\xc4W\
-_}\x85\x0b\x17.`QJ\x18L\x08\x03F9\x8c\
-\x0b6\xc2\x90t\xa1\xe6\xcc\x11\x0f\x04f\x92j\xfaL\
-\x07\xea}8\x19\xbe\x18\xcet\xb9\xe6y\xa2\xc6l\xca\
-\x1a\x9f\xe9\xbc\xce\xd4\x87\xd3\xab\xee\x9a\xbd\xda\x5c\xd6]\
-:\x0cz+FR\x8c\xc7\xc2`\xe3\x14\x18E-\x80\
-$c\xa5,\xf6\x15\x9e0\xdf\xe3\x03\xe3\xe8\xe5\xb0Z\
-=\x17\x1f}\xf4\x11\xae^\xbd\x8aK\x97.\xc195\
-\x12\xd2\x82\xcd0\xdeN8\xc8\xde\xc4kC\xad\x05\xe3\
-\xfe\x12X\x9b\x1e\xa4\xcf_J\xbd\x1f'\x9bG`\xf3\
-\x09\xcd\x18h\x9c\xa6\xac\xf1[I\x0c4<\xad\xc5\x9a\
-\xc5vR\xcd\xc3z\x03;\xde\xd2]:\x5c\x16{\xe7\
-\xd1\xd0w\x9b\x00\xc3M\xd3`\x1c\xbb\x08&\xdb\x5cd\
-\xb1\xdf\xbb\x09\x16G\xfca\xba\xd3\x07\xda\xcb&!\xab\
-\xb2\x94\x1f\xff\x0c\x03W\xae\x5c\xc1\x86\xf4xX0\x0c\
-\xe4\xfb\xc3h\xdbf\xd2\x87\x1b\xe9\xdfM~(he\
-u\x9c\xce\xb7\x82\x93\xcd#\xb0\xf9\x04\xc69\xcd\xf3\xc5\
-\xaf\xb7)b\xcf<YKC\x1d\x81\xeb\xd8\xce\xba\xff\
-\xcf\xbe\xab\x1e&t\xd1\xc3\xa8\x1e\x86h?\xa1\x13\x0c\
-VR\xfc\xd7\x8c\x87\xbe\x87=\x0c}Y\xfc\x17B\x9a\
-\xe7\x0a\xb3\xdd>\xb08\x1a\x00\xcb\xd3\xa1\xb0:\x1f\x01\
-\x03\x1f\x07\xcc\x88\xf0\xc3\xe1\xc3\x87\xf1\xe1\x87\x1f\xe2\xcb\
-/\xbf\xc4\x17_|\x81\x90\xac4\xd8\x14\x90.,$\
-\x0c\xe4\xf9C\x98\xe3\x07\x1d\xe7\x19\x10t\xb0\xfd\x90\xce\
-\xebJ}0'\x9b/fsKl\x8e\xa9\x19\x03\xaf\
-\xb6)\xfb;\xa6\xc1l\x04\x02\xce~H{\xdd\x9bS\
-{\xe8aJw=\xcc\xeak\x82%\xfd\x0d0\x99\xfe\
-{x/c\xb4\x9d\xd1\x13\x86\x1e\x13\xf9\xf1\xcf\xb4\x9f\
-\x09i>\xb3\x1a\x8a\xff\xc9\x10>\xf6\xe6\x1f\xa5\xc1\xe4\
-H\x1a\xcc<\x16\xa1\xa8\xb4\x04\x07\x0f\x1e\xe4\xb5 \x8b\
-?\xc3A\x5c^\x16Z\xe5\x07@T\x1c\x00\xe3\x82 \
-\x18m\x0f\x80\x8e\xdb\x5ch\xf4h\xff)]\xcd:\xba\
-\x86\xa1\xd4\xdbs\xcd5\x83W\xdd\xd4k8L\x87\x7f\
-\xd0\xa3\xb5\xce\xdeY\xbd\xf41\xe3]=\xcc\xecm\x04\
-\xef\xe9\x1d\xb0~\x94!\xd6\x8d0\xc4\xd2\x01\x06\x98\xd4\
-M\x0f\xc3\xfaH\xd0ja?\x18\x05\xcf\x868u9\
-\xcf\xff\x16\xc7\x83az.\x1d\xd23\xd90L&\x1d\
-\xe8:\x1b\xdd7:#\x7fG1\x0e\x1c8\x80\xd3\xa7\
-O\xe3\xf3\xcf?\xe7u\xe1\xd6\xc2<t\xc8\x0f\x84\xb8\
-4\x08\xc6\xc5\xc10*\x08\x86\x9e\xf7\x22h\xf4\xed|\
-\x8d\x13\x08\x9ak\x06\xaf\xbe\xa9\xd7p\xec\xa8\x0f\x10\x0b\
-5\xc2\x9d\xc7\x0b\xff7\xa7\xb7>f\x13\x06\x9c\xc7\xb6\
-\x84\xcf$#\xf8\xd8\x13\x0e\xc6\x09\xe15\xda\x10\xebG\
-\x1a\xf2|\xc0r\xc3\x90\xf7Ma\xb7f\x04$9.\
-\x90\xec\x8e\x84\xe4P*\x0c\x22]\xa0\x1f\xbc\x12\x061\
-kI'\xccC{/Gd\x15\x16`\xdf\xbe}8\
-y\xf2$>\xfb\xec3\x1e\x03\xdbJ\x8a\xd19\x9f\xfc\
-aY0\x8cw0\x1c\x84@\xdfo\x194\x07u\xbf\
-\xc1i\x08|\xe9zFq\xb2\xa5x\xacf\xd0\x8c\x81\
-\x97\xd7\xea\xad\xe1\x10\xef\xafs\x18exo\xddd#\
-\xcc{O\x1fs\xa9W\xe4oAj\xa4\x07\xfc\x1c\xda\
-\xc0\x7f\x861\xfc\xe8\xef6M\x10\xc2g\xac\x10\x9e\xa3\
-\x84<\x0e&v\xd5\xc5\xa0a-\xd1\x22`!\xcf\xe3\
-\xba4\x8e\xc5{\x12!=\x97K:\xcf\x9f\xb4\xc2\x02\
-\xd8z.EJ^.\xf6\xec\xd9\x83\x13'N\xe0\xd3\
-O?\xe51PRY\x81^\xdb\x83 \xa9\x0c!.\
-\x08\x81hG(\xf4CVAsx\xef\xef8-\xcd\
-`\xba\xae\xb1\x9c\xcc\x830/\xc2ti\xf3|\xf1\x8b\
-5e\x7f\xc7\xf2+\xcb\xb3Ci\xbcy\xf5y\xdf\xf4\
-Z\xd0b16R\x9c\x1d\xfa\xeac~\x1f}|\xf6\
-\xc9y\xdc\xbbw\x0f\xe7\xce\x9dCR\x98\x0b\x02\x16\xda\
-\x22h\x961\x02\xa6\x1a\xc1\x9f8a\xf3x!\xbcG\
-\x0b\xb1\x98p0\x81p\xd0\xe7=3\x98\xbaN\xe5u\
-\x9ddo\x22L\x8eg\xc80\xe0\xe9\x00\xd3u\x0b\x11\
-\x99\x93\x81\xdd\xbbw\xa3\xb6\xb6\x16\x97/_\xc6\xb5k\
-\xd7P]\xb3\x1b\x03r\x83aR\x1d\x0eqy\x18D\
-ea<wh\x8e\x7f\xffGN\x87\xaf\x1bM\xa0\xde\
-\x95k\xae\x1b\xbdh\xab\xbf\x86\xa3\xa3\x15b:\xb6\xeb\
-]\x9f\x85&\x88p\x14#\xd8A\x8cE\xfd\xf4\xb1\x90\
-0p\xf9\xe2y\xdc\xb8q\x03\xdf}\xf7\x1d\xee\xde\xbd\
-\x8bS'O )d\x05\x82\x17\xb7@\xe8\x1c\x11\x82\
-\xa7\x1b#\x888!`\xa2\x10\x1b\xc7\x08\xf9\xf7\x8d\xa7\
-\xbc\xd0{d;H\xbd\xe7\xf1\xb1\x17\xef\x8a\x830\xdb\
-\x97\xc7\x80\xc8}\x01|\xb7&\xa3\xba\xba\x1a\xc7\x8e\x1d\
-\xc3'\x9f|\xc2\xf3\xc0\x81\x83\x070*+\x18\xd2\x9a\
-H\x88\xab\x22 \xaa\x88\x800\xd9\x13ZS\x87\xfe\xca\
-\xe9\xeb\xb2\xba\xd1dN\xb6\xbeDQ3h\xc6@\xc3\
-[}5\x1c6\x9e\xec\x05B\xbd$\x9d\x99\x03\x7f[\
-\xb4\xb0%B\x97\x8a\x11\xef,A\xd2j\x99\xdegc\
-\xba\xf6\xe0.~\x8c^\xbf~]\x05\x07\xc7k\x8f!\
-!`\x11\xc2\x97X#r\x9e\x08a\xc4\x19\xa1S\x8c\
-\x10\xc2\xb4\x02\xe1\x80ag<\xf9\xc6w\xc7t\x80\x89\
-\xdfb\x9e\x0f\xf8Z\xa0\xc7|\x18\x92&pK\x8bC\
-ee%\x8e\x1e=\x8a\x8f?\xfe\x98\xc7\x00\xcb\x0b\x93\
-3B \xdd\x1b\x05\x93]\xd1\x90T\xc7@\x98\xe9\x03\
-\xed9\xa3\xff-02\xc8\xa4\xeb\x9dN\xbd''[\
-S\xa6\x5c7j\xd6\x04\x8fo\xea\xfe\x8e\xd5[\xd8=\
-\x9c)\x90\x1a\xe7\xe9\xcc\x1f\xfa\xff\xfa-\xed\x89\xa0E\
-\x22\xc48\x89\x91\xb6\xd6\x04\xdb\xbd\xa5X5D\xa6\xf5\
-\x8b3\xa2q\xf1\xe2E>_\xab\xe3\xe0\xce\x9d;8\
-z\xe4 \x12\xfc\xe7#r\xa9%b\x16\x88\x10E\xb9\
-!b\x9a1\xc2\x09\x0b\x9bH#\xb0<2\xb6\xab>\
-\xbaO\xec\x0a\xf1\xe6%\xd0\x0fw\x86.\xf9\x02\xbd5\
-s\xb08!\x0ceee\xfc\x1c\xc1\xf9\xf3\xe7yo\
-\xc8<\xc2\xdc\xf40\x981\x0c\xd4\xc4@\xb2+\x96\xe7\
-\x10\xed%\x13\x7f\x17\x98\x18\xe7\xd3u\xcf\xe6\x9ak\x06\
-\x0dm\xf5\xd5p\xd8\x5c\xfb\x02\x8d\x96f\xbbu\x96\x8e\
-z`\xee4\x1c>\x0e\x12D,\x17#\xd9E\x82l\
-O)v\xf8Iy\xad\xb7\xec}\x03\xc4n\x98\x8fS\
-\xa7N\xf1\xf9_\x81\x83\xaf\xbf\xfe\x1a\xdf~\xfb\xad\x0a\
-\x0e\x0e\x1e\xd8\x8bx\xdf\x19\x88[n\x8ex\xca\x1f\xb1\
-\x94\x1b\xa2\xe93\xa2H'\xf8\x12\x0e\x98\x96\x18\xd3M\
-\x1f]\xec\xbbA\xb8v&??\xa8\xbbz\x16\xa6D\
-\xf8\xa2\xb0\xa8\xa8\xce\x1b\xb0\xcfg\xe7Z\x92\x12\x0a\xb3\
-=\xe4'v\x13\x0f\xec\x8a\x81qa0t\x9d\xa6\xfd\
-O`fR\xc6\xae\x9f{T3\x10q\xcd\xf3\xc5\xf5\
-5u\x7f\xc7j8\xfd\xa9;jtlQ\xab\xe38\
-\xf6\xa1\x9e\xf3\x048,\xb2E\xe8\x12\xe2\xfdU\x12d\
-\xb8\x9b\xa0\xc0G\x8a\xaa Sd\x11\x0f,\xa7\xf8\xbb\
-\xdb\xb7\xe3\xc7\xe7\xf1\xe3\xc7y\x1c\xb0\xb9<\x96\xb3\x99\
-\x87\xfb\xe6\x9bo\xeap\xc0r\xc2\xad[\xb7P\xb3\xab\
-\x1cq\xde\xe3\x91\xe4(E\xd2\x221\x12\xe6\x8a\x10G\
-\x9c\x10K:a\x13\xe5\x05\xe6+Gu7D\xfb1\
-]\xa0;c\x18t\x96M\xc60_7deg\xa3\
-\xa2\xa2\x82\x9f+bs\xc6\x0c\x0b\x8e\x09!\xb0\xd8\x19\
-\x0e\xc9\xce\x08\xd2\x04\x912\x0c\xac\x9e\xf9@`e\xca\
-\xeaF\x8b\xe5\xdf\xa7\x15\xd7\x5c3Po\xea\xfe\xae\x1d\
-\xc7\xe6U\x05\x027\xad\xfe\x9d.\xeb\xae\x1cO\xf7q\
-\x02\xfa:\xbe\x87\xc0\x85\xc4\xfb+$H[C\xbc\xef\
-%E\x99\xbf)\xf6\x86\x9b\xe1H\x8c9\x5c\x86\x19\xf2\
-\x18\xc8M\x8b\xc1\xde\xbd{\xebp\xc08\xfaI8`\
-\xff]]Q\x88\x04\xef1Hu2E*\xe1+y\
-\xbe\x08\x89\xb3EH\x98i\xcc\xeb\x036\xb70\xa2\x9b\
-\x10\xad\xdeo\x0d\x9d\xc9\x1f\xa0\x87\xd3|\xc4'%\xa2\
-\xa0\xa0\x80\xd7\x86,\xfe\xcc#\xb8\xc6\x87\xc1\xb2\x8c\xbc\
-aE(D\xe4\x0d\x8c\x8bB(\x7f\xccz\xa0ak\
-\xc9\xeaF\x8e\x5cs\xcd@\xbd\xb1\x5c\xa8\xbcF\x8f\xcd\
-\xa1\x8d\xe045|\xb5G\xf7\xba\xa1\xbbz\x22t]\
-\xeca\xee2\x1a\x1b\x17\x90\xde'\xcd\x97\xbc\x9ax\xdf\
-\xc3\x04;|\xa5\xd8\x15b\xca\xc7\xfeL\x8a\x05J\xdc\
-\xac\xe06\x9c\xc6\xed\xe2!|\x9e\xde\xb9sg\x1d\x0e\
-\x98VS\xe7\x03\xa6\x0d\xd4qPU\x96\x87\xc4\x0d\xc3\
-\xb0u\x95\x14\xe9\xcbH_PnH%NH\x9e%\
-\xc3\x01\x9bc\x1c\xd6U\x08\xdb\x01\xad\xd1j\xdah\x84\
-\xc7D#77\x17\xe5\xe5\xe5|\xfcY\xdf\x10\x17\x8e\
-\x16%\xc1\x90T\x86\x11\x0e\xc2!*\x0d\x83\xae\xdb\x9c\
-\x87\x1ammN\xd0w[E\xfd\x03N\x86q\x86\xf5\
-\x7f2\x06\x94k8\x8a\xda\xed8\x81\xben\xb4\xf6\xb4\
-\x81?\xea\xad\x99\x02=\xb7)\xd0\xa7\xee\xb0\xc8\x0e\xa1\
-\xa4\xf9\xe2\x9d\x88\xf7\xdd\x88\xf77\x12\xef\x07Jq \
-\xd2\x0c'\x13-\xf0a|\x0b\x9c\xdd\xdc\x11\x89s\xcc\
-\x88\x03\x0c\xe1\xbd` 2\x92\xa3\xf8\xb80\x1c\xb0|\
-}\xe4\xc8\x11\x1e\x07\xca|\xc0\xe6w\x19\x0e\x94u\x22\
-\xd3\x0b\xe5\xc5\x99H\xde0\x18\xd9\xab\xa5\xc8\x5cN\xe7\
-\xa4\xdc\x90N\x9c\x90:\xc7\x98\x9f?\x98\xdeS\x0fC\
-\x08\x07\xbd\x86\xf5@@X\x08\xb2\xb2\xb2PRR\xc2\
-\xfb\x03\xc69\x81\xc9qh]\x14$\xcb\x05;#!\
-\xaa\x8c\x84\xde\x06\x07htn\xcd\xeaFn\x9c\xacf\
-\xc0\xd6\xa3\xfe\x13k\x06\xea\xfe\x8eyd\xe6\x95\xa7\x08\
-\xc4\x86[u\x1cF\xfcK\xcf}\x1ay\xaf\x19\xd4\xa7\
-\xa3\xafS_\x04\x92V\x8f&\xcd\x97\xe6B\xbcO\x9a\
-\xafl\xb3\x14{\xc3LQ\x1bg\x8e\x0f\x93\xadp6\
-\xa0\x03*]ly\xed\xb6a\x94\x10\xab\x06\x1b\xf0\xb9\
-\x80\xe1 +5\xf6\x99q\xc0\xf8\x80y\xbc\xd2\x82-\
-H\xdd0\x00\xdb]\xa5\xc8\xa1\xbc\x93\xb5X\x8cL\xe2\
-\x84t\xe2\x04\x86\x03Vs\xb2\xefk\x01\x1f\xb7\xe5\xc8\
-\xc8\xc8\xc0\x8e\x1d;x\xbea\xf9 :-\x19\xed\x0b\
-\x02a\xb2;\x12b\xf2\x87b\xf2\x87\xfa\xbeK\xa1\xd9\
-\xbb\xd3\xa7\xf4]=\xb9\x7ff\xcd\xa0\xbe}8l]\
-\xdd,\x81\x85\xa4X\xd7q\xdc\x7f\xf9\xb8o\x98\xc5w\
-3\xf7\x89\xf0\x9eG\xbc\xbfD\x84$\xd2|\xd9\xebH\
-\xef\x93\xe6\xdb\x15L\xbc\x1fm\x863\xc9\x168\x17\xd6\
-\x06\xc7}\xda#b\x8a\x18\x15\x8e\x12\x1c\xf3\x90b\xab\
-<>+\x07\x11\x0e\x06\x1aRN\x18\x86\xdc\xadI\xbc\
-fc\xf9z\xff\xfe\xfd\xfcXeqb8`~\x8e\
-\xad\xfb`8`y@\x19\x07\xac\x0eX\x94\x13\x83t\
-\xcfwQ@:3\x8f8(\x97\xf2P\xceB1\xb6\
-\xce\x13\xf1\xf5\x05Vc\x9a=\xa4\x0d\xc2\x03\xbcP\x5c\
-\x5c\xcc\xebB\xf6\xd9I[\xb7\xa0s^\x00\xa4{\xc8\
-\x17\xd4\xc4A\xb2'\x1e\x06AN\xd0\x1c\xd0\xedK\xfa\
-\xce\xacn\xc4j\x06\x8a}\x06o;\x06\x945>\xf3\
-w\xac\x86\xc3\xf6\xe1,\xd6hc\xb5Ow\x95\xfd\x03\
-=O\x8a\xfb\xc69\xd0\xf3\x9e\x0d}\x8a\xff\x22\xe2\xfd\
-\x10\xd2|q+\xe8^\x93\xe6+ \xcdW\xe5O\xbc\
-\x1fA\xbc\x9f@c?\xb6%\xcf\xfb\xc9sM\xb1\xcd\
-A\x84/b\xcd\xf1\xd3\x11[\xdc\xcc\xb7\xc6\x89\x8d2\
-\x1cx\x8d\x92\xe1\xc0q\x90\x10\xbeKG '=\xf1\
-\xb18`|\xa0\x8e\x03\xf6'\xcb\x0bl\xfe\xb7(3\
-\x14\x99\x1bz\xa0\xd8M\x8a\xc2U&\xc8'N\xda\xbe\
-\x98\xe1\xc0\x18\xeb\x86\x1b\xc2\x9ep\xb0t\xe2\xbbH\x8c\
-\x0a\xe4?\x9b}nFn6z\xe6\xfaC\xba\x8f0\
-\xb07\x0e&\xfb\x92`\x10\xe9\x0a\xcd\xa1\xbd\xd8~#\
-\x7fNV3`\xfb\x0c\xde\xe6\x9a\x81\x22\xf6,\xd71\
-\xed\xcb4\xf0\xfb\xd4\x9d5{\xb5\xffPw\xcdT\x1a\
-\xef\xb3\xa1\xe7;\x1f\xfa~\xf3y\x0c\xf4_\xd5\x0f\x81\
-\x94s\xa3i\xac\xa5\x91\xe6\xdbF\x9a\xaf\x8c4\xdf^\
-\xd2|\xb5\x14\xe7s\x89\x96<\xef\x97\xacj\x89x\xf2\
-kg)\xde?\xeeo\x89\x9f\x8f\xda\xca\xba\x1c\x07\xc7\
-\x093[\xc8\xdfoP\xe0`\xa0\x10~\xcbFb[\
-fJ\x83p\xc0x@\x19\x07,_\xe4o\xd9\x8c\x1c\
-\xaf.(e|D\xd7VD\xbcS@\xd7\x99I\xd7\
-\xbb\x96|\x08\xab1-\x9b\xf4\x1e\x8a\xb7g\xf2\x9f\x99\
-G>\xa1_\xd6fH\xf7GS\xfc\xe3ar \x19\
-\xc2\x04\x0fh\x8d\xee\xff\x1d\xa7\xa9\x19J\xf7a\x22\xf7\
-\xf6\xee3x\x5c\x0d\xc7Skh\x8f\xab\xban\xd3\xa1\
-\xe75\x17\xfa\x9b\x1d\xa0\x1f\xb8\x88\xfe\x5c\x00\xf3\xf5\x93\
-\xe0=\x97x\x9ftW\x12\xf1m\x16i\xbebo\xe2\
-\xfd@S\x1c&\xcdw:\x91\xe2\x1f\xd2\x16G\xbc\xda\
-\x11\xef\x8b\xb0\xd7\xd9\x04wv\xd8\xe0\xa7\xc3\xb2\xb8\xf3\
-]\x8e\x83\x9f\x8e\xd8\xe1F\x9e5j\x09\x07\xe9s\x94\
-\xf9\xc0\x18\x9b\x1d\xc7\x10\x0eRy\x1c\xec\xda\xb5\x8b\xc7\
-\x01\x9b\xe7g^A\x19\x07,\x070\x1c(\xbc#\xc3\
-\x01[/X\xb8\xc5\x07y\xde\x9dP\xb1^\x8aR\xd2\
-&%t\xad\xc5\xcbd8X3\x94\xe1@\x1f\xeb\x16\
-\x8eFuy1v\x90>\x1c\x92\xbe\x19\xa6\x07c!\
-=\x90\x00\xe9\xa1\x14\x18\xa5o\x84\x96\xfd\xe0\x1f8\x1d\
-\xedXNV3P\xec3x[0\xa0\x5c\xc3a9\
-\x8e\xe5\xbaQ\x9c\x8eV\x90\x96\xfd\x80\xbb\xba\xee3i\
-\xac\xcf\x83~\xc0\x22\x18\x84.\x85A\xf0\x12\xd2H\xf3\
-\xb1h!\xf1>i\xbe8\xe2\xd7\xadt_\x0bH\xf3\
-U\xfa\x11\xef\x87\x11\xef\x93\xe6;\x17e\x8b3~\x1d\
-\x11?S\x8a\x02\xe2\xdf\xaf\x92,\xf0\xd3![>\xfe\
-\x8a\xae\x8c\x81\x9f\x8f\xd9\xe1\xa7\xa3v<\x1f\xd4n\x90\
-\x22m\xb6\x12\x1f\x0c2\x82\xff\x8aq\xc8\xcbN\xaf\xc3\
-\x01[\xff\xa1\xc0\x81\xc27\xd6\x87\x036\x97\xc8\xfe.\
-?\xd9\x03E>\xed\xb0\x93]'\xe5\xa9\xb2\x95\x12\x94\
-:\x8a\x91E8X\xfd\x81\x01&t3\xc0\xc6\x15S\
-\xb0='\x03\xe3\x93\xfc`v8\x8e\xe2\x9f\x08\xe9\x91\
-4\x18\xb3\xf9\xe2\x99#~#\xdf\x93\xca\xc9\xf6\x9a0\
-=\xa4^3x\x13\x9b\xb2\xbfS\xaa\xe1\xe8'j\xcf\
-\x1e\xf6\x8b\xee:\x8a\xbd\x0f\xf1}\xd0\x12\x18\x84/\xa7\
-\xbe\x8c\x1f\xff\xfd\x9d\x07 p\xae1\xa2I\xf3\xa5\x92\
-\xe6\xdb\xe6n\x82R\xd2|{\x82Lq,\xca\x1cg\
-\xe3H\xef\xfbw@\xderk\xde\x97_\xf03\xc5\x8f\
-\xfb(\xe6\x07me\x188\xf4\x18\x0c(p \xe7\x83\
-c<\x0e\x8c\xb1\x81\xf4\x9b\x13\xc3\xc1`c\x048\x8d\
-\xe7q\xc0j=\xea8P\xe7\x83\x9b7o\xf28`\
-\xb9\xe1\xf6\xed\xdb8}\xea$\x0a\x92\x5cQ\xba\xa9-\
-v\x13\xd7T\x93V\xacr\x96\xa0\x82|C\x06\xe9D\
-\x865\xfb\x1eFX\xeb0\x0ec\x83\xd7\xc0\xfch<\
-\xa4G\x93 \xadM\x87hG\x18\xb4\xe7\x8f\xfd\x97\xc0\
-\xc8\x80\xed7b{M\xde\xe4\x9a\xc1\xdf\xd6\xe8q\x8a\
-\x1a\x8e\xa98_{\xc9\xb8\xdf\xf5<(\xd7oZ\x00\
-\xfd\xe0e0\x88Z\x01\x83\x18'>\xfe\xe6\xde\xd3\xe0\
-=\xdb\x04\xe1\xa4\xe5\x12I\xf3e\xd1X*\xa68U\
-\x93\xe6;\x1cN\xbcOc\xfflP;\xec\xf7h\x83\
-\x88\xc9\xc68\xe8j\x82\xbb\xa56\xf8\xf1\x00\xc5\xfb\xc0\
-\x130\xa0\xc6\x05\x0a>\xb8\xb1\x9dp@\xdc\x9dJ8\
-\xf2T\xe0\x80\xf2B\xc0\xca\x89(\xd8\x96Y\x87\x03\xa6\
-\xe7\x1f\xc7\x07\x0c\x07l\xce@\x81\x83\x13\xc7k\x91\x9f\
-\xb0\x92\xf8\xaa\x15\xf6R\xce\xda\xedNy\x8b8l'\
-q\x02\xf3\x0b\x8e\xe4K\xc7w5\xc4\xd0%Ca\xb5\
-7\x1c\xd2\xe3\xa9\x90\x9e\xd8\x0aqe4t\x96\xd8\xff\
-.\x90\x18\xb1\xfdF\xf3\xb8\xbf\xd7\x0c\xde\x04\x0c\xd4\xb7\
-F\x8fay\xbeFK\xf3\x9d:N\x93\xff\xd4]O\
-\xfa\xde\x97r}\xc8r\x18F\xaf\x84a\xc2j\x18\xc6\
-\xac$_\xb4\x18\x0b\x1dZ#\x84\xeeQ\x1ci\xa9t\
-\x1a;\xf9\xe4\xe5*7I\xb1\x9f\xfc\xde\x09\xf2{g\
-#\xecp\x9ax?f:\xe5Z\xca\xb3_\xa7Y\xd2\
-\xd8o\xc9\xeb>\xd6\xeb0\xf04.\x90c@\xc1\x07\
-\xd7s\xacp\x84\xce\x95<\xd3\x18\xebG\xc8p\xb0\xe2\
-\x031\x82VOA\xe1\xf6l\x15\x1c\xb09>\xc6\x05\
-\xca8`\xb5@\x86\x03Vsd\x9c\xc0j\x0bG\x0e\
-\x1f@~\xac\x03v\xfb\xb7\xc4~\xd2\xa6{I+\xd6\
-\x10^w\xd3\xf7J\x9bc\xcc\xaf=\x18\xf5\x9e\x18\xdd\
-6M\x85\xf9!\xe2\x82\x93\x19\xe4\x11\xe3\xa1\xe38\xe5\
-\x0f\x81T\xc4\xf6\x1b\xb1\xbd&\x8a}\x06o\xc2^\x93\
-\xfa\x9e\xb3 \xab\xe1tnu\x5cg\xf5\xb4\x87\xba\x9e\
-s\xa1\xe7G\x1a/\xd4\x11\x86\xb1\xce\x10&\xaf\x85a\
-\xf2\x1a\xf2C\x8e\xe8\xe72\x18\x01\xc4\xc7Q\xe4\xf7R\
-\x9d\xc4\xc8%\xfe,%\x1e\xad\x090\xc5Q\xf2{g\
-b\x18\xefwB\xf6\x12+^\xc7}\x12d\x86\x1fj\
-(\xee{[\xaa`\xe0y\xb8\xe0\xe7\xdaG88L\
-qJ\x22\x1cx\xc8q\xe04\xc4\x04\xc1\xae\xd3Q\x98\
-\x97\xc3\xe3\x80\xad\x07R\xe0@\x9d\x0f\xd4q\xc0\xb4\xc2\
-\xc1\xfd\xbbQ\x14;\x17\xfb\x02[\xe0\x10a\xf9\x00\xe1\
-l\x1f}\xb7=\xe4\x1bX\xfeb5\xe7\x91\xfd\xa5\xe8\
-\x120\x1bf\xb5i\x90\xecO\x84\xae\xcb\xac?\x05V\
-RV7Z\xc2\xc9\xf62\xb5\xe6\x9a\xf6si\xd4k\
-8lM<[\x1b\xbfF\xb3\x7f\x97K:k\xd8\x9c\
-\xce<\xe8m^\x0c\xfd\xb0\x150\x8c[\x0da\xaa;\
-\x84[\xd6\xf1\xe3\xdf\xdco6\xbcf\x11\xef\xb3\xba\x0b\
-\x8d\xeb,\x17\xf2T\xc4\xcb\xd5\xe4\xf7\x0e\x91\xdf;\x15\
-\xc3x\xbf\x03j\xdc\xdb j\x8a1\x8e\x11\xa7\xde+\
-k\x81\x1f\xf6\xb4\xe4{\x1d\x06\xf6\xd5\x83\x81\x83\x0d\xc7\
-\x802\x0e\x0e\xb9\xab\xe3@\x82\x90\xb53Q\x5c\xb0\xbd\
-\x8e\x0f\x0e\x1d:T\xc7\x07\xcc\xe7)\xe3\x80q\x00\x9b\
-Cd\xb9\x81\xe1`\xdf\x9e*\x14GO\xc3\xe1`\x1b\
-\x1ce\xdf\x8b\xb4\xe2A7\xc2\x02\xe5\x06v\x9e\xb9\xbd\
-\xf51b\xa0\x05:E-\xe1\xbd\x81\xde\xba\xf9\x0f4\
-l-\x0ep\xb2\xbd&\x83\xe4\xf7\xb4)\xd6\x8d\xd4\x9f\
-\xb3\xc0\xe64\x87sZ\x9a\x9b4G\xf5\xf9Vg\xed\
-,\xf2w\xe4\xe9\xfd\xd9z\x0a\xca\xf3\x09\xae\x14w\x0f\
-\x18exB\x98\xe6\x0e\xc3\x08G88\xb4A0q\
-b\xecb\x11\xd2)O\xe6\x93\xdf\xab \xce\xdcG~\
-\xef8\xf9\xbd\xb3a\xadp\xd2\xb7\x13\xa2\xa6IPI\
-^\xfb\xdb\x0c+\xfc\xb0\xbb%?\xfeU0\xf0\xac\x5c\
-p\xf4\xf18`\x7f\xaf\xc0A\xa2\x12\x0eV\x0e\x95\x22\
-\xccm\x0e\xe1`[\x1d\x1f0\x1c(j\xce\x0c\x07l\
-M\x00\xc3\x01\xdbK\xa4\x8c\x03\xc6\x09{v\x95\xa0$\
-f2\x8e\x85\x92\x17!\xedz\x94\xf4\xcda:\xc7\x01\
-\xca\x0dq\xd3\x8d1\xbb\x97\x1e\x86\x0do\x89\xf6\x91\xcb\
-\xa1\xef\xbd\xe8\xa1F\x07\xdb\x93t?Ws\x8f\xeaF\
-M\x09\x03\xf5\xd6p8]\x9d\x08\xad\xa9\x1f\xfc\xa0\xe3\
-F\xb1\xf7^\x00\xbd\x00\xd2\xf6\x11\x94\xeb\x13\xd7@\x98\
-\xbe\x1eF9\xde0\xca\xda\x00\xc3x\x17\x0cp%\xde\
-\xa7\xfb\x1bE~/\x85\xfc^.\xdd\x87R\x1a\x1b5\
-\x9b\xa58\x1aJ\xbc\x1fi\x8ds\x01\x9d\x91\xee`\x81\
-l\xe2\x87O\xc9\x03~_Mc\x7fW\x8bG\x18\xa8\
-y\x01\x0c<\x81\x0b~9n\xc7\xbf~=\xdb\x8a\x1f\
-\xab\x093d\xf3|+\x06\xca\xf2B\x98\xfb\x1c\xec(\
-\xca\xaf\xc3\x81r\xcd\xb9>\x1c\xb0?Yn`X\xd8\
-]U\x88\xb2\xa8q8\x19n\x85\x93\xfe\x84s\xd2\x8a\
-l\xee\xfa\x10i\xde\x98\xa9F|\x8d\xe9\x83\xe1\xb6\xb0\
-\x9e=\x18\x9a\xdd\xda\xb1\xba\xd1\x1aN\x86\x01\xc6\x03,\
-\x174\xa67|B\x0d\xc7(C{\xfe\xe8\x7f\xe9\xd0\
-\xbd\xd1\xdd\xe8\x00\xbd@\xf2v\x91\xab`\x98\xb4\x16\xc2\
-\xad\x9e0\xda\xb6\x09Fy\x9b\x08\x07\x1e\xb0\xf2\x9f\x03\
-\xef\x19\x12\x84\xcd\x15!a\x89\x18\x99\xe4\xf7\x8a\xc8\xef\
-\xed$\xbfw\x90\xfc\xde\xc9H\xf2\xfaA\x1dQ\xb5\xa6\
-5b\xa7\x19\xe3\x14\xe1\xe2\x1e\xe9}\x16\x7f\xbe+0\
-\xd0\x00.x\x1em\xa8\x8c\x036\xaf\xfcM\x96\x15\x0e\
-P\xeef8\xa8\xe3\x83aR\x84\xaf\x9b\xa7\x82\x83\xa7\
-\xf1\x81\x02\x07\x8c\x17\xaa\xcb\xb2Q\x11=\x1ag\x22,\
-q\x9a\xb4\xceI\xe2\xbd\x13\x94\xfb\x0e\x12\x0e\xc2'\x1b\
-aZ\x0f=\x0c\xe8o\x09i\x1b\xd3\x8bt\x7f\xdd9\
-Y^e\xbe\x80\x8d\xb9\xc6\xa8\x17<\xae\x863G`\
-)-\xd5^>\xe9\x7f\xba\xebH\xe7\xf9,\x84^\x10\
-qX\x14\xe9\xfbd\xca\xf5\x19^\x14w_\x18\x17\xb1\
-\xfd\x94\x1b!$\x0d\xb0hAk\x04\xb3\xf56\xa4\xf9\
-\xb6\x90\xdf\xcb\xa3\xef\x5cN|\xb8\x8f\xc6~m\x98)\
-\xce\x86\xb6\xc5\x09\xe2\xfd\xc8)b\xec\xa6\xbcp\x83\xee\
-\xff\xf7U\x14\xf7\x9d\xf2\xae\xc0\xc0k\xe2\x02U\x1cH\
-\xf9yg\x05\x1f0\x1cD\xacw@\xe9\x8e\xa2z\xf9\
-\x80\xd5\x1c\x158`qg8`:\x81\xe1\x80\xe1\xa1\
-\xaa$\x03;\xa3\x87\xe2|\x94\x05\xce\x05\x12\xef\xf9\x98\
-\xf2x?Lx\x0b\xb57\xc2\xe4nz\xe8c\xa7}\
-O\xa4\xaf\x91\xc2\xb1\xfc*[_\xae\xfb\x9a\xe3\xaf\xbe\
-F\x8f\xd5p\x98O]\xa4\xd1\xc6z\xbf\xf6\xcai\x7f\
-\xe9\xae'\x9d\xb7i\x11\xf4\x82\x1d\xa1\x1f\xbd\x1a\x06)\
-\xeb`\x94\xe9\x0d\xe3\xfc\xcd0\xde\x11\x00\xe3b\x7f~\
-\xec\xf7_;\x14\xfe\xd3\x8d\xf8\xf5\xb8\xc9\xac\x9eF\xbe\
-\xa8d\x1d\xf9#\x1a\xfbG\xc8\xef\x9d\x0ekA\xf7\xa1\
-+R\xe6\x99\xf3\xb5\x9d\xcf#\xccq\xbf\xa2\x05\xeeW\
-\xb6\x90a\xa0\xea\xe9\x18x\xd9\xdaP\x81\x01\x05\x0e\xae\
-m\xb5\xc4^\xd2o\x8c\x9b\xdc\x87\xc9p\xb0j\x849\
-\xa2\xbc\x96\xa0\xacdG\x1d\x0e\x94k\xce\xca8`\xb1\
-W\xe0\x80a\x82\xadK\xa9(H@M\xf4\x00|\x1c\
-m\x81\xf3\xe4q\xce\x91g8Cc\x82\xcdul\x1e\
-'\xe4k\x0b=m\xb4\xaf\x18\xea\x08\xd8Z\x92V\x9c\
-\x8c\x83_g\xec\x155\x1c\xe6IX\x0dg\x95F\x8f\
-\xf6gu\x5cfB\xd7\x93r\xbd\xefb\xe8\x858A\
-?\xc6\x05\x86\x14{\xf6,\x0d\xe3\x02\x7f\x88J\x83 \
-*\x0b\xe6\xb9\xdf*d!\xbcH\xcb\x85\x91\xdfKX\
-$F\x86\x93\x04\x85l\xbe\x8c\xfc\xde\x01\xca\x85'\xc2\
-\x88\xf7\x83;\xa3\xc4\xd9\x8e\xe7\xda\xb3\x94\x1b\xef\xee\xb0\
-\xc6\xfdr\x9b:\x0c\xd4\xe1@\x81\x81\xfap\xf0\x8a\xb4\
-a\x1d\x0eN\xd8\xf1\xff\xfe+\xc2\xc1\x1e\xc2A\xcc4\
-#\xb8\xc9q\xe0<\xca\x0a\xd1\xde\xcb\xea\xc5\x01\xcb\x0b\
-\xea8`\xbe\x91\xe1\x80q\x01\xab5V\xe6Eb\x7f\
-L_|\x12c\x81\x8f\x82\xcdp\x9e<\xc3\x87t\x1f\
-\xf6\xd3y\xd8Z\xa4\xf1]t\xff\xeaf\xadu\xca@\
-G\xc0\xd6\x18\x9b\xcbc\xf3*c\xaf^\xc3\x19\xc2\x09\
-\x04\xeb5\x07\xf7\xfcR\xdbu\x96,\xf6~K\xa1\x17\
-\xba\x12\x06\xb1k`\x98\xea\x01a\xb6\x0f\x8c\x0a\x03 \
-*\x0f\x85\xa4:\x92\x8f\xbf$}\x03\x96,h\x87 \
-\x8a+[\x83\xbd\x85\xfc\xdev\xf2\xc2e\x1e&\xd8K\
-X?Fc\xfflH{\x1c\xf5y\x07\x11\x93e\xb5\
-\x9d\x9b\xc4\xb7\xf7\xca(\xf6\xac+0\xf0\x8c\x5c\xf0\xaa\
-\xf2\x81\x0a\x0e\xb6X\xa2f5\xd3o\xc6\x8fp0\xd2\
-\x12\xb1\x9b\x9cPQVZ/\x0eX~P\xe0\x80\xe9\
-B\xc6\x07\xac\xee\xc8p\xc0\xd60\x97o\x0b\xc5\xe1\xd8\
-^\xb8\x1ck\x8e\x8b\xe4\x85?\xf2\x93\xe2\x02\xf3Ft\
-\xcf\xd8\xdc\xf5\xd8\xce\xba\x0f:[j\x1d\xd4\xd5\x12L\
-\x90\x8f\xcb\x97\xad\x09\xd5k8l\x8f\xe3hN[+\
-Ps\xfc\xfbw\xb4\xd7\xcc\x86\xce\x06\xd2y\x9bI\xe3\
-\x87\xaf\x82A\xfcZ\x18\xa6\x91\xb7\xcb!\x9dW\x14\x08\
-\xe3\x0a\x8a}M,_\xfb6/\x09\xc5x\xaf\x89\xf0\
-'}\x1bI~/\x99\xfc^6\xe5\xf5\x1d\xe4\xf7v\
-\x11\xb6\x0f\xfbKq:\xc4\x964_w$\xcc6E\
-\x11i\xc2\xab\xe4\xfd\xef\x95\xd8\xf0\xba\x8f\xef\x0a\x0c4\
-\x84\x0b^\x936T`\x80\xf5\x1f\xe9\xbd_\xa5\xcbp\
-\x10=\xf5\x11\x1f\xb8\x8ci\x818\xbf\x95\xa8(W\xc5\
-\x01\xd3\x87\x0a\x1c\xb0}\xe7\x0a\x1c0>P\xecAg\
-\xebS*s7\xa36\xbe'>\x8d3\xc7e\xf2E\
-\x177\x9b\xe2c\xca\x95\xbbW\x99\xc0\x9d4\xc8\xe8N\
-\xba\xffmo\xa6U\xaa!\xe0k\x88Z/9\xf6L\
-k2\xbd\xc1\xd6)L\xe4\x0c\xf5\x13\xb5f\x8e\xf8U\
-\x87|\xb0\xae\x17\xc5\xde\x7f9\xf4\xc2\x9d\xc9\xdb\x93\x9f\
-g\xcfP\xdb\xe6\x07\xa3\xe2 \x18W\x86C\xbc'\x16\
-&\x07\x93`\xbb?\x05\xfdS=\xb1\x91\xb4\x5c(\xf9\
-\xbdx\xca\xe9\x19\xe4\xf7\x0a\x88\xcf*I\xef\xee'~\
-;\x11L\xda'\xb8\x1b\x0a\x9cl\x91:[\x84\x8f|\
-M\xf1]!\xc5|\x87\xbc\x97(a\xa0\xec\x09\x18h\
-,.8\xa1\x84\x03z\xdfU\xe2\x83\xdd\xc4_Qr\
-\x1c8\x12\x0eV\x8f\xb6F\xfcfgTV\x94\xf38\
-\xa8\xa9\xa9\xe1\xd7\x1e(\xf8\x80\xcd'1>`\xeb\x0c\
-\x14s\xc9L\x170\x1c\xb0\xd7+\xb2\xbcq*\xa1\x0b\
->\x8f\xb3\xe0\xbd\xf0e\xca\x97\x9f\x10oV\xd38r\
-\x1el\x80\xbev\xda\x9f\x09\x04\xfc\x18}\x11]X_\
-\x0d\x87\xe1j\xba\xc0T\xbc]k\xd1\x84\xdfu\xdc\xd9\
-\xde\xd9\x85\xfc\xb3\xf2\xf4\x22VC?\x91b\xbf\x954\
-\xfev\x7f\xd2y\xc1\x10UE\xc8\xd6\xbb\x1cNF\xfb\
-\xdal\xf4(\x8d\xc3J\x07\xe2}\xca\x911\xe4\xf7\xd2\
-hlo#\xbfWFc\x7f\x0f\x8d\xfd\xa3\x01\x8c\xf7\
-;\xe1\xa0\xf7;\xa4\xf7\x8dq\x98\xbc\xc0-\xf2\xddw\
-\x8b\xacq\xb7\xd8\x86\xef*\x18(U\xc2\x80\x12\x0e\xfe\
-\x96\x0f\x1e3W\xd0`m\xf84.xL>P\xe6\
-\x83\xabi\x96\xd8E\xdf5j\x8a\x11\xbf>\x84\xf1\x81\
-\xeb\xd8\x96\x88\xf7_\xfd7\x1c0>`]\x99\x0f\x14\
-s\xc9,/0N8u\xea$vf\xba\xe3lb\
-g|\x19o\x81\xcf\x88\x0f\xae\x10\x1f\x5c\xf2\x91\xadu\
-i%\xd5d\xb5\xe4\xe7\xfd\xe5\x97\xc7\xd6p\x04-\xcd\
-\xab\xb5\x1d\xa7\xfc\xa9C~Ww#i\xfc\xa0\x15\xd0\
-\x8bt\x81A\xd2:\x8a\xbd7i;\xd2\xf7\xc4\xf1\xa2\
-\x9d\x91\x90\xec\x8b\x87\xf4H\x0a\xba\x9e\xc9C\xd7\xea\x14\
-\x0cu\x1d\x0e\x7f\xf2\xb3\x11\xe4\xf7\x92\xc8\xefe;\x8a\
-Q\xec*A5y\x9cC4\xf6O\x07\xb5\xc2\xd9\xe0\
-\x9e\x88\x9d!E\x19i\x82k\xf4\xbd\xee\x16P\xec\x0b\
-\xe5\xbdH\x09\x03\xcf\xc2\x05\x8d\xa8\x0d\xeb\xfaI\x19\x0e\
-\xbeLQ\xc5\x81\xa3\x1c\x07\x09\x01\xae\x84\x81\x8a:\x1c\
-\xb0Z\xa3\x02\x07\xca|\xc0j\x8c,/0>\xe0q\
-@\x7f\xbf?o\x03.&u\xc4\x97\x91f\xf8\x8c\xc6\
-\xd0\x15\xe2\x82\x80\xf1\xc2\x1b\x1cW\xf7C@\xcf\x13{\
-\xe5\x1a\x0e\xabA-\xd3\xe8hwL\xdby\xc6C\x1d\
-\x8f\xf9\xd0\xf5!\x8d\x1fL\x1a?\xca\x15\x06\xc9\x1e0\
-\xcc\xf0\x86\x90\xc5\xbe\x94b_\x1dM\xb1O\x84\xf9\xb1\
-t\xbc{\xbe\x18\x9dw\xa5\xc0\xdci\x22\xbc\xecE\x08\
-%\xbf\x1c?\xcf\x18[\xc9\xef\xe5\x93\xdf\xabt7\xc1\
->\xd22\xc7\x03,\xf0ahOl[\xde\x92_\xb3\
-\xf7\x09a\xf9\xbb\xed\xd6\xf8.\x9f:\xc3\x80\x02\x07r\
-.x*\x06\x9a\x986T`\x80\xc7\x01}\xde\x17\xc9\
-\x16\xa8\x22\xcf\xc3\xe6w\xd8:!\x86\x83\xb5\x13Z#\
-9\xc4\x03UU\x95O\xc4\x01\xe3\x03\xc5\xbe\x05\x86\x03\
-\xa6\x13O\x9f8\x82/3{\xe3j\xb8\x19\xbe`<\
-\xb0Q\xfaP_[0\x88{\xb6\x1cP_\x0dg\x10\
-\xbd\xea\xaa\xd1\xa7\xf3Em\xf2w:\xeb\x17@\xd7w\
-\x09\xf9\xbb\x95\xe4\xed\xd7\x90\xb7_\x0f\xc3L\x1f\x08\xf3\
-\x03aT\x1a\x06\xd1\xae\x18H\xf6'\xc1\xfax&\xfa\
-\x5c,G\xbb\xb2\x18\xe8,\xb5\xc7\xfcqf\x08$\xcc\
-G\x93\xdfK\xa5\xb1\xbfm\x85\x04\xa5\xc4\xef5\xe4k\
-\x8f\xf8\x99\xe2\x5cH\x17\xec\xdb\xf0\x0e\xe9%c\xd4\xba\
-Kq+\xd3J\x16\xff<9\x06\xf2\xff\x8e\x81\xfa\xf2\
-A}\xda\xb0\xbe|\xf0Dm\xb8\xef\xe5h\xc3\xc7\xe5\
-\x03\x05\x0e~8\xd0\x12\x9f'Z\xa0r\x85*\x0e\xdc\
-\xec\xdb!%\xd4\xb3\x0e\x07\xec\x19\x14\x8a\xb5\x07L#\
-(\xfc\x02\xf3\x88\x0c\x07\xac\xf3\xcf\xa99\x1a\x8eo\x88\
-3\xaf\x06\x99\xe1K\xba\xa7mM\xb5\xd8\x1a\x82\x86z\
-\x81\xfa\x9e\x95=\x9c\xd3\xd0\xd8\xa89\xb2\xcfumW\
-\xd2\xf8u\xfen\x15\xf4c\xd7\xc2\x80=/9k\x13\
-\x84\xec\x99Hea0\xa6\xd8\x8b\x0f$\xa1\xd5\xe9m\
-x\xffR%Z\xe6\x06\x83r\x05\xde\x9b\xd1\x1d\x9b\xed\
-\x85\x88 \xbf\x97D~/\x8b\xb8\xbd\x88\xc6\xfe\xceu\
-&8\xe8\xc3x\xbf-\xce\x04\xf7B\xf4t\xf2\xfft\
-/\xbe\xa6\xefp'\xd7\x0aw\xb6Y?\xc2@\x9e\x12\
-\x17\xbch>h\x02\xdaP\x81\x01\x19\x0el\xebp\x10\
-6I\x19\x07\xed\x91\x16\xe1\xcd\xef[\xa8\x0f\x07\x8c\x0f\
-\x14\xf5F\x96\x13\xee\x5c=\x89\x9b\xa43\xbe&Mx\
-\x954\xa1\xb9\x91\xc6\x84\x06\x8e\x7f\xf5\xe7,\xb0\x1a\xce\
-XNO'Rk\xf2\x07\xdfk\xaf\x9d\x0d]\xb9\xbf\
-\xd3\x0bs\x86~\x9c\x1b\x0c\xd26\xc00\xc7\x17\xc2\xc2\
-`\x18\x97G@\xb4;\x96\x8f}\xa7s\x85\x18\xf0Q\
-\x05\xcc\x93\xbd\xa1C\xef3u\x9d\x02\xcf\x89\x22\x84\x90\
-\xfe\x8d'\xbf\xb7\x95\xfc^\xbe\x93\x18\x154\xf6\xf7\xd1\
-\xd8\xaf\xddl\x85\xf3a\xbd\x91\xb1\xd8\x86\xaf\xed\x5c\x0e\
-4\xc5\x1d\xd2|wr\xac\xe4\x18\x90\xf3\xc0v5\x0c\
-4\x80\x0b\xde\x04m\xa8\x82\x03:\xc7g\x84\x03\xb6^\
-,\x94p\xe0*\xc7\x81\xfb\xe4\x0e*8`{\xda\x14\
-5g\x05\x1f0\x1c0>\xb8\xb9\xfd\x1d\x5c\x8f2\xc7\
-\x9e\xd5&w\xe4\xfc\xfd\xb41_\xdf\xb3\xb2'\x0bD\
-\xc2t\xad\xf9c\xfe%\xf3w\x0b\xe5\xfe\x8e4~\xbc\
-;\x0c\xb6xAH^\xd4\xa8(\x84\xbc}$D5\
-\xf109\x94\x82\x9e\x17J\xd0\xf7l1\xc4\xe1\xae\xd0\
-#}`\x10\xe1\x0c\x87Y\xad\x10H\xdf%\x9a\xfc^\
-*\xf9\xbd\x5c\xf2{%\xab%\xd8\xbd\x8e\xbc>\x8d\xfd\
-\x0fC{\xa0\xda\xa3\x93\xac\xb6C\x1e\xf0\xd6VK\xdc\
-f\xf1W\xc6\xc0c\xb8\xe0\xa5k\xc3\x06\xce\x15\xbc\x0a\
-mX\xd7O\xc9\xf2\xc2\xa7\xc4\x81\xe5\xcb%\x08\xb1W\
-\xc6AGl\x89\xda\xc4\xafW\xaf\xaa\xaaR\xc1\x81\xc2\
-/|]1\x03\xdf\x92/\x1c\xdeQ\xd7W\x9e\xc7\x1b\
-\x12{\xd5\xe7,\x98I\x0a\xb5\x96L\xfc\xa3\xce\xdf\x05\
-2\x7f\xe7B\xfe\x8e4~:\xe9\xbcm\xfe\xe4\xedC\
-\xc9\xdbGA\xb4\x874\xfe\xe1-\xe8{\xb1\x02\xef\xd5\
-n\x87Q\x90\x13\xc5}5\xff\xec\xdc~kGb\xf3\
-D!\xc2\xc9\xef%\xce5F\x16\xf9\xbd\x22\xf2\xa8U\
-kMp\x80\xc6\xfe\xe9\xc0\xf68\x15\xd4\x0b\x91S%\
-\xd8E\xaf\x7fC\xd7}\x9b\xf2>\xdf\xb3\x940\x90\xa3\
-\x86\x81\xa7p\xc1\x9b\xac\x0d\x95q\xf0=\x9d\xefr\x8c\
-9J)_\x06O4\x82\xcb\x10C~\xed\xe0\xfa\xe9\
-]\x91\x11\x1fT\x87\x03\xb6f\x9d\xc5\xfe\xcc\x993\xf8\
-\xfc\x80?\x9cF\x1a\xe6\xcby\xfci\xb1W\xf8;\xc5\
-\xb3\xb2\x17\x0aZ[\xed\xd1v\x9a\xfa\x80\xf7w>\x0a\
-\x7fG\x1a?\xc9\x83\xf7w\xc2\xed\x010\xdaA\xb1\xaf\
-\x8a\x86ho\x02\xac\x8ee`\xd0\xa5*t\xadI\x83\
-\xc1\xe6\xe5\xfc3\xb3\xd9~G\xcb\x98\x95\xc4\xfb\x84_\
-\xd2|l?}:\x8d\xfd<\x1a\xfb\xe5.\x12\xec\xf1\
-0A\xad\xaf\x0d.D\xf4C\x9a\x83\x15\xf2\x16\x8a\xf1\
-)i\x16~\xecg\xb0\xfe\x08\x03\x7f\xe3\x82mj\x5c\
-\xf0\x0c\xf9\xe0M\xd2\x86\x0a\x0c\xf08\xa0\xf3^\x22\x1c\
-\x94\x90g\x0aR\xc2\xc1\x86Y=\x91\x11\x17\xc8\xe3\x80\
-\xe5\x06\x86\x83\xa2\x82m?s\xb2z\xdc\x93t\x9f\x22\
-\xdf\xb3q\xcf\xbc=\xf3wN\x1a\xdd\xda\xfe\x1f\xed\xd5\
-r\x7f\xb7\x89\xf9;\xa6\xf1\x99\xbf#\x8d\x9f\xb1\x91\xfc\
-\x1di\xfc\x12\xd2y;c \x22\x7fg{\x22\x07\xc3\
-\xae\xecB\xbb\xa2(\xd2\x06\xcb!*\x0a\x82\xf4X\x0a\
-Dy~X0\xa7-\x02\x89\xbb\xa2\xc8\xef\xa5\x90\xdf\
-\xcb\xa5\xb1_B\xbew\x97\x9b\x09\x0eyI\xf9\x9c_\
-\xe1\xd6\x89_\xf7t\x8e\x8eo\xa6Z\xe2V\xba%\x8f\
-\x01\x19\x0e\x940\x90\xd5\xb0|\xf0J\xb5\xe1\x8b\xe4\x83\
-\x17\xd0\x86\x0a\x0c\xd4\xe1\x80r{1\xdd\xcb\xc0\x09F\
-X-\xc7\x81\xe7\xcc\x1e\xc8J\x0c\xe5\xd7\xa3\x11\x1f<\
-422\x1a\xfb\x84\xf8+\xfc=\xd3\xf9l>\xb77\
-i|\x17\xcd\xc1=?\xd7v\x99\xa5\xea\xefbH\xe3\
-\xa7x\xca\xfd\x1di\xfc\xd2p^\xe3\x8b\xc8\xdfu:\
-\x93\x8f\x11\x97\xaaa\xb3\xd5\x0f\xfa\xc4\xf9\x12\xd2\x7ff\
-\x17\xb2a\xb2+\x12\x03\xdcF\xc2o<\xf1>i\xbe\
-D\xd2|\x99\xe4\xf7\x0aW\x88Q\xe5j\x82\xfd\x94\xe3\
-\xcf\x04u\x22\xbf\xff\x1e\xf1\xbe\x18\xfbW\x9b\xe0:\xf1\
-\xfe-\xd2\xad\xb7\xb6\xc81\x90n\xf9\x88\x0b2\xd5\xb8\
- \xe75j\xc3F\xa8)7\x04\x07\xf7\xe9:>\x89\
-4\xe7k#\xca8\xf0\x9a\xd3\x1b\xd9Ia\xe8\xdf\xbf\
-\x7f\x18'\x9b\xaf\x7f\x5c\xfc\x15c\xbf\x03\xa7\xa5\xe5\xa4\
-9\xfe\xfd\x1b\xb2\x1a\x8e\xb2\xbf#\x8d\x9fJ\x1a?[\
-\xa6\xf1\x8d\xca\x22`\xcck\xfcd\xbc{~\x07\x86\x9e\
-/\x874v\x1d\xff\xecL\xe9\xb14\x98\x7f\x96O\x7f\
-&\xc2&\xce\x09^\xe3E\xfcs\xb5\xe2hl\xa7\x93\
-\xdf\xcb#\xde*\xa3\xb1\xbf\x87\xc6~\xed\xa6\x96\xb8\x10\
-\xf9>\xe9\x01\x0b\x1e\xc7_\x84\x98\xe1f\x8a%?\xfe\
-o*0\xb0E\x0d\x03O\xca\x07\xcf\xaa\x0dK\xdel\
-m\xf87\x1cD\x10\x0e\x16\x8b\x11\xc0p\xf0\x81\xec\xf9\
-'3\xfbH\xeeY\x894\xbd8Y}^}m\x80\
-\x22\xfeRNKs\xaa\xd6\xe4!7u\xd6\xcak8\
-\x0a\x7f\xc7k|\xe6\xef\xfcH\xe3\xcb\xfd]\x0d\xdb\xaf\
-\x94\x8a\x01\x17\xcb1\xe0x\x1e\x8cC\x9caH\x9a\xc0\
-\xf4\x5c\x16,\xbe*\x84\xf9\xf9t\x88\x0b7\xc3av\
-\x1b\x04\x92\xe6\x8b\x22=\x9fB\x9a/\x87\xfc\xde\x0e\x1a\
-\xfb\xbb\x5c%8\xe4i\x86\xf3\x91\xfdQ\xe4\xd2\x81\xdf\
-w\xc3j\x987\x92,p3\xd9\xe2\x11\x06X\x1eh\
-\x00\x17\xfc\xd3\xb5\xa1r\xbf\xb7\xbb\x05.F\x98\xf1\xfb\
-\xe0\xfc\x89w\x158\x98\xd8U\xef\xaaT\xa8\xb1\x8c\x93\
-\xad\xd3Q\x8e?\xc3\xc4;\x9a#\xfa\x9c\x95=\xffT\
-\xa9\x86\xc3\xd7\xef\xe4\xfe\xae\x98\xfc]e$\xaf\xf1-\
-\x8e\xa4c\xd8\xe5j\xf4\xda\xb7\x15\x06\xfe\x8e\xa4\xef}\
-av)\x0f\x96\xd7w\xc0\xe2J6\xa45\x11\x18\xe0\
->\x92_\x9f\xc2\x9e\xa5\x96H\x9a/\x934_!i\
-\xbeJg\x09\xf6\xb9\x9b\xe0lpw\x1c\xd9\xfc\x1e\xbf\
-~\xfb\x08\xf9\xff\xeb\xb1\xe6\x8f\xe2\xcfc\xc0\xe2\xef\x18\
-x\x16.x\x0d\xda\xb0\xc1\xf9\xe05iC\x15\x1c\xd0\
-\xb5}\x1c\xf6\x08\x07\xce\x84\x83%\x03\x0c\xfel!\xd1\
-\xf4Q\xca\x07,\xfeB\x0d[K\x7f\x1dwy\x0d'\
-PV\xc3Q\xf1w\xbc\xc6\x97\xf9\xbb\x96\xb5Y\x18\xf3\
-\xe9nt.\x8b\xe7\x9fw,\xda\x11\x0c\x8b/\x0aa\
-u\xb3\x14\x96W\xf3`z\x9cx?a\x1560\xde\
-\xb7\x17\x22n\xba\x11\xb6\xcc\x13\xf1\xfb\xe2\xcb\x9c$\xa8\
-Y#A\xad\x8f\x1d.D\x0dF\xecL3\xbe\xb6\xf3\
-%\xf1\xfe\x8d\x04\x0b\xdcH\x94\xf5\x9bIJ\x18xB\
->h\xd6\x86O\xc6\x00\xebw\xe9:\xd9\xba\xb1\xed\x0e\
-b\xfey(\x8b\xfb\x1b\xfc[GS0\x90{\xf4\xfb\
-\xf6\x1d\xb4\x17N\xb8-\xf3wN\xd0\x8bR\xf8\xbb\x8d\
-\x8f\xfc\xddN\x99\xbfk\x7fj\x1b\xc6\xd2\xb8o\x95\x1d\
-\x08}\xc2\x89dw\x0c,\xae\x15\xc3\xeaV\x19\xac\xbe\
-!\xde\xbf\xb0\x05\xe2b\x7f\xd2\xfb\xedH\x8b\x08\xf9:\
-w\x0aq{\x0e\x8d\xfdb\x1a\xfb\xd5\xab\x89\xf7=\xcc\
-p!z \xb6;\xb5\xe5\xf7A^\xf4\x91\xf2s\x14\
-7\xe2-d\x18P\xe0\xe0i\x5c\xd0\xac\x0d\x9f\x09\x07\
-\xdf\xd1\xb5\xb3g`\xb0\xf5s]\xac\xb4\xe29YM\
-OK`m\xba\xea\x91\xbf[#\xf3w\x8a\x1a\x0e\xf3\
-w\xd51\x10\x93\xbf{\xf7\x5c\x11\xc6\x5c\xac\x82E\xa2\
-'\x0cH\x17H\x8f$\x13\xdf\x97\xc0\xfaV)\xaco\
-\x14\xc3\xf2\xd3,H\xf7D\xa2\xbf\xc7h\x19\xef\x93\xe6\
-c\xfb$2\xe6\x1b\xa3\x80\xb4]\xc5J\xe2}\xe2\xf9\
-\xb3!\xef\xe2\x80\xef{\x88!Mp\xdc]\xca\xcfO\
-~\x1bg\xfex\x0c4\x90\x0b\xdeHm\xd8\x90|\xf0\
-\x12\xb9\xe0\x87\x83-q|\x9d\x94\xed5<\xc6\xc9\xd6\
-\x86\x09\xb5\x86\xf4*\xe65~\x8cz\x0d\x87\xf9\xbbX\
-\xfe\xd9\x14\x03?\xae\xc0\xb0\xd3\xc5\x90\x84\xbb\xc20\xde\
-\x0d\xa6g2`u\x83\xe2~\x9b\xc5\x9fb\x7fu\x1b\
-\xccN$\xa0E\x22\xe3}1\xcf\xfb\xb1\xd3\x88\xf7\xc9\
-\xefm_$B\xa9\xa3\x04\xbb\xc9\xdb\x1d\xdf\xd4\x16\x1f\
-F}\x80\xe8\x19RTS.\xf8\x8ax\xff\xdb\x18\x8a\
-}\xac\xbc\xab\xe3 \xb1>.h\xd6\x86\xcf\xab\x0dY\
-\xff\x9a\xeee\xdal\xd1u\xf9\x5c\x8f\xb9\x8e\xc3\xb8\x8f\
-\xeaj8\x0a\x7f\xc7\xd7p\xe2`v(\x0d#/\xef\
-\xc2\xfb\x87ra\xc8t\xdeVo\x98]\xcc\xe5s\xbd\
-\xf5\xed\x1d\xb0\xa1n\xfdM>\xf1~\x1a$;\xfc\xe1\
-\xc0\xe6y\x18\xef\x93\xe6K!\xcd\x97C~\x8f=\xff\
-b'\xf9\xbdC\xeb,\xf0q\xecPd-k\x8d\x5c\
-z\xfd\xb2\xaf\xa9l\xecG\x9b\xcb0\x10\xf3\x18\x0c4\
-4\x1f4k\xc3\x06q\xc1\xadL\x1bVK\xb8\xcd\xc9\
-\xd6\xea\xb7\xd4u\x9f\xfb-\xf3wB\xde\xdf)j8\
-qhq4\x03\x13>\xdd\x83\x1e\x95I\xd0\xe7\xe7\xf3\
-\x02aA\xbe\xde\xfaV\x09\x1fw\x9b\xdb\xc5\xb0\xb9Q\
-H\xbc\x9fI\xbcOz_\xc1\xfb\x93\x89\xf7)\xc7d\
-\xcc#\xde'\xbfWA~\x8f\xad\x89\xff0\xbc\x1fj\
-6\xf6\xe6\xf7H\x9c\xf6\x90\xe2\x1b\xf2\xaa,\xfe|\x8f\
-V\xc2\x81\x12\x17\xf0\x18P\xe3\x82\xc7\xe6\x83\xb4'h\
-Cu.h,m\xd8H5e\x05\x0e~\xa6\x7fs\
-#\xb1+b\xe6\xda\xd6\xca\xf9\xbf\x95\xbe\xdf\xd2;\xc2\
-m\xaa\xfe\xae\xc3\xc9m\x98\xf2\xe9>\xb4\xcb\x0d\x81~\
-\xc0rH\xaa\xa3`y\xad\x88\xe7{>\xee\xac\xdf*\
-\x82\xd5W\x8c\xf7\xe3\xd1\x22a\xa5l\x9e\x87\xe9}\x05\
-\xef/$\xde'\xcd\xc7\xf6\xb7\x9f\xf0\xed\x88\xb3QC\
-\x115\xcd\x04{V\x99\xf0\xbc\x7f\x9d\xc5?R\xde\x9f\
-\x80\x81\xa7\xe7\x83fm\xd8P.\xf8\xae\xa0+\xee\x14\
-\xcc\xff\xab{k\x93e\xf2y\x9f\x16\xfa\xbeK\xaf\xd5\
-\xf9;\xd2\xf8=\xce\x14b\xd2\xa5\x1a\xd8\xa4l\x84~\
-\xe8J\xfe\xb94\x96\xdf\x14\xcb\xc7|Q]\xb7\xbe\x9e\
-\x07\x8b\x8f\x88\xf7K\xfc\xb1hv\x1b\x04\x11\xef\xb3\xf5\
-\xcdu\xbcO\x9ao\xa7\x93\x98x\xdf\x12\x17\x13F\x22\
-}\xb1\x1d\xf2\x17\x89q\xc5\xcf\x14\xdf\x84\x9b\xf1\xfdz\
-\x84\x12\x0e\x94\xb9\xa0\xa1\xf9\xa0\xa9h\xc3\x97\xbc\xfe\xfc\
-U\xcc\x1b\xde+\xe9L\xd7\xea\x08\xe7\xe9\x03r9\xd9\
-\x9e\x0d\xd6\xcc\xf4\xdd\xe7\x9dc\xfe\x8e\xad\xd1{\xffB\
-9\xc6\x9e+\x874r-\x0cc\xd6@zj\x0b\xe9\
-<9\xd7\xdf.\x94w\x8a\xff\x8d\x02X~F\xbc\xbf\
-/\x12\x03\x89\xf7\xd9\xfcB\x84\x9c\xf73\xc9\xd3\x15\x90\
-\xe6\xab\xa0\xb1\xbf\x974\xdf\xf9\xa8A\xa8\xda\xf0\xae\xac\
-\xb6\xe3)\xc5\xd7\xa1\x14\xfb0\xb3\xa7c\xa0\x81\xf9\xa0\
-Y\x1b>\x9d\x0b\xee\x97\xbdC\xd7\xb9\x0c\xde\x8bG\x95\
-r\xb2\xda\xbeb\x1d\x90Pw\xfe\xd8R\xe9\x81\x14\x8c\
-\xba\xb4\x0b\xc3j\x0b`\x14\xe8\x04!\xe9\x01\xb3\x8f\xb3\
-a}S\xc6\xf7-(\xee-\xf8qO\xf1\xbfUH\
-\xbc\x9f\x03\xb3\x93\xf1\xb0Iv\x86\xd7\x041\xbf\x1f\x91\
-\xcd\xf3\xa4+x\x7f\x99l\x7f\xe6)\xff\xae8\x1d1\
-\x0cQS\xc58@X\xb8\x16D1W\xc4?L\x1d\
-\x07j\xf9\xa0\x11\xb5\xe1\xf3\xe6\x83\x97\xae\x0d\x9fg\x8d\
-\x91\x9a6\xbc_\xde\x91\xaes1B\x9c'\xd6\xc85\
-\x9f\xf2\x1a0m\x83\x01=6\xd8\x93\xce\xeb\xbbk\x0b\
-_\xb37\xce\xdbL:/\x8ft\xde\x0ey\xdc\x0b\xe4\
-]\x86\x01\xeb\xeb\xdba\xf1q*LJ\x89\xf7\xe7\x10\
-\xefO\x94\xf1~\xaa2\xef\x93\xe6;\xbc\xce\x06\x17\x13\
-\xc7\x22i\xbe5\xff\xdag\xc4\xfb_S\xde\xff&D\
-\x8e\x81\xd0\xfa0\xf0b\x5c\xd0\xac\x0dU\xb9\xe0~E\
-G\xbaF\x07\xc4\xb8O9\xc4\xc9\x9e\xb1\xa9^\x07f\
-Xh)\x9d?\xe1(\xfb\xcd*1i\x00\x8b\xabE\
-|\xae\xe7\xe3}G9\xfe\xd4o\xe6\xc3\xea\xb3\x0cH\
-\xf7\x13\xef\xaf\x1fS\xc7\xfb\x8c\xdb\x19\xef\x172\xbd\xef\
-\xc8x_\x8a\x8fb\x87a\xc7\xdan\xfc\xb3y.x\
-\x11\xef\x07\x9b=\xea\xca8x\x12\x06\x9a\xb5\xe1sk\
-\xc3\xfb\x95\x1d\xe8\xfa\xe6#\xddg\xd6)\x81@\xd0\xa1\
-\x9e\xd8+\x9a\x8e\xfe\xa0\x9e\xeb&]\xae\xf9\xcf\xf8;\
-\xc7\xd0\xee\xd6N\xd5\xf8+0p\xab\x00\xd6\xd7r`\
-~*\x016\xa9.<\xef\x87\x11\xef\xc73\xde\x9fk\
-\x8c<\xe2\xfd29\xef\x9f\x0e\xec\x89\xe3\xe1\xc3\x10=\
-M\x84\xa3kH\xef\x07\xd0\xd8\x0fb\xfd1\x18x\x16\
-.h\xd6\x86O\xd5\x86\xdf\xeflG\xd77\x0b\xdb\x03\
-\xe7\x9f\xd7\xd4\xd0`{\xf4\x9e\xb6\x17X(\xb14\x9f\
-\xe8\x92\x97\xf6\xd1\xfa\xfb\x17\xd0\xf7\xce^\xb4\xbc]\xca\
-k=\x05\x0el\x88\xf7-/\x12\xef\x97\x07`\xe1\xbc\
-\xf6\x08&\xdeg\xcf%I\x9dm\xcc\xcf\xe7\xec\xe0\xf5\
-\xbe\x04G\xd6\xdb\xe2b\xd2x\xc4\xcf\xb1$\x0d(\xc1\
-\x17\x8c\xf7\x03\xe5\xfdq\x18h\x08\x174UmX\xd8\
-\xb4\xb4\xe1\xf7;\xdb\xd2\xb5MGq\xe8\xc2\x8b\xdaZ\
-\x9a\xdd\x1b\x10{Ec\xeb\xfd[\x0d\x9a5%.\xf4\
-\xeb\xb3\xbf\xcf\xb8{\x1c\xednW\xc9|\x9f\x9c\xf7M\
-\x0fDb\x80\xd78\xb6\x9f\x08\x91Sd\xbc\x9f%\xe7\
-\xfdJ\xe2\xfd}.R\xf2zcP\xe0\xd2\x85\xcf\x07\
-\x17\xbd\xa5\xb8Fc\x9fuU\x0c\x98>=\x1f4Q\
-m\xd8d\xe6\x0d\xeb\xc9\x07\xdfW\xb7\xa1\xeb\x9a\x82\xea\
-\xd8e_\xe8\xe9h\xf7~\x86\xd8+\x1a\xd3\x03\xc6R\
-+\x8bI.y\xa9\x1fy0.\xb8\xbd\x176W\xf3\
-\xf8\xf9}\x9b4\xe2\xfd\x89\xb2}\x09\x8c\xf7\xb7\xaa\xf1\
-\xfe\xd9\xd0>8\x122\x14\xb1\xd3E8\xe1.\xc5W\
-\x9bM\xeb\xe2\xaf\x82\x81'qAS\xd2\x86oPM\
-\xf9\xfb\x9d\x14\xfb\xed\xf6\xd8\x9b\xb0\xfc+\x03=\x9d\xfe\
-\xdc\x8b\xed\xf9f\xefm=x\xce\xb4\xf8\xd0\xaf\xce\xfc\
->\xf9J5\xac\x8a\x83\xb1pn;\x19\xefO3\xe2\
-\xd7\xec\xe4:\x10\xef/\x15\xf3\xb5\x9cc^m\xf0q\
-\xb2=bf\x9a\xf1\xc7l\xcf\xd15\x7f\xa5^\x1f\x0e\
-\xd4\xb9 \xe4uj\xc3g\xcb\x07MY\x1b~\xbf\xb3\
-5]\xcf\x04\x1c\xdb\xb2\xea\xa6H\xa8\xcf\x9e\x09\xa6\xfd\
-\x02\xb1W\xe5\x02K\x8b\xc9.\xe9q\x9f\xae\x0b]R\
-\xc7\xfb\xec\xb9\xa8\xecY\xd6l\xadY\x15\xf1\xfe~W\
-3|\x92<\x019N\x1d\xf9g\xf3\x5c\xda(U\x8d\
-\xfd\x930\xf0\xaa\xb8\xe0M\xd0\x86/\xa1\xa6\xfc\xfd\xce\
-Vt\x0dcQ\xbb\xd5\xf9\xb6\x89\xc8\x90\xfd\x86\xcc\xcb\
-~\xfe\x8f\xa1\xa9Pc\xbd\xdf\x04\xd1CV\xd3g\xeb\
-\x072\x88\xf7\xf3\x17\x89P\xbe\x5c\x8c\x9aU\x12\x9c\x8f\
-\xfa\x00\xfb\x02>\xe0\xff\xee\x8c\x07\xf1~}\xb1\x7f^\
-\x0c4\x09m\xf8\x98\xb9\x82F\xd6\x86|\xecsF\xe1\
-L\xb6\xcb=\xa9\xd8p\xf4+\x88\xbd\x80=;bq\
-?\xfdk!\x13e5}\xc6\xfbl\x8c\xb3\xfd\x07\xbb\
-\x88\xe7\x8fo\xea\x84\x0bI\x93\xf8\x9a\xfe\x1e\xc2\xc2U\
-u\xde\x7f\x16\x1c<\xa36\xac7\x1f\xfcC\xe6\x0d\xbf\
-\xdfiG\xe7\x1f\x86K\x05n\xbf\xd8\x98\x8b\xa7p\xb2\
-\xfd;/\xbbI\xfa\xb5\xd2\xceU\xd4\xf4\xd9\xf3\x89\xd9\
-\xbeL\xb6\xd6\xbcj\x85\x18\x07\xd6Z\xe0r\xda\x14\xa4\
-/m\x83\x02V\xdb\xf1y\x0c\xef\xbf,.xam\
-h\xf1Vh\xc3\xef\xabl\xe9\xbc\x1f\xe0J\xc1\xda_\
-[YK\xd9\xef\x03<io\xdf\xf36m\x13C\x8d\
-\xb9\x9b\xc6\x08\xff\xe4\xd7r\xa9\xf1>\x1b\xeb\x1f\xc5\x8e\
-@\xb5\xcf\x00\xbe\xe6wn\xfd3\xc6\xbeY\x1b>\x97\
-6\xbc_\xd5\x92\xce9\x10WK\xd6\xfd\xbb\x83\x9d9\
-{&\xbc\xc1+\x88=\xcf\xfb\x0b\xfb\xe9_U\xae\xe9\
-+\xf3\xfeI\xffn8\x97`\xcf?{\xff\x90\xab\x09\
-\xaen~\xce\xd8\xbf..x\xd3\xe6\x0d\xeb\xe1\x82\xfb\
-\x15,\xf6\x03p\xad\xc4\xed?]\xdbY/\xe7\x9e\xff\
-\x99>Ok\xe2>v\xdaY\x81\xf5\xd4\xf4\x19\xef\x1f\
-t\xb7\xc6\x95\xf4\x19Hv\xb0\xe5k}\x9f\xf9\xbe`\
-\xec\x9b\xb5\xe1\xd3\xf3A9\xc5>\xb3\x1fnT\xac\xfb\
-o\xefwl]\xb8\xc7\xef\xe9z\xd1\xa6)\xd4\x15\x8c\
-\xdf8\xda\xf0\xbf\x8fj\xfa\xc6u5\xfd=\xce&\xb8\
-\x988\x0ee\x9e}\xf9\xda\xceG^/\xc0\xfb\xafP\
-\x1b\xbeU\xf3\x86e-\xe8\xb3\xfb\xe0F\xb9\xfb\x7f\xdf\
-\xef\xd1\xc6\x83\x93\xed\xd7{UM<\xa2\xa3NU}\
-5}\xb6/\xfftPo\x9c\x8ac\xbc/\xc6\xb1\xb5\
-&\xb29\xbe\x97\x1d\xff\xc6\xd4\x86\x09MM\x1bR\xec\
-3z\xe1v\xa5\xdb\x9f\x83\xdfm\xc7\xf6\xf1\x89^a\
-\xecY\xeb\xb4~\x84\xe1/\x7f\xaf\xe9\xb3\xbd\x1b-p\
-9c6\x12\xe6\xd9\xf0\xbf\xad\xfa\xc5\xcb\xe2\xfd\xe7\xe2\
-\x02\xb3\x7f\x806d\xb1\xef\x81\xbbUk\xff\x1a?\xa8\
-K0'{\x06\xdb\xabl\x1aR\xa1\xc6l\xbe\xa6\xaf\
-X\xcb\xa5T\xd3\xff$\xc5\x1eE\xee\xbd\xf8\xb9?\xbe\
-\xb6\xf3\xaac\xff\x0f\xd7\x86\xb73\xba\xe1n\xa5\xeb_\
-\xd3F\xf4\x8c\xe6\x1e\xad\xd9{\x95M\xbb\xbb\xb5Vp\
-\xbc\x12\xef\xd7\xd5v\xc2\x06\xa06z\x02\xe5\x04\xa5\xda\
-\xce\xeb\x8a\x7f\xa3\xe4\x83\xc6\xd5\x86\xb73\xba\x90\xe6_\
-\x8d\x05\xe3\xfb$s\xb2g\xb0\xbd\x8e\xe7\xfa\xeb\x0f\xef\
-\xa0\x93\xab\x5c\xd3g\xb5\x9c\xa3^mp)c.\xe2\
-\xe6X\xf2\xde\xefo\xb5\x9d\xc6\xc6\xc1\xd3\xb4a\xbd8\
-h\xba\xda\xf0\xf6\xd6wH\xef\xaf\x84\xe3\xb4\x81\x99\x9c\
-\xec\xb9\x1c\xaf\xeb7\x1d\x84\x93\xbb\xebU1~W\xae\
-\xe9_&\xaf\x97\xb3\xaa+\xf9\x7f1.?\xae\xb6\xd3\
-\xd8\x18hJ\xda\xf0i\xfb\x94\x9f\x90\x0fnm\xedD\
-z\x7f\x05\xd6\xce\x1b\xca~\xf7\xd1\xfa5\xc6\x9e5\xe3\
-\xd9\xbd\xf4j\x94k\xfal\xbf\xde\x81\xd0\xd1\xbc\x0f<\
-\xfd\xb4\xdaNS\xc0\xc1\x8bh\xc3\xa7\xe4\x83W\xad\x0d\
-om\xed\xc0\xaf\xd3\xf6_1\x8e\xfd\xd6\x9f\xedk\x8e\
-=k\xc2Y\xbd\xf4*\xebj\xfa\x1b;\xe0\xe2\xd6\xb9\
-\x88\x9de\x86}\xe4\xfb\x1b\x5c\xdbil\x0c\xbc\x81\xda\
-\xf0Vz;\xe5u\xda\xecY-\x8d\xf1[^\xfa\x13\
-\xba\xe8fW\xcak\xfaW2\xe7 \xc3\xb1#\xe5\x02\
-1>\xdd\xd4\x04x\xbf\xc9\xe4\x83\x97\xab\x0domi\
-\xcb\xaf\xd3\x8eu\x9fzHP\xff:\xed\xd7\xd5\xb4\xfb\
-\xdaiof5\xfd\x0b\xb1#\xb1\xdb\x7f8\xff\xbb\x0b\
-\x1fz6\xe1\xd87(\x1f4\x5c\x1b\xbe\xee\x9a\xf2\xad\
-\xb4\xd6\xa4\xf7\xe7\x22m\xe3\xac\x93\x9a\x1a\x1a\x1d\x1b1\
-\xf6\xac\x09$\x06\x1a\xa3k}\xbb>\xbc\xb0e.b\
-fH_Nm\xa7\xb11\xd0D\xb5\xe1\xcd\xd4V\xa4\
-\xf7g!\xc7\x7f\xde9\x8a\xfd;\xdc\xab\xfd\xcd\xa6\x86\
-6\xc9\x90\x1e-\x82\x13\x16\xd8\xfd\xce\x9e\xbf\xfd\xf9\xeb\
-\x98\xe3k,.x\xad\xf3\x86\xaa\x5cp3\xc5\x8eb\
-?\x93_\xa7\xad\xab\xad\xc5~K\xa5)\xc4\x9e5V\
-\xfbm]\xea\xd1\xeb\xeb\x1fv{\x127\xcd\xa3\xef\xda\
-\x0d\xd7\x02-\x1b?\xa6M\x8d\x0b\x9eW\x1b&\xdb\x92\
-\xd7\x9b\x86\xb2\xc8%Wtu\xb4zq/\xef\xf7\x99\
-^Vc\xebG\xdb\x0e\xe8\xddmmf\xd4\x86S\xdf\
-\x9f\xc9\xf9\xf3\x87\xdd\xeb\x89\xb7\x86\xd1\xfd\xb1\xa3{k\
-\xd6\xf8\xb1m*\x18xVm\x98\xd4\x82\xfc\x9e=\xf6\
-$8\xbe\x8cu\xda\xaf\xba1\x1c\x98K\xc4\xc6#V\
-.\x9c\x96~\xa24\xee\xe6/'\x13q\xb7h\x01}\
-\xd7\x1et\x1f\xad\x1a?\xbe/3\x1f\xbc\xea\xf5\x86\x89\
-6\xe4\xf5\xc6\xe3p\xea\xcao\xc5F\x06C\xb8\x97\xb3\
-N\xfbu4\xa6I\xd9Z\x93\xb6=\xbbvX\x91\x14\
-\xe4v\xe4\xee\xa9\x9c?~\xdc\xbb\x91t\xecH\xba?\
-\xad\xe9\xbe\xbe\x01\x9c\xd0\xa8\xda\xd0\x86\xbc\xdeh\x9c\xc8\
-p\xbecb\xfcJ\xd6i\xbf\xae\xc6\xf8\xca\xd4Hh\
-0x\xd1\xac\x09\x89\x87\x0b\xa3\xbe\xfe\xf5T\x0a\xee\xed\
-XB\xdf\xb5\x17\xddG\xeb\xc6\x8f\xf3\xcb\xe0\x82\x97\xaa\
-\x0dY=g\x04\xce\xe5\xb8\xdc\xb7\x94\x8a\xc6s\xaff\
-\xad\xee\xebnln\x92\xad;m\xdd\xb9C\xeb\xc5Q\
-\x9b\x9c\xf7\xde:\x91\xfd\x9f\x1f\xf7o&\x9c\x8f\xa5{\
-\xd4\x96\xee\xafy\xe3\xc7\xfay\xb8\xe0\x99\xeaHf\x7f\
-\xcb\x07\xaa\xda\x90\xcd\xed\x0d\xc5\xc7\xdb\xd7\xfcdm&\
-\x9e\xcc\xc9\x9e\xbb\xf8\xb65\xc6\x09&\xfaz\xba\xfdf\
-O\x1a\x15Y\x93\x1b\xfa\xf9/g\xb6<\xbcW\xb6\x9c\
-x\xaf\x0f\xddG\x9b\xc6\x8fwc\xe4\x83\x18\x16\xfb!\
-\xb8R\xb8\xf6\xd76-L\xd9\xef2\xbf\x8au\xdaM\
-\xa91N`\xf8\xb6mcg3'\xd8\xd3q\xe7\xb7\
-\xb5\xd9\xff\xfa\xe9P0\xafy\xafG\xb4o\x9a\x9c\xf0\
-\x22\xda\xf0\xb1\xf9\x80\xf9\xfcA\xf8\xbc\xd8\xfd\xff\xb6\xb7\
-}e\xeb\xb4\x9brc\xf3\x19\x12\x1dm\xed\xf7\xa6\x8d\
-\x1f\x16\xb6;7\xec\xf3_\xcfn}x\xbf|\x05\xe9\
-`\xe2\x84\xa0&\xc6\x09/\x93\x0b\x22\xd9\xfcN?|\
-\xc5\xd6i\xb7}\xa5\xeb\xb4\xdf\x84\xa6\xe0\x84\x96\xc4\x09\
-\xb3\xfd\xd7--\xff\xeap\xc6o2N\x98D\xf7\xaa\
-c\xd3\xe2\x84\x17\xae)\x9b\x93\xcf\xef\x83\xeben\xbf\
-\xf7\xe9b\xe7\xca\xbd\xbau\xdaobc\x9c \xd2\xd4\
-\xd4\xe81a\xe4@\xff\x8a\xadA\x97~9\x97\xf5\x90\
-\xads\xba\x99<\x80\xeem\x8b\xc6\x8f\xff\x0bq\x819\
-q[/\xdc,w{\x1d\xeb\xb4\xdf\xe4\xc68\x81y\
- \x1b\x1bK\xb3\xc9^\xab\x17\x14^\xd9\x97\xf6\xe3\xcf\
-G\xc3\xf9y\xd1\xebQ\x9dq-\xd0\xe2\x0d\xc3\x00\xc5\
->\xa1'nW\xac\xfdsd\xbf\x8e\xec\xf7\xf6\xc4O\
-\xb9\x07\xcdM\xd6\xd8\xdc\x92\x91@ \xe8<|P\x1f\
-\xaf\x82$\xdf\xf3?\x9d\xcdy\xf0}\xb5\x1bn\xa6\x0e\
-\xa6\xfbk\x8bF\x9don\xd0\x5c\x01\xf3\xf8\xdd\xf0]\
-\xc5\x9a\x07\xafi\x9d\xf6\xdb\xd8\x14\xbfEce*\x95\
-\x8c]\xb3lV\xce\x85\xea\xe4\xbb?\xd7\xc6\xe0\xbb\xfc\
-\xd9\xe4\xa5\xba6^\x0d\xea)s\x05\xdf\xc6v\xc5\xbd\
-J\x97\x873F\xbe\x1b\xc3\xc9~+\xfbu\xaf\xdbz\
-\xdb\x1a\xe3\x04\xa6\x9b:\x0cx\xaf{\xd3\xa8A\x05\xd4\
-\x8f\x83oc:\xf3\xb1_0\xbeo\x0a\xf7\xfa\xd6i\
-\xff\x93\x1a\xe3\x04\x0b\x13\x89\xf1(\xd7\xa53\xb3/\xec\
-J\xb9\xfb\xcb\xf18\xdc-\x98\xdb8\x9c\xa0\x84\x81\xeb\
-\x91\x1dp\xbfb%VL\x1b\x98\xc5\xc9~/\xb99\
-\xf6\xaf\xae\xf1\x9c \xe09\xa1\x9bkZ\xe8\xbacw\
-Oe\xfd\xf7\x87\x9a\x0d\xb8\x95>\x9c\xb4w\xab\xd7W\
-\x83b\xb1\x8fh\x8f\xfbe\x8ep\x9b7\xac1\xd6i\
-\xff\xd3\x1b\xab\x9b\x9a\x19\x09\x0d>X>or\xea\xa9\
-\xf2\x84[\xbf\x9cL\xc2\xdd\xe2\x85\xa4\xc3^}]\xfa\
-\x9b\xf06\xb8W\xb2\x14\x9b\x96\x8d\xa9\xe0d\xbf\xa3\xd2\
-\x1c\xfb\xc6iuu\xe9^\xdd:\xad\x88\xf3w=p\
-\xebx\xe6\x7f~\xdc\xb7\x09\xb73\xc6\xf0qz\xd9s\
-K\xac\xd6}o\xc7\x22\x84\xae\x9e\xb8\x87\xce\xdb\x8ak\
-\xdc\xf5\x9a\xcd\xedQS\xd4\xa0\xfa\xcf\x9b:&\xf6P\
-a\xf4\xd7\xbf\x9eI\xe3\xf7S\xdcH\xe8\xfdR\xea\xd2\
-Lw\xb2\xb5/\xf1\x1e\xd3\x8e\x92_m\xcb5\xc7\xbe\
-)6\xc6\xc5\xac\xd6\xd2\xbas\x876K\xa2\xfd\x5c\xf6\
-\xc9\xea\xd2~/T\x97f\xf3\x10\xcc\x87f\xf9\xcd9\
-#_\xab\xdb\x1c\xfb\xa6\xdfd\x9c\xa0\xaf\xd7o\xce\xe4\
-QQ{r\xc3\xbe\xe0\xeb\xd2\xa5\xcfV\x97\xfe:\xa4\
-%\xbe\xcb\x9b\x89\xc2\x10\x87\x8f\x9b\xd8Z\xdd\xe6\xd6\xb0\
-\xa6R\x97\x0e\xd9\xb0\xa2\xbaAu\xe9\x003\xbe>u\
-\xafd\x09*b\x1c\xaf\xe8\xeah7\xc5\xb5\xba\xcd\xed\
-\xd9\x1a_\x97\xd6\xd6\xd6\xea5i\xcc\x07\x81e[\x02\
->\xf9\xf9l\xe6_\xdfW\xaf\xc5\x9d\xec\x09\xb8\x992\
-\x90\xef\xb7\xb3\xc6\xf1\xfb\xef\x7f>\x95\xf60v\xe3\x92\
-\xfd\x14{6\xee\x9bc\xff\xf6\xb4\xba\x1a\x94\x95\x85\xe9\
-d\x8fU\x0e\xdb\xab\xb7E_\xb9x \xf7\xfe'\x07\
-\xb6\xdd\xdf\x93\x1f\xf7\xb9\xaf\xdb\xf2\x92\xb6v-\xd8\xba\
-\x1d\x0b\xae9\xdf\xbf\xcdM\xe1#\xd9\xb3\x16Z\xcb;\
-\x9b\xcf3\xe2\x9as}s{K\x1b\x1e\xd3~\xf3W\
-=\xae\xb5S=\x0e\x10\xa9\x1c>\xe4tU\x8e\x1fp\
-\x9a*\xc7\x7fp\x02\xd5\x8fW;\xf3\x0d\x8eS9a\
--\xc7\x0dQ>\xa6+U\xbe\x80\x87t\xac|\xc2\x07\
-t\xac|\xc2?\xe8X\xf9\x84\xbf\xa9}\xd5\x1b\xecX\
-\xe9\x84\xb5\xecX\xe9\x84\xfc\xadyt\xc2\x87\xfc\xf1\xa3\
-o\xfc\x80?~t\x01\x7f\xf0\xc7\x8f.\x80?\x9d\xd2\
-\x05\xdcP\xbb\xd7\x01\xb2\xe3\xba\x13\xcac\xa18\xe1C\
-\xf9\xb1\xe2\x84\x0f\xe4\xc7\x8a\x13\xfe!?V\x9c\xf07\
-\xf9\xb1\xe2\x847\xd4\x82\x1b\xa08\xf6W9\x9d\xe2\x02\
-\x1e\xd6\x1d\xdb\xa9\x9cNq\x01\x7f\xd4\x1d\xeb\xaa\x9cN\
-q\x01u\xa7\x93\x9f0\xe0\xd1\xb1\xbf\xca\xe9d'|\
-\xa8tl\xa7r:\xd9\x09\xffP:\xd6U9\x9d\xec\
-\xb8V\xe9XS\xf5t\xfc1\xa7z\xac|:v\x81\
-\x0fT\x8e\x87\xa8\x9c\x8e]\xd0o*\xc7\x22\x95\xd3\xb1\
-\xe3\x00\xb5c\x95CN\xf7\xa1\xda\xf1\x03\xb5c\xd5\xd3\
-q\xa2\x1bj\xc7\xaa\xa7\xe3\xec\x02\x9er\xcc=\xf9X\
-}\x8f\x81z\x1ek\xec9k\xf5\xf3\xab\x1f\xab_\xaf\
-\xfa\xf7\x11\x05\xa8\x1e\xdb\xd5\xaa\x1e\x0f\xb9\xa1z\xec\xaf\
-\x1a^N\x0d\x0e\x025\xb8h\xaa\xc2\x8b\xe1O\xf5\xf4\
-j\xc7vj\xef\x1f\xa2\xf6\xf9\xfej\xc7\xaahg\x03\
-X\xe5XS\xedXWu4\xb0\xd3?\xf1\xd8N\xed\
-x\x88\xda\xb1\xbf\xda\xb1\xdah\x13\xa8\x1dk\xd63\x1a\
-\x95\xafO}\xf4\xaa\x8f\xee!jl\xc0\xb3C\xad\xca\
-\xe9\x95?@\xa0\xc6Nr\xba\xab{\x83\xae*\xfb)\
-\xe8\xb2\xee\x0d\x0a:\x0dP>\xbd\xd2\x1b\xfc\xd5\xe8U\
-\xc1\xc6\xf27\xa8\xd3\xf7\xa3\xe3\x07\xca\x97S\xf7\x06\xa5\
-|tC\xe9r\xea\xde`\xf7\xe8\x18\xca\x97\xa3x\x83\
-\xbf\xd2\xf1\x1f\x9cZ~\xe4\xd4\xf2g\xed\xdf\xf2\xabj\
-\xfe}\xc8\xa9\xe6g\xd4\x0eA\xbd\xed\xff\x03\x098\x96\
-:\
 \x00\x00\x05\x8e\
 \x00\
 \x00\x1dex\x9c\xb5Y\xcdn\xdc6\x10\xbe\xfb)\x84\
@@ -990,1163 +97,6 @@ Q\x1b\xa69k\x18\x9e\xd2\x83\xe1xJ=i?\xd8\
 \xff\xb9\xa1\xbd\xfc\xac\x0c\x99X\xc8\x90\xd0\xf1\x13\x17\x8b\
 \x97\x0c\x17\xff~\xeax\x99b\xaf\xbe\xc3\x02\x0cB,\
 S\x1d\xb8\x96\x99\x10\xfb\xe0?\xda\x87p\xb7\
-\x00\x00H$\
-\x89\
-PNG\x0d\x0a\x1a\x0a\x00\x00\x00\x0dIHDR\x00\
-\x00\x00\x80\x00\x00\x00\x80\x08\x06\x00\x00\x00\xc3>a\xcb\
-\x00\x00\x00\x01sRGB\x00\xae\xce\x1c\xe9\x00\x00\x01\
-YiTXtXML:com.ado\
-be.xmp\x00\x00\x00\x00\x00<x:xm\
-pmeta xmlns:x=\x22a\
-dobe:ns:meta/\x22 x\
-:xmptk=\x22XMP Core\
- 5.4.0\x22>\x0a   <rdf\
-:RDF xmlns:rdf=\x22\
-http://www.w3.or\
-g/1999/02/22-rdf\
--syntax-ns#\x22>\x0a  \
-    <rdf:Descrip\
-tion rdf:about=\x22\
-\x22\x0a            xm\
-lns:tiff=\x22http:/\
-/ns.adobe.com/ti\
-ff/1.0/\x22>\x0a      \
-   <tiff:Orienta\
-tion>1</tiff:Ori\
-entation>\x0a      \
-</rdf:Descriptio\
-n>\x0a   </rdf:RDF>\
-\x0a</x:xmpmeta>\x0aL\xc2\
-'Y\x00\x00@\x00IDATx\x01\xed\xbd\x09\x98\
-]\xc5u.\xba\xce\xd4\xf3<\xa8\xa5nI-\xb5\xa4\
-\xd6\x04\xa2%\x04\x08,\x84@\x08\xc4,0`<a\
-\x1b\xdb_\xe2\x9b\xe4\xbd\xbc\xcf/\xb1\x93w\xef\xf7\xbe\
-\xdc\xfb\xdeMnb\xe7\xdd\xbc$$/Nl\x82\x0d\
-\xb1\x1d\x83\x99\x8d\x99A\x13\x9a\xe7V\xb7\xa4V\xcf\xf3\
-<\x9dyx\xff_\xb5k\x9f}N\xb7@\x12\x1a!\
-\xf5\x9d:U\xb5j\xd5\xaaa\xad\x9aV\xd5\xde[\xe4\
-?\xccg\xba\x05\x5c\x9f\xe9\xda\xa7V\xde\x8d`6l\
-\xbe\xe526\x08;\x01\xeb\x87\x8d\xc1~\xea\xccg]\
-\x00X\xff\x0c\xd8\xb2\xd2\x8a\xca\xd5w?\xf4\xa5\x87V\
-\xdc\xb0vU\xd9\xac\xear\x97\xb8d\xa8\xafs\xa8~\
-\xef\x8e\xc3\xbf}\xe1\xdf\x9eooiz\x0fx\xfd\xb0\
-q\xd8O\x8d\xf9\xac\x0a\x80\x07\x1c,\xf0\xf9|\xf3\xd7\
-\xdc\xb6\xe9\x81\x0d\x9b\xbf\xfa@\xd5\xca\x0dW\x1f\xe9\x8d\
-\xbaO\x0eDd$\xa0;{A\x96[jJ|\xb2\
-|\x86/\xb1\xfb\xd5\xa7\xde\xf8\xd9\x0f\xbe\xff\xbdH$\
-r\x14i\xa3\x9f\x16\x09\xf8,\x09\x00\xeb\x9a\x09;\xa3\
-r\xde\x82\x9b\xee}\xf4\x89/\xdep\xf7\x97o\xeb\x8a\
-\xe4\xe5\xedj\x0fJC_XF\x831\x89'RY\
-\xebB\xaa\x92l\x8f\xdc4/[|\xed\xdb\x8f\xfc\xe4\
-O\x1e\xfb\x1a\x84\xe0\x10\xb0>\x15B\xf0Y\x10\x00/\
-\x98U\x90\x9d\x9d\xbd\xe8swl\xfe\xfcm\x9b\xbfr\
-_\xf1\x92\x1b\x17\xefm\x0f\xb9\x0ev\x85\xa4k<*\
-\xa1h\x1a\xd7Se@\x85\xb2}.Y37[\xb2\
-\xda\xde\xdb\xff\xf3?\xfb\xfa7 \x04G\x10q\xc5\xaf\
-\x0b>\xad\x02\xc0zqAWQ\xb3h\xd9\xfa{\x1e\
-\xfb\xc6\xa3u\x1b\xbf\xb0\xae\xc5\x9f\x9d\xb3\x1b\xbd\xfd\xc4\
-@X\xc6C\xf1)\xbd]q\xfa#\xfer \x047\
-Vg\x8b\xeb\xc4o>\xfc\xf9\x7f\xfd\xd6\x13@m\x84\
-\xbd\xa2\xd7\x04\x9f6\x010\xbd\xbdv\xdd\xa6\x07\x1f\xb9\
-\xfd\xe1o<\x90[\xb3z\xc1^0\xfd\x00z{\xf7\
-XT\xc2\xb1\x8f\xef\xed\x1f!\x03\x92\x9b\xe1\x96\x9b\xe7\
-g\x8b\x7f\xef/\xdf}\xfe\x87\x7f\xf8m\xe06_\xc9\
-B\xf0i\x10\x00\xb3}\x9b\xb9\xe4\xeaU\x1b6>\xf4\
-\x95\xcf\xaf\xb8\xed\xe1\xb5\xec\xed{\xd8\xdb\x07\xc32q\
-\x0e\xbd\xfd\xa3\x84 ?\xd3-\xebjrdp\xcb\xbf\
-\xbc\xf6\xca\xdf\xff\xe7\xdf\x03n\xdb\x95*\x04W\xb2\x00\
-\xf8\xd0\xe8EYyyK\xef|\xe0\x0b_\xb8\xf5\xc1\
-o\xdc\xe7\xaeX6gOGP\x0ev\x87\xa4o<\
-&\x91\xf4\x15\xddGq\xf5,\xe3\xb8CX\x0f!\xe8\
-|\xe3o\x9f\xff\xed\xbf\xfc\xf7?D\xf2\x0e\xd8O6\
-\xbc\x9ce\x19\xce\x07\xfa\x95&\x00\xec\xed9\xb0\x95W\
-]\xbb\xe6\xce\x8d\x9f\x7f\xfc\xa1\xe5\xeb6\xdft|\xc4\
-\x9bA\xc6\x9f\x1a\x8a\xc8d8.\x89\x8b\xc1\x06\xb4\x5c\
-q\x96G\xd6/\xc8\x91\x93\xbf\xfe\x8bg\xde}\xf6\x7f\
-\xfe1\xca\xd5\x0d{1rG6\xe7\xc7\x5c)\x02@\
-eMqaI\xc9\x8a\x8d\x0f|\xf9\xb1[\x1e\xfa\xda\
-]\x91\x82\x9aY\x5c\xd0\x1d\xee\x09\xc9\xc0dT\xa2\x17\
-s)\xe6h5n\x11o[\x98#\x87\x9f\xf9/\xff\
-\xb2\xed\xf9\x1f\xfd\x17\x94\xb3\x07\xf6\x8a\x11\x02GU\xce\
-\x8fD\x9dG*vo_q\xdd\x8dwmz\xe4\x89\
-G\x96\xdc|\xff\x0d\xf5\x03.\xef^\xab\xb7\xfb\xd9\xdb\
-\xcfc\x86\x1fK*\xbd\xb5\xa8$\x80\x99\x91\x0b!\xa8\
-\xc9J\xec\xfc\xe7\xff\xfd\xc9\xdd\xaf=\xf3g\x00\x0d\xc0\
-^\xd4\xa2\xb1\x1c\xe7b\xd2\xabt.4\xceg\x1a\x96\
-\x87s{iII\xf95\xb7o\xfe\xe2\xa37?\xf0\
-\xf8\xa6P\xe1|\xd5\xdb\x8f\xf6\x86/~o7\xb5s\
-\xb6\x94\xc5x\x15\x058\x83\x159\x98\x0e\xe6g%\xb6\
-\xfd\xfd\x1f\xfc\xf5\xfe\xb7\x7f\xf5\xe7\x88\x1b\x82\xbd\xec\x85\
-\xc0Y-S\xd5K\xe1\xb2\xb7\xe7\xc2\xce\xb9~\xedm\
-\xf7\xdd\xf1\xe87\x1f\xae\xb9\xfe\xce\x95\x87zc\x1e\xf6\
-\xf6\xd6\xe1\x88\x04\x22\x89K\xd7\x9a\xceV2\xcc\xb7`\
-v\xd0\x12\x82[\xab3bo\xff?\xdf\xfe\xf3\xa3[\
-_\xfbk\xd4g\xf8R4\xe6\xd9\xe4\xe9\xac\xda\xd9\xa4\
-;\x1f\xb8\xcc[\x1d\xc4T\xe0 \xe6\x8e\x87\xbf\xfa\xe8\
-\x8d\xf7~\xe5\x8e\xd1\xcc\xca2\xce\xed\x0d\xbd!\x19\x84\
-N>v1\xe7\xf6\xf4Z9[\xc7p\x9a8\x80\xab\
-(\x13o\x05\x88R\x89\xe9\xe0\x969\x9e\xe8\xeb\x7f\xf5\
-\x8d?k\xfc\xf0\xad\xbf\x03\xf6H:\xd9\xcb)l\xaa\
-p1\xcb\xc4\x83\x98<\xf1\xf9\xe6\xddt\xcb\xc6\xcdw\
-=\xf2\xcd\x87f\xd5\xddz\xf5\xfe\xce\xb0k_gH\
-\xdaG\x22\x12<\x03\xd5\xec\x05/\xb0\xb3e\xce\x80\xf9\
-Z\x22\xf4t0\x1bB\xb0\xae\xca\x15~\xf1\xbf}\xf1\
-O\x9b\x0fn\xff\x11\xca:v\xc1\xcb{\x8e\x198\xab\
-y\x8e$\xce(\x19\xf3\xe1AL9\x0fb6=\xf4\
-\xd5G\xd6\xdc\xfd\xa5\xdb{\x13%\x85\xec\xed\x8d\xfda\
-\x19Fo\xbf\x80\xdb\xf63*\xa4\x8d\xe4l\x15\xc3|\
-\xc0\x14\xd8\xc4\x19\xd7\x0c\x07&\x0c\x97\xde\xea<\xaf\xdc\
-43\x16\xfc\xf5\xff\xf9\xd8\x1f\xb7\xd5\xef\xfa\x09@\xbc\
-Wp\xd9\x19S\xec\x0bU0s\xec\xba`\xed\xc6\xfb\
-\x1e\x82jvs\xd9\xb2\xb5K\xf6v\x84\x5c\xfb;\x83\
-\xd25\x8a\x83\x98O\xa8\x9a=\xaf\x05w\xb6\x86a<\
-3\xb0\x98\xaa%@\x87\x93@\x13v\xba.\xf1 M\
-5F\x82\x1b\xcbC\xfe_\xfe\x1f\x0f\xfe\xaf]'\x8f\
-\xfe\x1b0&a/+\xe3\xac\xf2\xf9*\x18i\xb2\xb7\
-\xabc\xd7{\x1e\xf9\xdack\xeey|\xc3\xc7\x1d\xbb\
-\x9e\xaf\xcc\xcf\x99\x8e\xb3%\x0c\xf3-\x98\x09*\xda\x0a\
-\x86?\xbaV|\xd2\xe55\x92$\xdc\x8d\xc0B\x8c\x04\
-\xd7\x15M\x8c?\xf3\xfd\xfb\x7f\xaf\xaf\xed\xe4s\x88\xe5\
-\xed\xa2\xcb\xc6\x98*\x9c\x8f\x02\x99\x83\x98Ek7\xde\
-\xff\xd0\xfa\xcd_\xbd\xafd\xe9M\xaa\xb7\x1f\xc4\xdc~\
-\xa6\xc7\xae\xe7\xa3 gE\xc3\xd9\x02NN\x03\xae\xa2\
-L\xbc\x09\xa4\x84\x91\x93\x1dv0\xdf\x86\x09F\x02\x97\
-\xd4\xe6y\xa4.\x7ft\xe4\xd9\xefo\xfe\xdd\xfe\xf6\xa6\
-\x97\x90*pVe\xbc\x80\xc8\xa6\xa8\xe7\x9a\x05\xd3g\
-\xc1\xce\x9c\xb7h\xf9-w?\xfa\xf8\xa3\xd7\xde\xf9\xc5\
-[Zq\x10\xc3K\x16\xe7z\xecz\xae\x859\xebt\
-\xce\xda\xa73?%\x8e\x94\x010\xb0).\x98?\x05\
-\xc6$\x1a\xc8\xe9`1\xa6\x83\x15\xd9\x03\x83O\xff\xf1\
-\xbd\xdf\x1c\xe9\xed\xfa-by\xdf\xf0\x92\x1bS\xec\xb3\
--\x08{{QV~\xfe\xd2\xdb\xefz\xe8\xe1u\x0f\
-|\xf5\x9e\x9c\xeak\x17p\xcf\xce\x83\x98\x1e\x5c\xb2\xf8\
-\xa4\xc7\xaeg[\xa0\xb3\xc6w\xd6\xdcp\xcf\x82\x99\xa0\
-\xcdp\xc3|\x93\xc6v\x1d\xbd\x9e\x05 \x5c\xc5\xe1\xcf\
-\xf6k\x18\x1bl)\xa6\x83\xa5\xde\xae\xde\xa7\xbf\xf7\xc0\
-\x13c\xfd=o\x03\x14\x82\xbd\xa4F\x15\xf7\x0cK@\
-e\x0d/Y\xcc\xac\xbd\xban\xc3\xdd\x8f<\xf1\x05\x1c\
-\xbb~\xee\xc4\x98/sw{@\x9a\x06#2q\xb1\
-\x0eb\xce\xb0\xc0\xd3\xa29kls\x1a\x98\x16\xcf4\
-\x03u8\x094a\xa7\xeb`\xbe\xa1\xa9\x5c\x8b\x90\x05\
-SY\xf0\x0f?\x0a\xc1r\x8c\x04\x0b\x13\xa7:\xff\xf5\
-\x8f\x1e\xfa\xda\xe4\xe8\xe0\x16\x80\xc2\xb0\x97\xccX\xc5\xfc\
-\xc8\xfc\xa9\x9a-.,,\xbcz\xc3\x03_|d\xed\
-\xbd_\xba\xcb3\xeb\xaa\xb9\xea \x86\xc7\xae\x13\x17\xf6\
-\xd8\xf5#Kv\xb6\x91\xce\xda\x1a\xe6[0\x13T$\
-\x15\x0c\x7ft\xadx\x1b\x0eD\x13m\xc3\xe8\xb1\x98l\
-\xc3\xac\xe4\xe9p\x0a\xc15\x18\x09\xe6\x06\x1bZ\x9e\xfa\
-\xde\xc3_\x0fN\x8cl\x07(\xa2\xd2]\x82?g\xf5\
-\xd2\xb3'\xe3\xe7\xae\xb8\xf6\xc6{7}\xe128\x88\
-I/\xdd\xd9\x84\x9d\xb5tr\xdaf\x92EL\xe1\x19\
- `&\x9d\xed:\x98o\xc3\x98\xd6J\xe3\x80\xb9L\
->\x849\xe0\x14\x08\x1fN\x08Vba8s\xec\xe0\
-\x89\xa7\xfe\xe4\xe1\xc7#\x81\xc0\x1e`]\x92K\xa6\xa6\
-h\xac\x85\xd3\x10>o\xd5w\x7f\xf9\xe6\x86\xf5\xeb\x17\
-t\xe2*\xd5a\xf4\xf6\xfe\x8b}\xec\xea,\xd1\xb9\xfa\
-\x9d54L!-\xc0U\x94\x897\x81\x94\xb0\xc6S\
-Y#\xadA\xd1\x1e+\xce\xd0d$\xac\xc61\x1e\x83\
-C\x0a\x16\xccr2 \x04\xab\x0b\xbcR\xd8\xb3\xed\xc8\
-\xcf\xfe\xf3\x97/\xd9Mc*j\xa63\xc5U\xd7\xac\
-\xfbO\xa1\xdc\xd9\x9bv4\x8fy\x9b\x03y2\x11q\
-]>\x9a\xba\xe9J<\x1dLq\xc3\x8aHg\x14\xe3\
-\x9c\xd6\xc1\xa0\x148\x19\xafl\x1a>\xe9)\x9b\x84\xab\
-\xec\xd2`\x9a\x16q5\x1e\xa3\xe9\x8fAI\xd0\x87\xab\
-j\xe5\xe5\xf3f\xac\x5cy\xed\x0d\xf5[^\xdc\x1e\x8f\
-\xc7/\xfa1\xf2t\x02\xe0\xf2\xe6\x96\xdc<\xe7k\xff\
-\xf8O\xab\x97/\xf4\x9d\xaa\xdf/\x09_\x8e\xb8\xb2\x0a\
-t\x85Q\xfe\xcb\xdeX\x8d\xac\xcai\x18\xc5\x00\xe0*\
-\x8a\x7f4\xca%\x90\xd6\x84\x9dnZ\xaf\xb7qR\xf1\
-u\x16\x80Q\xf3c\xe3\x90\x0e\xc3\x1af\xbc*\xde\xc2\
-\x8ba\x7f\xd8\x17\x8cK\xc5\x8c\xf93\xaf^\xbel\xd5\
-\xe1\xf7_\xe4\xa2\x90'\x88\x17\xed\x18\x99+\xfbt\xe3\
-\x95\xd2Ek:\x07'\x5c\xfd\xd0Y]\xb3|\xb1\xc4\
-\xfa\x8eK\x220\x9a\x8ewy\x86\xc9\x00c\xd8\xea4\
-t\xc8\x07\xcb\xb5a\x0a\xa8B\x1a\x87^\x853M\xaf\
-Wq\x16\x11C\xc7\x0a\x1a&+J&\xce!\x0cv\
-\xbe\xb6\x14\x98|\xa0\x0c\xf0\xb9e7\xee/&j\xef\
-\xbc\xfe\xd1?}\xf2\x9f\x10\xb3\x10v:\xbe(\xf2\xe7\
-\xfbo\xba\x8c\xbc\xee\xbc\xb2\xeaD4,\x07[\x06d\
-\xc6\xecy2\xb3\xc0'\xb1\xfe\x13\x92\x88^\xf2m\xeb\
-\xe9\xebo\x1a\x9e\x18i\x0d\xad\xa2\xf8Gc\x02\x0a\xc7\
-\x84\x9d\xeeiz\xfd4\xf8j\xa17\x0d\x5cKZj\
-1l!1\xe5\x84k\xa6\x96 \x9e7\xd8\x85uV\
-\xe6\xd5\x9b\xd7n\xfe\xdf~\xc0#\xe4y\xb0\xd3\xf1\x06\
-\xe0\xf3k\xa6\x9b\x02\xb2\xbcsV~\xc9WQ\xbb4\
-\x81\xd6\x1a\xc3\xe3R\xd7.[ \xad\xc7\x0fK\xdc\x9d\
-)\xae\xec\x22]\xb3\xf3[\x8eOF\x8d\x8dj\x0c\x19\
-b\x0c\x1b\x99~\x032\x81\x94\xb03>\x8d\xf9&m\
-\x1a\x93U0\x0d\xa6\xf2\xd0\x11*?z5\x0c\xaec\
-4P0\x84\xb5\xf0X8`u\xc4\xe3\x96^\x7fL\
-j\x17\xd6\xd5\xcc\x99Q\xbc\xf0\xf8\xeew\xb8=\xe41\
-\xf2\x05\x9d\x0e\xa6\x15\x80\x8cY\xcb\x1f\xf5\x94-\xa8\x15\
-\x97[x\xef.;'[\xe6\x94\x17H[S\xa3\xb8\
-s\x8b\xc4\x95\xc1\x8b\xb9\xa6\x15\xe1\xbd\x94\xc6Y\x0c\xd5\
-\xea(\x0c`\x86\x176\x13\x14\x1e#t|\xaa\xeb\x18\
-\xf2\xd9\xefl\x1c\xe2\xa7\xa6aT:L\xe3k\xbc\xd4\
-|\xa7\xa6gZ\xe2$\xf3H\xd2\x8bx\xb1&\x80\x10\
-,[\xba\xbavfq\xde\xfc\x93{\xdf\xdf\x86\xd8\x0b\
-z\x97`:\x01\xf0yf,|\xc0[\xbep\x09\x05\
-\x80v`2\x22K\xe6UJd|PF\x87\x87\xc5\
-\x95[..\x0f\xd5\x04\x97\xd0\x98Fd\x11\xecV\xa7\
-_\xb7\xadj`\x15g\xfd)\x1c\x1dOH2\xfe4\
-\xbd\xde\x10b>D']\xfe9{s2B\xd1c\
-\xb4\xa2K\xd7\x89g\xc1\xcd\x90\xafp\x94\xa0!\xc2Q\
-.z\xc3X\x13\xf4MDe\xc5Uk\x16\xe7\xfb\xc2\
-3Z\x0e\xef\xfc\x10\xd4.\xd8]\x82\xe9\x04\xc0\xe3)\
-\xac\xda\xe0\xad\xa8\xads\x81\xf9\xb4\x14\x82\x11L\x05\xab\
-0\x15t4\xd5K4\xe1\x16wN\x89\x82\xb3\x0d.\
-\xbaa\x83\x1a\xa3Z\x1d\x01\xbb\x91-?\xe3\x15\x1e\xfe\
-\x0c~\x9a\x9b\xc2\x10;\x8e\xf8\xb4\xe94-\x98\xa1\xcb\
-x\x07\x93U1T\x1a\xe2\xd1\x03\xa3\xc2t\xd3\x86|\
-\x15M\xbc$\x8eN\xafa!<~\xd6;\x16\x93\xd5\
-\xd7\xae_\x91\x19\x1d)l?\xb6o\x170/\xc8]\
-\x82\xe9\x04\xc0\xe5\xca(X\xe9\xad\xbaz\x9d\xaa\x88\xaa\
-\xa4[\x82\xb8\x94\xe9\xf5e\xc8\x82\xd9\xe5X\x0f\x1c\x15\
-wv!\xa6\x82\xbcdeQ\xc2\x0bnL\x831#\
-\xb6\x98\xa3\xa1U\x14\xffhL@\xe1\x98\xb0\xd3\x9d\x86\
-!v\x1a'\x1e\xb3@\xc4\xb4ttf&\x1a\xa9\xa6\
-\xc5\x9b\x22d&\x81\xca\xcfJ\x92\x06c\xf9Cx\xfc\
-\xac\x0f\x0b\xc35k6\xaerM\xf4du\x9e8\xb4\
-\x1b9\x9c\xf7c\xe4\xe9\x04\x00\xf9G\xca}\xf3\xd6<\
-l\x8f\x00\x96\x10\x0c\xfb\xa32wV\xb9x\xe3\x01\x19\
-\xec\xeb\x11\xec\x16\xc4\xe5\xe5\xbd\xce\x8b`t{\xeb\x8c\
-\xd8`\xc6\xc0\xabB\x06d\x02)a \xdb\xe1\xd3\x0c\
-\xf9\x8a\x09\x16\x1ep5O\xe8I\xc2\xb4\xdfDj\x1c\
-;\xde1\x1a(\x18\xc2Zx\xac\xf4\xf6\x90\x9f\xa4\xa7\
-\xaa\x91\x96\xaf\x951\x90,!\x18\x89\xca\xda\xb5w\xae\
-\x0e\x0f\xb6\xb8{N\x1d\xdb\x07\xf0y\xbdP2\x9d\x00\
-$\x12\xe1@\xcc7\xa7\xee\xcb._\x16\x9e\x85\xd6\xd3\
-\x80\x9a\x0a\xb03\x19\xf4G\xa4nI\x8d\xf4\xb44J\
-\x18\x8f\xe3\xb8sJ1\x14\xb2v\x17\xd0\x90\x09\xc6\xa8\
-VC\xc0\xf0!\x9dA*B\xc7\xdb\xccQ8\x9a!\
-\xba\xd1\x9d\xf1\x86P\x12F\xf4\xd3\xf6z\x83\xaeh\x1a\
-<\x02\x93\xe9\x99v\xfa|\x928.%0\x8eti\
-\x02\xc2\x99\x974\x83x\xfc\xac\x7f8\xe6Z\xbf\xfe\x9e\
-5\x13\x9d\xc7\x22\xfdm'\x0e \xe6\xbc\xdd%\x98N\
-\x00@_\xa2._v\x9d\xb7x\xee\x12=\xcf\xa14\
-d2J\x15\xc1+\x11\x12.\x8f\xd4bQ\xd8z\xfc\
-\x08\xae\x83\x14\x88+\x13\xefU2\x8ca\xea\xf3eL\
-\xa3\x92\x1e\xe9\x9b<\xacvS\x8d\xae\xe2\xac?\x85C\
-\x5c\x86al7\xad\xd7\x13\xae\xe2\xf0g\xfb\xe1e\x90\
-\x7f\xce\xde\xac\xe8\xa8\x08\x85\xab\x8a`\xd28\xf3\xb3`\
-g>\xe4[eH\xa3\xa5\xcb\xc0\xb8d\x9e\x81lt\
-\xbc\xa1\x98\xeb\xb6\x0d\xf7\xdd4p|\xf7\xe8PO\x1b\
-\x1a\xfe\xfc\xdc%8\x9d\x00Db\x13\xbd\xa3\xbe\xd9\xab\
-\x1e\xc1j\x1f\xb7\x9aX\x18-\x00tG\x03Q\xa9,\
-/\x95\x1cO\x5c\xfa\xbb\xda\xad\xa9\x80\xd7\x00\xcf\xa3a\
-\xc3\x18\xc3\xfci\xe8\xb0(\x96k\xc3\x140\x19\x9f\x84\
-\x137\xad72R\xd5\x87\x84\x92i4M\x0b\xa6p\
-\xac8\x870\xd8\xf9N\x93\x9e4u;%i\xea|\
-\x92\xe1\x94<\x98\xb7\xea\xe5\xccS\xe7kz\xbd\x09\xeb\
-x\x9d\xde\x8fg\x10\x87\x87\xe3\xee\x8dw<\xb8\xae\xb7\
-q\xd7\xf0Ho;\xdfU\xf4\x895s\xa7\x13\x80\x84\
-\xc4\x22\xfd\x12\x0d\xce\x84>`\x15{\xbfjH\xe5\xba\
-1\x02\xe0\x0dZ\x98\x0a\xaeZ4_\x06;OI0\
-\x14\x86~\x80S\xc1\xe9\xc8\xa1\xa8gj\xd80\xb44\
-\xaaa\xac\x80n#\x05\xd2qV\xbc\x93\xf9*\x0d\xe1\
-:n*C\xac4*\xde\xe01\x1b\x127\x19$\xe1\
-&3\x13\x8d\x98i\xf1T\xdb\xa4\xd0L\xa5\xa7\xd3\xa7\
-\xc2L\x19\xb5\xab\xc9\xea2\xa4\x97C\xa7\xa3pLb\
-:\x18\x19Nx\xee\xd8\xf4\xd0\xfa\xaeC[{G\x07\
-\xba\xeaQ\xa2Ot\xa1\xe4\xa38\x16\x8a\x8fv\x1d\xf7\
-\x94\xcc\xbd\x03\xda\xbfR=\x02X\x85Ai\xa2q,\
-\x15Q\xfa%5s\xa5\x03Z\xc2DF\xee'?0\
-\x02y\xdb\xb0\xd5\x8ca\xb6\xf4\x1b\x90\x09\xd056%\
->m\xc87qiLN2\xc6AG\xd1\xc3\x9f\x85\
-\xab\x8aa\xf2p\x8c\x06*_\x84S\x84\xcc\xee\xd1I\
-z:=\xe9%a6\xa3\x09\xb2\xb22\xf9\xa5\xe01\
-`\xc7\xeb\xf4\x13\x18\x09\xc6 \x04\xb7\xdf\xb9y}\xdb\
-\x81w:\xc6\x87\xfa\x1b\x11s\xce\x17J>J\x00@\
-WF\x13#m}\xbe\xaa\x95\x0f\xb8\xdc\x1e\xb7\xd1\x09\
-\x98\xf5\xc08N\xb2\xca\x8a\x0b\xa40\xc7'\xbd\xed\xa7\
-\xd4\x82\xd0\x95\xc1[c\xe7`\xd8@\xc6\xa8VC\x80\
-\xb0\xb4\x06P0\x05L\xc6\x1b<6\xe2\xd4\xdeH<\
-\x8b\x88E\xcf$\x9f\xb6\xd1\x15n2\x89\xa6=5\xbd\
-\xce+\xbd\x0c\xc4K\xc2\xcet\xa17\xb5\x1c\xc9\xfcT\
-S(\x9a\x16\x0cB7\x8e5\xc1\xe4\x88\xdb\xb7\xe9\xae\
-\x8764\xedz\xe3\x14\xae\x96\x9dD\xae\xe7$\x04\x1f\
-'\x00\xf1D$\xd8\x99\x88\x85gy\xcaj\xeaT\xa5\
-\x95\xd4cJ\xb0\x16\x85\x9c\x0a\x96\xd4\xcc\x91\xf1\x81N\
-\xf1OL@K\x88\xad\xa1\x87\x17\x9f\xce\xd0\x98\x06#\
-\xbaa\x94\xf2[m\xc9x+\xac \x16\x83TC\xdb\
-px\x00W\xa8\x86\x9eq\x09\xb5\xfd\x0a\x0d\xa8\x84\xa5\
-\xc2\xed\xbc\xad(;\x8d\x13\xcf\xa23U\xc8R\xe9i\
-\xf2\x0e\xfaV:\x93\xa7\xc9\xde\x99gz~\x0aG\x8d\
-(\xban\xc9x\x84)\x04\x98\x0e\xfc\xa3\x9e\x8c\x8dw\
-\xde\x7f\xeb\x89\x9d\xaf\x1f\x0f\x8c\x8f\x9cB\xccY\xdf*\
-\xfa8\x01\x00M\x09\xc5G:\x1b<%\xd5\x9b0\x15\
-\x94$\xa7\x02\xbd=\x8c'\x5c\x12\xc4\xd3=K\x17\xce\
-\x93\x8e\x93<0\xca\x80\x92\xa8X70S\x7f\x94a\
-\xc3\x18\xc3\x1a\xd3X\x8d\xa5\x82&^\xb9\xf8\xb3\xe2\x94\
-k\xe3N\xd3\xebU\x1c\xf1S\xd3h\x9a\xa90E\x0b\
-\x0djh\xdb\xf9\xaa\xb4I\xb8\x8eO\x1b\xf2\x11=%\
-\x0fE\xcb\x91\xce\x9e\x164\xec\xa3\x16z\x86\xd6\x19\x95\
-\x01w\x09\xc6\xf0\x9a\x9a\xf0xF\xd6\xa6M\x0f\xdc\xde\
-\xb0\xf5\xa5\xa3\xc1\xc9\xf1f\x94\x08\xfb\xb437g\x22\
-\x00\xa4\x16\x80\x10\xb8\xb2\xe6\xad\xdc\x98\x80\xf8\x99\xdeo\
-\xa6\x02\xbe\x96\xa50?Wf\x14\xe7Iw\xcbq\xb5\
- \xd4S\x01[h\x1a\xa3\x1a\xce\x82\x9b\x86f\xd0\xb4\
-\x9bI\xa6\xf0,d\xcbQ\xa9\x8c\x1fi\xe95\xccK\
-\xba\x80\xda8\x16]\x93O\x1a\x5c5:Q\x98\x84q\
-4*@7i\xcf\xb8\xd7\xab\xf4\xc9tNZ\x8a\xbe\
-\xc9\xc8A\xdbdn\xa2t\xbeVa\xd2\xf04\x0df\
-\x82\xed8\x84`\x14\x1a\xc3\xd8Df\xf6m\x1b6\xad\
-?\xfa\xfe\xaf\xf7GB\x81vD\x9d\xb1\x10|\x9c\x00\
-0\xfb\x82\x8a\x8a\xd2\x0d\xff\xf5\xcf\xbf\xf8\xdd\xd2\xb2\xf8\
-\x8c\xa3\xad\x18\xdeQ\x0a\xad%\xd4.G\x05N\x055\
-sfIdbH\xc6F\x86 \x04\x9c\x0a\xa690\
-\xb2\xea\xc5\x0a\xa8\x8a+\x0f\xfd\xba\xbdU\xe5U\x9c\xf5\
-\xe7l\x00\x1bN\xfc4\xe6\xdbq\x16!+\x9dn\xd4\
-T\x98\xdd\xc0*\xd2*\x86\xc9\xc71\x1a(<\x84\xf5\
-\x94\xc1<a\xed\x1em\x85IZ\xa5\xa5'\x09S@\
-\x15\xa1\xe3\xa7\xc7\x01>\x13\xf17%-\xa2\xec)\x80\
-\xf1,\x87\x93>\xfd.%\x04\xc38;p\x87\xf3\xf2\
-n\xbdm\xe3\xad\xf5[^\xa6\x10t\x22\xf6\x8c\x84\xe0\
-\xa3\x04\x80\x13y\xf5C_\xb8\xf9\xfb\x7f\xfb\xd3\xaf\xfe\
-Ef\xe5\xb1\xcap\xe4\xb7\xd2\xd4Z\x22\x13A\xdc\x09\
-P\x0d\x85\x12Z\x0d\xc4\xbb\x03\x13a=\x15t7\x1d\
-E\xee\x9e\xa9\x07F\xac\x801\xaa6\x08X\x95\x9aR\
-9\xabaL|\xd2\xd5\x0c\x99\x82O\x00\xad\xb3\xd1\x98\
-\x97\x82'\xf3\xd1t\x88kE\xc1M\xc24<5/\
-\x13o\xdcT\x9c\x0b\xb2\xd0\xb3\xcb\xc4<\xd3\x04\x90q\
-4\x8ez%p\xa1d\xd8\xeb\x96\x8chQ\xc1\xba\xf5\
-\x1b\xd7\x1fy\xff\x85\xdd\xd1p\xb0\x0bX\x1f\xfbv\x85\
-\xe9\x04\x80Y\x14TT\x96m\xfc\xcb\xbf\x7f\xe2\xc9/\
-\xfe~\xf5\x83\x83\xee7\xbc\xc3\xf1F\xcc\xef\x11\xbc7\
-\xb7M\x8e\x9eX\x82\x0b\xa2\xe8\xdd\xaa\x10hqNl\
-\xb0\xc1H\x5c2\xb2\xb2\xa4\xaa\xa2T\xbaO\xd5c-\
-\xc0\xbb\x03802\xbd\xca.\xb8U\x0b8\xf4\x91\x8c\
-2\xca%\x90\x96\x11N8\xc3h\x0c\x82L\x9cq\x09\
-\xb0\xfd:^\xf7\xdat8\xc3\x1a\xa6\xf24i\x9c\xf9\
-Y\xb0\xa9=.\x99Ve\xa7\x82\xfcK/\x8f\x86)\
-\x92*\x8ea\x0dK\xe2:pl\x81M\xc7\xd1\x15M\
--'\xf3\x9aJ\x8f\xa0\x04\x8e\x91\x87p\x9f +^\
-\x5cx\xe3Mk\xd7\x1ey\xff\xf9\x9d\xf1h\x94/\xac\
-\xfaH!H\x17\x00\xf6\xfa\xb9\x0f>\xfa\xb9\xef\xfd\xdd\
-\xcf\x1e\xff\x1f\xa5\x8bO\xce\xe9\x8d\xbe\x8f\xd3\x87!\x89\
-\x03\xd3\x85\x0c2\xbca\x89NNHk\xcf|\xf0\xdc\
-R\x10Q\x00\xac]\x01\xb5\x84sg\x96cS\xe2\x97\
-\x91\x01\x1e\x18\xe1\xee\x8090R\xb5a%\xb4\xb5+\
-\x87\xa0\x82\xf1\xcf\x8a\xd3a\x03\x07\x18\xc86>qh\
-\x08P\x96~m5\x88\xf0$L\xf9\x8d\x10ZIt\
-\xbc\x15H\xc1\x9d\xa6\xc7M\x93GJ\xbe\x8a\x89IZ\
-l\x8e$}\xf8\xed0\xe1\xc4\xd3N\x12G\xc3tX\
-\xe3\xa8\xfa:\xd3\x01l\xd2\x1a\xbcd]u\xfa8\xa6\
-\x82A\xac\x0b\x0a\xdc3J\xd7\xac\xb9i\xed\x91w_\
-\xc2M\xe3H\x1fR\x9e\xf6V\x91S\x00\xf2**\x8a\
-o\xff\xc1?|\xeb\x1f\x1e\xfb\xfd\xf9\x0f\x0d\xa8^\xdf\
-\x005S\x04\x22\x84FA\x03\xba\xd9\x88\x10\x82\xe2\xec\
->in.\x97\xf1\x00\xaf\x87\xa1\x94\x80\xeb5\x01\xfc\
-(\xd5\x18\xae;\xd7\xd6T\xcb@\xdbq\x89\xf2\xc0\x88\
-ZB\x8f\x95\x95\xa9+\x5ce\xe8\xb2&\xac\x95\xe5$\
-\xe1:N\xf7f\x8db\xe3X\x0d\x99\x0c\x93\x0ci8\
-\xe8\x18z\x8a\xbe\x15E\x18\xcdi\xf0\x14\xaa3\x9d\x03\
-Oy\xf5\x1f\xd2\x93\x86\xb1\xf0X~\x9d\x9e\xe1$L\
-\xc7i\x98In\xc3TY\x0c\x1d\xba\x0eA\xb7\xe3\xa6\
-\xd2S\xf9\x90\x08~NK!\x18@d\xb1of\xd9\
-\xaa\x95+\xaf?\xb6\xf5\xa5m\xb1X\xec\xb4\xd7\xcd\x8d\
-\x00d\x5c\xb36\xfb;\x7f\xf3\x8b[\x9f\xac\x5c68\
-\xb7?\xba\x0d\xb7\x0f\x86\xf4\xa6R\x95\x18\x22\x04\x19\xa2\
-\x00P\xdbKPIF\xab\x1c\xc1T\x90PS\x81\x16\
-\x02%\x0c\x10\x08>\x18\xea\xf1zeNU\x85t5\
-\x1dQ\x87E\xael\x1c\x18QPL\xa5l7\xad\x12\
-6\x9c\x15s\xe0\xab\x84\x84i\xb8\xb3\xd2\xaa\x88\xea\xcf\
-\xc4\x1b\x97\xb45}:v\x1a\x0arZ8e\x84Q\
-=/\x15G\xa7O\x85i\xda$de\xa3h\xa6\xe3\
-\x98H\x8d\x93\xcc\xd7\xc2Sy\x11\x87\xf1\x0e\xe6+Z\
-VZ8v:\x1b\xe4\xc8\xc7\xc4+\x17\xcfo`{\
-H\x8e\x97\xe7\xcc\x9dy\xd5U\xcb\xaf;\xfc\xdek[\
-\xb1&\x9c\xf6\xade\x14\x00fU\xb9\xfa\xe6\xc2\xef\x8d\
-\xf8\x8f\xd7\x8e\x07\xba$\xbb8&.\xcc)\x5c\xd8\xf1\
-g\xbfy\x13~\x0a\x01\x0e\x03%\xc3\x13\xc2\x151\xbf\
-\xb4\xf5U[\x05\xd7\xd3\x81\x9e\x0a\xa0\xa8\xc0\x0d\xa2\x8a\
-\xb2\x12\xbc\xf3-*#}\x9dj\x14pg\xe2Ir\
-\xe6F\xa3\x5c\xfc\xd1\x9db\xd9\x10\xa7i\x0cr\xc2\x81\
-O\xaffD:\x9d$\x9ef\x9e\xc1K\xc25\x9d\xd3\
-\xe5\x93\xa4\xf7\x89\x17zV\xd6&\xbf\xa9\xe5\xd5\xf5u\
-\xd6\x0bI\xa6\xd4KU]\xff\xa5\xb4\xc1\x14\xbaH\xaa\
-\x84\x00\x1d\xb1\xaa\xb0\xa6r\xe9\xe2\x9ak\x8enye\
-\x0b\xc0S\x9e9\xa0\x00\xf8\xea\xd6\xe4~\xfb\xfb\x7f\xb5\
-\xee\xdb>w\xae\x1c\xd9\xd7-\xa1\x00\xf6\xf5\xa5\x1e\xf1\
-e`\x9b\xa1\xa8\x03\x0b\x86\x8d\xad:\x0f\xa5\x16sM\
-qv\xaf4\x9d\xaa\x90\xc9P\xa1U\xd8\xe4\x9a\x00\xfa\
-\x02\xf5J\xf6\x85\xf3\xe7\xc8pw\xb3\x84\x83A\xbd5\
-\xc4\xc8\xa0\x1b\xc0\xc1\x08C\x5c\xb9h\x0c\x13\xa6\xc7X\
-zl\xbf\x86O\x19\xf2\xad\xf4\xa6\x81M[\xe9t\x8e\
-\xf4\x16\x1d[\xc8\xec\xfc\x88\x93\xc4K6\xb8\xa3\x1c*\
-\xad\xc6I\xd2OM\xe7\xccO\xe1\xd8\xbd<I;Y\
-\x17\x87\x00\x9e\xa6\x1c\xc4%\x1d\xd5\x00t\x9dV\x81U\
-\xa4\x863\xda\x0a\xc6\xf0\xee\xc2>\xec\xcc\xaa\xcbj\xe7\
-\xd6\xcc\x9d\xb5\xb4\xe1\xc370\x12\x08\x1f\xf0\xb0\xd7\x04\
-\x14\x80\x9c\xba\xf5\x9e\xef\xcc\x98\xdf\xbb|\xce\xec\xf92\
-kV\xa5\xd4\x1f\xe8\x921\xbcS\xbf\xa0\xc4-Y\xd0\
-;\x9b\xccI\x97o\xebS\xa3\x00*E8\xa7\x82\xa3\
-'\x97b\x94\x00c\x8dtX\xa7\x86\xea\xf5\xad\x98\xfb\
-\xe7VUJ\x0f\xa6\x02\xf1\xe6@\x08\xa0%t\x0e\xc1\
-\xa0\xa9*D\x07\x04U^\xcc\xc8\xaa\x84\x02\x10h`\
-\xf4*\x9b\x0aS\xf1\x0e\xbaI:&\x81E\x13A\x12\
-\xd0\xc2c\xc1\x14\x83R\xe9\x9d\xbe\xd7k\xbc\x0b\xb2\xd0\
-\xb3\xca6}]\x1d\xe5C\xb1S\xdbG\x87u\xbb0\
-\x12\xc6\xa2\x15\x85\x10\xf4\xe2\xccfQ\xe5\xd5\xe6\xba9\
-\x85\xc0\xbeiL\x01(\xbc~\x83\xef?\x95UI\xd5\
-x\xa0GJ\x8a\x8be\xc1\x82Er\xaa\xb1WzZ\
-\x03\x92W\xe0\x92\xec|\x08\x01\x1a\xd7\x88\x0d3R\xeb\
-\x01\xf0<\xd3\x13\x96\xf0\x98_\xda\xd5T\x90\x1c\x01\xcc\
-z\x80\xef\x0c(\xc5\x81Qn\xb6O\x1d\x1d\xf3\x06\x91\
-\x0b\x17\x8d4\x17\x93\x05Ma\x88*<\xe3\x1c\x95\xb6\
-`\x1ao*\x5c\xe1\x9a$\xc4\xa5\x99&=a\x04'\
-\x1b\x99\xb4\x92\xf4\x94W!8q\x141;\x8dN\x9f\
-\x9a\xce4\xb8\xa1\xafq\xac2X\xc9\x9dy\xda\xf1v\
-\xdcTz\xba\x18\xc9\xb2%\xd3[t\x89\x80\x9f\x22a\
-\xb9I\x1c\x03\xc0\x01\x01\x9eD\xee\xf3\xc7q\xb3{e\
-mY\xae\xaf\xea\xd4\x81\xad;\x90f\x9c\xe9(\x00%\
-\xd7m\xf0}\xa7\xb0\xd4]\xc2\xde=\x19\xea\x97\xcc,\
-/\xee\xa6_-=]\xc3\xd2\xd28&\xd9\x18\x05r\
-!\x088\x10d\x1ae\xd4\xe2\x1fB\xe1RSA\x8f\
-\x9e\x0a\x82\x98\x0a\xd4v\x10pk\x14H\x00q\x0cB\
-0ov\xa5\xf8\x87z$09\xae\xa7\x82\x0cKK\
-\x88J\xa8\xa2\xf2\xcf\x94Y\xf9\xf1g`\xf4*\x9b\x0a\
-\xd3\xf1&R\xe3\xd8i\x1c\xa3\x81\x82\xb1\xac\xcc\x0b\xe8\
-:L7\x95\x9e\x8eK\x85Y\x19\xab4\x0a]\xa5O\
-\xc7I\xd2\xb2\xe9;\xf1\xec)\x80Y:\xca\xa0p\xac\
-\xb4p\xec\xb2\xdb G>&^\xb9\xa9p\x95gz\
-\xbc\x093\x0f\x98H>F\x02<\x82\xb6b\xf1\x9a\xe5\
-Y\xf1@I\xfb\xb1\xdd\x1c\x09\xfcJ\x00V\xae\xf7\xfd\
-\x0e\x18\x8c\xa7?\xf5\xe4\x10\x8c\x8cB\x14\x82\xb2|i\
-\x9dL\x8e\x07\xe5\xf8\xe1!\xc1\xbd \xc9/vcu\
-\xafK\xcd\x7f\xb3+`\xc1\x8b\xbcP\x105AAD\
-\x99\xa2t\xb0T\x14\x02\xd8\x18\x0e\x8ch\xe7\xcc\xae\x92\
-\xbeSG%\x81'\x8c\xdcy\xc5\x10\x1e\x8fB\xb3+\
-\xaeH\xe3\x8fi\x95\x1f\x99X\xdet\x98\x8eO\xe2\xa9\
-FPi\x08K\xc2\x0d^2^\xd3L\xc79\xfd\x90\
-o\x95\xc1f\xe2T\xda\x8a\x16\xd1T\xfe\x96g\xda2\
-\xa4\xa5\x05\xea\x94r\x10E\xa5M\xc3U\xb4U$\x10\
-\x98\xd0J\xaa\xe0\x0c8\x01V\x18\x8e2\x16~$\xdf\
-+}x\x93\xcb\x92\xa57\xaf\xe8\xdc\xff\xd6\x89\xc0H\
-\xef\x11\x0a@\xfe\x92k=_\xcb-t\x15\xe1\xaa\x8f\
-\xa1\x8d\x0b\x9f\x93\x12\x0c\x0fJm\xedr(\x7f|R\
-\xbf\xbfW\xa2XP\x14\x14{\xc4\x8b\xc5\xa1)\xb8\xd9\
-\x15drW\x80\xe3\xe0\xf6\xdey`:\xa5\xdc\x12\x02\
-\xe5\xba\xd5\xbb~\x0b\xf2rqh\x94\x03\xfd\xc0\x09q\
-g\x15c$ph\x09U!I\x17%R~\xedN\
-i\x0c\xd6\xc8\xd1@\xc6\x9bl\x00+\xbdE\xc7\xeeq\
-*]jZ\xa6\xd1\xe9\xe9IMg\xea\x97\xa4o\x90\
-\x9dx:\x9d\xc29\xad\x80\xe8\x8c\x89\xe3\xac\x97\xb3\x0e\
-&o\x85\xa3\x0a\xe5\xcc\x83\xe9at\xa4M\xc3\x04\x93\
-4\x99\x01\xf1,\x9b\xee\xb7\xc2a\x08\xc1ps\x10X\
-\xde\xc2\xd1#o\xbe@\x01\xc8\x9a\xb3\xc8\xf3\xf9\xe22\
-\xd7,\xe2p\xcbg\x91\xc2{z\xf1\x01\x86`\x8f\xcc\
-\x9d[\x83/+\x96\xc9\xd1\xfd\xdd21\x1c\x95B,\
-\x0e3\xb3\x80\x85\x9f\x1a\x05\xd4T\x80\xf7\xc8@At\
-\xaae\x06\xce\x0a\xf4\xae\xc0(\x87\xd4\xe9!F\x82q\
-L\x05U3+p\x849$\x93\xa3\xc38+\xc0\x81\
-Q&\xae\x95\xb36\xca\xa2\x00\xcc\xdc\x04\xd3`*\xce\
-1\xb4\xabFP\xf8&A2=\xe9i\xe1\xb1`\x8a\
-A\xc4K\xe2\xe8\xf4\x0e\x98\x8d\xa3a\x94]\x8do\xe1\
-\xd8a\xc2-\x1c8I\x1c\x0b\xcf\x01S\x02\x98\x92.\
-\x99\xd6.\x8b\x021\xad#=`*^\xb9I\xb8B\
-!}\x05\xc7\x9f\x13`\xe0&N!\x11\xc7\xb2\x0c\xa3\
-\xfd\xfc\xa3x\x9fS\x9f\xdf\x1b\xdc\xf7\xcbg(\x00\xae\
-\x82b\xf7\xe7fV\xbb\xaeR\xab< \x1b!\xe0\xa2\
-/\x91\x88\xc9D\xa0W\xca\xca\xcaen\xf5\x5c9\xd5\
-\xd0'}x\x1bX~\xa1[\xb2sQ3\xfc\xd8P\
-\xe0\xaf\xea\xf9E\xdev\xa9?\xc9\xa9\x00+DU8\
-\x1dIa\xa0F1\x8cQfv\xd5l\x19l=\x86\
-\xf3\x04\x1c\x18\xe5aQ\xe8\xe3\xb4\xc1\x92hK'\xa5\
-1\xec8\x15\x93R\xe7\xd3\xe11kC\xcfN`\xc1\
-t\x9b!\xa0<\x0e<&p\xe0\xa4\xa7\xd3q:\x9d\
-\xa6a\xd22\x91\xf1\x1b\xd71\xd7\xdbq:\xad\xc9C\
-e\xa7@\xfc3\xe9\x9c\xae\x03\x9f`\xe2\xd0\xd8\xb8\x06\
-`\xc1\x9cq\xf4\xd38P4\x00\x97\x08\xdb'$r\
-\xf2\xd0`\xe8\xe8\xab?\xa1\x00\xc4q\xbf\xbf\xacf\xb9\
-\xe7\x1e\x85k-\xf5\xe90\xac\x95@X\x1c\x06\x07$\
-'7[j\x17\xd7JW\xdb\x90\xb4\x1f\x9f\xc4C\xa3\
-\x5c\x1c\xe2(\x12R\xe5\xc6\x1a\x81\x0bBN\x05a3\
-\x15\x80\xe9\xaa\xf7\xa3\xe4jJ\x80\x94@?$\xd98\
-0*)*\x92\x01\x08\x81;\xa3\x00B\x80\xe5\x07\xd3\
-#C\xd5k\x1d\xbd\x5cWVE\xa8\x02\xa9F`\xc1\
-h\xd3\xf1\x10\xb6\x87|\x15O<\xa6\xb5\xf0\xe9U\xfe\
-T\x98\xc6\xd10]\x86\xa9\xe9\x14\x0d\xfe\xf1\x07\x9b\xa4\
-\xa9aN}\x7fJ\x19l\x5cz\x1c\xe9\xe8UqV\
-z+Z\xe7cE\xaax&\xb2p\x95G\x05\x93\x00\
-\x07\x8e\x9d\xd6\xe0\x19\x9aV\x12:q<\xdc\x13\xda\x83\
-\x8b\xbc\x87_9\x18\xed<\xf83\x0a@\x220.\xa3\
-U\xf3]\x0ff\xe4\xb8\xb0\xd6\xa7\xd1\xec\xb7G\x02K\
-\x1a\x82\xe1\x1104,\x8b\x97,\x93\x89\xd1\x80\x9c<\
-2\x22>,\x0a\xf3\xb08\xf4\xe2H\x92\x82\xc05`\
-qV\xaf4\xb7\x94\xebcc\xd4R\xaf\x07\xaca\x02\
-B0\x81\xb7\x81SK\x98\x08M\xca\xc4P/\xb6\x85\
-\xa5\xe2\xc9\xa1\x96\x10\xe9M\xa1\xe9*k\xc1\xe8\xa4\xc0\
-\x92p\x83\x97\x8c\x9f\x9a\x968\x9fx\xa1wFeH\
-+\x17\x9b\xd3\xd4\x0bQ\xaa\x1c\x8a\x8e!f\xcaj\x5c\
-\x0bN\x5c\x82\x0c\x1a\xc3\xca\x1a\x80\x15&\x12\x0d\xe3\x8c\
-q\xfa\x0d\x0cn\xac7 \x81\xed'$\xd2\xbc_B\
-G^y!>\xd1\xff:\x05\x80\xe8\xa1\xf1a\xc9\xaa\
-^\xe4^\xaf\x07\x00\x82\xb4/\xe1X\x18\x02\x88\xc5\xa1\
-_\xa2\xb11YT\xbb\x14\x9d\xd6-\xf5\xfb\x06$\x0e\
-\x86\x16\x94@s\x98i\x8d\x04H^\x88\xa9@\xef\x0a\
-8\x15h=\x82Z\x13@\x00\xe2\xa8\x15\xce\x8bdv\
-\xe5l\x19n\xe7\x81QLO\x05\x99\xc4E&\xca\xe2\
-\xcfj\xb8\x94FH\xef\xf5\x0aM\x8f\x1e\xd3\xa5%L\
-\xa7\xa7\xc7\xd06\xae\x86%\xe9\x1bd\x13O\xd7\x81\x03\
-\x19N\x96\xcd\xf8-\x17\x11DM\xcdc*=\x85C\
-\xa4t\x5c$\xd5\x04\x0c\xbddP\xe1\xa6\xc73\xbd\x82\
-\xe1o:\xbf\x8eU\xff\xb1\x81\xa0\x04?l\x95\xe0\xf6\
-\x9d\x12i\xda\xcd7\xbeL\x86N\xbe\xfb\xa7\x12\x8f\xb7\
-\x18\x01@\x8fNtg\xe7\xc9\xea\xc2\x12\xd7\xec\xa4\x10\
-h*J\x1d\xac\x81\x9a`<,\x81\xd0\x00\x16\x87\xf3\
-\xa5\xb0(_\x8e\x1d\xe8\x93\x00\xf6\x98\x5c\x1cfPs\
-\x88Q\xc1\x07\x05QhlR:\xfa\xe6Y=/9\
-\x02P\x10\xb0\xa1\x90\xcc\x8cL|\x1b\xa6T\x06Z\xea\
-\x91&O\xdc\x05\xb8?\x80\xa9\xc09\xb4'\x1b\x15p\
-\xddz\xba\xc2\xac4\xc2j\xcaP~\x865\xcc\xd9\xb8\
-:=\xd3Z\xf1\x8a\x89\x0ck\x18\x8a\x92\x9a\xce\x0e'\
-ii\x1a&\xec\xa0\xa5h\xea2$\xe9\x00\x8f\xc6\xa2\
-o\xe7\xab@\xc9|\x15\x5c\xe1\xf1\x0f\xc6\x81\xaf\xbc\xa4\
-Mc\xe5\xa1\xe2MXEXq\xd3\xf9-Xl(\
-$\xc1\xdd\x1d\x12\xdc\xb6K\xc2\x8d\x1f\xe2-/x\xd5\
-\x8f\x7f(\x1al|\xf3\xbf%\xfc\xa3/\x01-l\x04\
-\x80\xd5\x8e\xf6\xb4&:\x8ag\xb8o\xcc\xc9\x93B\xf2\
-\x9b\xbd\x9f\x03\x01\xcb\xa0\xf8\xaf\xfe\xa0\x11\x84\x1b\xc7\x9d\
-\x1f\x7f\xb0_\xcagTHe\xe5L9q\xb4_\x06\
-{\xc2R\x88mbv\x1e\xd6\x05\x10\x82\xa2L\x9c\x15\
-`W\xc0\xb3\x02=\xb7#\x1b\xbdZ\x84\x8b[\xad\xf8\
-\x1cHYQ!f\x8d\xa8\x8c\xe1\xc0\xc8\x95Y\x22n\
-l\x13Y\xd9\xd4F@\x09TC\xa0 \xb6\x9b\xde\xe3\
-\x88\x93\xc4\xd3\xe9Sa*-\xff\xf0S\x8er\xa7\xc1\
-\xb12\xb7\xcb`\xf0\x90\xcc\xa4\xd5\xae\xa3\x0cv\xdcT\
-z\xc9\xb2\xa4\xa7g\xd8\x81o\x05I*\x99\x0f3\xb7\
-\x8c\xf1\xd25~F9\xfd\x08\xc6\x86\xc1\xf8\xbd\x9d\x12\
-\xdc\xb2S\xc2\xc7\xb6c\xe8'\xe3\x87%>\xdcy<\
-|\xe2\xad?\x89\x8f\xf6=\x0d4\xa5\x0ev\x0a\x80\x1b\
-\x8c\x0dt\x9d\x8aw\xe4\x15\xc9\xd5X\x97\x15\x91\xdf\xb6\
-\x10(\xe6\x03\x00\xc32S\x22\x12\x10\x83@pP\x0a\
-\x0a\xf2e\xc1\xc2\xf9\xd2\xde<$\x9d\xa7\x02\x08{$\
-\xaf\x88\xc3>\xae\x16y\xb0+h\xc2Y\x01v\x05J\
-;\x08\x01\xd0S\x01\x04\x09\x08A\xd0\x995c\x96\x8c\
-\xf7\xb6H$\x18RZB7\xd4\xc6v\x03\xa4\x0f\xf9\
-W\xe2B\x8f\x95a\x9b\x19F\xd9n*\x5c\xb5\xabj\
-`\xfe\xc1\x18\xc0tiU<q\xe8\xd1&>\x12\x96\
-\xe0\x9eN\x09l\xd9-\x11\xc5\xf8F\xc5\xf8\xcc\xd0P\
-\xcfd\xc3;\xffW\xa4}\xef\x9f\xe0\xc1_j\x00\xed\
-w\x0d\x18\x01 \x05\x8e\x02\x98\x16d\xa2\xb3)\xd1\xee\
-\xf5\xb9\xe7\xe3y \x5c\xed\xb1z?=\x96\xe1\x97=\
-T\xbe\x14\x02x\xb88\xa4rh1v\x08\xc3\x03\x93\
-r\xaa~L\xb2p&]\x80\x13\xc5L\x1f\x0a\xc5\xa9\
-\xa0\xbfZ\xf7~3\x02@\xadL\x81\x88\x82\x92\x1b\x8a\
-\xa6\xf2\xd2r\x19j\xc5\xe3n\xae,q\x17\xe2\xf6\xb9\
-\xda\x1a\x8283\xb2\xad\xa3\xc79`\xc9x\xa0*\x81\
-q\xa4c\xadT/\xd3t\x92C\xb5\x03G\xd1bX\
-\xc3T\xbb\xa7\xc1\x92y\xb0\x0c\x1a\xcf\x86\xb1]\xd2`\
-*\xa8\xff\x10\xa7\xf3N\xbaLo\xd10ISp\xac\
-xE\x97\x7f\x96!\x8e1\x0e\xbfb<z|`\x0b\
-\x86z2\xbe\xafA\xe2\x93#\xb2tv\xa1\xfc\xee]\
-u2p\xe4\x9d\xbf\xedhj\xf8k$\xe5\xed\xa0\x94\
-\xcb\xa2\x14\x00\x1a\x92\x03;\x95\x89a$\x18\xefi\x8b\
-\xb7\x06\x03\xae\xd2\xf2*\xd7l\x16\x87\x91\x06\x89\xaeS\
-\x08\x98*\x1c\x9d\x80\xe2h\x12\x8b\xc3EjQ\xd8x\
-\x087\x83QI\x1e+\x17\xe7bW\xd0\xc6\xa9\x00s\
-<+\xaeF\x01dMa\x80\xf5\x83XQn>\x84\
-\xc5#\xa3=-\xb8GX,\x9e\xc2T-!\xd31\
-\xe9\xb4\x8d\x088\xe3\xa60F\xe13\xc2\xc43\xbd\x09\
-\xa4\xd3\xb2\xa2\x94\xc0\x18<'\x0e\xfc \x94Z\x06\x83\
-\xa7\xf30eS8*\xd3\xf4\xf4\x16>\x1c\x85\xeb\x08\
-\x9a\xb0\xce\xc0\x8a\x07Ye\xe8N\xe3\x8f\x8f\xe1\xfbJ\
-{\xbb$\xf0\xc1n\x09\xd7s\xa8'\xe3\x87e\xd1\xac\
-|\xf9\xce\xdd\xd7\xc8\xa3\xeb\x96Ji~V\xe2G?\
-\xfa\xd1\x7f\x0f\x85B\x0d\xa0bx\xac\xe9\xe2\x1f\xcbn\
-e\x18A\xc9\xe0\xd3\xa6\x9c\x1b\x98]\xac\xe9p,\xe0\
-\x1f\x8f\x0f\xaf\xb9\xd3{g6.\xf9\xa8\xb9\x9f\x98`\
-X\x02\xaf\x89a\xd8i\xc7\x12\xa3\xd8!4\xc8\xa2\xe5\
-\x0bp\x8a\x98%\xfbv\x9d\x92I\xbc\xea\xa4d\xa6W\
-6\xae~K~\xf1\xde,\xc4C\xff\x1f\xf5\xe2:3\
-\xb2\x8e@\x08p\x1e@\xdb\xe3\x9f\x94\xd93\xabet\
-\xb0W\x02\xdd|\x19U\xaex*\xa0\x1f@k\xaa\xba\
-\x9bF0\x01GX\x83\xf0\xef\x80\xa9\x80\x15\xd6\x0ca\
-\xad\x1c8\x08j|\x22\xe9(g\xd8\xa6\xa5\x22\x19\xaf\
-\xf1R\xe1\x16=\x0bG\xd3\x99\x0aSit\xa4\xce\x13\
-~C\x8e\xe0\x94|MXEXqi~2>T\
-\xdf\x03\xa67\xa0\xb7\xe3\xb2\xeex\x9f$\x22!\xa9\x9d\
-],\x0f\xae\xb9F\xea\x16T\x80/\x09\xc9\xc8\xc8\x90\
-\x9e\x81\xa1\xe1\xb1\xb1\xb1AC\x22\xdd5#\x80\x81\xf3\
-\x06)-\x1f1\xe2\xb3f\xe3\x13#P\xef\xb7K\xac\
-b\x8e\xd4z\xbd./\x19\xaeJO\x0f\xea\x9a\xbeM\
-\x8c%\xa2xZxH***dVe\x99\x9c\xa8\
-\x1f\x94q\xa8\x8fK\xca\xa2\xd08\xf9\xa5cp\xbeN\
-\xcfQ\x00\x8c7\xeb\x82\x18\xc7f,\x0cKK+d\
-\xa4\xb5\x1e2\xe6\x15OA\xa9\xb83QD\xe4c7\
-\x92\x83\x89\xca\xab\xff\x1c8\xc0%\xb2\x95F5\xf4t\
-8\x16\xccD\xd9\xf4\xad\xe4&=\xeb:ud!\xfd\
-d\x1e*;\x05J\x859i\xd8\xf8,\x1d\xd0\x94\xa1\
-\xab\xac\x01XaF\x9a8\xfai\x10\x8e\x8f\xa3\xc7C\
-\x1d\x1f\xf8`\xaf\x84\x8f\xa2\xc7\xf7\xa0\x9d&\x87\xa4\xa6\
-\x22O~\xe7\xae\x15\xf2\xd8-KeFQ\x0e\xa6\xdf\
-,\xc9\xcf\xcf\x97\x5ct\xa2=\xdey\xd9{\xba\xa3\xd9\
-\x91\xe6\xbd\xdb@\xc5\x9e\xfb\x15M\xfc\xa5\x0b\x00\xe1\xaa\
-\x8f\xc35B\xe0\x0fN&\xba\xba\x9ae\xb2\xbcJ\x96\
-dd\xba2\x88\xe1\xdc\x1a2\x81.\xb1\xf2 .\x81\
-\xd7\xcb\x8dHaa\xbeT\xcf\x9f)\x1d\xcd#2\x80\
-\x1d\xc2\xcc\xb2~\xe9\x1c\x98%\x810v\x05\xd6\xf0o\
-\xa6\x01\x86\x03\xa8d~\xa6\xae\xc0X\xe7Il\x0d\x0b\
-\xc5]\x02\x5cn\x0d\xa7i\xf0t\x98\x0e\x13\xd7B\x87\
-k\xb7\xb6\xf2\x9bb&q\xec\x866\xf4\xed)\x80I\
-O3\xe4\xb3\x9a\x86\x9e\x9d\x85\xa6\xa9\xe0&^\xb9\xa9\
-\xf0\x14\xe6\x9bx\x83O\x9a\xc6oyIOi\xef\x0e\
-\xe2(\xfd\xfd}`\xfc6\x8b\xf1\x832\xa7$[\xbe\
-y\xc7U\xf2\xf8\x86\xabdFa\x8e\xea\xf1\x05\x05\x05\
-8\xbe\xd7\x0f\xe8F\xa3Qye\xa4Xzf\xac[\
-\x11i9<\x1a\x1bl\xe6{\x86R\x9e\x1f<\x9d\x00\
-\xa4\x0bA \x1cJt\xb7\x1f\x8f\x0f\x14\x96\xb9\x16A\
-_\x90\xcb\xd5\x9f\xf3\xba\x18\x13\xd0\xb2\x0e\x84S\x08\x02\
-\xe1Q\x14\xc6'\x0b\x17\xcd\xc1\xd3B~\xa8\x90\xfdR\
-\x9e\xdb\x8e/\x81.Gr*}\x90\xbd%\x08z$\
-\xf0\x08\xcf\xa9J\xd1\xf3\xf9\x84Qpt\x08[Ch\
-\x09\x0b\xb85\xb4\x88\xc3=\xeb\x85\x9e\xcdT&\xa6\xd5\
-\x8e\xa6\x99\x84\xa90\xb2!\xce\x94^o\xc1S\xca\xa1\
-\x92N\x97\x9e\xc80V^\xb6\x17\xa8\xc9\xf4V:\x15\
-\xc9?\xcb\x10\xc72q\xbc\x9d=t\x18S\x22\x18\x1f\
-:\xb2M\xa2\xddG\xd1\xe3\x07evI\x96|}\xc3\
-r\xf9\xc6\xc6\xabeVq\xaedffb\xe7U \
-99h'\x18\xbct\xda\x1e\x05\x9el\xcb\x11L\xe3\
-\xe2-]\xb48\xb0\xfbY~\xb4jX!Y\x7f\xd3\
-\x09\x00\xa3\x0c?9\x1dpm\xc0\xe9 \x18\x8bI\x7f\
-\xfb\x89xGv\x9e\xab\x06:\x9bb\x8d\xe4(1\x13\
-\x02H\x08\xe3hx\xac\xecrG\xa5fQ5V\x92\
-1\xe9n\x1e\xc4+g\x032\x1c\xa9\xb1\x87\x7f\xe7h\
-\x10W\x02\x81\xa9\xa0d\xa6\x8cu`~\x8bb\x97\x00\
-\x81pec\x1b\xa9\xda\x8c\x7f \x9cb5L\xc73\
-\x8ea\x0dK\xe29pR\x04b*-&U\xe9\xe0\
-\xe8\xf4S\xe9)\x1cF\x1a\xdc\x14\xd7\x81O\x12\x8c\xa3\
-\xb1]\xcbC\xc7\x86%\xfd\x09\xea\xeb\x0fC\xb9\xf6\x01\
-\x18\x7f\x18\x8c\xef\x02\xe3'\x06\xa4\xaa(S\xbeq\xfb\
-U\x8a\xf1\x95%\xb9v\x8f7\x8c\xc7\xf5o\xd5\xfb\xf3\
-\xf2\xf2pxW\x86%\x7f\xae<\xdd\x88\xcd:^>\
-\xe9\xca,.\x08\xed\xff\xf9\x1b\x89\x90\xff$\x8bb\x8c\
-Y\x04\x9a\xb0\xd3%\x0f\xc9|\xbe\x81\x82~%\x0c\x10\
-\xae\xf0\xee\xb7b\x13\x93\xa3\x89'\x96\xdf\xe0\xa9\x93\x04\
-\xbe\xe0\xcd\xd1\x00\x18\xf0j\x17\xfeL\xa6\xa0\xc5\x1f\x17\
-\x87\x11\xbc{xi]\x15\x94D\x99\x12\xfb\xcd!\xe9\
-\xee^,AO\xad^\x08b\xeeW\x8f\x94cq(\
-\xb0\xa3X\x1cfe\xe6I\xc5\x82\xab\xa4\xf3\xc4\x11\x89\
-\xe2\x1eaF^\x0d\xaf\x22'\x1b\x9c\xa4\x1dLN6\
-2ZtJ\xc3\xeaVV8*N\x87\xd3\xf1.\xf5\
-B\x8fC}\xb8a\x00\xc3|\x83D{!\xfc\xa3\xdd\
-X\xdc\x05\x84\xcc\xe6\xe2\xee\xc6eU\xaa\x81}>\x9f\
-\xea\xedt\xd9\xdb\xc9x\xce\xfb\x1c\xfa9\xf7\xd3LN\
-N\xca\xd6\x1e,\xb6Ch3\xa8\xda\xd5\xb6-\xa3\x00\
-\xe7\xf4\x03\xac\xbc\xe2\x0c\xf1>J\x00\x18OD\x0a\x81\
-a\xa7=\x22\xd4\xef\x8e\xfb'\xc7\x12_\xb9n\x83\xf7\
-\x160\xdf\xe5d>\x85\x81\xdbD%\x14H\x9aPB\
-\x12\xc06\xb1U\xaa\xe6U\xc9\x9d\x9b\x17J\xe2\xd57\
-eK\xd7l\x8c\x06zG@W\xa2(l\x04.\x16\
-\x87\x03\x9e\xa0\xcc*,\xc56\xb2\x5c\xc6z\x1a\xc5\x95\
-_$\x19\x0b\xa0\x96P\x0cd\xd1\xe0\xb1\xfc\x9a\xb1\x0c\
-h\xb0\x81\x1b\x9c\xa4p0~z<[8l\x1ai\
-xvR\xc0\x19eE']\x07\xbe\x8d\xeb\xc43\x09\
-\x9c0\xf8a\x12\xf8jj\xa8\x11\x8c?\x02\xc6\xf7`\
-+g1\xbe\x02\x0b\xba\x87n\x5c!\x9f[>[5\
-f\x06\x18\xce\x85\x9d\x977\xaba8\xc7\x93\xe9d>\
-\xa7\x00\x0a0\x19\xcf\xf8\xee\x81a\xf9US\xa9\xc4\xa1\
-iK\xe0v.^\xfe\x9d\x88\x8dt\xb71;\x95\xd8\
-\xfa\xfb8\x01 \x1a\x13\x90\xf1\x9c\x06\x8c\x9fB\x11m\
-mL\x04\x03\xfe\xe8\xd8M\x9b\xbcw\xe7\xe4\x8b\xda!\
-(\xa6\xe3\x8f\xdbD\x9d\x15%\x81\x02\x11\x07\x91\x08^\
--\xd3&\x05\xe5\xb3d\xd3\xdd3\xc4\xff\xd6N\xd9\xdd\
-v\x8b\xda\x0d$l\xe6c\xa8\x87?\x8am\xe2\x88\x1b\
-o\xae\xaf^\x22\xfe\x83\x18\x06;O\x88\x07\xf3\x9d\xa7\
-\x1c\x1f\x197mMWY\x030a\xb8\x8c\xe0O\xc5\
-3\x0c\xc3@JX\x01\x938\x8cS \xcb\xe3\xc0U\
-t,\x9a\x8a\x86\xc2\xd3\xe86]GPy\xa7\xa3g\
-\xe1\x90F\x02g\xe3\xe1\xc6A\x09\x1d\xc5\x81X7\x19\
-\xdf)\x09\xec\x94\xb0w\x97\xcd\xeb\x97\xcb\xfa\x15sU\
-V\xe9\x8c7C\xbd\x99\xfb=\xe80\x138\x82wc\
-\xfa\x1c\x1a\x1a\x96\x97\x9b'\xe4\xc5\x91\x0a\x19\xc2k%\
-\x13\xa1\xa8$\xa0r\x0f\x1f\xfcu\x9bD\x03\x1d\xc8\x9e\
-<\xb4\xcd\xe9\xd6\x006B\x9a\x87\x82`\x8f\x02\xf0O\
-L\x8eI{O\xbb\x84g\xcc\x96\xc58\x12\xd6\xdbD\
-U;\xe4\xc3J\x02\x89;y\xba&\xe7H|\x02C\
-X\x06\xee\xab\xc7\xe4Xk\xb1L\x84\xf0A\x0al\x03\
-\xf5B\x10\x82\x83\xc5!\xfd\x11\xac\xfe3\xf0\x88y\x1e\
-t\xd3c\xed\xc7@ G<e\xb8K\x88\x87V\xa6\
-h\xf4\x90\x8c\xf9if\xc0\xc3\x9f\x0a\xa7\xc2\x14\x0e@\
-\x8cT\xab|;\x1d\x810N!\xb1h\xe8\x05\xa1\xa6\
-\x99L\xaf\xd1m|\x93\xd4\xce\xd3\x09\xa0\xdf\xc2\x87\x93\
-\x08\x81\xf1\xc7\x06\xc5\xff\xfe\x01\x09\x1d\xa2p\x1fT{\
-\xf9R\x5c\xe1~l]\xad\xfc\xee\xdduR3\xb3\x10\
-\x87e\x19jH\xe7\x1cO\xe6r\xb8\xe7\xde\x9e\xc3|\
-\x11\xeeS\x10\x1e\x08\x04\xd4H084$?\xdb\xd7\
-.\xff\xb3\xad@v\xf8g\x8a\x7f\x12z\x1a\x8c,\x09\
-\xbc\xd7/z\x0aOz}\xf0\xe4\xb3\x89\xc0\xc8\x8b\xc8\
-\x9e\x1d\xd96g+\x00\x86\x8fj\x04\x00\x15\x12\xf3\x07\
-\xfd\x89\xae\x8e\x93\xf1\x91\x92\x0a\xd7\xe2\xac\x1cW\x16G\
-\x01Uc\xb8d>%\xc6\xd4\x9f\xbb\x03\x9a\x18.\x9d\
-z3\xe22+wR\xf67a*0;\x02\x8b\xf9\
-fa\x18\x86\xca8\x9f/\xa0\xc2\xf5\xb4\xc0`'v\
-\x0d%\xe2-\xa3\x96\x90\x82\xe2`\x8ajx\x1dV`\
-\x9b\xb1\xe98,\x0c\x99O\x97%\x81Q~\xe2\xd1\x9a\
-\xb0\x0e*\x80\x03\x96\x8cw\xe03\x09qhl\xd7\xf2\
-\xd0\xb1\xbc\x890\x18\xdf0\x88U\xfdA\x09\x1e\xdc*\
-\xd1\x8eC`|\x0f>\xc0\xe8\x02\xe3\x17C{W'\
-\x0bf\x16aU\xaf\x99\xcc\xe1\x9d\xc3\xb9\x99\xe39\xfc\
-\x17\xe3\xda>]\xbf\xdf\xaf\x04\x02J\x1e\xf9\xf9\x9e&\
-\xf9\xeb\x96<\xd9\x19\x9a-\x93\x01\xac\x0b\xb0{\xa0\x90\
-\xc5\x07Zp6\xf0\x0b\x8c0\xaf\xd5c\x07\xf1]\x94\
-\x84O\x0b\xa7\x98\xb3\x15\x00&\xd6\x1cL\x1d\x09\x02\xd1\
-\x88\xf4\xb5\x9f\x8cw\xe7\x15\xe2s\xb9\x05\x02\x15\x1e\x8d\
-\xee\xf9\xf4i\xa1\xa0O'\xa4\x9a\x18\x03\x13*8&\
-n,\xfaZ\xfag\x02\x1d\x5c\x03c5\xf3\xf5(\xc0\
-]A\x1cC\x5cQ~\xb9\xf8\xfb[\xf1\xe6\xba v\
-\x04eP\x15\xe3\xbd\x846\x93A\xd4b\x9eb\x84\x93\
-\x09\x86\x01\x96\xabz}\x1a\xcc\xe6\x9e\x81+r\x08X\
-4\x0d\x03\x93.\xe3\x88d\xa1\xd0Oc\xbb\x96\xc7r\
-T\x8f?>\x04\xc6\x1f\x92\xe0\x01\xf4\xf8\x0e\xf4\xf8\xb1\
-^<j\xef\x92G\xd6\xd6\xcaw\xeeY)\x0bga\
-\x8d\x83\xab\xf2F\x81C\xc6;{<>\xdb\xa7\x18\x1f\
-D\xfd9\xf7s\xae\x7fn_\x93\xfc\xf0\x84O>\x08\
-\xcd\x95I\x7f\x06\x18\x1fQ\xd3Jb\xb0]B\x07^\
-\xc0\x0e\xe2\xd5p\xac}\xdf\xf3\x91\xaeC\x7f\x88\xd2\xf1\
-mb\xec\x8b)\xe6L\xd6\x00)\x09\xac\x00\x09Q\x10\
-\x8cU\xd3\x02\x16\xfa\xa1\xed\xaf\xc5\xc6\xebnv}\xab\
-\xb6N\x16S\x1dI\xc6'\xa8:\x8e\x83\x91\xf4[\x96\
-[\x06\x1c8\xe1\x9d\x03!Y6\x7f\x874tV\xe0\
-\xfb9\xf3\xd5B0\xa1\x16\x82(\x1a5\x85X\x0b\xf8\
-\xbd8T\xc2N\xa1|\xc1\x0a\xe9:\xba\x0bCZ\x91\
-x\x8a\x96\xe3\xd0\x88\xef)F+\xf3g5\xb6b\x82\
-\x09\x10f,<\xa9\xc2\xc18+\x91\x8dc@\x008\
-`\xca\x0f\xf4\x14|GpJ\xbc\xc2E]q\x096\
-|b\x08\x8b;\xcc\xf1]P\xdb\x8et\xa89\xbe\x00\
-[\xda\x07\xd6/\x96\x0du\xf3\xc4\x8bi\xce\xb9\xaa\xe7\
-Poz\xbc\x11\x06\x0e\xfb\x9c\xe3\x09\xa7\x00\xbcv\xb0\
-I\x9e\x1b,\x92\x0e|]&\xcea>\x04\x0d>.\
-\xe5\xc4\xc7\xfa\xb1\xa6x\x17\xeb\x89C\xb1\xd8P\xfb;\
-\xd1\xbe\x93\x7f#\xb1\x10\x1f\x02\x19\x81\x9d\xc2|\x16\xf3\
-\x5c\x05\x80i\xc9|N\x05<?\xa0\x9f\x19(\xed\xe1\
-\x81-\xd1\xc9\xc91\xcf\xd7 \x087\x00\x06\xc6s\x9b\
-\x88E\xa0r\xcd\x19\x02\xdeE\x899\x8d<\xf0\xe5D\
-\xe5\xa6%\xaf\xcb\xcb\xfb\x1e\xc7\xfb)\xb1\x08\xe49\x01\
-\x17\x85\xd6\xb6\x90\xfeQ\xa8\x84\xcb\xb2s\xa5\xa8j\xbe\
-\x0c\xe3\x1bF\xae\x93%\x92Y\x87E\x12\xee\x1d\xa42\
-v:\xe69p\xc8X\x9asa\xbeI\xebH>\x85\
-\xf9\xc0Q\x8co\x02\xe3\x0f\xe3\xfaU\x17.\xbf\x0ek\
-\xc6\x17\xe6x\xe5\xee\x1b\x16\xc9\xc6\x95\xf3$\x03\x07_\
-\xe9\x8cg\x8f'\x8c\x8c\xe7\xfcN\xc6s\x8e'\xe3\xd9\
-\xeb_\xde\xd3 \xcf\xf5\xe5H\xab\xc5\xf8\xb8\xc5\xf8\x04\
-\x94f\xe1\x13\x1fH\xa4\xe3@<6\xdc\xb1#:p\
-\xe2o%\x1cx\x17\xc5\xe4\x19\x00ytZ\xf3I\x04\
-\x80D\x0d\xe3\xa9+\xa0\x00\x18\x1b9q0\xe6\x9f\x9c\
-\x88\x8f\xac\xd9\xe8\xdd\x98\x95p\xe3\xae\x01?;\xc7\x11\
-\x81(\x14\x08,\xf0\x90\xda\x8d\xa3\x7f\xde',/\x1b\
-\x97k\xe6\xbc/{;\xee\xc4\xc2\x05\xccG\xef\xc7S\
-(\xb6\x8dcH\x1c\xe3TP1O\x02#\xfd\x12\xea\
-l\xc0(P \x19\x8bJ\xac\xdejq\x87\x8e\xb1\xf0\
-\xa4\x0a\x07\xe2h\x08\xb4\xd0\xe9jYH\x85%\xe3-\
-D\xe3X\xee\x94x\x90\xe5v+|rX1>\x0a\
-\xc6\x83\x19\x10\x86I\xc9\xc3+\xdd\xeeY\xbbP\xee\x5c\
-5\x7f\x0a\xe3\xb9\x82'\x83\xc9xn\xe7\xc8x\xae\xee\
-9\xc7\xe3\x04O\xc5\xbd\xb9\xbfA~\xd1\x9d)\xa7d\
-\x9e\xea\xf1\x8a\xf1x\x1b\x0b/s\x86On\x95H\xfb\
->\x0a\xd9\x91H\xdf\xc9'\xa1B\xfd\x0d\x8a\xc2\xd7\xc3\
-\x9c\xd1\x1bD?\xa9\x00 \x1f[\x08\xd8\xfb\xb1\xf1\xb0\
-G\x86hWS\x22\xf4\xc1dl\xec\xa6{e3n\
-\x0f\xfb\xb4\xc2\x08\x5c\xe7\x0f\x82\xc0\xb0\x0f\x96O\x1be\
-`!\xb4\xbc\xfa\x88\xb4\x0e.\x96\xc1\xf0B\xbb\xf7\xf3\
-\xe4\x90#\x00\xa7\x85 \x1a+\x80\xe9\xa0\xa4f\x85\xf4\
-\x1c\xd9!\x91\x96&\xec\x0a\xb03(\xe5\xb3\x86,\x0a\
-\x0c]\xe5\x9f\x86\xf9\xe7\xd2\xeb\x0dM\x92u\xe6\xa1\xe0\
-\x1a@\xc6G\x9aG\xc1\xf8\x93\xe8\x85\xf5`|;\x86\
-\xe5\x09\xc9\xc6\xcb\x1a\xee\xbe\xb1F\xeeZ]#Y\x19\
-^\xc5d.\xec\xc8l\xb3\xb8\xa3K\xcd\x9d\xd9\xcf\x1b\
-\xc6s\xad\xf2\xde\xfe\xa3\xf2l\x9bK\x8e%\xe6\x82\xf1\
-h/\x08\x04W\xf5\x89pP\x22\xa7p\xbf\xafe\x17\
-\x86\xfd\xae\x9eh\xdf\x89\xe7\xe2\x81\x91\xe7Q$\xbe:\
-\x96\xaa\xde\x94\x95>\x8bz:s.\x8b\xc0\xd3\xd1\x22\
-\xdc\x8c\x00j*@x\xd2?\x91\xe8\xe0ARi\xa5\
-k1\xae\x00\xb2\xd3+\xa3\x84\x81\xed\x07\x00\x1bVm\
-\xeb\x10,\xf0u\xc8\xa9\xbee\x00\xeb\x1bDj\xb5\xaf\
-4\x85zq\x18A\xa3f\x09\x08\xe1\xe3\x15\x93\xdd'\
-\x91c\x81xgbk\x08!2\xcc\xbfX\x0b=\xc5\
-\xf8\xa6\x11\x5c\xc48*\xa1\xfd\xdb$\xd2\xb6\x1f{y\
-\xbc_\x01\xaa\xef{W\xcf\x93?\xb8o\xa5\xac\x98?\
-\x03\xd7\xe03\xd5\x02\xce\x0c\xeb,\x1f\x85\x80\x8c\xa7\xe5\
-\x90\x1f\x89\xe0M,jJt\xc9\x96\x83\xc7\xe4\xafv\
-\xf6\xc8\xcf\x87fIO \x07j`,\xee\xf0\xea\x9d\
-D\xc0\x0f\xc6\x7f\x88\x05\xde\x8bR\x10\xde'\xde\x91}\
-\x07\xc6[\x9a\x9eLD\x83o\xa2\xe9\x9aa\xf9\xe87\
-\x99o\x9a\x19\xde\x8f6\xe7[\x00\x981-\x05\x81s\
-\x0f\x87\xa1@8\x88\x83\xa4\x13\xf1\xbe\xc2r\xd7\xe2\xec\
-\x5cW.\x0f\x8b\xb8?\xe0\x82\xd0t+\xcd44\x8c\
-;\x88\xa14(=c\xf3\xb5TpW\xa0n\x0fq\
-J\xa0\x10@I\x84\xde\x94\xef+\xc0h7\x88'\x93\
-!\xf0^l\x0dgPA\xc4^\x9f\x14\x04-\x10\x0c\
-[0k\xd7\xa0\x82\x06\x86(#8S\xf0\x93\xc5s\
-\xe0\xa0\xe4\xa8]\xe4\xd4(\xee\xdc\x1d\x95\xe0>0\xbe\
-\x15C\xf0H'\x043\x22w\xaf\xae\x96\xff\x05\x8c\xaf\
-\xab\xa9\xc0\x13\xd1Y\x8a\xc1fX\x0795\xafs\x1b\
-g\x18\xcf\xb9\x9d\x8c\xe7\xe2o\x174\x81\x7f\xb9\xbdS\
-\x9e\x1d,\x97N\x7f\xae\xc4\xb0\x9d\x132>\x88\x17\xf5\
-\xb4\xe0\x5c\xe0\xe0\x0bR\xe69(\xcb\xaa\x0famq\
-|wG\xa3\xffi\x90\xdc\x0f\xcb!\x9f\xcc\xe7w\x04\
-\xd8\xee\x97L\x00\x90\xb7\xca\xdc)\x04\x94\xc8`,\x8a\
-\x83\xa4\x93\xf1N\xac\xe3j\x0a\x8a]\xb8o\xc8\x96\x87\
-QB\xc0\xf6\xd5\xcc\xe3HP\x80\xcb\xa4\xbd\xc3Pf\
-D\xf1\x0e\x22\x0a\x00\xac\xd3\x8d\xe3\x95h\x14\x84|\xbc\
-{\xc8\xdf}\x5c\xe2!\xdcV)\xc4\xd60\x1f\xbb\x82\
-\x14\x86Zy\x18\x18\xb2#\xdf\x15\x92\x03f\x8ab\x0b\
-\x8aIf\xb9&\x1egYj\xa8\x0fn\xa9O2\x9e\
-=\xde\x15\x95\xbb\xaf\xad\x96\xdf\x03\xe3W-\x9c\xa9\x18\
-O&\xa7\xf7x'\xe39\xef\x93\xf1\x5c\x03\xec\xado\
-\x94\x1fnk\x95\xa7z\x8a\xa5\x9d\x8c\xc7\x17\xd9\x15\xe3\
-C\xd0\x9c\xb6c\xebx\xe8e)u\x1d\x90\x876\x9f\
-\x90\xb9\xa5\x0d\x89\x03\xef\x8emk>\x16{\x06\x159\
-\x04K\xe6s\xd8\xe7\xf4\xcb\x91\xf7\x8c\x99\x0f\xdcO\xb4\
-\x0b`\xfa\xd3\x19\x16\xc2\x8c\x00F\x18\xa2\xf1\xa8Dv\
-\xbf\x19\x1b\xf7\x8f'\xbe\xb9\xf4z\xef\x0a}\xabH\x8f\
-\x04q\xec\x111E\xa8\xa9 \x03\xcf\x88\x5c7\xef\xb7\
-\xf2fc\xa5\xda\x15\xa8\xdbC\x98+]X\x1c*?\
-\xb7\x86XXeD}R\x5c\xbdL\x06\x9a\xeb\xa1Y\
-\xc35\xb2b|\xe8\x0c\xda4eL\x0fg\x00\x8cL\
-a\xbc\x053\x8c\xb5\x22\x15\x9e\x8aJc<\x1em\x96\
-p\xeb\x18\xe6\xf8&\xcc\xf1X\xdc\x0d\xb5\xaa9\x9ew\
-Un\xbfv\x8e\xdc{\xdd\x02\xc9\xcf\xc9T\xf3\xba\x99\
-\xe39\xc4\x93\xc1\x5c\xc9sQGK\x81\xe06.\x1c\
-\x0e+\xf8\xfe\xa3\xc7\xe4\xa7\xf5#\xb23X\x8eK4\
-X\xc7@m+\xf86S\x02\x877\xd1^\xec N\
-\xed\x90\x82\xac>\xf9\xfcc\x9dr\xed\xca~\xd9\xf1\x9b\
-\xc9\xd8[\xbf\x0a\xbd\xdd\xdb\x96\xe0\xb1.\xe7\xfbnX\
-2\xdf\x0f\xcb\x8e\xc6\x91\xf7\xb2\x10\x00\x94C\x15\xc4\x0c\
-GF\x08\x18\x8e\x1c\xfd0\x1e\xc0U\xb1\xaf\xac\xbaU\
-n\xc6Z\xc0\xa5u\x03\x5c\x14\xba\xd5ki\xd0)\xa4\
- oB\x96\xcfxO\x0e\xf6\xdf\x85\x14\x00@\x00\x12\
-\x88P[D,\x04yv0\x0ef\x17\xc6\xca$\xb7\
-\x98#A\xa3\x84 \x04Y\xab*1Z\x90\xe3\xc8\xc9\
-bd\x0a\xf3\xd3\x99\xab#\xd3p\xad\xb4\x86\xf1GN\
-a\xa5\x8d\xc5\x9d\xc5x\xc8\x9e\xdc\xbar\xb6\xdcs]\
-\x8d\x14\xe5\xe9E\x1d\x19LfsQGC\x010\x8c\
-\xa7P\x90\xe9\x9c\xe7\x89s\xb8\xe1\xb8<{t@\xb6\
-L\x14c~,\xe3\xf8\x88\xfa`\x9e\xc7b2\xd6\x8f\
-\xbc\xb0\xb8\xcbqw\xcb]\xf7u\xcb-\xeb\xfbp[\
-:*\x1f\xbc\xe8\x8f\xbe\xfd\xab\xf0k\x83=\x89\x17@\
-\x9e\xf7\xfb\xa8\xd5\x1b\x81e\xcf?'\xe6#\xdd\x05\x1b\
-\x01H\x9b\xc60\xde,L\xcc\xda \xd2R\x1f\xf3\xf3\
-\xbe\xe1\x8dw\xfb\xee\x81\x00x\xb5\x92\x08\xba\x02(\x8c\
-\xf8\x86Y\x0f\x14$\x0bf\x1c\x96\x8e\xd1\xc52\x14\xad\
-E\x15-\x01\xa0 \xc0\xcf-\x22\x0f\x8c\x02\xd9\x19R\
-0{\x09\xee\xc8aW\xd0\xda\x88]A\x9e\xf8\xe6\x17\
-:\x18j\x09\x03K3\x1d\xf3S\x84\x84H0(\x8c\
-\xea\xf1G\x9b\xb1\xb03\x8c\x1f\x97\x0cwB\xd6_3\
-[\xee\xbb~\x81\x14\xe7k5-\xb7nd*\x19n\
-\xee\xe1\xa53\x9e\xf3<a\xc7\x8e\x9f\x90\x9f\x1d\xec\x92\
-\xf7\xc6\x8apc\x0a\xdbW<\x1e\xc5\xbb|\x09\x08\x1a\
-\x147\x98^vJf\xacK6\xdd\xd9#\xeb\xd6\xf7\
-JnV\x0cOQ\xc7\xe5\xfd\x17'C\xef\xfe:\xfa\
-\xe2\xe8@\xe2\x15\x94\xee8l/\xaca>\x87\xfd\xb3\
-\xee\xf9H\xa3\x8c\x16W\x13\xba0n\xba\x10\x98p\xac\
-\xaf=\x11~\xff\xb9\xe8\xf8\x8d\xf7y\x1e\xc6\xa3e8\
-CH\xe0\x1e\x81V\x18q-@AXY\xf5\xba\xbc\
-\xd7\xcc\xa9\x80\xa3\x80\xde\x0er\x14H\xc0\xcf-b\x00\
-\xe3\xb0\x0f\xcf\xb7\x14\xcd\xbbJ\x06N\x1e\xd0SA\xd9\
-UX\x13 19N\x06O\xc7x\xd65\x9d\xf9\xc8\
-?\x82'gC\x87\x0d\xe3[\xb0\x00\x1bC/\x89\xcb\
-\xba\xab\xaa\xe4\x815\x0bq[)G\xf5r2\x9eL\
-\xa7\xa51=\x9e\xc2\xc0\xa1\x9e\xbd\x9d\xf3<\xf1\x9aN\
-5\xcb\xcf\xf7\xb7\xca\xeb\x83\xb92\x1e\xc1;\x13\xa1\xa7\
-OD\xc2\xaa\xc7S%\x1ci\xd9#\xae\xb1N\xb9\xe1\
-:\xbf\xdc\xf9H\xa3\x14\xe4BE\x8e\xb2\x8d\xf6\xc7\xe4\
-\x83\x97\xfd\xc1w_\x88>71\x1c\x7f\x0d\xd9\x9c\x80\
-%\xf3\xcd\x82\xcft,\xb6\xe99\x99\x8b!\x00,\x18\
-\x0bHKi\xe5\x90E\x89\xa5\x8d\x8e\x0c\xc4\x83\xef\xfd\
-\xbb\x0c\xad\xb9G\xbeZV\xe5.\x06\x0f\xd4^\xd1\x03\
-\xe5\x10M~\xf6\xb8,.}O\x8e\x0es*\xe0(\
-\xa0{\xbf\x8b\xc2\x00?/\x96Nb\x18\xce\x8f\x15I\
-^y\xa5L\xe0\x22E\xe8p\x89\xe4\xdcT\x0d\x09\x02\
-\x81\xe9\x98o`\x8c\xa6\x1f=>\xd2\x09\xc6\x1f\x01\xe3\
-[1\xc7\x0f\x92\xf1\xa3`B\x5c\xd6.\xaf\x92\xfb\xaf\
-\xafQoB\xe7\xf0n\x86z2\xdcl\xe7\x0c\x8c\x8c\
-go'\xe3\x09kim\x93_\xeek\x96\xd7z3\
-d\x04\x0b\xda\x04^\xd6\xc4\x1e\x8f3ql\xed\x061\
-\xba\xec\x13\xcfx\xa7\xdc\xb2\xa2\x06\xd7\xe9\xe32\xffs\
-\xf5(2\xde\xb2\x8c6\x18\xec\xc6\xb0\xff\xb2\x7f\xe2\x83\
-\x97b\xbf\xc0H\xf9\x06J\xd9\x04\xcb{\xfd\x86\xf9f\
-\xc1\xc7v=g\xe3h\x8as\xa6q\xb6\x09\xd1\xb7\x15\
-k\xb0d\xc7\x9d%\x5c\x01\x84\x9d\x8d\xb7\xc9\xde|\xdd\
-\x9d\xdeo\xcd^\xe8\x99\xe5\x83R\x88\x0f\x9aR\x08\xb8\
-\xe5\xc2}D\xd9\xda\xf6\xa8\x8c\xc4\x17\xe1\xb9\x11\x1c\x8d\
-f\xe1t\x10\xdb\x09\xa1\x1f.aY\xd1\x0c\xc9\xc6\xdd\
-\xb7\x81\x06<\x03\x87O\xdbf\xae\xba^2\x97ZZ\
-Bd\xa0\x0c\xb9m\xd5X1\x9e=\xbesR\xf5\xf8\
-(n\x22\xc7\x86Z\xa0p\x19SLX\xbb\xacR\x1e\
-\xb8a\x81\x94\x17\xe5\xa6\xf4n\xd3\xe3\xd9\xd3\x0d\xe39\
-\xc7\x93\xe9\xdc\xca1\xbe\xab\xabK~\xb1\xb3Q^\xec\
-\xc6\x87\x9e\x229X0\x82\xf18\x09\xe4P\x9f\xf0\x8f\
-a\x94\xc1\xcem\xb8E\xee\xc0e\x8f\xbb\xd7,\x91\xf6\
-\x89_H\xf1\xb2\xdd`<T\xc1h\x9d\xde\xf6\x88l\
-}50\xba\xf5\x95\xd83xe\xdf\xdb({3,\
-\x99?\x06K\xd5\xbb\x19\xf6\xe1\xfdd\xe6R\x08\x00K\
-\xcc|\xd9?)\x04\xbc\xc9X\x0c[\x85\xd3\xbd\xeb\xae\
-\xb9\xd9\xfb\xad\x85+=\xb5\xb8},^\xf5\xb41\xb6\
-\x13X:\x8e\xf9\xf3ek\xe7\x13\x12\xcf\xc0\xc3%`\
-\xb8+\x1b\xd6\x12\x04\x15\xc6\x9b\xc7\xf2\xc71\x22\x8cO\
-H\x7f#\x1a\xb3r\x85d\xaf[\x815\x01\xb6\x14\xe9\
-\x0b=\xc5x\xf4\xf8\xa3-\xb8\xd5\x82C\x9a\xc1f0\
-\x1e=\x1e\xbd\xef\xc6\xa5\xb3T\x8f\x9fY\x92\xaf\x98i\
-\x18=]\x8fw2\x9ex===\xf2\xdc\xae\x06y\
-\xbe\x15\x97'\xa3\xb87\xcb\xc5\x9dZ\xd5C\x00\x82\x13\
-8\xf7\xc7\x075\x06N\xc9\xcd\xabj\xe5\x1b\xf7\xdf\x22\
-\xeeX\x00#\xdb?Ha\xcdQ\xf5\xd0\x05v\xb7\xd2\
-\xd9\x14&\xf3\xfb?|=\xfaS\xcc\x22\x1f\xa0]Z\
-`\xfba\x0d\xf3\xb9\x90\xe6\xe8y^\xcc\xa5\x12\x00\x16\
-\x9eys4\xa0\x10d\xc3\x16\xc1\xe2LX\xea\x16\xad\
-\xf2|\xfd\xaa\xb5\xde\xeb\xa8\x1eV\xef\x99\x06\x03c8\
-\xedj\x1e\xa9\x93\x86\xb1\xbbp\xc1\x91\x02\xa0{\xbev\
-s1\x12`4\xf0fK\xc10n#\xf7\xb6\xcah\
-_\x97\xf8jo\x94\x9c[\x16\xe0I#f\x03\x83\xc1\
-2\xda\xc5\xa1\x9e\x8cG\x8fW\x8c\xc7q46\xf8k\
-\x96\xcc\x94\xcdk\x16\xc8,0>}\xa87=\x9b=\
-\x9e\x82\xc0\xa1\xdeh\xed\xc8\xf8\xfe\xfe~y~\xc7a\
-y\xae%\x22=\x91<\xe8%8l\x81\xe9\xb8\x89\x93\
-\x08\xe1\xc2F\x17\xee5\xf67\xc9\xd5P\x0e\xfd\xce\xe7\
-o\xc7'vfKkk\xb3\x1c\x0f\xfe\xbd\xe4\xcf>\
-\xa9\xaeR\x91\xf9-\xc7\xc2\xb2\xed\xb5`\xd7\x9ew\xa2\
-Oa&\xe1)^+,\xdf\xfa:\x0e\xcb\x9e\x7f^\
-\x99\x0fz\x17|\x17\xc0<Ng8wQ\x92\xa9-\
-4~V0zb_\xcc\x8fE\xcf\x17Vo\xca\xd8\
-\x88\x1b\xc8\x1e\xb7W\xeb\x0a\xaa\xf3\x0f\xe2\x09\xa2\xc5\x98\
-O\x17\xa9\xad!\xe7\x7f\xbd=\xd4\x8bB\xde\x1b\x08\xe4\
-c\xbf\x1d\xaf\xc6\x81\x11\xb6O\x1d\x0d\xe8\xe5\x85\x92U\
-W\x0e&`\xa8\xaf\xc7}\x82\x16\xcc\xf1\xe8\x85\xec\xf1\
-8x\x95\x1bk+T\x8f\x9f]^\xf8\xb1\x8cg\x8f\
-\xd7G\xdcX\xacB\x18\x06\x07\x07\xe5\xe5\x9dG\xe4\x97\
-'\xf0\xecc8\x0f\xcc\xc6\xf1\xb6\x99\xe3\xa1\xaf\x8f\xe1\
-.c\xac\xff\x84,\xad.\x97\xcdwm\x94\x1bV,\
-V*\xe1\xe3'\x8fI\x9b<)\xf9U\xed\xe2\xa12\
-\x08\x02~\xfc@P\xb6\xfd&\xd4r\xe0\x83\xd8S\x00\
-\xedD;\xb4\xc3\x92\xf9\x13\xb0l\xa3\xf3\xce|\xd04\
-3\x22\xbd\x97\xcc\x98\x91\x80\x0bR\x8c\xd7\xc2k\xad\xb8\
-\xfd)\x8b\x8a+\xdc\x0f\xae\xb9\xdf\xf7\x10^a\x97\x01\
-\xc5\x9f2\xfeH\xbel\xef\xfd\xa6\xc42\x8b\xb0\x16\xd0\
-k\x00QS\x81\x9e\x12\x08\xcb\x1d\xc7Vr\x22(\xfd\
-\xd8\x1a\xba\xca\x17\xe1Zy\x09\x04\xe0\xb8\xee\xf1~\xbc\
-\xe5\x04O/]\xbf\xa8B\x1e\xbcq\xa1T\x95\xe1,\
-!mq\xc7\x1e\xcf\x9eM\xcb\x1eo\x18o\xe0\xa3\xa3\
-\xa3\xf2\xea\x8e\xfd\xf2\xcc\xb11i%\xe3\xd5\xe2\x0e\xfc\
-\xc1(\xc5\xfd<\x0eg\xd4#\xd9\x95xp\xe3\x91[\
-\xeb\xa4n\xf1<<\xf1T\xaa\xe8\x1c\xa9\xdf/\xbd\xd9\
-\xff(\xb9\xa5\xbdj\xce\xe7\xec\xd4\xb07$\xdb\x7f\x13\
-n<\xbc#\xfa\x14*\xb9\x17\xb6\x03\x96G\xb9N\xe6\
-\xb3\x93\x9cw\xc3\xc6\xbf\x1c\x0c\xcbAK!\x80>P\
-\x09\x014$R\x83\xd7\xcf\xdcu\xc3\xbd\xde/\x15\x96\
-\xb9\xf3\xa8\x11f+\xb4O\xac\x90\xc6\xc9{R\x17\x84\
-\xd6\x9a\x80\x02\xe0\xf1\xe5H\xfe`\x5c\x82\x03]2t\
-r\x1f\xfaN\x18\xb7c1\x8a\xc6\x22\xb2\xb2\xa6\x0c7\
-m\x17JuE\xd1\x14\xc6S-K\x86\x1b\xe6s\x0b\
-Gc\x18\xcfK\x19o\xef: O\x1f\xea\x97\xe3\x01\
-\x0e\xf5\x98\xe31\xd4SSH\xed\x1dw\x0f\xbc\xce]\
-\x98\x19\x95\xfbn\xbaZ\xae_6O\xdd\xd6\xe5\x1d}\
-\x8e\x18\x07\x0e\x7f(C\x05\xff$Y\x85\x83\x98vp\
-\x17\x02\x95\xa9\xdfM\xe6\x87\x8e6\xec\x8d\xff+\xb2B\
-a\x15\xf3\x87\xe0N\xc2\x9a\x9e\x7fA\x98\x0f\xfa\x97t\
-\x0a`\xfe\xc6\xb0\x82\xb4\xce\xad\x8d\x9a\x0e0\x15\x84\xb6\
-\xfe*:\xb6\xfa.\xcf\xd7\xcbg{\xca\xb8j\xa8\xcc\
->\x8c\xf7\xdfb*\x88\xe0u\xf5\xdc\x16\xa2\x07\x9bm\
-!\xb5\x85\x9c\x0a\xfc\xb82\x96\x1b\xaf\x94\xec\xa2v\xf1\
-\xb7\x1dV\x8c\x7f\xe0\x86\x1a\xa9\x99\x85\x83\xa3\xb4\x1e\xff\
-Q\x8c\xa7@\xf0R\xc6\x9b;\xf6\xc8\xd3x.\xaf~\
-\x12\xf3\x7f\x08O\xc7Q\x81\x83\xed\x5c\x02+\xd48\x94\
-8\xec\xf5\xde\xe8\x80,.\x1f\x97G6\xde/3q\
-K\x96\xa7|\xe5\xe5\xe5J\xdf\xbf\xfb\xc0;2Q\xfa\
-\x94d\xe6@\x7f\x03\x81\xa1\xea\xfb\xc8\x87!\xd9\xfaJ\
-dws}\xfcY\xd4\xfd\x00l\x17\xaca>\xf7\xf8\
-l\x83\x0b\xc6|\xd0\xbe,\xa6\x00\x96\xc3i\xb8b\xa3\
-\xe5\xe2\x90\xdb\xc4\x12\xd8\xd9\xe8\xfd7\xd6m\xf0}\xab\
-\xb2\xd6]\xcda3$\x85\xb2g\xe4\x9b\xd8\x15\xe0\xd9\
-\xc1\x94\x05\xa1\xb5M\xe4\xf4p\xb2M&\x0f\xed\x90\x95\
-ss\xe5\xf7\xef\xa9K\xe9\xdd\xec\xe5\xa6g;\x87z\
-s*I\x18/dl\xd9s@~\xb2\xbbM\x0e\x8d\
-ga \x01/\xb8\xb8\xe3P\x8f\x05\x1e\xef\xefGq\
-;\xc9\x1b\x19\x94\xf2\xfc&<\x96\xed\x96\x8d7\xfd\x0e\
-\xde\xa98S1\x9f=\x9ff\xc7\xbe\xd7$Z\xf5,\
-F&<%\x85\x1d\x08\xb7\x83\x87\xb6\x07\x13[_\x8e\
-n\xedh\x8a\xfd\x1bP\x8e\xc2\x92\xf9\xd4\xeb\xb3\xe7\x93\
-\xf9\x5c\x1f]P\xe6\x83\xfee3\x02\xb0,\xc6\x98\x8a\
-\xa7,\x0e\xb10\x0a\xef{32\xe1\x1f\xf7>QS\
-\xe7\xb9\xda\xe7\x19\x95\x9a\xec\xb7\xe5D\x08S\x81R\x0d\
-\xeb\x05!o\x12\xa9Q\x01\xd4\xc6\x0en\xc1\xc2,\x08\
-\xd5\xed5j\xf1e\x18\xcd\x11\xc0\x0c\xf5t9\xd4S\
-\x18\xc8|\xc3\xf8ww\xec\x96\xa7w7\xcb\xdea\x1f\
-\xde\x90\x8aE&t\xf9T\xe0\xf0~c|\xac\x0f\x8b\
-;\x5cF\x89\x0c\xc8,0~\xce\xdc.\x993s\xa9\
-\x5c\xbf\xfc\xebx\xa4\xad\x5c1\xbf\xa4\xa4D\xe9\x06\xb6\
-\xef\x7fN\xe2s\xfe\x1d\xf4qR\x8b\xb4\x14\xa2C;\
-B\xb1-/\x86\xdf\xe9nK\xfc;\x8ai\x0eu\xa8\
-\xda=\xe7C\x1d\xd3xg\xebr\xce\xbd\x1c\x0d%\xdf\
-\x0c\x7f\xf4S(\x18\x8e4|\x88/\x16\x0d'\xbe|\
-\xd5:\xcf\xba\x0a\xdf!W_x\xb1\x8ca* \xe3\
-\xf5\x152\xed\xc6z\xba\x14\xf3+K\xf3\xa5\xaev\x8e\
-b8\x87z2\xd8\x08B:\xe3\xa9\xc5\xdb\xbeg\x9f\
-\xfcx\xfbq\xd99\x08\xad@\x18\xf7\x17\xc38\xa4A\
-oW\xc36\xee\xde\xc5\x06\x9ap\x8by\x10SI\x8b\
-\xcc\xc8\xc7C.x\x9b\xd2\xfcY\x9f\x93\xab\xe7\x7f\x19\
-w\xf5\x8bm\xe6s\xda\xd8z\xe0\x19\xf1\xcc\x7f\x09\xbd\
-,\xac\xe6\xfb\xb0\x9f=?\x14{\xf7\xb9\xf0\xab\x03=\
-\x89_\xa3>\xe6P\x87\xda=2\xdf(x.x\xcf\
-G^\xca\x5c\xae\x02\xc0\xc2\x19\xc6;\xf5\xdd\x14\x82X\
-Gc,\x10\x9a\x8c\x8f\xd7\xdd\xe1\xbbka\xd6o=\
-\xfb\xfds0'k\xc6\x9b\xb5@\xb4\xb3]\x91\xb8a\
-\xe9l\xd5\xc3\xd3{<\x85\xc1\xa8r\xb9\xb5;p\xf8\
-\x88\xfc\x18\x17<>\xe8\xc1AP\x08\x1aHha\xf4\
-\x1c\x8f!\x1b\xdaA\xea\x0c\xb0\xaa\x94\x85\xf3:\xb0\x8f\
-o\x95\xd0D\x08t\xddR;\xe7nY6\xf7\x11\xdc\
-\xd7/Q\x97<xo\x9fW\xb6?8\xf8c\xf1-\
-zE\xdc8\x03\xe7b/\x00-\xe5\xfe\x0fB\x91\xf7\
-\x9e\x0f\xbf8\xd4\x9fx\x11\x85k\x84\xed\x85u\xaav\
-\xcd\xe8\x07\xf0\xc51\x97\xb3\x00\xb0\x05\xd2\x85\x80\x0dD\
-\x1b\xe9\xefH\x84v\xbe\x18\x1d^\xb5i\xe4\xe1\xea\xcc\
-\xb7\xb3\x9b#\xf7\xa8\x11\xc0\x1c\x19\xc7\xfa\xa19\x05c\
-\xeb\x16V\xaa\xe1\x9f\x02\xc0\x958\x19\xcf\xe1\x9ea2\
-\xfehC\xa3\xfc\xeb\x07\x87\xe4\xed\xf6\x10\x8ef1}\
-pUo\x0d\xf5\xd4\xde\xc5\x86\xda\xd07\xfbe\xc1\xbc\
-.\xb9nU\x1b\xb6r!\x19\xec\x8a\xe3\xad\xa9\x1eY\
-Q\xf3\x98,\xaa\xbaG=\xac\xc1{\xfb\x5c\xf4Q7\
-\xf0\xfe\xe1\xbf\x13_\xcd[`>\x9e\xcaE\x0d\xc6\x86\
-\xa2\xb2\xf7\xfd`\x10z\xfd_\x8d\x0d\xaa\x13\xbd\x93\xa8\
-\x03U\xbbN\xe6\xb3\xae\xb4\x17\xd5\x5c\xee\x02\xc0\xc60\
-\x8d\xc2\xe1\x11\x13\xa9\x0as$\x88\x8e\x0d\xc6\x83\x10\x82\
-\x91k\xef\xda\xffxA\xf6\x92\xc2\xf1H-\xe6\x7f\x8c\
-\x04\x18\xca9\xf7\x13u\xf1\xbcY\xaag:\x19\xcf\x9e\
-\xdf\x88\xa3\xd9\xa7\xde\xdb/o\xe2\xa3\x18\x93P\xe0(\
-]=\xd2q\x9e\xc6#\xd4\xfaF\xef$\xde\x858\xbb\
-[n\xba\xb3U\xe6\xcc\xc7\xcb\xae0\x84w5\xe3\xf6\
-\x11v\x1e\xabk\xbf-\xf3f\xaeS\x8fh\xf11-\
-^\xf1\xa2*\xf8\x83\x86\x1fJ\xc6\xdc\xad8\xa9D\xb1\
-!`\x83}\x11\xd9\xf3vhr\xeb\xab\xb1\x7f\xc3\xa1\
-\xce\xeb(T\x13l?\xacQ\xed\xb2^\x97\x84\xf9\xc8\
-\xf7\xb2\x5c\x04\xb2\x5c\xe9\xc64\x90i,3\x12\xc4\x02\
-\x13\xf1\xf0\x87/\x86\xc7\x96\xdc\xf6\xea\x13\x933\xaaf\
-\xc5yk(\x88\xe1\x9b\xa7H`\xc0\xacr|\xb8\x0a\
-\xbd\x9d\x96\x8c?\xd9tJ~\x86\x17.\xbcvr\x14\
-\x1f\xb6\x02\xe3y\xbd\xdaZ\xd5\x0b\xb6v\xb1\x11\xac\x1d\
-&\xfb\xf1\xbe\xa2^\xb9\xfe\xb6\x16Y\xb4\x04\xef>\xc4\
-[P\x87\xc0\xb2\x9eV\xec\xdd\xe3\x99\xb2f\xe9\x1f\xe0\
-\xdb\x88\xd7\xa9=>\x87|\xaa\x86\x9b[\x9aeW\xdb\
-\x0f$\xa3\x12\xf7\x03\xa1\x1f\xa0 \x0dv\xc5d\xf7;\
-\xc1\x91\x1d\xafG\x9f\x86F\xf8\x1dT\xaa\x19\xd6\xa8v\
-)\xa1\x14d\xd6\xe5\x92\x99+a\x04p6\x0e\x1b\xcb\
-\x08\x03]5\x12\xf0\x89\xa4#o\x0c\x8c\x97\xady\xeb\
-[\xf1\xda{\x17\xc6\xb1\x00S\xc7\x88\x14\x02<k\xc8\
-\xa1\xbf\xad\xadM~\xfa\xf6Ny\xa9aHF,\xc6\
-\xab\x91\x02[2,\xf3\xb1\xb2\xef\xc1]\xbc~u\x05\
-k\xed\xad\xcdr\xd5\xca\xa0\x94\xcd\x84\x160\xd7'\x9d\
-\xcd\x11im\xc0p\x1e\xcb\x95\x9b\xaf\xfe#\x08\xd52\
-{\xb1G-aCc\xbd\x1c\xe8\xff\x0b\xf1\x96C\xf5\
-\x0b\xad \x05\xaf\xb75\x02\xe6\x87\x06v\xbd\x15\xfb\x09\
-\xc8\xbf\x8f\xb2\xb6\xc2\x1a\xd5\xee\x05\xd1\xeb\x83\xfeY\x9b\
-+M\x00XA\xc3x\xb3M\xd4a\x5c\xcd\x1f\xd8\xbe\
-+\x92\x9b\xb7\xf8\x8f\xdc\xd9\xe53O\xa6@\x86\x00\x00\
-\x06mIDAT\x05\xf3/Q\xf7\x1cn\x90\x9f\xff\
-\xb6G~}\xa4G\x06\x02\xa6\xc7c]I\xc6C3\
-\x18\x1f\x1fP\x8c\x9fQ>\x22\xb7nj\x91\x08\xce\x10\
-x\x08UV\x81\x83\xa5R\xb7:\xa0i:\x1c\xc5m\
-\xa0r\xb9\xb9\xee\x8feF\xe9|\x9b\xf9\xdcM\x1c:\
-\xbcO\x8e\x8e\xff\x0f<\xa6\xd6\x8c\xa7\xb0p\xd5\x15=\
-\xbf\xe3dXv\xbd\x13\xee:\xf8A\xec\xc7\x98U\xb6\
-\xa1 XHLQ\xed^\xd2\x9e\x8f\xf2(\x03\x95\xca\
-\x15kXv*\x8cx%\x87\xa7\x89\x05\xb0\x95\xee\xdc\
-\xc2\xfbsn\xf9\xf2wc\xbdC\x5c\xe5I\xd9\x8cR\
-\x19\xc1\x112\xc5\xc6\xac\xea)\x1c\x09\x5c\xc8\xe0kW\
-\xf2\x0a\xc6\xe4\x9a\xd5-x{\xc9\x98\xcc\xc1\x09D\x1e\
-\xb4\xbf\xc7\xf6\x85\xd4\xd7Q2\xf1\xf0&\x16\x9b\x92\x9b\
-9\x1b\x976\xbe\x87=~\x95\x9a\xeb\xb9\xc7\xe7\x94\xb2\
-w\xffv9\x11\xfeK\xa8\xa41m`\xab\x88\x1bc\
-\xd2\x5c\x8f\x9e\xffn\xb8\xf5\xd0\xf6\xd8?cp7\x87\
-:\xd4\xee]p\xbd>\xf28k\x83\x15\xd3\x15o\xf4\
-\x08\x80\x81\x1c5\x09AE\x8b.\x1d\xa9tg\x95,\
-\xe2: \x82\x87)f\x95\x16\xcb\x18\x9e\x9cUC>\
-^\xab\x16\xc7\x93;Y\x9e>Y\xbe\xa2QV\xddp\
-J*\xe6\x84%\xbf\xcc+\xdeb<\xac\x91\x8b\x8b\x09\
-s\xf1\x18\xdaPL\xf0\xda\x5c)\xc9\xad\x95\xf5u\x7f\
-\x0a\xed^\xa5\xdd\xf3\xc9\xfc\x0fw\xbf+MQ0?\
-\xb3\x07S\x03\xd6\x06\x18QN\x1e\x8e\xc8\xce\xb7\xc2'\
-\x8f\xec\x88\xff\x08\x02\xe7d\xfeE\xd1\xeb\x9f\x0b'?\
-\x0d\x02\xc0zs8\xa5\xe5\xb8?\x19\x1b\xee\xe9\xf4\xe4\
-\x95}\xce\xe5\xcd*\x8cCW\x1f\xc1-\x9ch\x04\x0f\
-`\xe0\x0e\xbf/\xd1'\x8b\x16\x9d\x90\xab\xaei\x94\xe2\
-R?t\xf3\xf8\xdeA\xa1Wr\xf0\x05\x94\x0c\xf4\xf8\
-\xb0\x0f\x82\x80\x89\xb1\x18\x9f\xca\xeb=\x95\x85\x17\x5c\xfe\
-\xdf\xf8\x94\xde\x0c\xbc\xf2\xaePm\xf7\xb8\x85\xdc\xb2\xf3\
-UL\xe8?\xc4\x12z@\xad\xf6\xf9\xba\xfc\x06\x8c\x1a\
-;\xdf\x8c\x1cm\xdc\x07\xe6\x8b\xec\x86\xed\x80\xbd\xa8z\
-}\xe4w\xd6\xe6\xd3\x22\x00\x1c\x05\x9c#\xc1hlr\
-p\xc8ST\xb9\x1e\x8f\x9b\xf8\x22P\xe3\xba\xe3\xc3R\
-=\x07g\xf3\xcb\x8ea\xeb\x86K \xa89\xaf\x9ce\
-\xe1\xb37\xd9\xf8\xa4\x1a\xbf\x81\xc4\xf7\x11\xf2\x9c!\x02\
-&\xef{mR\xaaK6\xca\xd2\x05\xb7(\xe6S\x00\
-h\xde\xdd\xf6\x9ct\xf9\xfe_L>\xd8\xc2\x83\xf11\
-\xdc\xf8\xa9\xdf\x1d\x96\x0f\x7f\xcbC\x9d\xc4\x8f\x81\xb2\x0f\
-\xb6\x13\x96z}j\xf7\xb8V\xa1p\xb2|\x97\x9d\xb9\
-\x12\x17\x81\xa7kD62\x0dW\xd8CP\xd5\xbd\x1c\
-i\xd9\x99\xe5\xf2f\xaf\xc2\xe3\xc7\xe5\xd5Kzk+\
-+\x12s\xf0\xb5\x0a\xce\x04\xea\x01\x14\xb2\x84\x0b\x09\xea\
-\xf7#\xd0\xd1\xbbp\x1b\x13\xcb\x06h\x99\xa22\xda\x1b\
-\x91\xabWoR\xfb|*xx\xaf\xff\xadm?\x95\
-\xe1\xbc\x7f\x85r'\xa0\xb6\x8e\x11,\xfa\xeaw\x85\x12\
-\xbb\xde\x8en\xe9nI<\x03R<\xd4\xe9\x86\xbd$\
-z}\xe4{\xd6\xe6\xd32\x02\x98\x8a\xb3\x97\xd1R\x18\
-\x82\x89H\xb0!\x11\x1a\xdf\x9d\x08\x8c\xee\x1fl\x8f6\
-\xe3\x11\x94\xca\x82\x19\xee\x0a\xf4s\xd5\xd3=x\xc39\
-/\x9f\xf2E\x15\xea\xe5\x93\x8a\x8aK\xfa\x1a!C\x13\
-Er\xef\xad\xdfU\xf3>\x9f\xe6\xf9\xcd\x96\x7f\x94\xb1\
-\x82\x9fb\xb1\x07]\x01z=\xbf\xaf|h[(\xbe\
-\xf3\xcd\xd8\xdb\xbd\xed\x8a\xf9\x87\x91\xdc\xc9|\xaeI.\
-\xdb\x9e\xaf\xaa\x8a\xbfO\x9b\x00\x98z\x19!\xe09\x02\
-G\x04^E\x1f\x19\xeeN\xb4\xe03E\x85%\x95\xee\
-\xb9`8\x1e/ \xf3!\x0cj\xe8\xc7X\xa0\x86\x03\
-\x8c\xdf\x07\x03\xb2\xb0j\xad\xdc\xb0\xf2~\x19\x1f\x1f\x97\
-\xd7\xb7\xff\x0d\xee\x17<\x8f\xeb^\xb8\xeb\x8fa?0\
-\x8e\xb3\x83-\xc1\xd8\xeew\xe2\xaf\xe2I\x9d\x9f\x836\
-O\xf4z`\xa9\xdae^W\x04\xf3Q\xce+F\x13\
-\xc8\xb2\x9e\x8dq\x0a\x00W\xe0\xec\x89\x5c F\xba\x8f\
-\xc7\x02A\xbc\xb8b\xc5\xc6\x8c\xbb}\x99\x09/\x87q\
-\x0fz3\xe7\xfe\x04>c\x17\x85\xb8LBw_\xb5\
-r\x09^\xb96$o\xec\xfe\x81D\x8a\xde\x02\x1c\x8b\
-H\xb0\x95\xaf]=\xb0%\x149\xb8%\xf6k<\x98\
-\xfc\x02h\x1e\x87\xbd,\xf4\xfa(\xc7Y\x9bO\xeb\x08\
-\xe0l\x08\x0a\x83\xd2\x18\xc2\xe5\x880\x89\xdba\x1d\xc3\
-\x1d\x89hY\xb5{1\x9eA\xf0RE\xac\x0d>f\
-5\x12\x97\xb1\xce\xb0\xcc\xad\xb8N\xea;_\xc07w\
-\xdf\x81N\x00z\x03P\xe0\xd6p\xdf\xfb\xa1\xd0\x81-\
-\xf1\x7f\x9f\x18Ma>\xf5\xfaT\xed\xb2\xe73?\xda\
-+\xc2|\x16\x04\x80\x8c0#\x02\x19\xc4U\xb9?\x14\
-Ht\xf5\x9eJ\x8c\x16\xcfr\xd5\xe2sy\xdc\x03\xa8\
-\x05`p\x18\xcf\xe3\xe1\xfb\xba\xb1\xccV\xc9\x80j\x97\
-[<2\x7f\xb87*{\xde\x0dO\x1e\xda\x1e\x7f6\
-0!/\x81\xc6\x09X\xf6|\xe7\xa1\x8eY\x88\x02|\
-e\x98\xcf\x92\x008\x85\x80#A \x1aJ\xf4v5\
-\xc6z\xf2J\xf1\x06\xf4\x02W>w\x00\xe1\xb1\xb8\xf8\
-!\x04\x999A\xf5\x154N\x1e\x03\x9d8\xd4y7\
-4z\xf4\xc3\xc4O\xc2\x01q\x9e\xe8]\xb0\xfb\xfa\x17\
-K|>+\x02\xc0\xf6\xa4\x00\x18!0SB\x10Z\
-\xe1\xc1\xae\xe3\xb1vo\xa6T\x17\x94\xbbK#\x01,\
-\xf2F\xf0\xd1\x8bI|\xdcr\x8eWz\xda\xd9\xf3C\
-\x83\x0d{\xe5\x9fq\xa8\xf36h4\xc3^v\x87:\
-(\xd39\x99\xcf\x92\x00\x98\x062\x82`\x0b\x01\xc4b\
-\xb8\xbf9\xde\x82\xf7)\xcf(\xa9rW\xe1\xd3z\xd0\
-\x1c&d\xa0;&\x0d\xfb\xa3\xdd'\x0e\xca\xff\x87s\
-\xa3\xf7A\xa0\x156\x9d\xf9\xa4w\xc5\x9a\xcf\xa2\x00\x90\
-Y\xe9#\x01\xd7\x05\xa3\xc3]\xf1fl\xf1\xb2\xf1-\
-\x84\x1a\xbc\xd2\xc6\xd5\xd7\x91h9uX\x9e\xc4(\xb1\
-\x1d\xf1\xe6D\xef\xb2\xd5\xeb\xb3bgk\xcc\xf2\xf7l\
-\xd3}\x1a\xf0Yw\x9e&R\x1b\x8a3@\xf50J\
-\x09\xdc\xea\xfc\x22\xf7\xadx\xf6\xcf\x83\x17a\xf3)\x1d\
-\xb3\xd8\xe3\x1e\x9f\xcc\xe7\xfa\x81\xa3\xc7\x15\xdd\xf3Q~\
-e>\xcb\x02\xc0\x06`\xfdi)\x04|\x22\x89\xc7\xca\
-8\x0fTO,S8\xa8D\x22\xd3\xa9\xd3\xa7\x82\x87\
-\xcc\xbf\xec\xb5{(\xe3\x19\x9b\xcf\xba\x00\x98\x86\x22\xb3\
-9\x1dR\x10x\xbf\x80.\x0d\x99M\xa6\x9b^\xff\xa9\
-b>+\xf8\x1f\x02\xc0V\xd0\x86mAA0.\xa1\
-f\xad@\xd7X\xc2?5\xe6?\x04`*+\xa7k\
-\x93O\xc5|?\xb5\xaa\xff\x01\xf9\xcc\xb7\xc0\xff\x0fI\
-\xcd\xa8\x7f.2<R\x00\x00\x00\x00IEND\xae\
-B`\x82\
 \x00\x00\x0f\xf6\
 \x89\
 PNG\x0d\x0a\x1a\x0a\x00\x00\x00\x0dIHDR\x00\
@@ -48993,10 +46943,6 @@ G\x01@+:\xd4\x053\xfe\x08?\x0a\x00Z\xb1w\
 "
 
 qt_resource_name = b"\
-\x00\x0b\
-\x08\x97?\x1f\
-\x00k\
-\x00m\x00a\x00n\x00a\x00p\x00p\x00.\x00i\x00c\x00o\
 \x00\x05\
 \x00o\xa6S\
 \x00i\
@@ -49005,10 +46951,6 @@ qt_resource_name = b"\
 \x03\xb6_\xf9\
 \x00m\
 \x00a\x00i\x00n\x00w\x00i\x00n\x00d\x00o\x00w\x00.\x00u\x00i\
-\x00\x0b\
-\x08\x97'\xc7\
-\x00k\
-\x00m\x00a\x00n\x00a\x00p\x00p\x00.\x00p\x00n\x00g\
 \x00\x09\
 \x05\xe6\x85\x87\
 \x00b\
@@ -49226,121 +47168,117 @@ qt_resource_name = b"\
 "
 
 qt_resource_struct = b"\
-\x00\x00\x00\x00\x00\x02\x00\x00\x00\x04\x00\x00\x00\x01\
+\x00\x00\x00\x00\x00\x02\x00\x00\x00\x02\x00\x00\x00\x01\
 \x00\x00\x00\x00\x00\x00\x00\x00\
-\x00\x00\x00\x1c\x00\x02\x00\x00\x005\x00\x00\x00\x05\
+\x00\x00\x00\x00\x00\x02\x00\x00\x005\x00\x00\x00\x03\
 \x00\x00\x00\x00\x00\x00\x00\x00\
-\x00\x00\x00,\x00\x01\x00\x00\x00\x01\x00\x007\xa6\
+\x00\x00\x00\x10\x00\x01\x00\x00\x00\x01\x00\x00\x00\x00\
 \x00\x00\x01r\xc7o\xe0\x8d\
-\x00\x00\x00L\x00\x00\x00\x00\x00\x01\x00\x00=8\
-\x00\x00\x01r\xeb\xc2\xbdi\
-\x00\x00\x00\x00\x00\x01\x00\x00\x00\x01\x00\x00\x00\x00\
-\x00\x00\x01r\xc7k\xf9W\
-\x00\x00\x04\x1c\x00\x00\x00\x00\x00\x01\x00\x08\xc2 \
+\x00\x00\x03\xe4\x00\x00\x00\x00\x00\x01\x00\x08BR\
 \x00\x00\x01ro \xc0+\
-\x00\x00\x01>\x00\x00\x00\x00\x00\x01\x00\x02\x17\x04\
+\x00\x00\x01\x06\x00\x00\x00\x00\x00\x01\x00\x01\x976\
 \x00\x00\x01rybF\xf5\
-\x00\x00\x05f\x00\x00\x00\x00\x00\x01\x00\x0b\x0bZ\
+\x00\x00\x05.\x00\x00\x00\x00\x00\x01\x00\x0a\x8b\x8c\
 \x00\x00\x01r\xbcxSM\
-\x00\x00\x05\x18\x00\x00\x00\x00\x00\x01\x00\x0aw\xb4\
+\x00\x00\x04\xe0\x00\x00\x00\x00\x00\x01\x00\x09\xf7\xe6\
 \x00\x00\x01ro-O\xd6\
-\x00\x00\x00\xcc\x00\x00\x00\x00\x00\x01\x00\x00\xb6\xd3\
+\x00\x00\x00\x94\x00\x00\x00\x00\x00\x01\x00\x007\x05\
 \x00\x00\x01ryefk\
-\x00\x00\x03\xbc\x00\x00\x00\x00\x00\x01\x00\x07\xbe\xbc\
+\x00\x00\x03\x84\x00\x00\x00\x00\x00\x01\x00\x07>\xee\
 \x00\x00\x01ro!\xbci\
-\x00\x00\x02\x82\x00\x00\x00\x00\x00\x01\x00\x04\xb3\x0a\
+\x00\x00\x02J\x00\x00\x00\x00\x00\x01\x00\x043<\
 \x00\x00\x01r\x83\x0a\xde,\
-\x00\x00\x05N\x00\x00\x00\x00\x00\x01\x00\x0a\xadD\
+\x00\x00\x05\x16\x00\x00\x00\x00\x00\x01\x00\x0a-v\
 \x00\x00\x01ro \x94\xf5\
-\x00\x00\x01\xb8\x00\x00\x00\x00\x00\x01\x00\x03\xd3I\
+\x00\x00\x01\x80\x00\x00\x00\x00\x00\x01\x00\x03S{\
 \x00\x00\x01rn\x81\xa0K\
-\x00\x00\x00\xa2\x00\x00\x00\x00\x00\x01\x00\x00\xb1\xd6\
+\x00\x00\x00j\x00\x00\x00\x00\x00\x01\x00\x002\x08\
 \x00\x00\x01r\x83\x17T#\
-\x00\x00\x03\x9e\x00\x00\x00\x00\x00\x01\x00\x07\xbc$\
+\x00\x00\x03f\x00\x00\x00\x00\x00\x01\x00\x07<V\
 \x00\x00\x01r\x83\x18\xc72\
-\x00\x00\x00h\x00\x00\x00\x00\x00\x01\x00\x00\x85`\
+\x00\x00\x000\x00\x00\x00\x00\x00\x01\x00\x00\x05\x92\
 \x00\x00\x01r\x83\x18J\xbf\
-\x00\x00\x02\x02\x00\x00\x00\x00\x00\x01\x00\x04\x5c\xbc\
+\x00\x00\x01\xca\x00\x00\x00\x00\x00\x01\x00\x03\xdc\xee\
 \x00\x00\x01r\x83\x0b\xa39\
-\x00\x00\x01\xa0\x00\x00\x00\x00\x00\x01\x00\x03i\x18\
+\x00\x00\x01h\x00\x00\x00\x00\x00\x01\x00\x02\xe9J\
 \x00\x00\x01rn\x7f\x9a\xa2\
-\x00\x00\x038\x00\x00\x00\x00\x00\x01\x00\x06\xb1\x8b\
+\x00\x00\x03\x00\x00\x00\x00\x00\x00\x01\x00\x061\xbd\
 \x00\x00\x01rx\xd0\xef\xa4\
-\x00\x00\x02l\x00\x00\x00\x00\x00\x01\x00\x04\x97\x19\
+\x00\x00\x024\x00\x00\x00\x00\x00\x01\x00\x04\x17K\
 \x00\x00\x01ro&U\x86\
-\x00\x00\x00\xf4\x00\x00\x00\x00\x00\x01\x00\x01\xb5\xf8\
+\x00\x00\x00\xbc\x00\x00\x00\x00\x00\x01\x00\x016*\
 \x00\x00\x01r\xbcx\xf1\xbd\
-\x00\x00\x042\x00\x00\x00\x00\x00\x01\x00\x092\x1d\
+\x00\x00\x03\xfa\x00\x00\x00\x00\x00\x01\x00\x08\xb2O\
 \x00\x00\x01ro'\x5c\xdd\
-\x00\x00\x04\x82\x00\x00\x00\x00\x00\x01\x00\x09\xb2\xd5\
+\x00\x00\x04J\x00\x00\x00\x00\x00\x01\x00\x093\x07\
 \x00\x00\x01r\xa2l\xb8\xf8\
-\x00\x00\x05\xb6\x00\x00\x00\x00\x00\x01\x00\x0b\xb6\xbd\
+\x00\x00\x05~\x00\x00\x00\x00\x00\x01\x00\x0b6\xef\
 \x00\x00\x01rxL\xc3L\
-\x00\x00\x03\x0a\x00\x00\x00\x00\x00\x01\x00\x05\xfe\xd1\
+\x00\x00\x02\xd2\x00\x00\x00\x00\x00\x01\x00\x05\x7f\x03\
 \x00\x00\x01rn\x80a\x98\
-\x00\x00\x03\xf4\x00\x00\x00\x00\x00\x01\x00\x07\xdbH\
+\x00\x00\x03\xbc\x00\x00\x00\x00\x00\x01\x00\x07[z\
 \x00\x00\x01ro!\x10\x8b\
-\x00\x00\x01\x0a\x00\x00\x00\x00\x00\x01\x00\x01\xba{\
+\x00\x00\x00\xd2\x00\x00\x00\x00\x00\x01\x00\x01:\xad\
 \x00\x00\x01ro6\xcc\x14\
-\x00\x00\x04\x06\x00\x00\x00\x00\x00\x01\x00\x08M\xd7\
+\x00\x00\x03\xce\x00\x00\x00\x00\x00\x01\x00\x07\xce\x09\
 \x00\x00\x01ryf\xd9E\
-\x00\x00\x03j\x00\x00\x00\x00\x00\x01\x00\x07\x09\x05\
+\x00\x00\x032\x00\x00\x00\x00\x00\x01\x00\x06\x897\
 \x00\x00\x01rn\x83W\xb2\
-\x00\x00\x02\xda\x00\x00\x00\x00\x00\x01\x00\x05a\xca\
+\x00\x00\x02\xa2\x00\x00\x00\x00\x00\x01\x00\x04\xe1\xfc\
 \x00\x00\x01rn\x80\x8e_\
-\x00\x00\x024\x00\x00\x00\x00\x00\x01\x00\x04_7\
+\x00\x00\x01\xfc\x00\x00\x00\x00\x00\x01\x00\x03\xdfi\
 \x00\x00\x01ro'\xd9\xb1\
-\x00\x00\x03 \x00\x00\x00\x00\x00\x01\x00\x06L\xdf\
+\x00\x00\x02\xe8\x00\x00\x00\x00\x00\x01\x00\x05\xcd\x11\
 \x00\x00\x01ro!\x80\x9f\
-\x00\x00\x05,\x00\x00\x00\x00\x00\x01\x00\x0a\x8e\x8e\
+\x00\x00\x04\xf4\x00\x00\x00\x00\x00\x01\x00\x0a\x0e\xc0\
 \x00\x00\x01ro*{\xa5\
-\x00\x00\x05\x9a\x00\x00\x00\x00\x00\x01\x00\x0b}\xaa\
+\x00\x00\x05b\x00\x00\x00\x00\x00\x01\x00\x0a\xfd\xdc\
 \x00\x00\x01rxA\xa0\xe6\
-\x00\x00\x04\xb6\x00\x00\x00\x00\x00\x01\x00\x09\xbbV\
+\x00\x00\x04~\x00\x00\x00\x00\x00\x01\x00\x09;\x88\
 \x00\x00\x01r\x8a:\x08\x8f\
-\x00\x00\x02N\x00\x00\x00\x00\x00\x01\x00\x04\x93\x86\
+\x00\x00\x02\x16\x00\x00\x00\x00\x00\x01\x00\x04\x13\xb8\
 \x00\x00\x01r\xa2b\xf5\xfa\
-\x00\x00\x03N\x00\x00\x00\x00\x00\x01\x00\x06\xe5G\
+\x00\x00\x03\x16\x00\x00\x00\x00\x00\x01\x00\x06ey\
 \x00\x00\x01ro'\xf7\xd9\
-\x00\x00\x03\xda\x00\x00\x00\x00\x00\x01\x00\x07\xd6\x89\
+\x00\x00\x03\xa2\x00\x00\x00\x00\x00\x01\x00\x07V\xbb\
 \x00\x00\x01r\x8a6j\xde\
-\x00\x00\x02\xba\x00\x00\x00\x00\x00\x01\x00\x05\x02v\
+\x00\x00\x02\x82\x00\x00\x00\x00\x00\x01\x00\x04\x82\xa8\
 \x00\x00\x01ro+U:\
-\x00\x00\x00\x80\x00\x00\x00\x00\x00\x01\x00\x00\x95Z\
+\x00\x00\x00H\x00\x00\x00\x00\x00\x01\x00\x00\x15\x8c\
 \x00\x00\x01ro\x22L\x9b\
-\x00\x00\x01j\x00\x00\x00\x00\x00\x01\x00\x02\xd5\xda\
+\x00\x00\x012\x00\x00\x00\x00\x00\x01\x00\x02V\x0c\
 \x00\x00\x01rn\x80\xbaA\
-\x00\x00\x01\xe8\x00\x00\x00\x00\x00\x01\x00\x04Z\xa7\
+\x00\x00\x01\xb0\x00\x00\x00\x00\x00\x01\x00\x03\xda\xd9\
 \x00\x00\x01r\x9e\xb0mx\
-\x00\x00\x01\x84\x00\x00\x00\x00\x00\x01\x00\x03!\x88\
+\x00\x00\x01L\x00\x00\x00\x00\x00\x01\x00\x02\xa1\xba\
 \x00\x00\x01ro\x14<\x9f\
-\x00\x00\x04N\x00\x00\x00\x00\x00\x01\x00\x09R\xcc\
+\x00\x00\x04\x16\x00\x00\x00\x00\x00\x01\x00\x08\xd2\xfe\
 \x00\x00\x01ro\x14\xa8\xb6\
-\x00\x00\x00\xe0\x00\x00\x00\x00\x00\x01\x00\x010\x1f\
+\x00\x00\x00\xa8\x00\x00\x00\x00\x00\x01\x00\x00\xb0Q\
 \x00\x00\x01ro\x1e\xc7F\
-\x00\x00\x04\xe8\x00\x00\x00\x00\x00\x01\x00\x0a+\xa6\
+\x00\x00\x04\xb0\x00\x00\x00\x00\x00\x01\x00\x09\xab\xd8\
 \x00\x00\x01rxK\x8a\x1d\
-\x00\x00\x02\xf6\x00\x00\x00\x00\x00\x01\x00\x05\xac\xc0\
+\x00\x00\x02\xbe\x00\x00\x00\x00\x00\x01\x00\x05,\xf2\
 \x00\x00\x01ro!G\x15\
-\x00\x00\x01\xd0\x00\x00\x00\x00\x00\x01\x00\x04:\x8a\
+\x00\x00\x01\x98\x00\x00\x00\x00\x00\x01\x00\x03\xba\xbc\
 \x00\x00\x01ro*\xb4%\
-\x00\x00\x01\x1e\x00\x00\x00\x00\x00\x01\x00\x02\x06\xa2\
+\x00\x00\x00\xe6\x00\x00\x00\x00\x00\x01\x00\x01\x86\xd4\
 \x00\x00\x01r\x82\xb4i\x96\
-\x00\x00\x04h\x00\x00\x00\x00\x00\x01\x00\x09\x5cf\
+\x00\x00\x040\x00\x00\x00\x00\x00\x01\x00\x08\xdc\x98\
 \x00\x00\x01ryaf\xee\
-\x00\x00\x03\x84\x00\x00\x00\x00\x00\x01\x00\x07V\xcd\
+\x00\x00\x03L\x00\x00\x00\x00\x00\x01\x00\x06\xd6\xff\
 \x00\x00\x01ryg+\xf0\
-\x00\x00\x05\x80\x00\x00\x00\x00\x00\x01\x00\x0b\x1a\xd2\
+\x00\x00\x05H\x00\x00\x00\x00\x00\x01\x00\x0a\x9b\x04\
 \x00\x00\x01rx\xcbU\xa4\
-\x00\x00\x05\x04\x00\x00\x00\x00\x00\x01\x00\x0aP#\
+\x00\x00\x04\xcc\x00\x00\x00\x00\x00\x01\x00\x09\xd0U\
 \x00\x00\x01rx\xcc\xdf'\
-\x00\x00\x04\x9c\x00\x00\x00\x00\x00\x01\x00\x09\xb5A\
+\x00\x00\x04d\x00\x00\x00\x00\x00\x01\x00\x095s\
 \x00\x00\x01r\xbcw>\x8a\
-\x00\x00\x02\xa2\x00\x00\x00\x00\x00\x01\x00\x04\xb7\xa2\
+\x00\x00\x02j\x00\x00\x00\x00\x00\x01\x00\x047\xd4\
 \x00\x00\x01rn\x80\xf2c\
-\x00\x00\x04\xcc\x00\x00\x00\x00\x00\x01\x00\x09\xc0T\
+\x00\x00\x04\x94\x00\x00\x00\x00\x00\x01\x00\x09@\x86\
 \x00\x00\x01ro!-\x86\
-\x00\x00\x01V\x00\x00\x00\x00\x00\x01\x00\x02h#\
+\x00\x00\x01\x1e\x00\x00\x00\x00\x00\x01\x00\x01\xe8U\
 \x00\x00\x01rn\x7f\xe8!\
 "
 
diff --git a/makepkg.md b/makepkg.md
index f11903f..daa7c48 100644
--- a/makepkg.md
+++ b/makepkg.md
@@ -23,6 +23,8 @@ A: rm -fr __pycache__, 重新打包
 1.  (kmanenv) [gavin@gavin-2 kman]$Release/kmanapp.app/Contents/MacOS/kmanapp
 NameError: name 'kMan' is not defined
 A:   pathex=['/Users/mark/penv/kman',]
+     Analysis(['kmanapp.py'], ==>
+     Analysis(['kman.py', 'kmanapp.py', 'kmanapp_rc.py', 'mainwindow.py', 'mtable.py', 'parseweb.py', ],
 
 
 # reference
diff --git a/x b/x
new file mode 100644
index 0000000..5fcc8da
--- /dev/null
+++ b/x
@@ -0,0 +1,1894 @@
+   ncalls  tottime  percall  cumtime  percall filename:lineno(function)
+    618/1    0.004    0.000  174.623  174.623 {built-in method builtins.exec}
+        1    0.126    0.126  174.623  174.623 kmanapp.py:10(<module>)
+        1  165.835  165.835  173.240  173.240 {built-in method exec_}
+      191    0.023    0.000    4.123    0.022 kmanapp.py:558(show_status_info)
+      192    0.046    0.000    3.857    0.020 kman.py:130(status_info)
+      192    0.136    0.001    3.757    0.020 kman.py:561(get_kindle_path)
+       29    0.001    0.000    2.301    0.079 kmanapp.py:366(tree_item_selectionchanged)
+       29    0.006    0.000    2.299    0.079 kmanapp.py:373(tree_item_clicked)
+      193    0.038    0.000    2.235    0.012 subprocess.py:681(__init__)
+      193    0.070    0.000    2.164    0.011 subprocess.py:1412(_execute_child)
+       36    1.256    0.035    1.727    0.048 {method 'setColumnWidth' of 'PySide2.QtWidgets.QTableView' objects}
+      388    1.355    0.003    1.359    0.004 {method 'read' of '_io.TextIOWrapper' objects}
+      193    1.305    0.007    1.305    0.007 {built-in method posix.read}
+   298083    0.378    0.000    0.928    0.000 kmanapp.py:825(data)
+        1    0.001    0.001    0.782    0.782 kmanapp.py:75(__init__)
+      193    0.764    0.004    0.764    0.004 {built-in method _posixsubprocess.fork_exec}
+        1    0.002    0.002    0.588    0.588 kmanapp.py:485(contextMenuEvent)
+        1    0.007    0.007    0.578    0.578 kmanapp.py:605(fill_treeview)
+        1    0.534    0.534    0.534    0.534 {staticmethod object at 0x10bb78590}
+    351/7    0.003    0.000    0.456    0.065 <frozen importlib._bootstrap>:978(_find_and_load)
+    351/7    0.002    0.000    0.456    0.065 <frozen importlib._bootstrap>:948(_find_and_load_unlocked)
+    331/8    0.002    0.000    0.454    0.057 <frozen importlib._bootstrap>:663(_load_unlocked)
+    457/9    0.000    0.000    0.453    0.050 <frozen importlib._bootstrap>:211(_call_with_frames_removed)
+       13    0.000    0.000    0.432    0.033 __init__.py:1(<module>)
+    37461    0.412    0.000    0.412    0.000 {method 'emit' of 'PySide2.QtCore.SignalInstance' objects}
+        1    0.393    0.393    0.393    0.393 {method 'expandAll' of 'PySide2.QtWidgets.QTreeView' objects}
+    276/7    0.001    0.000    0.363    0.052 <frozen importlib._bootstrap_external>:722(exec_module)
+       18    0.002    0.000    0.360    0.020 kmanapp.py:225(refresh_ui_component)
+   364/17    0.001    0.000    0.303    0.018 {built-in method builtins.__import__}
+  327/204    0.001    0.000    0.264    0.001 <frozen importlib._bootstrap>:576(module_from_spec)
+    46/24    0.000    0.000    0.258    0.011 <frozen importlib._bootstrap_external>:1040(create_module)
+    46/24    0.119    0.003    0.257    0.011 {built-in method _imp.create_dynamic}
+      191    0.246    0.001    0.246    0.001 {method 'addPermanentWidget' of 'PySide2.QtWidgets.QStatusBar' objects}
+      174    0.220    0.001    0.220    0.001 {method 'addFile' of 'PySide2.QtGui.QIcon' objects}
+ 1302/374    0.001    0.000    0.209    0.001 <frozen importlib._bootstrap>:1009(_handle_fromlist)
+        1    0.000    0.000    0.189    0.189 __init__.py:32(_setupQtDirectories)
+        1    0.000    0.000    0.152    0.152 __init__.py:106(<module>)
+        2    0.000    0.000    0.148    0.074 __init__.py:41(<module>)
+        7    0.038    0.005    0.147    0.021 kman.py:442(filter_clips)
+        1    0.000    0.000    0.145    0.145 parseweb.py:12(<module>)
+       26    0.145    0.006    0.145    0.006 {method 'setHtml' of 'PySide2.QtWidgets.QTextEdit' objects}
+    11245    0.048    0.000    0.134    0.000 kman.py:218(format_time)
+    37788    0.042    0.000    0.099    0.000 kmanapp.py:833(rowCount)
+        2    0.000    0.000    0.095    0.047 __init__.py:3(<module>)
+        1    0.049    0.049    0.094    0.094 mainwindow.py:21(setupUi)
+    22776    0.020    0.000    0.090    0.000 re.py:271(_compile)
+        1    0.000    0.000    0.085    0.085 connectionpool.py:1(<module>)
+        1    0.000    0.000    0.080    0.080 __init__.py:7(<module>)
+       12    0.001    0.000    0.079    0.007 kmanapp.py:316(render_textedit_infos)
+      276    0.004    0.000    0.066    0.000 <frozen importlib._bootstrap_external>:793(get_code)
+    22490    0.016    0.000    0.064    0.000 re.py:180(search)
+    38763    0.062    0.000    0.062    0.000 {method 'format' of 'str' objects}
+  342/322    0.003    0.000    0.062    0.000 <frozen importlib._bootstrap>:882(_find_spec)
+      102    0.001    0.000    0.062    0.001 sre_compile.py:759(compile)
+      103    0.000    0.000    0.061    0.001 re.py:232(compile)
+       11    0.002    0.000    0.060    0.005 kmanapp.py:272(render_textedit_words)
+    37788    0.041    0.000    0.057    0.000 mtable.py:28(get_num_rows)
+    37638    0.021    0.000    0.055    0.000 kmanapp.py:838(columnCount)
+        1    0.000    0.000    0.051    0.051 kmanapp.py:758(export_filter_notes)
+        1    0.001    0.001    0.051    0.051 kman.py:295(export_notes)
+      587    0.046    0.000    0.049    0.000 {built-in method io.open}
+        1    0.008    0.008    0.043    0.043 kman.py:233(format_note_data)
+    37459    0.038    0.000    0.043    0.000 mtable.py:24(get_iat)
+      337    0.000    0.000    0.043    0.000 <frozen importlib._bootstrap_external>:1272(find_spec)
+      337    0.002    0.000    0.042    0.000 <frozen importlib._bootstrap_external>:1240(_get_spec)
+        3    0.000    0.000    0.042    0.014 kman.py:551(json2dict)
+        1    0.000    0.000    0.042    0.042 exceptions.py:1(<module>)
+        3    0.000    0.000    0.042    0.014 __init__.py:274(load)
+      192    0.007    0.000    0.040    0.000 subprocess.py:847(__exit__)
+      276    0.001    0.000    0.040    0.000 <frozen importlib._bootstrap_external>:523(_compile_bytecode)
+        3    0.000    0.000    0.039    0.013 __init__.py:299(loads)
+        3    0.000    0.000    0.039    0.013 decoder.py:332(decode)
+        3    0.039    0.013    0.039    0.013 decoder.py:343(raw_decode)
+      276    0.038    0.000    0.038    0.000 {built-in method marshal.loads}
+      102    0.001    0.000    0.038    0.000 sre_parse.py:913(parse)
+        1    0.000    0.000    0.038    0.038 __init__.py:13(<module>)
+       19    0.036    0.002    0.037    0.002 {method 'setModel' of 'PySide2.QtWidgets.QTableView' objects}
+  428/102    0.002    0.000    0.037    0.000 sre_parse.py:411(_parse_sub)
+  542/109    0.013    0.000    0.036    0.000 sre_parse.py:469(_parse)
+      633    0.008    0.000    0.035    0.000 <frozen importlib._bootstrap_external>:1356(find_spec)
+    37638    0.025    0.000    0.034    0.000 mtable.py:31(get_num_columns)
+        2    0.000    0.000    0.033    0.017 connection.py:1(<module>)
+      316    0.001    0.000    0.033    0.000 overrides.py:166(decorator)
+202379/201190    0.032    0.000    0.032    0.000 {built-in method builtins.len}
+        1    0.001    0.001    0.029    0.029 kmanapp.py:789(closeEvent)
+  642/641    0.015    0.000    0.029    0.000 {built-in method builtins.__build_class__}
+        1    0.000    0.000    0.027    0.027 ssl_.py:1(<module>)
+        1    0.000    0.000    0.027    0.027 url.py:1(<module>)
+    74930    0.026    0.000    0.026    0.000 {method 'row' of 'PySide2.QtCore.QModelIndex' objects}
+        1    0.000    0.000    0.025    0.025 utils.py:9(<module>)
+        1    0.000    0.000    0.025    0.025 multiarray.py:7(<module>)
+4818/4450    0.006    0.000    0.023    0.000 {built-in method builtins.hasattr}
+      102    0.000    0.000    0.023    0.000 sre_compile.py:598(_code)
+        1    0.000    0.000    0.022    0.022 overrides.py:1(<module>)
+    22490    0.022    0.000    0.022    0.000 {method 'search' of 're.Pattern' objects}
+        1    0.000    0.000    0.022    0.022 _internal_utils.py:9(<module>)
+        1    0.000    0.000    0.022    0.022 compat.py:9(<module>)
+      193    0.009    0.000    0.022    0.000 subprocess.py:1014(wait)
+        3    0.000    0.000    0.021    0.007 kman.py:543(dict2json)
+        3    0.000    0.000    0.021    0.007 __init__.py:183(dumps)
+        3    0.000    0.000    0.021    0.007 encoder.py:182(encode)
+        3    0.021    0.007    0.021    0.007 encoder.py:204(iterencode)
+      316    0.021    0.000    0.021    0.000 {built-in method builtins.compile}
+        1    0.000    0.000    0.019    0.019 kman.py:10(<module>)
+  997/102    0.006    0.000    0.018    0.000 sre_compile.py:71(_compile)
+        7    0.000    0.000    0.018    0.003 six.py:80(_import_module)
+        4    0.000    0.000    0.018    0.004 six.py:112(_resolve)
+        1    0.016    0.016    0.017    0.017 {method 'show' of 'PySide2.QtWidgets.QWidget' objects}
+        9    0.000    0.000    0.017    0.002 <frozen importlib._bootstrap>:433(spec_from_loader)
+       10    0.000    0.000    0.017    0.002 <frozen importlib._bootstrap>:873(_find_spec_legacy)
+        4    0.000    0.000    0.016    0.004 six.py:205(is_package)
+        1    0.000    0.000    0.016    0.016 six.py:115(__getattr__)
+     1359    0.001    0.000    0.016    0.000 <frozen importlib._bootstrap_external>:74(_path_stat)
+        1    0.000    0.000    0.016    0.016 index_tricks.py:1(<module>)
+       30    0.011    0.000    0.016    0.001 {method 'setVisible' of 'PySide2.QtWidgets.QWidget' objects}
+     1366    0.015    0.000    0.015    0.000 {built-in method posix.stat}
+        1    0.000    0.000    0.015    0.015 numeric.py:1(<module>)
+        1    0.014    0.014    0.015    0.015 six.py:21(<module>)
+      216    0.010    0.000    0.015    0.000 posixpath.py:75(join)
+        1    0.000    0.000    0.015    0.015 __init__.py:19(<module>)
+        1    0.000    0.000    0.014    0.014 _internal.py:6(<module>)
+    74918    0.014    0.000    0.014    0.000 {method 'column' of 'PySide2.QtCore.QModelIndex' objects}
+        1    0.000    0.000    0.014    0.014 universaldetector.py:36(<module>)
+        1    0.000    0.000    0.013    0.013 client.py:69(<module>)
+      276    0.007    0.000    0.013    0.000 <frozen importlib._bootstrap_external>:914(get_data)
+        1    0.000    0.000    0.013    0.013 __init__.py:10(<module>)
+      193    0.008    0.000    0.012    0.000 subprocess.py:1621(_wait)
+28844/28776    0.012    0.000    0.012    0.000 {method 'join' of 'str' objects}
+        1    0.000    0.000    0.012    0.012 platform.py:10(<module>)
+    40089    0.012    0.000    0.012    0.000 {built-in method builtins.isinstance}
+        1    0.000    0.000    0.012    0.012 (builtin):65(bootstrap)
+      384    0.012    0.000    0.012    0.000 {method 'close' of '_io.BufferedReader' objects}
+        1    0.000    0.000    0.012    0.012 py3k.py:12(<module>)
+      193    0.003    0.000    0.011    0.000 subprocess.py:1358(_get_handles)
+        2    0.000    0.000    0.011    0.006 shape_base.py:1(<module>)
+      578    0.011    0.000    0.011    0.000 {built-in method posix.pipe}
+        1    0.000    0.000    0.010    0.010 loader.py:43(<module>)
+        1    0.000    0.000    0.010    0.010 __init__.py:124(<module>)
+        1    0.000    0.000    0.010    0.010 _pickle.py:1(<module>)
+        1    0.000    0.000    0.009    0.009 cookiejar.py:26(<module>)
+        1    0.000    0.000    0.009    0.009 kman.py:123(__init__)
+        1    0.000    0.000    0.009    0.009 parser.py:5(<module>)
+      327    0.002    0.000    0.009    0.000 <frozen importlib._bootstrap>:504(_init_module_attrs)
+        2    0.000    0.000    0.009    0.004 platform.py:1061(system)
+        2    0.000    0.000    0.009    0.004 platform.py:923(uname)
+        1    0.000    0.000    0.009    0.009 feedparser.py:20(<module>)
+      771    0.009    0.000    0.009    0.000 {built-in method posix.close}
+        1    0.000    0.000    0.008    0.008 platform.py:780(_syscmd_uname)
+     3293    0.003    0.000    0.008    0.000 <frozen importlib._bootstrap_external>:56(_path_join)
+        1    0.000    0.000    0.008    0.008 zipfile.py:5(<module>)
+       13    0.000    0.000    0.008    0.001 enum.py:633(_convert)
+    11325    0.008    0.000    0.008    0.000 {method 'split' of 'str' objects}
+        1    0.000    0.000    0.008    0.008 defmatrix.py:1(<module>)
+     4378    0.008    0.000    0.008    0.000 {method 'write' of '_io.TextIOWrapper' objects}
+        1    0.000    0.000    0.007    0.007 tempfile.py:24(<module>)
+    46/42    0.000    0.000    0.007    0.000 <frozen importlib._bootstrap_external>:1048(exec_module)
+        1    0.000    0.000    0.007    0.007 mbcsgroupprober.py:30(<module>)
+      472    0.005    0.000    0.007    0.000 sre_compile.py:276(_optimize_charset)
+     7437    0.003    0.000    0.007    0.000 sre_parse.py:254(get)
+    46/42    0.002    0.000    0.007    0.000 {built-in method _imp.exec_dynamic}
+      255    0.000    0.000    0.007    0.000 enum.py:284(__call__)
+       11    0.007    0.001    0.007    0.001 kman.py:746(filter_words)
+        1    0.000    0.000    0.007    0.007 fromnumeric.py:3(<module>)
+        1    0.000    0.000    0.007    0.007 random.py:38(<module>)
+       17    0.003    0.000    0.007    0.000 enum.py:135(__new__)
+        1    0.000    0.000    0.007    0.007 ssl.py:91(<module>)
+        1    0.000    0.000    0.007    0.007 __init__.py:71(<module>)
+        1    0.000    0.000    0.006    0.006 _policybase.py:4(<module>)
+       33    0.006    0.000    0.006    0.000 {method 'connect' of 'PySide2.QtCore.SignalInstance' objects}
+       13    0.000    0.000    0.006    0.000 enum.py:389(_create_)
+    22490    0.006    0.000    0.006    0.000 {method 'group' of 're.Match' objects}
+      286    0.002    0.000    0.006    0.000 overrides.py:72(verify_matching_signatures)
+      276    0.006    0.000    0.006    0.000 {method 'read' of '_io.FileIO' objects}
+     7205    0.004    0.000    0.006    0.000 sre_parse.py:164(__getitem__)
+        1    0.000    0.000    0.006    0.006 __init__.py:15(<module>)
+        1    0.000    0.000    0.006    0.006 linalg.py:10(<module>)
+      351    0.001    0.000    0.006    0.000 <frozen importlib._bootstrap>:147(__enter__)
+        1    0.000    0.000    0.006    0.006 shutil.py:5(<module>)
+      418    0.000    0.000    0.006    0.000 <frozen importlib._bootstrap_external>:93(_path_isfile)
+      450    0.001    0.000    0.006    0.000 <frozen importlib._bootstrap_external>:84(_path_is_mode_type)
+     9468    0.005    0.000    0.005    0.000 sre_parse.py:233(__next)
+      552    0.002    0.000    0.005    0.000 <frozen importlib._bootstrap_external>:271(cache_from_source)
+      198    0.003    0.000    0.005    0.000 posixpath.py:154(dirname)
+        2    0.000    0.000    0.005    0.003 function_base.py:1(<module>)
+        1    0.000    0.000    0.005    0.005 pathlib.py:1(<module>)
+        1    0.000    0.000    0.005    0.005 defchararray.py:17(<module>)
+      732    0.001    0.000    0.005    0.000 <frozen importlib._bootstrap_external>:1203(_path_importer_cache)
+      191    0.005    0.000    0.005    0.000 {method 'showMessage' of 'PySide2.QtWidgets.QStatusBar' objects}
+      677    0.003    0.000    0.005    0.000 <frozen importlib._bootstrap>:157(_get_module_lock)
+        1    0.000    0.000    0.005    0.005 subprocess.py:42(<module>)
+      102    0.001    0.000    0.005    0.000 sre_compile.py:536(_compile_info)
+      598    0.001    0.000    0.005    0.000 <frozen importlib._bootstrap>:403(cached)
+    27084    0.005    0.000    0.005    0.000 {method 'append' of 'list' objects}
+    11246    0.004    0.000    0.004    0.000 {method 'groups' of 're.Match' objects}
+     2376    0.004    0.000    0.004    0.000 kmanapp.py:843(headerData)
+      422    0.003    0.000    0.004    0.000 posixpath.py:41(_get_sep)
+        1    0.000    0.000    0.004    0.004 _add_newdocs.py:10(<module>)
+        1    0.001    0.001    0.004    0.004 packages.py:1(<module>)
+     3293    0.003    0.000    0.004    0.000 <frozen importlib._bootstrap_external>:58(<listcomp>)
+       24    0.002    0.000    0.004    0.000 __init__.py:316(namedtuple)
+        1    0.000    0.000    0.004    0.004 socket.py:47(<module>)
+      199    0.002    0.000    0.004    0.000 codecs.py:319(decode)
+      616    0.001    0.000    0.004    0.000 _inspect.py:98(getargspec)
+      322    0.001    0.000    0.004    0.000 <frozen importlib._bootstrap_external>:369(_get_cached)
+      273    0.001    0.000    0.004    0.000 function_base.py:460(add_newdoc)
+        2    0.000    0.000    0.004    0.002 __init__.py:71(search_function)
+        1    0.000    0.000    0.004    0.004 sjisprober.py:28(<module>)
+     5597    0.004    0.000    0.004    0.000 {built-in method builtins.getattr}
+        1    0.000    0.000    0.004    0.004 inspect.py:27(<module>)
+       76    0.000    0.000    0.004    0.000 re.py:205(split)
+        1    0.000    0.000    0.004    0.004 __init__.py:97(<module>)
+      276    0.000    0.000    0.004    0.000 <frozen importlib._bootstrap_external>:951(path_stats)
+        1    0.000    0.000    0.004    0.004 hashlib.py:54(<module>)
+ 1131/239    0.003    0.000    0.004    0.000 sre_parse.py:174(getwidth)
+      193    0.001    0.000    0.004    0.000 subprocess.py:1608(_try_wait)
+        1    0.000    0.000    0.004    0.004 pickle.py:24(<module>)
+        1    0.000    0.000    0.004    0.004 threading.py:1(<module>)
+        1    0.000    0.000    0.003    0.003 core.py:21(<module>)
+        2    0.000    0.000    0.003    0.002 decoder.py:2(<module>)
+        1    0.000    0.000    0.003    0.003 _dtype_ctypes.py:24(<module>)
+        1    0.000    0.000    0.003    0.003 scimath.py:17(<module>)
+        1    0.000    0.000    0.003    0.003 os.py:980(popen)
+       19    0.000    0.000    0.003    0.000 kmanapp.py:349(convert_to_panda)
+        1    0.000    0.000    0.003    0.003 __init__.py:192(<module>)
+        1    0.000    0.000    0.003    0.003 cookies.py:127(<module>)
+        1    0.000    0.000    0.003    0.003 financial.py:12(<module>)
+        1    0.000    0.000    0.003    0.003 __init__.py:119(<module>)
+        1    0.000    0.000    0.003    0.003 header.py:5(<module>)
+        1    0.000    0.000    0.003    0.003 models.py:8(<module>)
+       19    0.003    0.000    0.003    0.000 mtable.py:19(dataframe)
+        1    0.000    0.000    0.003    0.003 request.py:68(<module>)
+        1    0.000    0.000    0.003    0.003 numerictypes.py:81(<module>)
+      197    0.002    0.000    0.003    0.000 codecs.py:309(__init__)
+      326    0.001    0.000    0.003    0.000 <frozen importlib._bootstrap>:194(_lock_unlock_module)
+        1    0.000    0.000    0.003    0.003 sbcsgroupprober.py:29(<module>)
+      106    0.003    0.000    0.003    0.000 {built-in method posix.getcwd}
+      322    0.001    0.000    0.003    0.000 <frozen importlib._bootstrap_external>:1351(_get_spec)
+        1    0.000    0.000    0.003    0.003 traceback.py:1(<module>)
+      193    0.002    0.000    0.003    0.000 os.py:806(fsencode)
+        1    0.000    0.000    0.003    0.003 chardistribution.py:28(<module>)
+        1    0.000    0.000    0.003    0.003 gbk.py:7(<module>)
+        1    0.000    0.000    0.003    0.003 typing.py:19(<module>)
+      342    0.001    0.000    0.003    0.000 functools.py:37(update_wrapper)
+       32    0.000    0.000    0.003    0.000 <frozen importlib._bootstrap_external>:1404(_fill_cache)
+        1    0.000    0.000    0.003    0.003 parseweb.py:88(bookInfoSpide)
+     3952    0.001    0.000    0.002    0.000 sre_parse.py:249(match)
+        1    0.000    0.000    0.002    0.002 npyio.py:1(<module>)
+      612    0.002    0.000    0.002    0.000 _inspect.py:67(getargs)
+        1    0.000    0.000    0.002    0.002 linecache.py:6(<module>)
+        1    0.000    0.000    0.002    0.002 core.py:1(<module>)
+      193    0.002    0.000    0.002    0.000 {built-in method posix.waitpid}
+        1    0.000    0.000    0.002    0.002 __init__.py:24(<module>)
+        1    0.000    0.000    0.002    0.002 utils.py:5(<module>)
+      677    0.002    0.000    0.002    0.000 <frozen importlib._bootstrap>:78(acquire)
+        2    0.000    0.000    0.002    0.001 request.py:1(<module>)
+      193    0.002    0.000    0.002    0.000 subprocess.py:875(__del__)
+      196    0.002    0.000    0.002    0.000 {built-in method builtins.sorted}
+        1    0.000    0.000    0.002    0.002 _pocketfft.py:29(<module>)
+       23    0.000    0.000    0.002    0.000 overrides.py:206(decorator)
+        1    0.000    0.000    0.002    0.002 type_check.py:3(<module>)
+      327    0.001    0.000    0.002    0.000 <frozen importlib._bootstrap>:318(__exit__)
+        2    0.000    0.000    0.002    0.001 scanner.py:2(<module>)
+        1    0.000    0.000    0.002    0.002 api.py:11(<module>)
+       32    0.002    0.000    0.002    0.000 {built-in method posix.listdir}
+      677    0.002    0.000    0.002    0.000 <frozen importlib._bootstrap>:103(release)
+      193    0.002    0.000    0.002    0.000 subprocess.py:240(_cleanup)
+      875    0.002    0.000    0.002    0.000 {built-in method __new__ of type object at 0x100fe3e30}
+      199    0.002    0.000    0.002    0.000 {built-in method _codecs.utf_8_decode}
+        1    0.000    0.000    0.002    0.002 signal.py:1(<module>)
+        1    0.000    0.000    0.002    0.002 tokenize.py:21(<module>)
+      323    0.001    0.000    0.002    0.000 <frozen importlib._bootstrap_external>:574(spec_from_file_location)
+        1    0.000    0.000    0.002    0.002 decimal.py:2(<module>)
+      192    0.002    0.000    0.002    0.000 {method 'setText' of 'PySide2.QtWidgets.QLabel' objects}
+      351    0.000    0.000    0.002    0.000 <frozen importlib._bootstrap>:151(__exit__)
+      137    0.000    0.000    0.002    0.000 sre_parse.py:96(closegroup)
+        1    0.000    0.000    0.002    0.002 message.py:5(<module>)
+      188    0.001    0.000    0.002    0.000 sre_compile.py:411(_mk_bitmap)
+        1    0.000    0.000    0.002    0.002 datetime.py:5(<module>)
+       39    0.000    0.000    0.002    0.000 abc.py:125(__new__)
+     3550    0.002    0.000    0.002    0.000 <frozen importlib._bootstrap>:222(_verbose_message)
+     4495    0.002    0.000    0.002    0.000 {method 'startswith' of 'str' objects}
+        1    0.000    0.000    0.002    0.002 polynomial.py:4(<module>)
+        1    0.000    0.000    0.002    0.002 dis.py:1(<module>)
+     2523    0.001    0.000    0.002    0.000 {built-in method builtins.setattr}
+       13    0.000    0.000    0.002    0.000 enum.py:654(<listcomp>)
+        1    0.000    0.000    0.002    0.002 pyopenssl.py:43(<module>)
+        1    0.000    0.000    0.002    0.002 nanfunctions.py:22(<module>)
+        1    0.000    0.000    0.002    0.002 mainwindow.py:11(<module>)
+        1    0.000    0.000    0.002    0.002 {method 'selectRow' of 'PySide2.QtWidgets.QTableView' objects}
+       14    0.000    0.000    0.001    0.000 hashlib.py:116(__get_openssl_constructor)
+       32    0.001    0.000    0.001    0.000 <frozen importlib._bootstrap_external>:1190(_path_hooks)
+      276    0.001    0.000    0.001    0.000 <frozen importlib._bootstrap_external>:438(_classify_pyc)
+        1    0.000    0.000    0.001    0.001 getlimits.py:96(_register_known_types)
+      251    0.001    0.000    0.001    0.000 enum.py:70(__setitem__)
+        1    0.000    0.000    0.001    0.001 polynomial.py:57(<module>)
+        1    0.001    0.001    0.001    0.001 kman.py:423(get_author_num)
+        1    0.000    0.000    0.001    0.001 sessions.py:9(<module>)
+        1    0.000    0.000    0.001    0.001 mapping.py:40(<module>)
+      893    0.001    0.000    0.001    0.000 {built-in method _thread.allocate_lock}
+      162    0.001    0.000    0.001    0.000 {method 'setIcon' of 'PySide2.QtGui.QStandardItem' objects}
+     7144    0.001    0.000    0.001    0.000 {method 'rstrip' of 'str' objects}
+        1    0.000    0.000    0.001    0.001 filepost.py:1(<module>)
+        5    0.000    0.000    0.001    0.000 six.py:90(__get__)
+     2546    0.001    0.000    0.001    0.000 sre_parse.py:160(__len__)
+        3    0.001    0.000    0.001    0.000 {method 'setWindowTitle' of 'PySide2.QtWidgets.QWidget' objects}
+        1    0.000    0.000    0.001    0.001 string.py:15(<module>)
+      570    0.000    0.000    0.001    0.000 sre_compile.py:423(_simple)
+       47    0.000    0.000    0.001    0.000 enum.py:442(_get_mixins_)
+        1    0.000    0.000    0.001    0.001 {method 'setSortingEnabled' of 'PySide2.QtWidgets.QTableView' objects}
+      193    0.001    0.000    0.001    0.000 subprocess.py:1555(_handle_exitstatus)
+        1    0.000    0.000    0.001    0.001 importhandler.py:40(<module>)
+        6    0.000    0.000    0.001    0.000 getlimits.py:37(__init__)
+        1    0.000    0.000    0.001    0.001 twodim_base.py:3(<module>)
+        8    0.000    0.000    0.001    0.000 hashlib.py:73(__get_builtin_constructor)
+        2    0.000    0.000    0.001    0.001 encoder.py:2(<module>)
+        1    0.000    0.000    0.001    0.001 charsetgroupprober.py:28(<module>)
+       47    0.001    0.000    0.001    0.000 enum.py:453(_find_data_type)
+     2921    0.001    0.000    0.001    0.000 {method 'rpartition' of 'str' objects}
+        1    0.000    0.000    0.001    0.001 kmanapp.py:857(sort)
+        1    0.000    0.000    0.001    0.001 parse.py:28(<module>)
+        1    0.000    0.000    0.001    0.001 kmanapp.py:429(table_item_selectionchanged)
+        1    0.000    0.000    0.001    0.001 _parseaddr.py:7(<module>)
+        1    0.000    0.000    0.001    0.001 string.py:65(__init__)
+        1    0.000    0.000    0.001    0.001 kmanapp.py:203(check_increase_books)
+      472    0.001    0.000    0.001    0.000 sre_compile.py:249(_compile_charset)
+      347    0.001    0.000    0.001    0.000 <frozen importlib._bootstrap>:58(__init__)
+        1    0.000    0.000    0.001    0.001 bz2.py:5(<module>)
+        1    0.000    0.000    0.001    0.001 lzma.py:9(<module>)
+      188    0.001    0.000    0.001    0.000 sre_compile.py:413(<listcomp>)
+     1676    0.001    0.000    0.001    0.000 sre_parse.py:286(tell)
+       51    0.000    0.000    0.001    0.000 typing.py:605(__init__)
+       37    0.001    0.000    0.001    0.000 {built-in method builtins.print}
+        1    0.000    0.000    0.001    0.001 ntpath.py:6(<module>)
+        1    0.000    0.000    0.001    0.001 mainwindow.py:170(retranslateUi)
+        1    0.000    0.000    0.001    0.001 kmanapp.py:205(<listcomp>)
+        1    0.000    0.000    0.001    0.001 kmanapp.py:436(table_item_clicked)
+        1    0.000    0.000    0.001    0.001 fields.py:1(<module>)
+      102    0.000    0.000    0.001    0.000 enum.py:836(__and__)
+      553    0.001    0.000    0.001    0.000 <frozen importlib._bootstrap_external>:62(_path_split)
+     1507    0.001    0.000    0.001    0.000 {built-in method posix.fspath}
+       32    0.000    0.000    0.001    0.000 <frozen importlib._bootstrap_external>:1445(path_hook_for_FileFinder)
+        1    0.000    0.000    0.001    0.001 arraysetops.py:27(<module>)
+        1    0.000    0.000    0.001    0.001 _type_aliases.py:24(<module>)
+     1782    0.001    0.000    0.001    0.000 sre_parse.py:172(append)
+      347    0.001    0.000    0.001    0.000 <frozen importlib._bootstrap>:176(cb)
+      770    0.001    0.000    0.001    0.000 <frozen importlib._bootstrap>:416(parent)
+        1    0.000    0.000    0.001    0.001 _methods.py:5(<module>)
+      828    0.000    0.000    0.001    0.000 <frozen importlib._bootstrap_external>:51(_r_long)
+      276    0.000    0.000    0.001    0.000 <frozen importlib._bootstrap_external>:471(_validate_timestamp_pyc)
+        1    0.000    0.000    0.001    0.001 secrets.py:7(<module>)
+       17    0.001    0.000    0.001    0.000 enum.py:177(<setcomp>)
+      197    0.001    0.000    0.001    0.000 codecs.py:260(__init__)
+        1    0.000    0.000    0.001    0.001 certs.py:14(<module>)
+        1    0.000    0.000    0.001    0.001 adapters.py:9(<module>)
+      350    0.001    0.000    0.001    0.000 {built-in method builtins.any}
+      192    0.001    0.000    0.001    0.000 subprocess.py:844(__enter__)
+        1    0.000    0.000    0.001    0.001 utils.py:1(<module>)
+        1    0.000    0.000    0.001    0.001 threading.py:834(start)
+        1    0.001    0.001    0.001    0.001 {method 'setModel' of 'PySide2.QtWidgets.QTreeView' objects}
+        2    0.000    0.000    0.001    0.000 queue.py:1(<module>)
+      323    0.001    0.000    0.001    0.000 enum.py:376(__setattr__)
+      193    0.001    0.000    0.001    0.000 {method 'rfind' of 'bytes' objects}
+        1    0.000    0.000    0.001    0.001 opcode.py:5(<module>)
+      348    0.000    0.000    0.001    0.000 sre_parse.py:408(_uniq)
+       38    0.000    0.000    0.001    0.000 typing.py:1199(_alias)
+        1    0.000    0.000    0.001    0.001 arrayprint.py:5(<module>)
+     2285    0.001    0.000    0.001    0.000 {built-in method builtins.min}
+      406    0.000    0.000    0.001    0.000 typing.py:706(__setattr__)
+        1    0.001    0.001    0.001    0.001 pickle.py:1024(_Unpickler)
+        1    0.000    0.000    0.001    0.001 charset.py:6(<module>)
+       30    0.000    0.000    0.001    0.000 getlimits.py:43(<lambda>)
+       19    0.001    0.000    0.001    0.000 kmanapp.py:821(__init__)
+     1026    0.000    0.000    0.001    0.000 <frozen importlib._bootstrap>:859(__exit__)
+        2    0.000    0.000    0.001    0.000 response.py:1(<module>)
+       44    0.000    0.000    0.001    0.000 core.py:145(get_object_signature)
+        3    0.000    0.000    0.001    0.000 warnings.py:130(filterwarnings)
+        1    0.000    0.000    0.001    0.001 idna.py:3(<module>)
+       76    0.001    0.000    0.001    0.000 {method 'split' of 're.Pattern' objects}
+     1181    0.001    0.000    0.001    0.000 sre_parse.py:111(__init__)
+        1    0.000    0.000    0.001    0.001 warnings.py:96(_showwarnmsg)
+        1    0.000    0.000    0.001    0.001 warnings.py:20(_showwarnmsg_impl)
+        1    0.001    0.001    0.001    0.001 {method 'addAction' of 'PySide2.QtWidgets.QMenu' objects}
+      273    0.000    0.000    0.001    0.000 function_base.py:446(_add_docstring)
+        1    0.000    0.000    0.001    0.001 threading.py:534(wait)
+        1    0.000    0.000    0.001    0.001 escprober.py:28(<module>)
+     1034    0.001    0.000    0.001    0.000 {method 'endswith' of 'str' objects}
+        1    0.000    0.000    0.001    0.001 warnings.py:117(_formatwarnmsg)
+        1    0.000    0.000    0.001    0.001 warnings.py:35(_formatwarnmsg_impl)
+        1    0.000    0.000    0.001    0.001 threading.py:264(wait)
+       26    0.000    0.000    0.001    0.000 core.py:6660(__init__)
+       30    0.001    0.000    0.001    0.000 {method 'itemFromIndex' of 'PySide2.QtGui.QStandardItemModel' objects}
+        1    0.000    0.000    0.001    0.001 cookiejar.py:1240(CookieJar)
+     1026    0.000    0.000    0.001    0.000 <frozen importlib._bootstrap>:855(__enter__)
+      211    0.001    0.000    0.001    0.000 {method 'encode' of 'str' objects}
+      162    0.001    0.000    0.001    0.000 {method 'appendRow' of 'PySide2.QtGui.QStandardItem' objects}
+        6    0.001    0.000    0.001    0.000 {method 'acquire' of '_thread.lock' objects}
+       52    0.000    0.000    0.001    0.000 core.py:900(__init__)
+       26    0.000    0.000    0.001    0.000 core.py:6665(getdoc)
+        1    0.000    0.000    0.001    0.001 linecache.py:15(getline)
+        1    0.000    0.000    0.001    0.001 request.py:940(AbstractBasicAuthHandler)
+        1    0.000    0.000    0.001    0.001 linecache.py:37(getlines)
+        1    0.000    0.000    0.001    0.001 linecache.py:82(updatecache)
+      530    0.001    0.000    0.001    0.000 {method 'strip' of 'str' objects}
+        1    0.000    0.000    0.001    0.001 struct.py:3(<module>)
+       30    0.001    0.000    0.001    0.000 {method 'indexes' of 'PySide2.QtCore.QItemSelection' objects}
+       30    0.001    0.000    0.001    0.000 {method 'selectedIndexes' of 'PySide2.QtWidgets.QTreeView' objects}
+      242    0.000    0.000    0.001    0.000 enum.py:526(__new__)
+       18    0.000    0.000    0.001    0.000 {built-in method builtins.next}
+     2050    0.001    0.000    0.001    0.000 {built-in method _imp.acquire_lock}
+    14/13    0.000    0.000    0.001    0.000 typing.py:248(inner)
+       15    0.000    0.000    0.001    0.000 arrayprint.py:1489(_array_str_implementation)
+        1    0.000    0.000    0.001    0.001 status_codes.py:21(<module>)
+        1    0.000    0.000    0.001    0.001 contextlib.py:107(__enter__)
+      252    0.000    0.000    0.001    0.000 sre_parse.py:343(_escape)
+        2    0.000    0.000    0.001    0.000 (builtin):79(ensure_shibokensupport)
+        1    0.000    0.000    0.001    0.001 errors.py:5(<module>)
+        1    0.000    0.000    0.001    0.001 exceptions.py:8(<module>)
+        4    0.001    0.000    0.001    0.000 {method 'addWidget' of 'PySide2.QtWidgets.QSplitter' objects}
+        1    0.000    0.000    0.001    0.001 ctypeslib.py:51(<module>)
+        1    0.000    0.000    0.001    0.001 status_codes.py:107(_init)
+        1    0.000    0.000    0.001    0.001 extras.py:10(<module>)
+        1    0.000    0.000    0.001    0.001 error.py:12(<module>)
+     1660    0.001    0.000    0.001    0.000 {method 'find' of 'bytearray' objects}
+     2050    0.001    0.000    0.001    0.000 {built-in method _imp.release_lock}
+        1    0.000    0.000    0.001    0.001 scanner.py:5(_import_c_make_scanner)
+       15    0.000    0.000    0.001    0.000 arrayprint.py:477(wrapper)
+        1    0.000    0.000    0.001    0.001 pickle.py:181(<listcomp>)
+      616    0.000    0.000    0.000    0.000 _inspect.py:15(ismethod)
+        1    0.000    0.000    0.000    0.000 poolmanager.py:1(<module>)
+   120/93    0.000    0.000    0.000    0.000 sre_compile.py:461(_get_literal_prefix)
+        1    0.000    0.000    0.000    0.000 histograms.py:3(<module>)
+        1    0.000    0.000    0.000    0.000 selectors.py:5(<module>)
+        1    0.000    0.000    0.000    0.000 copy.py:49(<module>)
+       16    0.000    0.000    0.000    0.000 enum.py:830(__or__)
+      347    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:369(__init__)
+        1    0.000    0.000    0.000    0.000 kman.py:406(get_bookname_num)
+      277    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:401(_check_name_wrapper)
+        4    0.000    0.000    0.000    0.000 core.py:122(doc_note)
+      102    0.000    0.000    0.000    0.000 re.py:170(match)
+      162    0.000    0.000    0.000    0.000 {method 'setAccessibleDescription' of 'PySide2.QtGui.QStandardItem' objects}
+        1    0.000    0.000    0.000    0.000 utf8prober.py:28(<module>)
+        1    0.000    0.000    0.000    0.000 bisect.py:1(<module>)
+        5    0.000    0.000    0.000    0.000 textwrap.py:414(dedent)
+        1    0.000    0.000    0.000    0.000 {method 'selectedIndexes' of 'PySide2.QtWidgets.QTableView' objects}
+       15    0.000    0.000    0.000    0.000 arrayprint.py:1482(_guarded_repr_or_str)
+        1    0.000    0.000    0.000    0.000 {method 'setMenuBar' of 'PySide2.QtWidgets.QMainWindow' objects}
+        2    0.000    0.000    0.000    0.000 __init__.py:1069(__init__)
+      276    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:35(_new_module)
+      633    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:36(_relax_case)
+      337    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:792(find_spec)
+      102    0.000    0.000    0.000    0.000 sre_parse.py:224(__init__)
+       32    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:98(_path_isdir)
+        1    0.000    0.000    0.000    0.000 numbers.py:6(<module>)
+        1    0.000    0.000    0.000    0.000 kman.py:392(get_totalnum_nt)
+        1    0.000    0.000    0.000    0.000 encoders.py:5(<module>)
+       17    0.000    0.000    0.000    0.000 {method 'setSectionResizeMode' of 'PySide2.QtWidgets.QHeaderView' objects}
+       39    0.000    0.000    0.000    0.000 {built-in method _abc._abc_init}
+        9    0.000    0.000    0.000    0.000 {method 'addAction' of 'PySide2.QtWidgets.QToolBar' objects}
+      276    0.000    0.000    0.000    0.000 {built-in method _imp._fix_co_filename}
+        6    0.000    0.000    0.000    0.000 {method 'data' of 'PySide2.QtCore.QModelIndex' objects}
+      829    0.000    0.000    0.000    0.000 {built-in method from_bytes}
+       19    0.000    0.000    0.000    0.000 _add_newdocs.py:6738(add_newdoc_for_scalar_type)
+       32    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:1319(__init__)
+      137    0.000    0.000    0.000    0.000 sre_parse.py:84(opengroup)
+        1    0.000    0.000    0.000    0.000 ufunclike.py:5(<module>)
+       40    0.000    0.000    0.000    0.000 _inspect.py:142(formatargspec)
+     1508    0.000    0.000    0.000    0.000 {method 'get' of 'dict' objects}
+        1    0.000    0.000    0.000    0.000 mimetypes.py:24(<module>)
+      342    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:719(find_spec)
+        1    0.000    0.000    0.000    0.000 socks.py:36(<module>)
+      193    0.000    0.000    0.000    0.000 {built-in method posix.WIFSIGNALED}
+        1    0.000    0.000    0.000    0.000 __init__.py:5(HTTPStatus)
+     1371    0.000    0.000    0.000    0.000 {built-in method _thread.get_ident}
+        2    0.000    0.000    0.000    0.000 posixpath.py:391(realpath)
+        1    0.000    0.000    0.000    0.000 universaldetector.py:51(UniversalDetector)
+      273    0.000    0.000    0.000    0.000 function_base.py:428(_needs_add_docstring)
+      616    0.000    0.000    0.000    0.000 sre_parse.py:168(__setitem__)
+      149    0.000    0.000    0.000    0.000 sre_parse.py:295(_class_escape)
+      327    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:311(__enter__)
+        5    0.000    0.000    0.000    0.000 re.py:185(sub)
+      348    0.000    0.000    0.000    0.000 {built-in method fromkeys}
+        6    0.000    0.000    0.000    0.000 enum.py:793(_missing_)
+        6    0.000    0.000    0.000    0.000 enum.py:800(_create_pseudo_member_)
+        1    0.000    0.000    0.000    0.000 stride_tricks.py:7(<module>)
+      406    0.000    0.000    0.000    0.000 typing.py:592(_is_dunder)
+       50    0.000    0.000    0.000    0.000 _internal.py:784(_ufunc_doc_signature_formatter)
+      527    0.000    0.000    0.000    0.000 {method 'add' of 'set' objects}
+        1    0.000    0.000    0.000    0.000 calendar.py:6(<module>)
+      389    0.000    0.000    0.000    0.000 {method 'extend' of 'list' objects}
+      616    0.000    0.000    0.000    0.000 _inspect.py:28(isfunction)
+       71    0.000    0.000    0.000    0.000 {method 'text' of 'PySide2.QtGui.QStandardItem' objects}
+     2496    0.000    0.000    0.000    0.000 {built-in method builtins.ord}
+     2582    0.000    0.000    0.000    0.000 {method 'setdefault' of 'dict' objects}
+       26    0.000    0.000    0.000    0.000 core.py:927(__init__)
+      336    0.000    0.000    0.000    0.000 functools.py:67(wraps)
+        1    0.000    0.000    0.000    0.000 _encoded_words.py:6(<module>)
+       20    0.000    0.000    0.000    0.000 {method 'selectionModel' of 'PySide2.QtWidgets.QAbstractItemView' objects}
+        3    0.000    0.000    0.000    0.000 socket.py:162(__repr__)
+        1    0.000    0.000    0.000    0.000 message.py:105(Message)
+        1    0.000    0.000    0.000    0.000 einsumfunc.py:4(<module>)
+      395    0.000    0.000    0.000    0.000 {method 'update' of 'dict' objects}
+        1    0.000    0.000    0.000    0.000 ctypeslib.py:359(_get_scalar_type_map)
+        6    0.000    0.000    0.000    0.000 enum.py:872(_decompose)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:7(<module>)
+        1    0.000    0.000    0.000    0.000 helper.py:4(<module>)
+        1    0.000    0.000    0.000    0.000 ctypeslib.py:370(<dictcomp>)
+        1    0.000    0.000    0.000    0.000 tokenize.py:443(open)
+      612    0.000    0.000    0.000    0.000 _inspect.py:43(iscode)
+        1    0.000    0.000    0.000    0.000 retry.py:1(<module>)
+       17    0.000    0.000    0.000    0.000 enum.py:125(__prepare__)
+       32    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:1433(<setcomp>)
+     1304    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:321(<genexpr>)
+       18    0.000    0.000    0.000    0.000 core.py:1003(__init__)
+        1    0.000    0.000    0.000    0.000 kman.py:788(get_book_word_num)
+      475    0.000    0.000    0.000    0.000 mtable.py:49(get_columns)
+      193    0.000    0.000    0.000    0.000 {method 'rstrip' of 'bytes' objects}
+        1    0.000    0.000    0.000    0.000 getlimits.py:3(<module>)
+        1    0.000    0.000    0.000    0.000 auth.py:8(<module>)
+        2    0.000    0.000    0.000    0.000 posixpath.py:400(_joinrealpath)
+        1    0.000    0.000    0.000    0.000 cookiejar.py:1976(MozillaCookieJar)
+      480    0.000    0.000    0.000    0.000 sre_parse.py:81(groups)
+        1    0.000    0.000    0.000    0.000 {built-in method _hashlib.openssl_md5}
+      106    0.000    0.000    0.000    0.000 {built-in method numpy.array}
+      102    0.000    0.000    0.000    0.000 {built-in method _sre.compile}
+        1    0.000    0.000    0.000    0.000 ast.py:26(<module>)
+       17    0.000    0.000    0.000    0.000 enum.py:474(_find_new_)
+      351    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:143(__init__)
+      337    0.000    0.000    0.000    0.000 {built-in method _imp.is_frozen}
+        1    0.000    0.000    0.000    0.000 _iotools.py:3(<module>)
+      251    0.000    0.000    0.000    0.000 enum.py:26(_is_dunder)
+       12    0.000    0.000    0.000    0.000 datetime.py:473(__new__)
+      207    0.000    0.000    0.000    0.000 enum.py:18(_is_descriptor)
+       29    0.000    0.000    0.000    0.000 {method 'accessibleDescription' of 'PySide2.QtGui.QStandardItem' objects}
+        4    0.000    0.000    0.000    0.000 typing.py:623(__getitem__)
+        1    0.000    0.000    0.000    0.000 _type_aliases.py:115(_add_aliases)
+        1    0.000    0.000    0.000    0.000 hmac.py:4(<module>)
+        2    0.000    0.000    0.000    0.000 random.py:88(__init__)
+      327    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:307(__init__)
+        1    0.000    0.000    0.000    0.000 records.py:35(<module>)
+        1    0.000    0.000    0.000    0.000 quoprimime.py:27(<module>)
+       69    0.000    0.000    0.000    0.000 status_codes.py:120(<genexpr>)
+      277    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:884(__init__)
+        1    0.000    0.000    0.000    0.000 random.py:97(seed)
+       30    0.000    0.000    0.000    0.000 getlimits.py:42(<lambda>)
+        6    0.000    0.000    0.000    0.000 enum.py:890(<listcomp>)
+        1    0.000    0.000    0.000    0.000 arraypad.py:5(<module>)
+        2    0.000    0.000    0.000    0.000 __init__.py:1111(_open)
+       72    0.000    0.000    0.000    0.000 sre_compile.py:492(_get_charset_prefix)
+        1    0.000    0.000    0.000    0.000 {function Random.seed at 0x1015138c0}
+      108    0.000    0.000    0.000    0.000 {method 'copy' of 'dict' objects}
+       11    0.000    0.000    0.000    0.000 abc.py:130(register)
+        1    0.000    0.000    0.000    0.000 contextlib.py:71(inner)
+      251    0.000    0.000    0.000    0.000 enum.py:34(_is_sunder)
+        6    0.000    0.000    0.000    0.000 numeric.py:2388(extend_all)
+        1    0.000    0.000    0.000    0.000 cookies.py:10(<module>)
+        6    0.000    0.000    0.000    0.000 posixpath.py:376(abspath)
+        6    0.000    0.000    0.000    0.000 genericpath.py:16(exists)
+        1    0.000    0.000    0.000    0.000 structures.py:8(<module>)
+        1    0.000    0.000    0.000    0.000 {method 'setStretchLastSection' of 'PySide2.QtWidgets.QHeaderView' objects}
+       68    0.000    0.000    0.000    0.000 status_codes.py:114(doc)
+        1    0.000    0.000    0.000    0.000 core.py:6358(__new__)
+        6    0.000    0.000    0.000    0.000 {method 'sibling' of 'PySide2.QtCore.QModelIndex' objects}
+      193    0.000    0.000    0.000    0.000 subprocess.py:1573(_internal_poll)
+        9    0.000    0.000    0.000    0.000 __init__.py:1928(getLogger)
+      221    0.000    0.000    0.000    0.000 socket.py:91(<lambda>)
+        1    0.000    0.000    0.000    0.000 os.py:1006(close)
+      218    0.000    0.000    0.000    0.000 socket.py:76(<lambda>)
+        4    0.000    0.000    0.000    0.000 typing.py:180(_subs_tvars)
+       11    0.000    0.000    0.000    0.000 {built-in method _abc._abc_register}
+       10    0.000    0.000    0.000    0.000 extras.py:237(__init__)
+       30    0.000    0.000    0.000    0.000 {method 'model' of 'PySide2.QtCore.QModelIndex' objects}
+      110    0.000    0.000    0.000    0.000 {built-in method _imp.is_builtin}
+       55    0.000    0.000    0.000    0.000 kmanapp.py:187(eventFilter)
+      124    0.000    0.000    0.000    0.000 types.py:164(__get__)
+      945    0.000    0.000    0.000    0.000 {method 'isupper' of 'str' objects}
+        7    0.000    0.000    0.000    0.000 __init__.py:1216(getLogger)
+       10    0.000    0.000    0.000    0.000 extras.py:241(getdoc)
+        1    0.000    0.000    0.000    0.000 hermite.py:60(<module>)
+        3    0.000    0.000    0.000    0.000 loader.py:112(finish_import)
+        1    0.000    0.000    0.000    0.000 chebyshev.py:89(<module>)
+        1    0.000    0.000    0.000    0.000 _polybase.py:8(<module>)
+        5    0.000    0.000    0.000    0.000 __init__.py:802(__init__)
+      220    0.000    0.000    0.000    0.000 socket.py:86(<lambda>)
+    26/12    0.000    0.000    0.000    0.000 abc.py:141(__subclasscheck__)
+        1    0.000    0.000    0.000    0.000 typing.py:1487(IO)
+        4    0.000    0.000    0.000    0.000 typing.py:821(__class_getitem__)
+      204    0.000    0.000    0.000    0.000 sre_compile.py:595(isstring)
+        1    0.000    0.000    0.000    0.000 mixins.py:1(<module>)
+        2    0.000    0.000    0.000    0.000 threading.py:763(__init__)
+      316    0.000    0.000    0.000    0.000 overrides.py:124(array_function_dispatch)
+        3    0.000    0.000    0.000    0.000 importhandler.py:65(finish_import)
+      219    0.000    0.000    0.000    0.000 socket.py:81(<lambda>)
+        8    0.000    0.000    0.000    0.000 core.py:7996(__init__)
+        1    0.000    0.000    0.000    0.000 connection.py:108(_has_ipv6)
+        1    0.000    0.000    0.000    0.000 _collections.py:1(<module>)
+        1    0.000    0.000    0.000    0.000 polyutils.py:45(<module>)
+        1    0.000    0.000    0.000    0.000 legendre.py:83(<module>)
+    26/12    0.000    0.000    0.000    0.000 {built-in method _abc._abc_subclasscheck}
+        1    0.000    0.000    0.000    0.000 laguerre.py:60(<module>)
+       10    0.000    0.000    0.000    0.000 {method 'setIcon' of 'PySide2.QtWidgets.QAction' objects}
+        1    0.000    0.000    0.000    0.000 enums.py:5(<module>)
+      102    0.000    0.000    0.000    0.000 sre_parse.py:76(__init__)
+        5    0.000    0.000    0.000    0.000 typing.py:635(copy_with)
+        1    0.000    0.000    0.000    0.000 hermite_e.py:60(<module>)
+        1    0.000    0.000    0.000    0.000 layout.py:40(<module>)
+       56    0.000    0.000    0.000    0.000 typing.py:165(_collect_type_vars)
+       10    0.000    0.000    0.000    0.000 {method 'setText' of 'PySide2.QtWidgets.QAction' objects}
+        1    0.000    0.000    0.000    0.000 {built-in method _thread.start_new_thread}
+      102    0.000    0.000    0.000    0.000 sre_parse.py:897(fix_flags)
+        1    0.000    0.000    0.000    0.000 pathlib.py:615(PurePath)
+        1    0.000    0.000    0.000    0.000 _string_helpers.py:5(<module>)
+        1    0.000    0.000    0.000    0.000 pyscript:1(<module>)
+        8    0.000    0.000    0.000    0.000 core.py:8001(getdoc)
+        3    0.000    0.000    0.000    0.000 tokenize.py:132(_all_string_prefixes)
+      298    0.000    0.000    0.000    0.000 {built-in method numpy.core._multiarray_umath.add_docstring}
+      491    0.000    0.000    0.000    0.000 {method 'lower' of 'str' objects}
+       16    0.000    0.000    0.000    0.000 _type_aliases.py:79(bitname)
+        5    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:740(create_module)
+        7    0.000    0.000    0.000    0.000 posixpath.py:168(islink)
+      435    0.000    0.000    0.000    0.000 {method 'items' of 'dict' objects}
+      184    0.000    0.000    0.000    0.000 sre_compile.py:65(_combine_flags)
+        1    0.000    0.000    0.000    0.000 _datasource.py:36(<module>)
+        1    0.000    0.000    0.000    0.000 __init__.py:259(_reset_cache)
+        1    0.000    0.000    0.000    0.000 _compat_pickle.py:9(<module>)
+        1    0.000    0.000    0.000    0.000 _ufunc_config.py:5(<module>)
+        1    0.000    0.000    0.000    0.000 numbers.py:147(Real)
+       19    0.000    0.000    0.000    0.000 {method 'sort' of 'list' objects}
+        4    0.000    0.000    0.000    0.000 typing.py:241(_tp_cache)
+        1    0.000    0.000    0.000    0.000 _endian.py:1(<module>)
+      188    0.000    0.000    0.000    0.000 {method 'translate' of 'bytearray' objects}
+      4/3    0.000    0.000    0.000    0.000 {method 'view' of 'numpy.ndarray' objects}
+       88    0.000    0.000    0.000    0.000 six.py:137(__init__)
+       83    0.000    0.000    0.000    0.000 {built-in method builtins.repr}
+        1    0.000    0.000    0.000    0.000 quoprimime.py:55(<listcomp>)
+        1    0.000    0.000    0.000    0.000 _globals.py:17(<module>)
+        3    0.000    0.000    0.000    0.000 __init__.py:73(CFUNCTYPE)
+      323    0.000    0.000    0.000    0.000 {method 'get' of 'mappingproxy' objects}
+      112    0.000    0.000    0.000    0.000 {method 'match' of 're.Pattern' objects}
+        3    0.000    0.000    0.000    0.000 _bootlocale.py:33(getpreferredencoding)
+       36    0.000    0.000    0.000    0.000 getlimits.py:41(<lambda>)
+        1    0.000    0.000    0.000    0.000 mixins.py:63(NDArrayOperatorsMixin)
+        1    0.000    0.000    0.000    0.000 (builtin):89(<genexpr>)
+        2    0.000    0.000    0.000    0.000 __init__.py:991(__init__)
+      193    0.000    0.000    0.000    0.000 {built-in method posix.WIFEXITED}
+      515    0.000    0.000    0.000    0.000 {built-in method builtins.chr}
+        5    0.000    0.000    0.000    0.000 {built-in method _imp.create_builtin}
+        6    0.000    0.000    0.000    0.000 core.py:1152(__init__)
+        1    0.000    0.000    0.000    0.000 _string_helpers.py:9(<listcomp>)
+        1    0.000    0.000    0.000    0.000 {method 'readlines' of '_io._IOBase' objects}
+      327    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:424(has_location)
+       15    0.000    0.000    0.000    0.000 sre_parse.py:267(getuntil)
+        1    0.000    0.000    0.000    0.000 _compression.py:1(<module>)
+        1    0.000    0.000    0.000    0.000 kmanapp.py:217(add_ui_component)
+        1    0.000    0.000    0.000    0.000 opcode.py:37(<listcomp>)
+        1    0.000    0.000    0.000    0.000 response.py:7(<module>)
+        1    0.000    0.000    0.000    0.000 umath.py:7(<module>)
+        1    0.000    0.000    0.000    0.000 getlimits.py:444(iinfo)
+        1    0.000    0.000    0.000    0.000 random.py:72(Random)
+        2    0.000    0.000    0.000    0.000 core.py:2938(__array_finalize__)
+        4    0.000    0.000    0.000    0.000 {method 'addSeparator' of 'PySide2.QtWidgets.QToolBar' objects}
+        6    0.000    0.000    0.000    0.000 functools.py:492(decorating_function)
+        5    0.000    0.000    0.000    0.000 sre_compile.py:416(_bytes_to_codes)
+       14    0.000    0.000    0.000    0.000 __init__.py:139(_check_size)
+        7    0.000    0.000    0.000    0.000 {built-in method posix.lstat}
+        1    0.000    0.000    0.000    0.000 loader.py:191(move_into_pyside_package)
+        1    0.000    0.000    0.000    0.000 deprecated.py:75(fix_for_QtGui)
+        1    0.000    0.000    0.000    0.000 stringprep.py:6(<module>)
+       67    0.000    0.000    0.000    0.000 signal.py:10(<lambda>)
+        1    0.000    0.000    0.000    0.000 request.py:611(BaseHandler)
+       30    0.000    0.000    0.000    0.000 getlimits.py:27(_fr1)
+        1    0.000    0.000    0.000    0.000 utils.py:147(deprecate)
+        1    0.000    0.000    0.000    0.000 structures.py:15(CaseInsensitiveDict)
+       13    0.000    0.000    0.000    0.000 _dtype_ctypes.py:97(dtype_from_ctypes_type)
+        1    0.000    0.000    0.000    0.000 core.py:2717(MaskedArray)
+       10    0.000    0.000    0.000    0.000 typing.py:846(__init_subclass__)
+        1    0.000    0.000    0.000    0.000 tokenize.py:350(detect_encoding)
+        1    0.000    0.000    0.000    0.000 {method 'addToolBar' of 'PySide2.QtWidgets.QMainWindow' objects}
+       58    0.000    0.000    0.000    0.000 __init__.py:20(__new__)
+        3    0.000    0.000    0.000    0.000 socket.py:432(family)
+        1    0.000    0.000    0.000    0.000 cookies.py:164(<dictcomp>)
+      3/2    0.000    0.000    0.000    0.000 typing.py:340(__getitem__)
+        1    0.000    0.000    0.000    0.000 __init__.py:236(_sanity_check)
+        1    0.000    0.000    0.000    0.000 core.py:3087(view)
+       12    0.000    0.000    0.000    0.000 loader.py:131(put_into_package)
+        1    0.000    0.000    0.000    0.000 {method 'setWindowIcon' of 'PySide2.QtWidgets.QWidget' objects}
+        6    0.000    0.000    0.000    0.000 posixpath.py:338(normpath)
+        1    0.000    0.000    0.000    0.000 pathlib.py:119(_WindowsFlavour)
+        1    0.000    0.000    0.000    0.000 enum_sig.py:40(<module>)
+       26    0.000    0.000    0.000    0.000 {method 'setObjectName' of 'PySide2.QtCore.QObject' objects}
+        1    0.000    0.000    0.000    0.000 typing.py:438(ForwardRef)
+      193    0.000    0.000    0.000    0.000 {built-in method posix.WEXITSTATUS}
+        1    0.000    0.000    0.000    0.000 memmap.py:1(<module>)
+        1    0.000    0.000    0.000    0.000 utils.py:75(__call__)
+        1    0.000    0.000    0.000    0.000 core.py:2782(__new__)
+        1    0.000    0.000    0.000    0.000 token.py:1(<module>)
+        1    0.000    0.000    0.000    0.000 _policybase.py:99(_extend_docstrings)
+       19    0.000    0.000    0.000    0.000 typing.py:113(_type_check)
+        1    0.000    0.000    0.000    0.000 os.py:42(_get_exports_list)
+      192    0.000    0.000    0.000    0.000 sre_compile.py:453(_get_iscased)
+        8    0.000    0.000    0.000    0.000 _ufunc_config.py:39(seterr)
+       18    0.000    0.000    0.000    0.000 {method 'horizontalHeader' of 'PySide2.QtWidgets.QTableView' objects}
+        4    0.000    0.000    0.000    0.000 ssl.py:367(__new__)
+      277    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:909(get_filename)
+      256    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:1325(<genexpr>)
+        1    0.000    0.000    0.000    0.000 pathlib.py:1005(Path)
+        3    0.000    0.000    0.000    0.000 __init__.py:489(PYFUNCTYPE)
+        3    0.000    0.000    0.000    0.000 {built-in method _locale.nl_langinfo}
+       25    0.000    0.000    0.000    0.000 {built-in method translate}
+        1    0.000    0.000    0.000    0.000 typing.py:746(__getitem__)
+       13    0.000    0.000    0.000    0.000 mixins.py:48(_numeric_methods)
+       10    0.000    0.000    0.000    0.000 {method 'sub' of 're.Pattern' objects}
+      203    0.000    0.000    0.000    0.000 {built-in method builtins.issubclass}
+        1    0.000    0.000    0.000    0.000 jpcntx.py:31(<module>)
+       20    0.000    0.000    0.000    0.000 {method 'verticalHeader' of 'PySide2.QtWidgets.QTableView' objects}
+        4    0.000    0.000    0.000    0.000 contextlib.py:210(contextmanager)
+       21    0.000    0.000    0.000    0.000 sre_compile.py:432(_generate_overlap_table)
+       15    0.000    0.000    0.000    0.000 sre_parse.py:258(getwhile)
+       16    0.000    0.000    0.000    0.000 _type_aliases.py:66(_bits_of)
+       60    0.000    0.000    0.000    0.000 {method 'copy' of 'numpy.ndarray' objects}
+        4    0.000    0.000    0.000    0.000 _ufunc_config.py:441(__enter__)
+        1    0.000    0.000    0.000    0.000 eucjpprober.py:28(<module>)
+      276    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:719(create_module)
+        2    0.000    0.000    0.000    0.000 __init__.py:43(normalize_encoding)
+      122    0.000    0.000    0.000    0.000 ssl.py:149(<lambda>)
+       17    0.000    0.000    0.000    0.000 enum.py:335(__getattr__)
+       90    0.000    0.000    0.000    0.000 _inspect.py:133(strseq)
+       59    0.000    0.000    0.000    0.000 _inspect.py:146(<lambda>)
+        6    0.000    0.000    0.000    0.000 socket.py:97(_intenum_converter)
+        1    0.000    0.000    0.000    0.000 typing.py:1597(TextIO)
+        1    0.000    0.000    0.000    0.000 threading.py:1185(__init__)
+       78    0.000    0.000    0.000    0.000 _internal.py:795(<genexpr>)
+       11    0.000    0.000    0.000    0.000 {method 'currentIndex' of 'PySide2.QtWidgets.QAbstractItemView' objects}
+        3    0.000    0.000    0.000    0.000 __init__.py:831(createLock)
+      122    0.000    0.000    0.000    0.000 ssl.py:144(<lambda>)
+        1    0.000    0.000    0.000    0.000 gbk.py:30(getregentry)
+        2    0.000    0.000    0.000    0.000 {built-in method builtins.dir}
+        2    0.000    0.000    0.000    0.000 {built-in method posix.uname}
+        1    0.000    0.000    0.000    0.000 token.py:78(<dictcomp>)
+        1    0.000    0.000    0.000    0.000 arrayterator.py:9(<module>)
+      122    0.000    0.000    0.000    0.000 ssl.py:124(<lambda>)
+        1    0.000    0.000    0.000    0.000 ssl.py:158(TLSVersion)
+       17    0.000    0.000    0.000    0.000 enum.py:152(<dictcomp>)
+        1    0.000    0.000    0.000    0.000 typing.py:762(__getitem_inner__)
+        1    0.000    0.000    0.000    0.000 core.py:6376(__array_finalize__)
+        7    0.000    0.000    0.000    0.000 __init__.py:1267(_fixupParents)
+        1    0.000    0.000    0.000    0.000 timeout.py:1(<module>)
+        1    0.000    0.000    0.000    0.000 response.py:623(closed)
+        1    0.000    0.000    0.000    0.000 sbcharsetprober.py:29(<module>)
+      183    0.000    0.000    0.000    0.000 {built-in method builtins.max}
+       10    0.000    0.000    0.000    0.000 warnings.py:181(_add_filter)
+        1    0.000    0.000    0.000    0.000 ssl.py:801(SSLSocket)
+        1    0.000    0.000    0.000    0.000 gb2312prober.py:28(<module>)
+       43    0.000    0.000    0.000    0.000 {method 'replace' of 'str' objects}
+      364    0.000    0.000    0.000    0.000 {built-in method builtins.globals}
+        4    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:634(_load_backward_compatible)
+        1    0.000    0.000    0.000    0.000 {method 'addItems' of 'PySide2.QtWidgets.QComboBox' objects}
+        1    0.000    0.000    0.000    0.000 {built-in method connectSlotsByName}
+        1    0.000    0.000    0.000    0.000 kman.py:121(kMan)
+      122    0.000    0.000    0.000    0.000 ssl.py:129(<lambda>)
+        7    0.000    0.000    0.000    0.000 warnings.py:165(simplefilter)
+      122    0.000    0.000    0.000    0.000 ssl.py:134(<lambda>)
+        1    0.000    0.000    0.000    0.000 fields.py:73(<dictcomp>)
+        1    0.000    0.000    0.000    0.000 idnadata.py:3(<module>)
+       10    0.000    0.000    0.000    0.000 typing.py:535(__init__)
+        1    0.000    0.000    0.000    0.000 typing.py:1583(BinaryIO)
+        1    0.000    0.000    0.000    0.000 _type_aliases.py:154(_add_integer_aliases)
+        1    0.000    0.000    0.000    0.000 _type_aliases.py:246(_set_array_types)
+       30    0.000    0.000    0.000    0.000 getlimits.py:19(_fr0)
+        1    0.000    0.000    0.000    0.000 inspect.py:2407(_ParameterKind)
+        4    0.000    0.000    0.000    0.000 {built-in method _ssl.txt2obj}
+       27    0.000    0.000    0.000    0.000 enum.py:907(_power_of_two)
+      257    0.000    0.000    0.000    0.000 hmac.py:17(<genexpr>)
+      122    0.000    0.000    0.000    0.000 ssl.py:139(<lambda>)
+        1    0.000    0.000    0.000    0.000 latin1prober.py:29(<module>)
+        1    0.000    0.000    0.000    0.000 cp949prober.py:28(<module>)
+      175    0.000    0.000    0.000    0.000 {method 'isidentifier' of 'str' objects}
+        2    0.000    0.000    0.000    0.000 typing.py:1177(__class_getitem__)
+        2    0.000    0.000    0.000    0.000 {built-in method _ctypes.POINTER}
+        1    0.000    0.000    0.000    0.000 utils.py:133(_get_indent)
+        1    0.000    0.000    0.000    0.000 charsetprober.py:29(<module>)
+        1    0.000    0.000    0.000    0.000 __config__.py:3(<module>)
+        4    0.000    0.000    0.000    0.000 {method 'addWidget' of 'PySide2.QtWidgets.QBoxLayout' objects}
+        1    0.000    0.000    0.000    0.000 typing.py:293(_SpecialForm)
+        1    0.000    0.000    0.000    0.000 numerictypes.py:593(_register_types)
+       17    0.000    0.000    0.000    0.000 enum.py:64(__init__)
+      160    0.000    0.000    0.000    0.000 __init__.py:388(<genexpr>)
+        1    0.000    0.000    0.000    0.000 pathlib.py:136(<setcomp>)
+        1    0.000    0.000    0.000    0.000 format.py:163(<module>)
+        1    0.000    0.000    0.000    0.000 _polybase.py:19(ABCPolyBase)
+      257    0.000    0.000    0.000    0.000 hmac.py:18(<genexpr>)
+        1    0.000    0.000    0.000    0.000 {method 'setStatusBar' of 'PySide2.QtWidgets.QMainWindow' objects}
+        1    0.000    0.000    0.000    0.000 mbcharsetprober.py:30(<module>)
+       95    0.000    0.000    0.000    0.000 abc.py:7(abstractmethod)
+        2    0.000    0.000    0.000    0.000 threading.py:499(__init__)
+        1    0.000    0.000    0.000    0.000 datetime.py:2136(timezone)
+        1    0.000    0.000    0.000    0.000 machar.py:7(<module>)
+        1    0.000    0.000    0.000    0.000 tool.py:40(<module>)
+       51    0.000    0.000    0.000    0.000 six.py:173(_add_module)
+       54    0.000    0.000    0.000    0.000 {method 'translate' of 'str' objects}
+        1    0.000    0.000    0.000    0.000 linalg.py:82(_determine_error_states)
+       44    0.000    0.000    0.000    0.000 six.py:103(__init__)
+        1    0.000    0.000    0.000    0.000 mbcssm.py:28(<module>)
+        1    0.000    0.000    0.000    0.000 euckrprober.py:28(<module>)
+        1    0.000    0.000    0.000    0.000 big5prober.py:28(<module>)
+        1    0.000    0.000    0.000    0.000 euctwprober.py:28(<module>)
+      189    0.000    0.000    0.000    0.000 status_codes.py:115(<genexpr>)
+       46    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:1029(__init__)
+        2    0.000    0.000    0.000    0.000 os.py:684(__setitem__)
+        1    0.000    0.000    0.000    0.000 _version.py:7(<module>)
+        8    0.000    0.000    0.000    0.000 __init__.py:1336(__init__)
+        1    0.000    0.000    0.000    0.000 numerictypes.py:445(_construct_lookups)
+        1    0.000    0.000    0.000    0.000 socket.py:416(close)
+       36    0.000    0.000    0.000    0.000 _add_newdocs.py:6744(<genexpr>)
+        5    0.000    0.000    0.000    0.000 __init__.py:783(_addHandlerRef)
+        2    0.000    0.000    0.000    0.000 __init__.py:1349(setLevel)
+        1    0.000    0.000    0.000    0.000 codingstatemachine.py:28(<module>)
+        1    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:1459(_fix_up_module)
+        1    0.000    0.000    0.000    0.000 typing.py:596(_GenericAlias)
+       84    0.000    0.000    0.000    0.000 overrides.py:105(decorator)
+       36    0.000    0.000    0.000    0.000 _string_helpers.py:16(english_lower)
+        1    0.000    0.000    0.000    0.000 deprecated.py:41(<module>)
+        1    0.000    0.000    0.000    0.000 socket.py:412(_real_close)
+        1    0.000    0.000    0.000    0.000 wait.py:1(<module>)
+       23    0.000    0.000    0.000    0.000 {built-in method _struct.calcsize}
+        7    0.000    0.000    0.000    0.000 getlimits.py:497(__init__)
+        1    0.000    0.000    0.000    0.000 {method 'addLayout' of 'PySide2.QtWidgets.QGridLayout' objects}
+       20    0.000    0.000    0.000    0.000 {method 'hide' of 'PySide2.QtWidgets.QWidget' objects}
+        1    0.000    0.000    0.000    0.000 response.py:155(HTTPResponse)
+        1    0.000    0.000    0.000    0.000 hebrewprober.py:28(<module>)
+      132    0.000    0.000    0.000    0.000 six.py:87(__init__)
+       12    0.000    0.000    0.000    0.000 {built-in method builtins.round}
+        5    0.000    0.000    0.000    0.000 os.py:676(__getitem__)
+        3    0.000    0.000    0.000    0.000 datetime.py:1517(__new__)
+        1    0.000    0.000    0.000    0.000 _pytesttester.py:29(<module>)
+        2    0.000    0.000    0.000    0.000 codecs.py:94(__new__)
+        1    0.000    0.000    0.000    0.000 _asarray.py:5(<module>)
+        1    0.000    0.000    0.000    0.000 __init__.py:340(__init__)
+        2    0.000    0.000    0.000    0.000 core.py:6541(__init__)
+        2    0.000    0.000    0.000    0.000 os.py:690(__delitem__)
+        4    0.000    0.000    0.000    0.000 _collections_abc.py:664(__contains__)
+        1    0.000    0.000    0.000    0.000 __future__.py:48(<module>)
+        1    0.000    0.000    0.000    0.000 {function socket.close at 0x10be6bf80}
+        1    0.000    0.000    0.000    0.000 socket.py:139(__init__)
+        1    0.000    0.000    0.000    0.000 ssl.py:383(Purpose)
+        6    0.000    0.000    0.000    0.000 six.py:123(__init__)
+        9    0.000    0.000    0.000    0.000 {method 'remove' of 'list' objects}
+      135    0.000    0.000    0.000    0.000 enum.py:659(<lambda>)
+        1    0.000    0.000    0.000    0.000 _add_newdocs.py:6702(numeric_type_aliases)
+      119    0.000    0.000    0.000    0.000 opcode.py:39(def_op)
+       21    0.000    0.000    0.000    0.000 __init__.py:212(_acquireLock)
+        1    0.000    0.000    0.000    0.000 socket.py:133(socket)
+        2    0.000    0.000    0.000    0.000 threading.py:216(__init__)
+        4    0.000    0.000    0.000    0.000 _ufunc_config.py:446(__exit__)
+        1    0.000    0.000    0.000    0.000 kmanapp_rc.py:6(<module>)
+        1    0.000    0.000    0.000    0.000 {method 'mapToGlobal' of 'PySide2.QtWidgets.QWidget' objects}
+        1    0.000    0.000    0.000    0.000 {method 'start' of 'PySide2.QtCore.QTimer' objects}
+        1    0.000    0.000    0.000    0.000 __init__.py:1140(__init__)
+        5    0.000    0.000    0.000    0.000 {method 'cast' of 'memoryview' objects}
+        1    0.000    0.000    0.000    0.000 {method 'close' of '_io.TextIOWrapper' objects}
+        8    0.000    0.000    0.000    0.000 posixpath.py:64(isabs)
+        1    0.000    0.000    0.000    0.000 kmanapp.py:68(kmanWindow)
+        4    0.000    0.000    0.000    0.000 layout.py:84(__init__)
+        1    0.000    0.000    0.000    0.000 layout.py:134(define_nameless_parameter)
+        1    0.000    0.000    0.000    0.000 {method 'header' of 'PySide2.QtWidgets.QTreeView' objects}
+        3    0.000    0.000    0.000    0.000 __init__.py:242(_register_at_fork_reinit_lock)
+        1    0.000    0.000    0.000    0.000 _appengine_environ.py:12(is_appengine_sandbox)
+      207    0.000    0.000    0.000    0.000 {method 'items' of 'collections.OrderedDict' objects}
+      154    0.000    0.000    0.000    0.000 {method 'upper' of 'str' objects}
+       81    0.000    0.000    0.000    0.000 enum.py:623(name)
+       84    0.000    0.000    0.000    0.000 overrides.py:94(set_module)
+       30    0.000    0.000    0.000    0.000 _type_aliases.py:238(_add_array_type)
+        1    0.000    0.000    0.000    0.000 polynomial.py:1442(Polynomial)
+       12    0.000    0.000    0.000    0.000 {method 'clearSelection' of 'PySide2.QtWidgets.QAbstractItemView' objects}
+        7    0.000    0.000    0.000    0.000 {method 'setOpenExternalLinks' of 'PySide2.QtWidgets.QTextBrowser' objects}
+        1    0.000    0.000    0.000    0.000 uu.py:31(<module>)
+        1    0.000    0.000    0.000    0.000 _appengine_environ.py:8(is_appengine)
+        1    0.000    0.000    0.000    0.000 errors.py:2(<module>)
+       74    0.000    0.000    0.000    0.000 {method 'pop' of 'dict' objects}
+        9    0.000    0.000    0.000    0.000 typing.py:631(<genexpr>)
+        2    0.000    0.000    0.000    0.000 datetime.py:646(__neg__)
+       16    0.000    0.000    0.000    0.000 _string_helpers.py:72(english_capitalize)
+        6    0.000    0.000    0.000    0.000 _exceptions.py:17(_display_as_base)
+       13    0.000    0.000    0.000    0.000 _dtype_ctypes.py:69(_from_ctypes_scalar)
+       34    0.000    0.000    0.000    0.000 {built-in method sys._getframe}
+        2    0.000    0.000    0.000    0.000 {built-in method posix.putenv}
+        5    0.000    0.000    0.000    0.000 {method 'findall' of 're.Pattern' objects}
+        6    0.000    0.000    0.000    0.000 codecs.py:186(__init__)
+        1    0.000    0.000    0.000    0.000 fnmatch.py:11(<module>)
+        1    0.000    0.000    0.000    0.000 mtable.py:11(<module>)
+       20    0.000    0.000    0.000    0.000 mixins.py:20(_binary_method)
+        3    0.000    0.000    0.000    0.000 ufunclike.py:60(_fix_and_maybe_deprecate_out_named_y)
+       15    0.000    0.000    0.000    0.000 ssl.py:795(_sslcopydoc)
+      160    0.000    0.000    0.000    0.000 {method '__contains__' of 'frozenset' objects}
+       11    0.000    0.000    0.000    0.000 os.py:754(encode)
+        1    0.000    0.000    0.000    0.000 os.py:1079(__subclasshook__)
+      113    0.000    0.000    0.000    0.000 typing.py:615(<genexpr>)
+       32    0.000    0.000    0.000    0.000 _type_aliases.py:68(<genexpr>)
+        3    0.000    0.000    0.000    0.000 ufunclike.py:43(_fix_out_named_y)
+        2    0.000    0.000    0.000    0.000 __init__.py:1304(_clear_cache)
+       92    0.000    0.000    0.000    0.000 {method 'items' of 'mappingproxy' objects}
+        5    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:748(exec_module)
+        1    0.000    0.000    0.000    0.000 os.py:46(<listcomp>)
+        1    0.000    0.000    0.000    0.000 _dtype.py:5(<module>)
+        2    0.000    0.000    0.000    0.000 __init__.py:40(<module>)
+       32    0.000    0.000    0.000    0.000 {method 'keys' of 'dict' objects}
+        1    0.000    0.000    0.000    0.000 typing.py:789(Generic)
+        8    0.000    0.000    0.000    0.000 _ufunc_config.py:139(geterr)
+       18    0.000    0.000    0.000    0.000 _add_newdocs.py:6703(type_aliases_gen)
+        1    0.000    0.000    0.000    0.000 raw_json.py:2(<module>)
+       43    0.000    0.000    0.000    0.000 enum.py:628(value)
+        5    0.000    0.000    0.000    0.000 _weakrefset.py:81(add)
+        2    0.000    0.000    0.000    0.000 tokenize.py:374(read_or_stop)
+        1    0.000    0.000    0.000    0.000 base64.py:3(<module>)
+       20    0.000    0.000    0.000    0.000 tokenize.py:107(group)
+        1    0.000    0.000    0.000    0.000 <__array_function__ internals>:2(concatenate)
+        1    0.000    0.000    0.000    0.000 _iotools.py:499(StringConverter)
+        3    0.000    0.000    0.000    0.000 {method 'getsockname' of '_socket.socket' objects}
+        1    0.000    0.000    0.000    0.000 ssl.py:390(SSLContext)
+        6    0.000    0.000    0.000    0.000 _policybase.py:94(_append_doc)
+        1    0.000    0.000    0.000    0.000 escsm.py:28(<module>)
+        5    0.000    0.000    0.000    0.000 {method 'tolist' of 'memoryview' objects}
+        1    0.000    0.000    0.000    0.000 contextlib.py:70(__call__)
+       53    0.000    0.000    0.000    0.000 enum.py:198(<genexpr>)
+       24    0.000    0.000    0.000    0.000 tokenize.py:143(<listcomp>)
+        2    0.000    0.000    0.000    0.000 {built-in method numpy.core._multiarray_umath.implement_array_function}
+        1    0.000    0.000    0.000    0.000 _type_aliases.py:95(_add_types)
+        1    0.000    0.000    0.000    0.000 platform.py:1253(python_implementation)
+       10    0.000    0.000    0.000    0.000 {method 'setToolTip' of 'PySide2.QtWidgets.QAction' objects}
+       29    0.000    0.000    0.000    0.000 {method 'setter' of 'property' objects}
+        7    0.000    0.000    0.000    0.000 typing.py:666(__hash__)
+        1    0.000    0.000    0.000    0.000 parser.py:40(<module>)
+       21    0.000    0.000    0.000    0.000 __init__.py:221(_releaseLock)
+        1    0.000    0.000    0.000    0.000 datetime.py:1509(datetime)
+        1    0.000    0.000    0.000    0.000 kmanapp_rc.py:49347(qInitResources)
+        4    0.000    0.000    0.000    0.000 six.py:191(load_module)
+        1    0.000    0.000    0.000    0.000 calendar.py:50(_localized_month)
+        1    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap_external>:711(is_package)
+        1    0.000    0.000    0.000    0.000 typing.py:742(_VariadicGenericAlias)
+        8    0.000    0.000    0.000    0.000 typing.py:829(<genexpr>)
+        1    0.000    0.000    0.000    0.000 typing.py:1363(__new__)
+        2    0.000    0.000    0.000    0.000 datetime.py:1187(__new__)
+        1    0.000    0.000    0.000    0.000 numeric.py:159(ones)
+        1    0.000    0.000    0.000    0.000 platform.py:1149(_sys_version)
+        2    0.000    0.000    0.000    0.000 core.py:2912(_update_from)
+        1    0.000    0.000    0.000    0.000 errorhandler.py:40(<module>)
+        1    0.000    0.000    0.000    0.000 {method 'pos' of 'PySide2.QtGui.QContextMenuEvent' objects}
+        1    0.000    0.000    0.000    0.000 request.py:323(Request)
+       19    0.000    0.000    0.000    0.000 {method 'rsplit' of 'str' objects}
+        1    0.000    0.000    0.000    0.000 {built-in method _warnings.warn}
+       83    0.000    0.000    0.000    0.000 {built-in method _sre.unicode_tolower}
+        1    0.000    0.000    0.000    0.000 abc.py:137(__instancecheck__)
+        6    0.000    0.000    0.000    0.000 enum.py:583(__str__)
+        5    0.000    0.000    0.000    0.000 datetime.py:396(_check_date_fields)
+        1    0.000    0.000    0.000    0.000 {method 'dot' of 'numpy.ndarray' objects}
+        2    0.000    0.000    0.000    0.000 arrayprint.py:474(decorating_function)
+        3    0.000    0.000    0.000    0.000 {method 'invisibleRootItem' of 'PySide2.QtGui.QStandardItemModel' objects}
+        2    0.000    0.000    0.000    0.000 __init__.py:502(__init__)
+        1    0.000    0.000    0.000    0.000 core.py:12(where)
+        2    0.000    0.000    0.000    0.000 {built-in method posix.unsetenv}
+        1    0.000    0.000    0.000    0.000 {method 'setCurrentText' of 'PySide2.QtWidgets.QComboBox' objects}
+        1    0.000    0.000    0.000    0.000 _appengine_environ.py:22(is_local_appengine)
+       60    0.000    0.000    0.000    0.000 {built-in method builtins.divmod}
+      103    0.000    0.000    0.000    0.000 {built-in method _sre.unicode_iscased}
+        1    0.000    0.000    0.000    0.000 _collections_abc.py:72(_check_methods)
+       21    0.000    0.000    0.000    0.000 enum.py:855(_high_bit)
+        1    0.000    0.000    0.000    0.000 abc.py:1(<module>)
+        1    0.000    0.000    0.000    0.000 _inspect.py:7(<module>)
+       13    0.000    0.000    0.000    0.000 mixins.py:40(_inplace_binary_method)
+        1    0.000    0.000    0.000    0.000 {built-in method PySide2.QtCore.qRegisterResourceData}
+        1    0.000    0.000    0.000    0.000 decoder.py:284(__init__)
+       18    0.000    0.000    0.000    0.000 {method 'rfind' of 'str' objects}
+       96    0.000    0.000    0.000    0.000 {built-in method builtins.abs}
+        2    0.000    0.000    0.000    0.000 {method 'readline' of '_io.BufferedReader' objects}
+        2    0.000    0.000    0.000    0.000 re.py:252(escape)
+        1    0.000    0.000    0.000    0.000 random.py:681(getrandbits)
+        1    0.000    0.000    0.000    0.000 threading.py:513(set)
+        5    0.000    0.000    0.000    0.000 datetime.py:409(_check_time_fields)
+        1    0.000    0.000    0.000    0.000 pickle.py:372(_Pickler)
+        1    0.000    0.000    0.000    0.000 numbers.py:32(Complex)
+        1    0.000    0.000    0.000    0.000 _type_aliases.py:187(_set_up_aliases)
+        1    0.000    0.000    0.000    0.000 ufunclike.py:18(_deprecate_out_named_y)
+       21    0.000    0.000    0.000    0.000 loader.py:121(_get_modname)
+       15    0.000    0.000    0.000    0.000 __init__.py:187(_checkLevel)
+        1    0.000    0.000    0.000    0.000 client.py:106(<dictcomp>)
+        1    0.000    0.000    0.000    0.000 client.py:413(close)
+        1    0.000    0.000    0.000    0.000 encoder.py:9(_import_speedups)
+        1    0.000    0.000    0.000    0.000 {built-in method _codecs_cn.getcodec}
+       25    0.000    0.000    0.000    0.000 {method 'insert' of 'list' objects}
+        1    0.000    0.000    0.000    0.000 zipfile.py:1182(ZipFile)
+        1    0.000    0.000    0.000    0.000 mtable.py:34(reverse)
+       35    0.000    0.000    0.000    0.000 datetime.py:379(_check_int_field)
+       85    0.000    0.000    0.000    0.000 _compat_pickle.py:167(<genexpr>)
+        1    0.000    0.000    0.000    0.000 numbers.py:294(Integral)
+       16    0.000    0.000    0.000    0.000 _string_helpers.py:44(english_upper)
+        1    0.000    0.000    0.000    0.000 _internal.py:241(_missing_ctypes)
+       13    0.000    0.000    0.000    0.000 _internal.py:830(npy_ctypes_check)
+        1    0.000    0.000    0.000    0.000 subprocess.py:633(Popen)
+       25    0.000    0.000    0.000    0.000 mapping.py:149(__init__)
+        1    0.000    0.000    0.000    0.000 {method 'setText' of 'PySide2.QtWidgets.QAbstractButton' objects}
+        3    0.000    0.000    0.000    0.000 {method 'resize' of 'PySide2.QtWidgets.QWidget' objects}
+        4    0.000    0.000    0.000    0.000 __init__.py:1526(addHandler)
+        2    0.000    0.000    0.000    0.000 charset.py:211(__init__)
+        5    0.000    0.000    0.000    0.000 {built-in method _imp.exec_builtin}
+        1    0.000    0.000    0.000    0.000 utf_8.py:33(getregentry)
+       16    0.000    0.000    0.000    0.000 enum.py:360(__members__)
+        4    0.000    0.000    0.000    0.000 sre_parse.py:837(_parse_flags)
+        2    0.000    0.000    0.000    0.000 tokenize.py:380(find_cookie)
+        1    0.000    0.000    0.000    0.000 defchararray.py:1810(chararray)
+        1    0.000    0.000    0.000    0.000 inspect.py:2435(Parameter)
+        3    0.000    0.000    0.000    0.000 socket.py:438(type)
+        3    0.000    0.000    0.000    0.000 six.py:155(_resolve)
+        1    0.000    0.000    0.000    0.000 client.py:227(HTTPResponse)
+        1    0.000    0.000    0.000    0.000 client.py:789(HTTPConnection)
+        1    0.000    0.000    0.000    0.000 gbk.py:12(Codec)
+        1    0.000    0.000    0.000    0.000 {built-in method _abc._abc_instancecheck}
+        5    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:232(_requires_builtin_wrapper)
+        1    0.000    0.000    0.000    0.000 kmanapp.py:818(nTableModel)
+        1    0.000    0.000    0.000    0.000 datetime.py:774(date)
+       27    0.000    0.000    0.000    0.000 _add_newdocs.py:6743(<genexpr>)
+        1    0.000    0.000    0.000    0.000 selectors.py:80(BaseSelector)
+        1    0.000    0.000    0.000    0.000 defmatrix.py:74(matrix)
+        1    0.000    0.000    0.000    0.000 hermite_e.py:1621(HermiteE)
+       12    0.000    0.000    0.000    0.000 opcode.py:43(name_op)
+        1    0.000    0.000    0.000    0.000 {method 'bind' of '_socket.socket' objects}
+        1    0.000    0.000    0.000    0.000 {method 'setIcon' of 'PySide2.QtWidgets.QAbstractButton' objects}
+       13    0.000    0.000    0.000    0.000 __init__.py:716(__init__)
+        1    0.000    0.000    0.000    0.000 base64mime.py:25(<module>)
+        1    0.000    0.000    0.000    0.000 quopri.py:3(<module>)
+        1    0.000    0.000    0.000    0.000 compat.py:2(<module>)
+        1    0.000    0.000    0.000    0.000 models.py:587(Response)
+       24    0.000    0.000    0.000    0.000 {built-in method sys.intern}
+       21    0.000    0.000    0.000    0.000 {method 'acquire' of '_thread.RLock' objects}
+        1    0.000    0.000    0.000    0.000 _collections_abc.py:657(get)
+        3    0.000    0.000    0.000    0.000 typing.py:774(<genexpr>)
+        2    0.000    0.000    0.000    0.000 datetime.py:804(__new__)
+        9    0.000    0.000    0.000    0.000 {built-in method numpy.seterrobj}
+       69    0.000    0.000    0.000    0.000 signal.py:22(<lambda>)
+        1    0.000    0.000    0.000    0.000 polynomial.py:1009(poly1d)
+        7    0.000    0.000    0.000    0.000 core.py:2562(_arraymethod)
+        1    0.000    0.000    0.000    0.000 __init__.py:632(BufferingFormatter)
+        1    0.000    0.000    0.000    0.000 calendar.py:52(<listcomp>)
+        1    0.000    0.000    0.000    0.000 connection.py:68(HTTPConnection)
+        1    0.000    0.000    0.000    0.000 cookies.py:253(Morsel)
+        1    0.000    0.000    0.000    0.000 weakref.py:102(__init__)
+        1    0.000    0.000    0.000    0.000 threading.py:744(Thread)
+       23    0.000    0.000    0.000    0.000 overrides.py:202(array_function_from_dispatcher)
+        1    0.000    0.000    0.000    0.000 datetime.py:454(timedelta)
+       14    0.000    0.000    0.000    0.000 mixins.py:30(_reflected_binary_method)
+        1    0.000    0.000    0.000    0.000 chebyshev.py:1966(Chebyshev)
+        1    0.000    0.000    0.000    0.000 hermite.py:1627(Hermite)
+        1    0.000    0.000    0.000    0.000 laguerre.py:1578(Laguerre)
+        1    0.000    0.000    0.000    0.000 inspect.py:2720(Signature)
+        3    0.000    0.000    0.000    0.000 {method 'getpeername' of '_socket.socket' objects}
+        1    0.000    0.000    0.000    0.000 {method 'addWidget' of 'PySide2.QtWidgets.QGridLayout' objects}
+        1    0.000    0.000    0.000    0.000 {method 'setCentralWidget' of 'PySide2.QtWidgets.QMainWindow' objects}
+        1    0.000    0.000    0.000    0.000 message.py:945(MIMEPart)
+        1    0.000    0.000    0.000    0.000 mimetypes.py:384(_default_mime_types)
+        1    0.000    0.000    0.000    0.000 cookies.py:171(RequestsCookieJar)
+       21    0.000    0.000    0.000    0.000 {method 'release' of '_thread.RLock' objects}
+        1    0.000    0.000    0.000    0.000 warnings.py:415(__init__)
+       45    0.000    0.000    0.000    0.000 __init__.py:5(<genexpr>)
+        2    0.000    0.000    0.000    0.000 {built-in method math.log}
+        2    0.000    0.000    0.000    0.000 typing.py:212(_remove_dups_flatten)
+        6    0.000    0.000    0.000    0.000 typing.py:351(<genexpr>)
+        1    0.000    0.000    0.000    0.000 <__array_function__ internals>:2(<module>)
+        4    0.000    0.000    0.000    0.000 _ufunc_config.py:437(__init__)
+        1    0.000    0.000    0.000    0.000 legendre.py:1613(Legendre)
+       12    0.000    0.000    0.000    0.000 loader.py:124(_set_modname)
+        1    0.000    0.000    0.000    0.000 ssl.py:642(SSLObject)
+        1    0.000    0.000    0.000    0.000 compat.py:22(<module>)
+        1    0.000    0.000    0.000    0.000 cookiejar.py:866(DefaultCookiePolicy)
+       22    0.000    0.000    0.000    0.000 {method 'mro' of 'type' objects}
+        1    0.000    0.000    0.000    0.000 {function HTTPResponse.close at 0x10bfbddd0}
+        1    0.000    0.000    0.000    0.000 os.py:1003(__init__)
+        6    0.000    0.000    0.000    0.000 typing.py:199(_check_generic)
+       12    0.000    0.000    0.000    0.000 typing.py:547(<genexpr>)
+        1    0.000    0.000    0.000    0.000 threading.py:358(notify_all)
+        1    0.000    0.000    0.000    0.000 {method 'view' of 'numpy.generic' objects}
+        1    0.000    0.000    0.000    0.000 pathlib.py:397(_NormalAccessor)
+        1    0.000    0.000    0.000    0.000 <__array_function__ internals>:2(copyto)
+       68    0.000    0.000    0.000    0.000 signal.py:17(<lambda>)
+        2    0.000    0.000    0.000    0.000 core.py:6440(__setattr__)
+        1    0.000    0.000    0.000    0.000 core.py:6348(MaskedConstant)
+        1    0.000    0.000    0.000    0.000 __init__.py:1321(Logger)
+        1    0.000    0.000    0.000    0.000 __init__.py:1682(LoggerAdapter)
+       10    0.000    0.000    0.000    0.000 six.py:180(find_module)
+        1    0.000    0.000    0.000    0.000 url.py:54(<listcomp>)
+        1    0.000    0.000    0.000    0.000 decoder.py:302(__init__)
+        1    0.000    0.000    0.000    0.000 request.py:1665(URLopener)
+        1    0.000    0.000    0.000    0.000 contextlib.py:237(helper)
+        1    0.000    0.000    0.000    0.000 zipfile.py:785(ZipExtFile)
+        1    0.000    0.000    0.000    0.000 {built-in method _hashlib.openssl_sha224}
+        5    0.000    0.000    0.000    0.000 typing.py:682(__mro_entries__)
+        1    0.000    0.000    0.000    0.000 mtable.py:13(__init__)
+        1    0.000    0.000    0.000    0.000 datetime.py:1162(time)
+        3    0.000    0.000    0.000    0.000 datetime.py:2156(_create)
+        4    0.000    0.000    0.000    0.000 <string>:1(__new__)
+        4    0.000    0.000    0.000    0.000 getlimits.py:521(max)
+        9    0.000    0.000    0.000    0.000 _pytesttester.py:77(__init__)
+        1    0.000    0.000    0.000    0.000 __init__.py:793(Handler)
+        1    0.000    0.000    0.000    0.000 _policybase.py:112(Policy)
+        1    0.000    0.000    0.000    0.000 _encoded_words.py:73(_QByteMap)
+        1    0.000    0.000    0.000    0.000 iterators.py:5(<module>)
+        1    0.000    0.000    0.000    0.000 retry.py:161(__init__)
+        1    0.000    0.000    0.000    0.000 retry.py:29(Retry)
+       27    0.000    0.000    0.000    0.000 {method 'lstrip' of 'str' objects}
+        1    0.000    0.000    0.000    0.000 {built-in method posix.urandom}
+        1    0.000    0.000    0.000    0.000 enum.py:42(_make_class_unpicklable)
+        1    0.000    0.000    0.000    0.000 contextlib.py:116(__exit__)
+        6    0.000    0.000    0.000    0.000 functools.py:458(lru_cache)
+        2    0.000    0.000    0.000    0.000 _weakrefset.py:36(__init__)
+        5    0.000    0.000    0.000    0.000 typing.py:300(__new__)
+        4    0.000    0.000    0.000    0.000 threading.py:75(RLock)
+        1    0.000    0.000    0.000    0.000 threading.py:335(notify)
+        1    0.000    0.000    0.000    0.000 threading.py:899(_set_tstate_lock)
+        1    0.000    0.000    0.000    0.000 parse.py:348(_fix_result_transcoding)
+       43    0.000    0.000    0.000    0.000 _compat_pickle.py:165(<genexpr>)
+       16    0.000    0.000    0.000    0.000 _dtype.py:36(_kind_name)
+       38    0.000    0.000    0.000    0.000 {built-in method _ctypes.sizeof}
+        1    0.000    0.000    0.000    0.000 npyio.py:122(NpzFile)
+        1    0.000    0.000    0.000    0.000 layout.py:64(SignatureLayout)
+        1    0.000    0.000    0.000    0.000 __init__.py:49(check_compatibility)
+        1    0.000    0.000    0.000    0.000 queue.py:27(Queue)
+        1    0.000    0.000    0.000    0.000 mimetypes.py:58(MimeTypes)
+        1    0.000    0.000    0.000    0.000 escprober.py:35(EscCharSetProber)
+        1    0.000    0.000    0.000    0.000 langcyrillicmodel.py:31(<module>)
+        1    0.000    0.000    0.000    0.000 models.py:272(PreparedRequest)
+        3    0.000    0.000    0.000    0.000 {built-in method posix.register_at_fork}
+        6    0.000    0.000    0.000    0.000 {method 'end' of 're.Match' objects}
+        1    0.000    0.000    0.000    0.000 contextlib.py:81(__init__)
+        1    0.000    0.000    0.000    0.000 tempfile.py:627(SpooledTemporaryFile)
+        1    0.000    0.000    0.000    0.000 typing.py:1321(SupportsAbs)
+        1    0.000    0.000    0.000    0.000 bz2.py:28(BZ2File)
+        1    0.000    0.000    0.000    0.000 lzma.py:38(LZMAFile)
+        1    0.000    0.000    0.000    0.000 threading.py:1142(setDaemon)
+       18    0.000    0.000    0.000    0.000 {built-in method numpy.geterrobj}
+        1    0.000    0.000    0.000    0.000 pathlib.py:135(<setcomp>)
+        1    0.000    0.000    0.000    0.000 pathlib.py:470(_Selector)
+        1    0.000    0.000    0.000    0.000 _ufunc_config.py:452(_setdef)
+        2    0.000    0.000    0.000    0.000 arrayprint.py:1562(set_string_function)
+        1    0.000    0.000    0.000    0.000 _datasource.py:272(DataSource)
+        1    0.000    0.000    0.000    0.000 core.py:6152(mvoid)
+        1    0.000    0.000    0.000    0.000 (builtin):55(<module>)
+        7    0.000    0.000    0.000    0.000 opcode.py:47(jrel_op)
+        1    0.000    0.000    0.000    0.000 {method 'setVisible' of 'PySide2.QtWidgets.QHeaderView' objects}
+        1    0.000    0.000    0.000    0.000 {method 'setIconSize' of 'PySide2.QtWidgets.QMainWindow' objects}
+        2    0.000    0.000    0.000    0.000 {method 'sizePolicy' of 'PySide2.QtWidgets.QWidget' objects}
+        1    0.000    0.000    0.000    0.000 {method 'globalPos' of 'PySide2.QtGui.QContextMenuEvent' objects}
+        1    0.000    0.000    0.000    0.000 __init__.py:1291(_fixupChildren)
+        1    0.000    0.000    0.000    0.000 connectionpool.py:103(HTTPConnectionPool)
+        1    0.000    0.000    0.000    0.000 connectionpool.py:852(HTTPSConnectionPool)
+        1    0.000    0.000    0.000    0.000 six.py:496(Module_six_moves_urllib)
+        1    0.000    0.000    0.000    0.000 _collections.py:30(RecentlyUsedContainer)
+        1    0.000    0.000    0.000    0.000 _collections.py:106(HTTPHeaderDict)
+        1    0.000    0.000    0.000    0.000 chardistribution.py:40(CharDistributionAnalysis)
+        1    0.000    0.000    0.000    0.000 decoder.py:24(_floatconstants)
+        1    0.000    0.000    0.000    0.000 intranges.py:6(<module>)
+        2    0.000    0.000    0.000    0.000 {built-in method maketrans}
+       23    0.000    0.000    0.000    0.000 {method 'values' of 'dict' objects}
+       19    0.000    0.000    0.000    0.000 {built-in method builtins.vars}
+       26    0.000    0.000    0.000    0.000 {built-in method _sre.ascii_iscased}
+       12    0.000    0.000    0.000    0.000 sre_parse.py:162(__delitem__)
+        1    0.000    0.000    0.000    0.000 copyreg.py:12(pickle)
+        1    0.000    0.000    0.000    0.000 {built-in method math.exp}
+        7    0.000    0.000    0.000    0.000 typing.py:657(__eq__)
+        1    0.000    0.000    0.000    0.000 _type_aliases.py:63(<setcomp>)
+        1    0.000    0.000    0.000    0.000 __init__.py:427(LibraryLoader)
+        1    0.000    0.000    0.000    0.000 _internal.py:218(_getintp_ctype)
+        1    0.000    0.000    0.000    0.000 _internal.py:250(_ctypes)
+        1    0.000    0.000    0.000    0.000 _iotools.py:176(LineSplitter)
+        1    0.000    0.000    0.000    0.000 _iotools.py:276(NameValidator)
+        1    0.000    0.000    0.000    0.000 core.py:6649(_frommethod)
+        6    0.000    0.000    0.000    0.000 opcode.py:51(jabs_op)
+        1    0.000    0.000    0.000    0.000 {method 'setSelectionBehavior' of 'PySide2.QtWidgets.QAbstractItemView' objects}
+        1    0.000    0.000    0.000    0.000 {method 'setPlaceholderText' of 'PySide2.QtWidgets.QLineEdit' objects}
+        2    0.000    0.000    0.000    0.000 {method 'setSizePolicy' of 'PySide2.QtWidgets.QWidget' objects}
+        1    0.000    0.000    0.000    0.000 {method 'objectName' of 'PySide2.QtCore.QObject' objects}
+        1    0.000    0.000    0.000    0.000 __init__.py:1671(__init__)
+       10    0.000    0.000    0.000    0.000 _policybase.py:104(<genexpr>)
+        1    0.000    0.000    0.000    0.000 calendar.py:69(_localized_day)
+        1    0.000    0.000    0.000    0.000 hebrewprober.py:128(HebrewProber)
+        1    0.000    0.000    0.000    0.000 decoder.py:10(_import_c_scanstring)
+        1    0.000    0.000    0.000    0.000 encoder.py:141(__init__)
+        1    0.000    0.000    0.000    0.000 request.py:433(OpenerDirector)
+        1    0.000    0.000    0.000    0.000 error.py:35(HTTPError)
+        1    0.000    0.000    0.000    0.000 auth.py:79(HTTPBasicAuth)
+        1    0.000    0.000    0.000    0.000 sessions.py:96(SessionRedirectMixin)
+       21    0.000    0.000    0.000    0.000 {method 'bit_length' of 'int' objects}
+        5    0.000    0.000    0.000    0.000 {built-in method builtins.delattr}
+       15    0.000    0.000    0.000    0.000 {built-in method builtins.id}
+       25    0.000    0.000    0.000    0.000 {built-in method _sre.ascii_tolower}
+        1    0.000    0.000    0.000    0.000 os.py:1019(__getattr__)
+        1    0.000    0.000    0.000    0.000 __init__.py:42(__getattr__)
+       10    0.000    0.000    0.000    0.000 __future__.py:81(__init__)
+        1    0.000    0.000    0.000    0.000 {built-in method _hashlib.openssl_sha1}
+        2    0.000    0.000    0.000    0.000 threading.py:240(__enter__)
+        1    0.000    0.000    0.000    0.000 threading.py:728(_newname)
+        2    0.000    0.000    0.000    0.000 threading.py:1116(daemon)
+        1    0.000    0.000    0.000    0.000 threading.py:1131(daemon)
+        1    0.000    0.000    0.000    0.000 {built-in method numpy.empty}
+       15    0.000    0.000    0.000    0.000 _inspect.py:144(<lambda>)
+       16    0.000    0.000    0.000    0.000 _inspect.py:145(<lambda>)
+        1    0.000    0.000    0.000    0.000 pathlib.py:286(_PosixFlavour)
+        1    0.000    0.000    0.000    0.000 parse.py:205(_NetlocResultMixinBytes)
+        1    0.000    0.000    0.000    0.000 subprocess.py:60(CalledProcessError)
+        3    0.000    0.000    0.000    0.000 index_tricks.py:312(__init__)
+        1    0.000    0.000    0.000    0.000 extras.py:1522(__init__)
+        1    0.000    0.000    0.000    0.000 {method 'setGeometry' of 'PySide2.QtWidgets.QWidget' objects}
+        1    0.000    0.000    0.000    0.000 {method 'setMaximumSize' of 'PySide2.QtWidgets.QWidget' objects}
+        2    0.000    0.000    0.000    0.000 __init__.py:415(__init__)
+        1    0.000    0.000    0.000    0.000 socket.py:546(SocketIO)
+        5    0.000    0.000    0.000    0.000 six.py:177(_get_module)
+        1    0.000    0.000    0.000    0.000 parser.py:126(BytesHeaderParser)
+        1    0.000    0.000    0.000    0.000 calendar.py:148(Calendar)
+        1    0.000    0.000    0.000    0.000 calendar.py:293(TextCalendar)
+        1    0.000    0.000    0.000    0.000 _appengine_environ.py:28(is_prod_appengine)
+        1    0.000    0.000    0.000    0.000 url.py:82(Url)
+        1    0.000    0.000    0.000    0.000 timeout.py:19(Timeout)
+        1    0.000    0.000    0.000    0.000 charsetprober.py:35(CharSetProber)
+        1    0.000    0.000    0.000    0.000 request.py:1444(FileHandler)
+        1    0.000    0.000    0.000    0.000 request.py:2363(ftpwrapper)
+        1    0.000    0.000    0.000    0.000 response.py:14(addbase)
+        1    0.000    0.000    0.000    0.000 cookies.py:25(MockRequest)
+        1    0.000    0.000    0.000    0.000 sessions.py:337(Session)
+        1    0.000    0.000    0.000    0.000 {method 'expandtabs' of 'str' objects}
+       13    0.000    0.000    0.000    0.000 enum.py:901(<lambda>)
+        1    0.000    0.000    0.000    0.000 zipfile.py:313(ZipInfo)
+        1    0.000    0.000    0.000    0.000 {built-in method _hashlib.openssl_sha384}
+        1    0.000    0.000    0.000    0.000 {built-in method _hashlib.openssl_sha512}
+        1    0.000    0.000    0.000    0.000 _compression.py:33(DecompressReader)
+        1    0.000    0.000    0.000    0.000 mtable.py:11(mTable)
+        2    0.000    0.000    0.000    0.000 threading.py:255(_is_owned)
+        1    0.000    0.000    0.000    0.000 threading.py:567(Barrier)
+        1    0.000    0.000    0.000    0.000 _globals.py:67(__new__)
+        1    0.000    0.000    0.000    0.000 {method 'toordinal' of 'datetime.date' objects}
+        1    0.000    0.000    0.000    0.000 pathlib.py:1494(WindowsPath)
+        1    0.000    0.000    0.000    0.000 parse.py:142(_NetlocResultMixinBase)
+        1    0.000    0.000    0.000    0.000 numbers.py:267(Rational)
+        3    0.000    0.000    0.000    0.000 __init__.py:490(CFunctionType)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:302(AxisConcatenator)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:517(__init__)
+        1    0.000    0.000    0.000    0.000 hmac.py:26(HMAC)
+        1    0.000    0.000    0.000    0.000 core.py:909(_MaskedUnaryOperation)
+        1    0.000    0.000    0.000    0.000 core.py:1335(make_mask_descr)
+        4    0.000    0.000    0.000    0.000 core.py:3363(dtype)
+        1    0.000    0.000    0.000    0.000 inspect.py:2590(BoundArguments)
+        1    0.000    0.000    0.000    0.000 mapping.py:148(_Parameterized)
+        2    0.000    0.000    0.000    0.000 {method 'setHorizontalStretch' of 'PySide2.QtWidgets.QSizePolicy' objects}
+        2    0.000    0.000    0.000    0.000 {method 'setOrientation' of 'PySide2.QtWidgets.QSplitter' objects}
+        1    0.000    0.000    0.000    0.000 kman.py:801(Util)
+        1    0.000    0.000    0.000    0.000 __init__.py:982(StreamHandler)
+        1    0.000    0.000    0.000    0.000 exceptions.py:212(IncompleteRead)
+        8    0.000    0.000    0.000    0.000 six.py:185(__get_module)
+        1    0.000    0.000    0.000    0.000 client.py:425(flush)
+        1    0.000    0.000    0.000    0.000 feedparser.py:136(FeedParser)
+        1    0.000    0.000    0.000    0.000 errors.py:93(NonPrintableDefect)
+        1    0.000    0.000    0.000    0.000 calendar.py:72(<listcomp>)
+        1    0.000    0.000    0.000    0.000 calendar.py:558(LocaleTextCalendar)
+        1    0.000    0.000    0.000    0.000 mbcharsetprober.py:34(MultiByteCharSetProber)
+        1    0.000    0.000    0.000    0.000 sbcharsetprober.py:33(SingleByteCharSetProber)
+        1    0.000    0.000    0.000    0.000 request.py:2110(FancyURLopener)
+        1    0.000    0.000    0.000    0.000 adapters.py:84(HTTPAdapter)
+       10    0.000    0.000    0.000    0.000 {method '__init_subclass__' of 'object' objects}
+        7    0.000    0.000    0.000    0.000 {method 'partition' of 'str' objects}
+        7    0.000    0.000    0.000    0.000 {method 'isalnum' of 'str' objects}
+       10    0.000    0.000    0.000    0.000 {built-in method _warnings._filters_mutated}
+       10    0.000    0.000    0.000    0.000 {built-in method builtins.hash}
+        1    0.000    0.000    0.000    0.000 posixpath.py:52(normcase)
+        1    0.000    0.000    0.000    0.000 zipfile.py:1104(_ZipWriteFile)
+        1    0.000    0.000    0.000    0.000 tempfile.py:132(_RandomNameSequence)
+        1    0.000    0.000    0.000    0.000 {built-in method math.sqrt}
+        5    0.000    0.000    0.000    0.000 typing.py:279(__init_subclass__)
+        1    0.000    0.000    0.000    0.000 typing.py:1285(SupportsInt)
+        1    0.000    0.000    0.000    0.000 typing.py:1294(SupportsFloat)
+        1    0.000    0.000    0.000    0.000 threading.py:88(_RLock)
+        2    0.000    0.000    0.000    0.000 threading.py:243(__exit__)
+        1    0.000    0.000    0.000    0.000 threading.py:249(_release_save)
+        1    0.000    0.000    0.000    0.000 threading.py:252(_acquire_restore)
+        1    0.000    0.000    0.000    0.000 threading.py:204(Condition)
+        1    0.000    0.000    0.000    0.000 threading.py:1225(current_thread)
+        1    0.000    0.000    0.000    0.000 traceback.py:227(FrameSummary)
+        1    0.000    0.000    0.000    0.000 traceback.py:437(TracebackException)
+        9    0.000    0.000    0.000    0.000 _globals.py:77(__repr__)
+        1    0.000    0.000    0.000    0.000 version.py:5(<module>)
+        2    0.000    0.000    0.000    0.000 {built-in method numpy.core._multiarray_umath.set_string_function}
+        2    0.000    0.000    0.000    0.000 pathlib.py:60(__init__)
+        1    0.000    0.000    0.000    0.000 pathlib.py:587(_PathParents)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:143(_ArrayMemoryError)
+        1    0.000    0.000    0.000    0.000 records.py:234(record)
+        1    0.000    0.000    0.000    0.000 memmap.py:24(memmap)
+        8    0.000    0.000    0.000    0.000 getlimits.py:92(_register_type)
+        1    0.000    0.000    0.000    0.000 __init__.py:319(CDLL)
+        1    0.000    0.000    0.000    0.000 _internal.py:526(_Stream)
+        1    0.000    0.000    0.000    0.000 subprocess.py:97(TimeoutExpired)
+        1    0.000    0.000    0.000    0.000 selectors.py:290(SelectSelector)
+        4    0.000    0.000    0.000    0.000 mixins.py:55(_unary_method)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:252(__init__)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:547(__init__)
+        1    0.000    0.000    0.000    0.000 arrayterator.py:20(Arrayterator)
+        1    0.000    0.000    0.000    0.000 _version.py:18(NumpyVersion)
+        1    0.000    0.000    0.000    0.000 ctypeslib.py:200(_concrete_ndptr)
+        1    0.000    0.000    0.000    0.000 core.py:1321(_replace_dtype_fields)
+        3    0.000    0.000    0.000    0.000 core.py:1368(getmask)
+        1    0.000    0.000    0.000    0.000 extras.py:1474(MAxisConcatenator)
+        1    0.000    0.000    0.000    0.000 dis.py:461(Bytecode)
+        1    0.000    0.000    0.000    0.000 {method 'isValid' of 'PySide2.QtCore.QModelIndex' objects}
+        1    0.000    0.000    0.000    0.000 encoder.py:104(__init__)
+        1    0.000    0.000    0.000    0.000 __init__.py:457(Formatter)
+        4    0.000    0.000    0.000    0.000 __init__.py:1170(append)
+        1    0.000    0.000    0.000    0.000 string.py:78(Template)
+        1    0.000    0.000    0.000    0.000 connectionpool.py:64(ConnectionPool)
+        1    0.000    0.000    0.000    0.000 ssl.py:362(_ASN1Object)
+        8    0.000    0.000    0.000    0.000 six.py:75(_add_doc)
+        1    0.000    0.000    0.000    0.000 six.py:160(_SixMetaPathImporter)
+        1    0.000    0.000    0.000    0.000 client.py:1368(HTTPSConnection)
+        1    0.000    0.000    0.000    0.000 feedparser.py:45(BufferedSubFile)
+        1    0.000    0.000    0.000    0.000 _policybase.py:18(_PolicyBase)
+        1    0.000    0.000    0.000    0.000 header.py:179(Header)
+        1    0.000    0.000    0.000    0.000 header.py:541(_Accumulator)
+        1    0.000    0.000    0.000    0.000 charset.py:167(Charset)
+        1    0.000    0.000    0.000    0.000 _parseaddr.py:203(AddrlistClass)
+        1    0.000    0.000    0.000    0.000 calendar.py:410(HTMLCalendar)
+        1    0.000    0.000    0.000    0.000 _appengine_environ.py:3(<module>)
+        1    0.000    0.000    0.000    0.000 fields.py:125(RequestField)
+        1    0.000    0.000    0.000    0.000 poolmanager.py:129(PoolManager)
+        1    0.000    0.000    0.000    0.000 charsetgroupprober.py:32(CharSetGroupProber)
+        1    0.000    0.000    0.000    0.000 enums.py:17(LanguageFilter)
+        1    0.000    0.000    0.000    0.000 codingstatemachine.py:33(CodingStateMachine)
+        1    0.000    0.000    0.000    0.000 latin1prober.py:96(Latin1Prober)
+        1    0.000    0.000    0.000    0.000 utf8prober.py:35(UTF8Prober)
+        1    0.000    0.000    0.000    0.000 sjisprober.py:36(SJISProber)
+        1    0.000    0.000    0.000    0.000 eucjpprober.py:36(EUCJPProber)
+        1    0.000    0.000    0.000    0.000 cp949prober.py:34(CP949Prober)
+        1    0.000    0.000    0.000    0.000 euctwprober.py:33(EUCTWProber)
+        1    0.000    0.000    0.000    0.000 langbulgarianmodel.py:38(<module>)
+        1    0.000    0.000    0.000    0.000 cookies.py:457(BaseCookie)
+        1    0.000    0.000    0.000    0.000 structures.py:92(__init__)
+        1    0.000    0.000    0.000    0.000 models.py:60(RequestEncodingMixin)
+        2    0.000    0.000    0.000    0.000 {method 'decode' of 'bytes' objects}
+        1    0.000    0.000    0.000    0.000 {method 'reverse' of 'list' objects}
+       11    0.000    0.000    0.000    0.000 {method 'clear' of 'dict' objects}
+       15    0.000    0.000    0.000    0.000 {method 'discard' of 'set' objects}
+        1    0.000    0.000    0.000    0.000 {method 'find' of 'str' objects}
+        1    0.000    0.000    0.000    0.000 {built-in method builtins.all}
+        1    0.000    0.000    0.000    0.000 {built-in method _codecs.lookup}
+        1    0.000    0.000    0.000    0.000 {method 'append' of 'collections.deque' objects}
+        2    0.000    0.000    0.000    0.000 {method '__enter__' of '_thread.lock' objects}
+        1    0.000    0.000    0.000    0.000 {method 'seek' of '_io.BufferedReader' objects}
+        5    0.000    0.000    0.000    0.000 <frozen importlib._bootstrap>:765(is_package)
+        2    0.000    0.000    0.000    0.000 sre_parse.py:288(seek)
+        1    0.000    0.000    0.000    0.000 weakref.py:290(update)
+        1    0.000    0.000    0.000    0.000 tokenize.py:217(Untokenizer)
+        1    0.000    0.000    0.000    0.000 zipfile.py:604(LZMACompressor)
+        1    0.000    0.000    0.000    0.000 zipfile.py:765(_Tellable)
+        1    0.000    0.000    0.000    0.000 tempfile.py:414(_TemporaryFileCloser)
+        1    0.000    0.000    0.000    0.000 tempfile.py:457(_TemporaryFileWrapper)
+        1    0.000    0.000    0.000    0.000 tempfile.py:777(TemporaryDirectory)
+        1    0.000    0.000    0.000    0.000 {built-in method _struct.pack}
+        6    0.000    0.000    0.000    0.000 typing.py:176(<listcomp>)
+        3    0.000    0.000    0.000    0.000 typing.py:322(__hash__)
+        1    0.000    0.000    0.000    0.000 typing.py:488(TypeVar)
+        1    0.000    0.000    0.000    0.000 typing.py:1097(_ProtocolMeta)
+        1    0.000    0.000    0.000    0.000 typing.py:1303(SupportsComplex)
+        1    0.000    0.000    0.000    0.000 typing.py:1312(SupportsBytes)
+        1    0.000    0.000    0.000    0.000 typing.py:1330(SupportsRound)
+        1    0.000    0.000    0.000    0.000 _compression.py:9(BaseStream)
+        1    0.000    0.000    0.000    0.000 mtable.py:37(set_data)
+        1    0.000    0.000    0.000    0.000 threading.py:370(Semaphore)
+        2    0.000    0.000    0.000    0.000 threading.py:507(is_set)
+        1    0.000    0.000    0.000    0.000 threading.py:488(Event)
+        1    0.000    0.000    0.000    0.000 traceback.py:315(StackSummary)
+        1    0.000    0.000    0.000    0.000 tokenize.py:94(TokenInfo)
+        1    0.000    0.000    0.000    0.000 tokenize.py:108(any)
+        2    0.000    0.000    0.000    0.000 tokenize.py:109(maybe)
+        1    0.000    0.000    0.000    0.000 _globals.py:59(_NoValueType)
+        3    0.000    0.000    0.000    0.000 datetime.py:41(_days_before_year)
+        5    0.000    0.000    0.000    0.000 datetime.py:46(_days_in_month)
+        5    0.000    0.000    0.000    0.000 datetime.py:426(_check_tzinfo_arg)
+        1    0.000    0.000    0.000    0.000 py3k.py:116(contextlib_nullcontext)
+        1    0.000    0.000    0.000    0.000 pathlib.py:517(_WildcardSelector)
+        1    0.000    0.000    0.000    0.000 pathlib.py:544(_RecursiveWildcardSelector)
+        1    0.000    0.000    0.000    0.000 pathlib.py:982(PurePosixPath)
+        1    0.000    0.000    0.000    0.000 pathlib.py:992(PureWindowsPath)
+        1    0.000    0.000    0.000    0.000 pathlib.py:1487(PosixPath)
+        1    0.000    0.000    0.000    0.000 parse.py:760(Quoter)
+        1    0.000    0.000    0.000    0.000 pickle.py:184(_Framer)
+        6    0.000    0.000    0.000    0.000 _type_aliases.py:113(<genexpr>)
+        1    0.000    0.000    0.000    0.000 arrayprint.py:1221(DatetimeFormat)
+        1    0.000    0.000    0.000    0.000 records.py:100(format_parser)
+        1    0.000    0.000    0.000    0.000 records.py:319(recarray)
+        1    0.000    0.000    0.000    0.000 machar.py:18(MachAr)
+        3    0.000    0.000    0.000    0.000 __init__.py:99(CFunctionType)
+        1    0.000    0.000    0.000    0.000 __init__.py:387(PyDLL)
+        1    0.000    0.000    0.000    0.000 _internal.py:206(dummy_ctype)
+        1    0.000    0.000    0.000    0.000 subprocess.py:414(CompletedProcess)
+        1    0.000    0.000    0.000    0.000 selectors.py:60(_SelectorMapping)
+        1    0.000    0.000    0.000    0.000 selectors.py:206(_BaseSelectorImpl)
+        1    0.000    0.000    0.000    0.000 selectors.py:341(_PollLikeSelector)
+        1    0.000    0.000    0.000    0.000 selectors.py:433(PollSelector)
+        1    0.000    0.000    0.000    0.000 selectors.py:506(KqueueSelector)
+        2    0.000    0.000    0.000    0.000 index_tricks.py:145(__init__)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:110(nd_grid)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:296(__init__)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:605(ndindex)
+        1    0.000    0.000    0.000    0.000 ast.py:247(NodeVisitor)
+        1    0.000    0.000    0.000    0.000 function_base.py:1878(vectorize)
+        1    0.000    0.000    0.000    0.000 utils.py:70(__init__)
+        1    0.000    0.000    0.000    0.000 npyio.py:58(BagObj)
+        1    0.000    0.000    0.000    0.000 _datasource.py:169(__init__)
+        1    0.000    0.000    0.000    0.000 _datasource.py:144(_FileOpeners)
+        1    0.000    0.000    0.000    0.000 _datasource.py:626(Repository)
+        1    0.000    0.000    0.000    0.000 ctypeslib.py:179(_ndptr)
+        1    0.000    0.000    0.000    0.000 core.py:202(<listcomp>)
+        3    0.000    0.000    0.000    0.000 core.py:812(__init__)
+        6    0.000    0.000    0.000    0.000 core.py:852(__init__)
+        1    0.000    0.000    0.000    0.000 core.py:983(_MaskedBinaryOperation)
+        1    0.000    0.000    0.000    0.000 core.py:2389(_MaskedPrintOption)
+        1    0.000    0.000    0.000    0.000 core.py:2607(MaskedIterator)
+        1    0.000    0.000    0.000    0.000 core.py:6532(_extrema_operation)
+        1    0.000    0.000    0.000    0.000 core.py:7983(_convert2ma)
+        1    0.000    0.000    0.000    0.000 extras.py:217(_fromnxfunction)
+        1    0.000    0.000    0.000    0.000 mapping.py:92(_NotCalled)
+        1    0.000    0.000    0.000    0.000 mapping.py:169(Reloader)
+        1    0.000    0.000    0.000    0.000 enum_sig.py:57(ExactEnumerator)
+        1    0.000    0.000    0.000    0.000 mainwindow.py:20(Ui_MainWindow)
+        2    0.000    0.000    0.000    0.000 {method 'hasHeightForWidth' of 'PySide2.QtWidgets.QSizePolicy' objects}
+        1    0.000    0.000    0.000    0.000 kman.py:250(<listcomp>)
+        1    0.000    0.000    0.000    0.000 decoder.py:254(JSONDecoder)
+        1    0.000    0.000    0.000    0.000 encoder.py:73(JSONEncoder)
+        1    0.000    0.000    0.000    0.000 __init__.py:1134(_StderrHandler)
+        2    0.000    0.000    0.000    0.000 __init__.py:1164(__init__)
+        1    0.000    0.000    0.000    0.000 __init__.py:1205(__init__)
+        1    0.000    0.000    0.000    0.000 string.py:175(Formatter)
+        1    0.000    0.000    0.000    0.000 ssl.py:153(<dictcomp>)
+        1    0.000    0.000    0.000    0.000 client.py:1448(IncompleteRead)
+        1    0.000    0.000    0.000    0.000 __init__.py:5(<module>)
+        1    0.000    0.000    0.000    0.000 parser.py:16(Parser)
+        1    0.000    0.000    0.000    0.000 parser.py:79(BytesParser)
+        1    0.000    0.000    0.000    0.000 _policybase.py:41(__init__)
+        1    0.000    0.000    0.000    0.000 _policybase.py:271(Compat32)
+        1    0.000    0.000    0.000    0.000 header.py:413(_ValueFormatter)
+        1    0.000    0.000    0.000    0.000 calendar.py:154(__init__)
+        1    0.000    0.000    0.000    0.000 connection.py:223(HTTPSConnection)
+        1    0.000    0.000    0.000    0.000 retry.py:196(<listcomp>)
+        1    0.000    0.000    0.000    0.000 request.py:10(RequestMethods)
+        1    0.000    0.000    0.000    0.000 queue.py:10(LifoQueue)
+        1    0.000    0.000    0.000    0.000 enums.py:50(SequenceLikelihood)
+        1    0.000    0.000    0.000    0.000 gb2312freq.py:42(<module>)
+        1    0.000    0.000    0.000    0.000 jisfreq.py:44(<module>)
+        1    0.000    0.000    0.000    0.000 jpcntx.py:116(JapaneseContextAnalysis)
+        1    0.000    0.000    0.000    0.000 jpcntx.py:183(SJISContextAnalysis)
+        1    0.000    0.000    0.000    0.000 gb2312prober.py:33(GB2312Prober)
+        1    0.000    0.000    0.000    0.000 euckrprober.py:34(EUCKRProber)
+        1    0.000    0.000    0.000    0.000 big5prober.py:34(Big5Prober)
+        1    0.000    0.000    0.000    0.000 langgreekmodel.py:35(<module>)
+        1    0.000    0.000    0.000    0.000 langthaimodel.py:37(<module>)
+        1    0.000    0.000    0.000    0.000 langhebrewmodel.py:38(<module>)
+        1    0.000    0.000    0.000    0.000 langturkishmodel.py:37(<module>)
+        1    0.000    0.000    0.000    0.000 version.py:6(<module>)
+        1    0.000    0.000    0.000    0.000 core.py:8(<module>)
+        1    0.000    0.000    0.000    0.000 __init__.py:136(_import_OrderedDict)
+        1    0.000    0.000    0.000    0.000 decoder.py:272(JSONDecoder)
+        1    0.000    0.000    0.000    0.000 encoder.py:383(JSONEncoderForHTML)
+        1    0.000    0.000    0.000    0.000 request.py:909(HTTPPasswordMgrWithPriorAuth)
+        1    0.000    0.000    0.000    0.000 response.py:37(addclosehook)
+        1    0.000    0.000    0.000    0.000 response.py:68(addinfourl)
+        1    0.000    0.000    0.000    0.000 cookiejar.py:735(Cookie)
+        1    0.000    0.000    0.000    0.000 cookiejar.py:1770(FileCookieJar)
+        1    0.000    0.000    0.000    0.000 models.py:198(Request)
+        1    0.000    0.000    0.000    0.000 hooks.py:13(<module>)
+        1    0.000    0.000    0.000    0.000 auth.py:108(HTTPDigestAuth)
+        1    0.000    0.000    0.000    0.000 adapters.py:55(BaseAdapter)
+        1    0.000    0.000    0.000    0.000 gbk.py:16(IncrementalEncoder)
+        1    0.000    0.000    0.000    0.000 gbk.py:20(IncrementalDecoder)
+        1    0.000    0.000    0.000    0.000 {method 'startswith' of 'bytes' objects}
+        1    0.000    0.000    0.000    0.000 {method 'values' of 'mappingproxy' objects}
+        1    0.000    0.000    0.000    0.000 {method 'union' of 'set' objects}
+        1    0.000    0.000    0.000    0.000 {method 'index' of 'tuple' objects}
+        3    0.000    0.000    0.000    0.000 {built-in method builtins.callable}
+        1    0.000    0.000    0.000    0.000 {built-in method time.time}
+        2    0.000    0.000    0.000    0.000 {method '__exit__' of '_thread.lock' objects}
+        1    0.000    0.000    0.000    0.000 {built-in method _thread._set_sentinel}
+        1    0.000    0.000    0.000    0.000 {function HTTPResponse.flush at 0x10bfbde60}
+        1    0.000    0.000    0.000    0.000 contextlib.py:58(_recreate_cm)
+        1    0.000    0.000    0.000    0.000 sre_parse.py:98(checkgroup)
+        1    0.000    0.000    0.000    0.000 {method 'disable' of '_lsprof.Profiler' objects}
+        1    0.000    0.000    0.000    0.000 tokenize.py:212(TokenError)
+        1    0.000    0.000    0.000    0.000 tokenize.py:214(StopTokenizing)
+        1    0.000    0.000    0.000    0.000 <string>:1(<module>)
+        1    0.000    0.000    0.000    0.000 __future__.py:80(_Feature)
+        1    0.000    0.000    0.000    0.000 zipfile.py:38(BadZipFile)
+        1    0.000    0.000    0.000    0.000 zipfile.py:627(LZMADecompressor)
+        1    0.000    0.000    0.000    0.000 zipfile.py:727(_SharedFile)
+        1    0.000    0.000    0.000    0.000 random.py:691(seed)
+        1    0.000    0.000    0.000    0.000 random.py:669(SystemRandom)
+        1    0.000    0.000    0.000    0.000 {built-in method _hashlib.openssl_sha256}
+        1    0.000    0.000    0.000    0.000 typing.py:274(_Final)
+        1    0.000    0.000    0.000    0.000 typing.py:283(_Immutable)
+        5    0.000    0.000    0.000    0.000 typing.py:313(__init__)
+        1    0.000    0.000    0.000    0.000 typing.py:317(__eq__)
+        2    0.000    0.000    0.000    0.000 typing.py:832(<genexpr>)
+        1    0.000    0.000    0.000    0.000 typing.py:884(_TypingEmpty)
+        1    0.000    0.000    0.000    0.000 typing.py:1165(_Protocol)
+        1    0.000    0.000    0.000    0.000 typing.py:1392(NamedTuple)
+        1    0.000    0.000    0.000    0.000 typing.py:1627(io)
+        1    0.000    0.000    0.000    0.000 typing.py:1642(re)
+        1    0.000    0.000    0.000    0.000 zipfile.py:1942(PyZipFile)
+        1    0.000    0.000    0.000    0.000 shutil.py:55(Error)
+        1    0.000    0.000    0.000    0.000 shutil.py:65(ExecError)
+        1    0.000    0.000    0.000    0.000 shutil.py:68(ReadError)
+        1    0.000    0.000    0.000    0.000 threading.py:450(BoundedSemaphore)
+        1    0.000    0.000    0.000    0.000 threading.py:896(_set_ident)
+        1    0.000    0.000    0.000    0.000 threading.py:1153(Timer)
+        1    0.000    0.000    0.000    0.000 threading.py:1202(_DummyThread)
+        1    0.000    0.000    0.000    0.000 pyscript:1(_C)
+        1    0.000    0.000    0.000    0.000 _globals.py:46(VisibleDeprecationWarning)
+        1    0.000    0.000    0.000    0.000 _distributor_init.py:10(<module>)
+        1    0.000    0.000    0.000    0.000 datetime.py:1092(tzinfo)
+        1    0.000    0.000    0.000    0.000 pathlib.py:56(_Flavour)
+        1    0.000    0.000    0.000    0.000 pathlib.py:392(_Accessor)
+        1    0.000    0.000    0.000    0.000 pathlib.py:495(_TerminatingSelector)
+        1    0.000    0.000    0.000    0.000 pathlib.py:501(_PreciseSelector)
+        1    0.000    0.000    0.000    0.000 parse.py:126(_ResultMixinStr)
+        1    0.000    0.000    0.000    0.000 parse.py:134(_ResultMixinBytes)
+        1    0.000    0.000    0.000    0.000 parse.py:175(_NetlocResultMixinStr)
+        1    0.000    0.000    0.000    0.000 parse.py:310(DefragResult)
+        1    0.000    0.000    0.000    0.000 parse.py:318(SplitResult)
+        1    0.000    0.000    0.000    0.000 parse.py:329(DefragResultBytes)
+        1    0.000    0.000    0.000    0.000 parse.py:337(SplitResultBytes)
+        1    0.000    0.000    0.000    0.000 pickle.py:64(PickleError)
+        1    0.000    0.000    0.000    0.000 pickle.py:88(_Stop)
+        1    0.000    0.000    0.000    0.000 pickle.py:247(_Unframer)
+        1    0.000    0.000    0.000    0.000 numerictypes.py:429(_typedict)
+        1    0.000    0.000    0.000    0.000 numbers.py:12(Number)
+        1    0.000    0.000    0.000    0.000 _type_aliases.py:36(TypeNADict)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:40(_UFuncBinaryResolutionError)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:56(_UFuncNoLoopError)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:74(_UFuncCastingError)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:83(_UFuncInputCastingError)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:101(_UFuncOutputCastingError)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:125(AxisError)
+        1    0.000    0.000    0.000    0.000 _ufunc_config.py:36(<dictcomp>)
+        1    0.000    0.000    0.000    0.000 _ufunc_config.py:368(_unspecified)
+        1    0.000    0.000    0.000    0.000 _ufunc_config.py:375(errstate)
+        2    0.000    0.000    0.000    0.000 arrayprint.py:464(_recursive_guard)
+        1    0.000    0.000    0.000    0.000 arrayprint.py:854(FloatingFormat)
+        1    0.000    0.000    0.000    0.000 arrayprint.py:1143(IntegerFormat)
+        1    0.000    0.000    0.000    0.000 arrayprint.py:1166(ComplexFloatingFormat)
+        1    0.000    0.000    0.000    0.000 arrayprint.py:1195(_TimelikeFormat)
+        1    0.000    0.000    0.000    0.000 arrayprint.py:1258(SubArrayFormat)
+        1    0.000    0.000    0.000    0.000 arrayprint.py:1268(StructuredVoidFormat)
+        1    0.000    0.000    0.000    0.000 records.py:81(_OrderedCounter)
+        1    0.000    0.000    0.000    0.000 getlimits.py:34(MachArLike)
+        1    0.000    0.000    0.000    0.000 getlimits.py:293(finfo)
+        1    0.000    0.000    0.000    0.000 __init__.py:151(py_object)
+        1    0.000    0.000    0.000    0.000 __init__.py:193(c_double)
+        1    0.000    0.000    0.000    0.000 __init__.py:197(c_longdouble)
+        1    0.000    0.000    0.000    0.000 __init__.py:225(c_byte)
+        1    0.000    0.000    0.000    0.000 __init__.py:230(c_char)
+        1    0.000    0.000    0.000    0.000 __init__.py:251(c_wchar_p)
+        1    0.000    0.000    0.000    0.000 __init__.py:256(c_wchar)
+        1    0.000    0.000    0.000    0.000 __init__.py:358(_FuncPtr)
+        2    0.000    0.000    0.000    0.000 __init__.py:428(__init__)
+        1    0.000    0.000    0.000    0.000 _endian.py:23(_swapped_meta)
+        1    0.000    0.000    0.000    0.000 _endian.py:46(BigEndianStructure)
+        1    0.000    0.000    0.000    0.000 _internal.py:245(c_void_p)
+        1    0.000    0.000    0.000    0.000 _internal.py:848(recursive)
+        1    0.000    0.000    0.000    0.000 {built-in method _ctypes.dlopen}
+        1    0.000    0.000    0.000    0.000 subprocess.py:57(SubprocessError)
+        1    0.000    0.000    0.000    0.000 _pytesttester.py:47(PytestTester)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:210(MGridClass)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:257(OGridClass)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:422(RClass)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:554(ndenumerate)
+        2    0.000    0.000    0.000    0.000 index_tricks.py:728(__init__)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:684(IndexExpression)
+        1    0.000    0.000    0.000    0.000 ast.py:284(NodeTransformer)
+        1    0.000    0.000    0.000    0.000 stride_tricks.py:16(DummyArray)
+        1    0.000    0.000    0.000    0.000 utils.py:53(_set_function_name)
+        1    0.000    0.000    0.000    0.000 utils.py:58(_Deprecate)
+        1    0.000    0.000    0.000    0.000 _iotools.py:478(ConverterLockError)
+        1    0.000    0.000    0.000    0.000 polyutils.py:62(RankWarning)
+        1    0.000    0.000    0.000    0.000 polyutils.py:83(PolyBase)
+        1    0.000    0.000    0.000    0.000 core.py:162(MAError)
+        1    0.000    0.000    0.000    0.000 core.py:170(MaskError)
+        1    0.000    0.000    0.000    0.000 core.py:204(<listcomp>)
+        1    0.000    0.000    0.000    0.000 core.py:803(_DomainCheckInterval)
+        1    0.000    0.000    0.000    0.000 core.py:836(__init__)
+        1    0.000    0.000    0.000    0.000 core.py:828(_DomainTan)
+        1    0.000    0.000    0.000    0.000 core.py:846(_DomainSafeDivide)
+        3    0.000    0.000    0.000    0.000 core.py:873(__init__)
+        1    0.000    0.000    0.000    0.000 core.py:883(_DomainGreaterEqual)
+        1    0.000    0.000    0.000    0.000 core.py:1131(_DomainedBinaryOperation)
+        1    0.000    0.000    0.000    0.000 core.py:1289(_replace_dtype_fields_recursive)
+        1    0.000    0.000    0.000    0.000 core.py:2395(__init__)
+        2    0.000    0.000    0.000    0.000 core.py:3379(shape)
+        4    0.000    0.000    0.000    0.000 core.py:6352(__has_singleton)
+        1    0.000    0.000    0.000    0.000 extras.py:290(_fromnxfunction_seq)
+        1    0.000    0.000    0.000    0.000 extras.py:303(_fromnxfunction_args)
+        1    0.000    0.000    0.000    0.000 extras.py:1504(mr_class)
+        1    0.000    0.000    0.000    0.000 inspect.py:880(BlockFinder)
+        1    0.000    0.000    0.000    0.000 inspect.py:2399(_void)
+        1    0.000    0.000    0.000    0.000 dis.py:199(Instruction)
+        1    0.000    0.000    0.000    0.000 mapping.py:60(ellipsis)
+        1    0.000    0.000    0.000    0.000 mapping.py:128(Missing)
+        1    0.000    0.000    0.000    0.000 mapping.py:140(Default)
+        1    0.000    0.000    0.000    0.000 mapping.py:176(__init__)
+        1    0.000    0.000    0.000    0.000 tool.py:53(SimpleNamespace)
+        1    0.000    0.000    0.000    0.000 deprecated.py:61(PySideDeprecationWarningRemovedInQt6)
+        1    0.000    0.000    0.000    0.000 enum_sig.py:183(SimplifyingEnumerator)
+        3    0.000    0.000    0.000    0.000 {method 'fileno' of '_socket.socket' objects}
+        2    0.000    0.000    0.000    0.000 {method 'setHeightForWidth' of 'PySide2.QtWidgets.QSizePolicy' objects}
+        1    0.000    0.000    0.000    0.000 {method 'installEventFilter' of 'PySide2.QtCore.QObject' objects}
+        1    0.000    0.000    0.000    0.000 decoder.py:20(JSONDecodeError)
+        1    0.000    0.000    0.000    0.000 __init__.py:270(LogRecord)
+        1    0.000    0.000    0.000    0.000 __init__.py:409(PercentStyle)
+        1    0.000    0.000    0.000    0.000 __init__.py:424(StrFormatStyle)
+        1    0.000    0.000    0.000    0.000 __init__.py:433(StringTemplateStyle)
+        1    0.000    0.000    0.000    0.000 __init__.py:674(Filter)
+        1    0.000    0.000    0.000    0.000 __init__.py:711(Filterer)
+        1    0.000    0.000    0.000    0.000 __init__.py:899(setFormatter)
+        1    0.000    0.000    0.000    0.000 __init__.py:1065(FileHandler)
+        1    0.000    0.000    0.000    0.000 __init__.py:1158(PlaceHolder)
+        1    0.000    0.000    0.000    0.000 __init__.py:1200(Manager)
+        1    0.000    0.000    0.000    0.000 __init__.py:1665(RootLogger)
+        1    0.000    0.000    0.000    0.000 __init__.py:2057(NullHandler)
+        1    0.000    0.000    0.000    0.000 string.py:55(_TemplateMetaclass)
+        1    0.000    0.000    0.000    0.000 parseweb.py:109(__init__)
+        1    0.000    0.000    0.000    0.000 exceptions.py:7(HTTPError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:17(PoolError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:29(RequestError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:68(MaxRetryError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:86(HostChangedError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:101(TimeoutError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:111(ReadTimeoutError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:133(ClosedPoolError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:138(LocationValueError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:143(LocationParseError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:159(SecurityWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:179(InsecurePlatformWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:236(ProxySchemeUnknown)
+        1    0.000    0.000    0.000    0.000 exceptions.py:245(HeaderParsingError)
+        1    0.000    0.000    0.000    0.000 six.py:86(_LazyDescr)
+        1    0.000    0.000    0.000    0.000 six.py:102(MovedModule)
+        1    0.000    0.000    0.000    0.000 six.py:122(_LazyModule)
+        1    0.000    0.000    0.000    0.000 six.py:136(MovedAttribute)
+        1    0.000    0.000    0.000    0.000 six.py:169(__init__)
+        1    0.000    0.000    0.000    0.000 six.py:324(Module_six_moves_urllib_parse)
+        1    0.000    0.000    0.000    0.000 six.py:371(Module_six_moves_urllib_error)
+        1    0.000    0.000    0.000    0.000 six.py:394(Module_six_moves_urllib_request)
+        1    0.000    0.000    0.000    0.000 six.py:449(Module_six_moves_urllib_response)
+        1    0.000    0.000    0.000    0.000 client.py:173(HTTPMessage)
+        1    0.000    0.000    0.000    0.000 client.py:436(isclosed)
+        1    0.000    0.000    0.000    0.000 client.py:1431(NotConnected)
+        1    0.000    0.000    0.000    0.000 client.py:1445(UnimplementedFileMode)
+        1    0.000    0.000    0.000    0.000 client.py:1463(ImproperConnectionState)
+        1    0.000    0.000    0.000    0.000 client.py:1469(CannotSendHeader)
+        1    0.000    0.000    0.000    0.000 client.py:1472(ResponseNotReady)
+        1    0.000    0.000    0.000    0.000 client.py:1482(LineTooLong)
+        1    0.000    0.000    0.000    0.000 parser.py:71(HeaderParser)
+        1    0.000    0.000    0.000    0.000 feedparser.py:532(BytesFeedParser)
+        1    0.000    0.000    0.000    0.000 errors.py:16(HeaderParseError)
+        1    0.000    0.000    0.000    0.000 errors.py:20(BoundaryError)
+        1    0.000    0.000    0.000    0.000 errors.py:28(CharsetError)
+        1    0.000    0.000    0.000    0.000 errors.py:33(MessageDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:41(NoBoundaryInMultipartDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:44(StartBoundaryNotFoundDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:81(HeaderDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:87(InvalidHeaderDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:107(NonASCIILocalPartDefect)
+        1    0.000    0.000    0.000    0.000 _parseaddr.py:504(AddressList)
+        1    0.000    0.000    0.000    0.000 calendar.py:24(IllegalMonthError)
+        2    0.000    0.000    0.000    0.000 calendar.py:74(__init__)
+        1    0.000    0.000    0.000    0.000 calendar.py:160(setfirstweekday)
+        1    0.000    0.000    0.000    0.000 calendar.py:546(different_locale)
+        1    0.000    0.000    0.000    0.000 calendar.py:589(LocaleHTMLCalendar)
+        1    0.000    0.000    0.000    0.000 message.py:1168(EmailMessage)
+        1    0.000    0.000    0.000    0.000 queue.py:220(PriorityQueue)
+        1    0.000    0.000    0.000    0.000 queue.py:239(LifoQueue)
+        1    0.000    0.000    0.000    0.000 queue.py:255(_PySimpleQueue)
+        1    0.000    0.000    0.000    0.000 connection.py:255(VerifiedHTTPSConnection)
+        1    0.000    0.000    0.000    0.000 wait.py:14(NoWayToWaitForSocketError)
+        1    0.000    0.000    0.000    0.000 response.py:32(DeflateDecoder)
+        1    0.000    0.000    0.000    0.000 response.py:64(GzipDecoderState)
+        1    0.000    0.000    0.000    0.000 response.py:71(GzipDecoder)
+        1    0.000    0.000    0.000    0.000 response.py:121(MultiDecoder)
+        1    0.000    0.000    0.000    0.000 poolmanager.py:372(ProxyManager)
+        1    0.000    0.000    0.000    0.000 enums.py:8(InputState)
+        1    0.000    0.000    0.000    0.000 enums.py:32(ProbingState)
+        1    0.000    0.000    0.000    0.000 enums.py:41(MachineState)
+        1    0.000    0.000    0.000    0.000 enums.py:65(CharacterCategory)
+        1    0.000    0.000    0.000    0.000 chardistribution.py:113(EUCTWDistributionAnalysis)
+        1    0.000    0.000    0.000    0.000 chardistribution.py:132(EUCKRDistributionAnalysis)
+        1    0.000    0.000    0.000    0.000 chardistribution.py:151(GB2312DistributionAnalysis)
+        1    0.000    0.000    0.000    0.000 chardistribution.py:170(Big5DistributionAnalysis)
+        1    0.000    0.000    0.000    0.000 chardistribution.py:192(SJISDistributionAnalysis)
+        1    0.000    0.000    0.000    0.000 euctwfreq.py:44(<module>)
+        1    0.000    0.000    0.000    0.000 euckrfreq.py:41(<module>)
+        1    0.000    0.000    0.000    0.000 big5freq.py:43(<module>)
+        1    0.000    0.000    0.000    0.000 jpcntx.py:212(EUCJPContextAnalysis)
+        1    0.000    0.000    0.000    0.000 sbcsgroupprober.py:43(SBCSGroupProber)
+        1    0.000    0.000    0.000    0.000 exceptions.py:12(RequestException)
+        1    0.000    0.000    0.000    0.000 exceptions.py:32(ConnectionError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:53(ConnectTimeout)
+        1    0.000    0.000    0.000    0.000 exceptions.py:64(URLRequired)
+        1    0.000    0.000    0.000    0.000 exceptions.py:92(ChunkedEncodingError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:96(ContentDecodingError)
+        1    0.000    0.000    0.000    0.000 __version__.py:5(<module>)
+        1    0.000    0.000    0.000    0.000 errors.py:26(JSONDecodeError)
+        1    0.000    0.000    0.000    0.000 raw_json.py:4(RawJSON)
+        1    0.000    0.000    0.000    0.000 encoder.py:109(JSONEncoder)
+        1    0.000    0.000    0.000    0.000 request.py:630(HTTPErrorProcessor)
+        1    0.000    0.000    0.000    0.000 request.py:647(HTTPDefaultErrorHandler)
+        1    0.000    0.000    0.000    0.000 request.py:651(HTTPRedirectHandler)
+        1    0.000    0.000    0.000    0.000 request.py:793(ProxyHandler)
+        1    0.000    0.000    0.000    0.000 request.py:835(HTTPPasswordMgr)
+        1    0.000    0.000    0.000    0.000 request.py:1020(HTTPBasicAuthHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1031(ProxyBasicAuthHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1050(AbstractDigestAuthHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1196(HTTPDigestAuthHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1214(ProxyDigestAuthHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1226(AbstractHTTPHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1344(HTTPHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1353(HTTPSHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1368(HTTPCookieProcessor)
+        1    0.000    0.000    0.000    0.000 request.py:1386(UnknownHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1559(CacheFTPHandler)
+        1    0.000    0.000    0.000    0.000 error.py:19(URLError)
+        1    0.000    0.000    0.000    0.000 error.py:73(ContentTooShortError)
+        1    0.000    0.000    0.000    0.000 response.py:57(addinfo)
+        1    0.000    0.000    0.000    0.000 cookiejar.py:833(CookiePolicy)
+        1    0.000    0.000    0.000    0.000 cookiejar.py:1238(Absent)
+        1    0.000    0.000    0.000    0.000 cookiejar.py:1856(LWPCookieJar)
+        1    0.000    0.000    0.000    0.000 cookies.py:97(MockResponse)
+        1    0.000    0.000    0.000    0.000 cookies.py:165(CookieConflictError)
+        1    0.000    0.000    0.000    0.000 structures.py:89(LookupDict)
+        1    0.000    0.000    0.000    0.000 core.py:21(IDNABidiError)
+        1    0.000    0.000    0.000    0.000 models.py:174(RequestHooksMixin)
+        1    0.000    0.000    0.000    0.000 idna.py:218(IncrementalEncoder)
+        1    0.000    0.000    0.000    0.000 idna.py:292(StreamWriter)
+        1    0.000    0.000    0.000    0.000 idna.py:295(StreamReader)
+        1    0.000    0.000    0.000    0.000 auth.py:72(AuthBase)
+        1    0.000    0.000    0.000    0.000 gbk.py:24(StreamReader)
+        1    0.000    0.000    0.000    0.000 gbk.py:27(StreamWriter)
+        2    0.000    0.000    0.000    0.000 {method 'deleter' of 'property' objects}
+        3    0.000    0.000    0.000    0.000 {method 'pop' of 'list' objects}
+        3    0.000    0.000    0.000    0.000 {built-in method builtins.locals}
+        1    0.000    0.000    0.000    0.000 {built-in method atexit.register}
+        7    0.000    0.000    0.000    0.000 {built-in method _stat.S_ISLNK}
+        1    0.000    0.000    0.000    0.000 {method 'release' of '_thread.lock' objects}
+        2    0.000    0.000    0.000    0.000 codecs.py:214(setstate)
+        1    0.000    0.000    0.000    0.000 sre_parse.py:101(checklookbehindgroup)
+        1    0.000    0.000    0.000    0.000 copyreg.py:22(constructor)
+        1    0.000    0.000    0.000    0.000 zipfile.py:42(LargeZipFile)
+        1    0.000    0.000    0.000    0.000 typing.py:891(_TypingEllipsis)
+        1    0.000    0.000    0.000    0.000 typing.py:1361(NamedTupleMeta)
+        1    0.000    0.000    0.000    0.000 shutil.py:58(SameFileError)
+        1    0.000    0.000    0.000    0.000 shutil.py:61(SpecialFileError)
+        1    0.000    0.000    0.000    0.000 shutil.py:71(RegistryError)
+        1    0.000    0.000    0.000    0.000 mtable.py:41(get_data)
+        1    0.000    0.000    0.000    0.000 threading.py:721(BrokenBarrierError)
+        1    0.000    0.000    0.000    0.000 threading.py:1183(_MainThread)
+        1    0.000    0.000    0.000    0.000 _globals.py:32(ModuleDeprecationWarning)
+        1    0.000    0.000    0.000    0.000 multiarray.py:145(concatenate)
+        1    0.000    0.000    0.000    0.000 multiarray.py:1043(copyto)
+        1    0.000    0.000    0.000    0.000 {built-in method numpy.core._multiarray_umath.set_typeDict}
+        1    0.000    0.000    0.000    0.000 parse.py:323(ParseResult)
+        1    0.000    0.000    0.000    0.000 parse.py:342(ParseResultBytes)
+        1    0.000    0.000    0.000    0.000 pickle.py:68(PicklingError)
+        1    0.000    0.000    0.000    0.000 pickle.py:75(UnpicklingError)
+        1    0.000    0.000    0.000    0.000 numeric.py:74(ComplexWarning)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:34(UFuncTypeError)
+        1    0.000    0.000    0.000    0.000 _exceptions.py:120(TooHardError)
+        1    0.000    0.000    0.000    0.000 arrayprint.py:1156(BoolFormat)
+        1    0.000    0.000    0.000    0.000 arrayprint.py:1253(TimedeltaFormat)
+        1    0.000    0.000    0.000    0.000 __init__.py:160(c_short)
+        1    0.000    0.000    0.000    0.000 __init__.py:164(c_ushort)
+        1    0.000    0.000    0.000    0.000 __init__.py:168(c_long)
+        1    0.000    0.000    0.000    0.000 __init__.py:172(c_ulong)
+        1    0.000    0.000    0.000    0.000 __init__.py:181(c_int)
+        1    0.000    0.000    0.000    0.000 __init__.py:185(c_uint)
+        1    0.000    0.000    0.000    0.000 __init__.py:189(c_float)
+        1    0.000    0.000    0.000    0.000 __init__.py:218(c_ubyte)
+        1    0.000    0.000    0.000    0.000 __init__.py:235(c_char_p)
+        1    0.000    0.000    0.000    0.000 __init__.py:241(c_void_p)
+        1    0.000    0.000    0.000    0.000 __init__.py:246(c_bool)
+        1    0.000    0.000    0.000    0.000 index_tricks.py:522(CClass)
+        1    0.000    0.000    0.000    0.000 linalg.py:52(LinAlgError)
+        1    0.000    0.000    0.000    0.000 polynomial.py:30(RankWarning)
+        1    0.000    0.000    0.000    0.000 _iotools.py:470(ConverterError)
+        1    0.000    0.000    0.000    0.000 _iotools.py:486(ConversionWarning)
+        1    0.000    0.000    0.000    0.000 polyutils.py:66(PolyError)
+        1    0.000    0.000    0.000    0.000 polyutils.py:70(PolyDomainError)
+        1    0.000    0.000    0.000    0.000 core.py:91(MaskedArrayFutureWarning)
+        1    0.000    0.000    0.000    0.000 core.py:867(_DomainGreater)
+        2    0.000    0.000    0.000    0.000 core.py:889(__init__)
+        1    0.000    0.000    0.000    0.000 core.py:899(_MaskedUFunc)
+        1    0.000    0.000    0.000    0.000 extras.py:272(_fromnxfunction_single)
+        1    0.000    0.000    0.000    0.000 extras.py:328(_fromnxfunction_allargs)
+        1    0.000    0.000    0.000    0.000 inspect.py:878(EndOfBlock)
+        1    0.000    0.000    0.000    0.000 inspect.py:2403(_empty)
+        1    0.000    0.000    0.000    0.000 mapping.py:124(Virtual)
+        1    0.000    0.000    0.000    0.000 mapping.py:136(Invalid)
+        1    0.000    0.000    0.000    0.000 mapping.py:144(Instance)
+        1    0.000    0.000    0.000    0.000 mapping.py:158(ResultVariable)
+        1    0.000    0.000    0.000    0.000 mapping.py:163(ArrayLikeVariable)
+        1    0.000    0.000    0.000    0.000 enum_sig.py:204(HintingEnumerator)
+        2    0.000    0.000    0.000    0.000 {method 'setVerticalStretch' of 'PySide2.QtWidgets.QSizePolicy' objects}
+        2    0.000    0.000    0.000    0.000 __init__.py:2073(createLock)
+        1    0.000    0.000    0.000    0.000 socket.py:130(_GiveupOnSendfile)
+        1    0.000    0.000    0.000    0.000 exceptions.py:12(HTTPWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:41(SSLError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:46(ProxyError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:51(DecodeError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:56(ProtocolError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:95(TimeoutStateError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:118(ConnectTimeoutError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:123(NewConnectionError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:128(EmptyPoolError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:153(ResponseError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:164(SubjectAltNameWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:169(InsecureRequestWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:174(SystemTimeWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:184(SNIMissingWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:189(DependencyWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:198(ResponseNotChunked)
+        1    0.000    0.000    0.000    0.000 exceptions.py:203(BodyNotHttplibCompatible)
+        1    0.000    0.000    0.000    0.000 exceptions.py:231(InvalidHeader)
+        1    0.000    0.000    0.000    0.000 exceptions.py:253(UnrewindableBodyError)
+        1    0.000    0.000    0.000    0.000 six.py:227(_MovedItems)
+        1    0.000    0.000    0.000    0.000 six.py:473(Module_six_moves_urllib_robotparser)
+        1    0.000    0.000    0.000    0.000 client.py:1426(HTTPException)
+        1    0.000    0.000    0.000    0.000 client.py:1434(InvalidURL)
+        1    0.000    0.000    0.000    0.000 client.py:1437(UnknownProtocol)
+        1    0.000    0.000    0.000    0.000 client.py:1442(UnknownTransferEncoding)
+        1    0.000    0.000    0.000    0.000 client.py:1466(CannotSendRequest)
+        1    0.000    0.000    0.000    0.000 client.py:1475(BadStatusLine)
+        1    0.000    0.000    0.000    0.000 client.py:1487(RemoteDisconnected)
+        1    0.000    0.000    0.000    0.000 errors.py:8(MessageError)
+        1    0.000    0.000    0.000    0.000 errors.py:12(MessageParseError)
+        1    0.000    0.000    0.000    0.000 errors.py:24(MultipartConversionError)
+        1    0.000    0.000    0.000    0.000 errors.py:47(CloseBoundaryNotFoundDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:50(FirstHeaderLineIsContinuationDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:53(MisplacedEnvelopeHeaderDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:56(MissingHeaderBodySeparatorDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:61(MultipartInvariantViolationDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:64(InvalidMultipartContentTransferEncodingDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:67(UndecodableBytesDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:70(InvalidBase64PaddingDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:73(InvalidBase64CharactersDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:76(InvalidBase64LengthDefect)
+        1    0.000    0.000    0.000    0.000 errors.py:90(HeaderMissingRequiredValue)
+        1    0.000    0.000    0.000    0.000 errors.py:104(ObsoleteHeaderDefect)
+        1    0.000    0.000    0.000    0.000 calendar.py:31(IllegalWeekdayError)
+        2    0.000    0.000    0.000    0.000 calendar.py:55(__init__)
+        1    0.000    0.000    0.000    0.000 uu.py:39(Error)
+        1    0.000    0.000    0.000    0.000 queue.py:22(Full)
+        1    0.000    0.000    0.000    0.000 connection.py:62(DummyConnection)
+        1    0.000    0.000    0.000    0.000 mbcsgroupprober.py:41(MBCSGroupProber)
+        1    0.000    0.000    0.000    0.000 chardistribution.py:217(EUCJPDistributionAnalysis)
+        1    0.000    0.000    0.000    0.000 exceptions.py:28(HTTPError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:36(ProxyError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:40(SSLError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:44(Timeout)
+        1    0.000    0.000    0.000    0.000 exceptions.py:60(ReadTimeout)
+        1    0.000    0.000    0.000    0.000 exceptions.py:68(TooManyRedirects)
+        1    0.000    0.000    0.000    0.000 exceptions.py:72(MissingSchema)
+        1    0.000    0.000    0.000    0.000 exceptions.py:76(InvalidSchema)
+        1    0.000    0.000    0.000    0.000 exceptions.py:80(InvalidURL)
+        1    0.000    0.000    0.000    0.000 exceptions.py:84(InvalidHeader)
+        1    0.000    0.000    0.000    0.000 exceptions.py:88(InvalidProxyURL)
+        1    0.000    0.000    0.000    0.000 exceptions.py:100(StreamConsumedError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:104(RetryError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:108(UnrewindableBodyError)
+        1    0.000    0.000    0.000    0.000 exceptions.py:114(RequestsWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:119(FileModeWarning)
+        1    0.000    0.000    0.000    0.000 exceptions.py:124(RequestsDependencyWarning)
+        1    0.000    0.000    0.000    0.000 request.py:899(HTTPPasswordMgrWithDefaultRealm)
+        1    0.000    0.000    0.000    0.000 request.py:1501(FTPHandler)
+        1    0.000    0.000    0.000    0.000 request.py:1612(DataHandler)
+        1    0.000    0.000    0.000    0.000 cookiejar.py:1768(LoadError)
+        1    0.000    0.000    0.000    0.000 copy.py:55(Error)
+        1    0.000    0.000    0.000    0.000 cookies.py:144(CookieError)
+        1    0.000    0.000    0.000    0.000 cookies.py:597(SimpleCookie)
+        1    0.000    0.000    0.000    0.000 package_data.py:1(<module>)
+        1    0.000    0.000    0.000    0.000 core.py:16(IDNAError)
+        1    0.000    0.000    0.000    0.000 core.py:26(InvalidCodepoint)
+        1    0.000    0.000    0.000    0.000 core.py:31(InvalidCodepointContext)
+        1    0.000    0.000    0.000    0.000 idna.py:146(Codec)
+        1    0.000    0.000    0.000    0.000 idna.py:253(IncrementalDecoder)
+        1    0.000    0.000    0.000    0.000 auth.py:100(HTTPProxyAuth)
+
+